diff --git a/source/application/hal/hal.c b/source/application/hal/hal.c
new file mode 100644
index 0000000..dbf94ba
--- /dev/null
+++ b/source/application/hal/hal.c
@@ -0,0 +1,264 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "hal.h"            /* API */
+
+#include "hal_config.h"     /* HAL configuration */
+#include "system_init.h"
+
+#include <stdio.h>
+#include <assert.h>
+
+#if defined(ARM_NPU)
+
+#include "ethosu_driver.h"              /* Arm Ethos-U55 driver header */
+#include "timing_adapter.h"             /* Arm Ethos-U55 timing adapter driver header */
+#include "timing_adapter_settings.h"    /* Arm Ethos-U55 timing adapter settings */
+
+/**
+ * @brief   Initialises the Arm Ethos-U55 NPU
+ * @return  0 if successful, error code otherwise
+ **/
+static int _arm_npu_init(void);
+
+#endif /* ARM_NPU */
+
+int hal_init(hal_platform* platform, data_acq_module* data_acq,
+    data_psn_module* data_psn, platform_timer* timer)
+{
+    assert(platform && data_acq && data_psn);
+
+    platform->data_acq  = data_acq;
+    platform->data_psn  = data_psn;
+    platform->timer     = timer;
+    platform->platform_init     = system_init;
+    platform->platform_release  = system_release;
+    system_name(platform->plat_name, sizeof(platform->plat_name));
+
+    return 0;
+}
+
+/**
+ * @brief  Local helper function to clean the slate for current platform.
+ **/
+static void _hal_platform_clear(hal_platform* platform)
+{
+    assert(platform);
+    platform->inited = 0;
+}
+
+int hal_platform_init(hal_platform* platform)
+{
+    int state;
+    assert(platform && platform->platform_init);
+    _hal_platform_clear(platform);
+
+    /* Initialise platform */
+    if (0 != (state = platform->platform_init())) {
+        printf_err("failed to initialise platform %s\n", platform->plat_name);
+        return state;
+    }
+
+    /* Initialise the data acquisition module */
+    if (0 != (state = data_acq_channel_init(platform->data_acq))) {
+        if (!platform->data_acq->inited) {
+            printf_err("failed to initialise data acq module: %s\n",
+                platform->data_acq->system_name);
+        }
+        hal_platform_release(platform);
+        return state;
+    }
+
+    /* Initialise the presentation module */
+    if (0 != (state = data_psn_system_init(platform->data_psn))) {
+        printf_err("failed to initialise data psn module: %s\n",
+            platform->data_psn->system_name);
+        data_acq_channel_release(platform->data_acq);
+        hal_platform_release(platform);
+        return state;
+    }
+
+#if defined(ARM_NPU)
+
+    /* If Arm Ethos-U55 NPU is to be used, we initialise it here */
+    if (0 != (state = _arm_npu_init())) {
+        return state;
+    }
+
+#endif /* ARM_NPU */
+
+    /* followed by the timer module */
+    init_timer(platform->timer);
+
+    info("%s platform initialised\n", platform->plat_name);
+    debug("using %s module for data acquisition\n",
+            platform->data_acq->system_name);
+    debug("using %s module for data presentation\n",
+        platform->data_psn->system_name);
+
+    platform->inited = !state;
+
+    return state;
+}
+
+void hal_platform_release(hal_platform *platform)
+{
+    assert(platform && platform->platform_release);
+    data_acq_channel_release(platform->data_acq);
+    data_psn_system_release(platform->data_psn);
+
+    _hal_platform_clear(platform);
+    info("releasing platform %s\n", platform->plat_name);
+    platform->platform_release();
+}
+
+#if defined(ARM_NPU)
+/**
+ * @brief   Defines the Ethos-U interrupt handler: just a wrapper around the default
+ *          implementation.
+ **/
+static void _arm_npu_irq_handler(void)
+{
+    /* Call the default interrupt handler from the NPU driver */
+    ethosu_irq_handler();
+}
+
+/**
+ * @brief  Initialises the NPU IRQ
+ **/
+static void _arm_npu_irq_init(void)
+{
+    const IRQn_Type ethosu_irqnum = (IRQn_Type)EthosU_IRQn;
+
+    /* Register the EthosU IRQ handler in our vector table.
+     * Note, this handler comes from the EthosU driver */
+    NVIC_SetVector(ethosu_irqnum, (uint32_t)_arm_npu_irq_handler);
+
+    /* Enable the IRQ */
+    NVIC_EnableIRQ(ethosu_irqnum);
+
+    debug("EthosU IRQ#: %u, Handler: 0x%p\n",
+            ethosu_irqnum, _arm_npu_irq_handler);
+}
+
+static int _arm_npu_timing_adapter_init(void)
+{
+#if defined (TA0_BASE)
+    struct timing_adapter ta_0;
+    struct timing_adapter_settings ta_0_settings = {
+        .maxr = TA0_MAXR,
+        .maxw = TA0_MAXW,
+        .maxrw = TA0_MAXRW,
+        .rlatency = TA0_RLATENCY,
+        .wlatency = TA0_WLATENCY,
+        .pulse_on = TA0_PULSE_ON,
+        .pulse_off = TA0_PULSE_OFF,
+        .bwcap = TA0_BWCAP,
+        .perfctrl = TA0_PERFCTRL,
+        .perfcnt = TA0_PERFCNT,
+        .mode = TA0_MODE,
+        .maxpending = 0, /* This is a read-only parameter */
+        .histbin = TA0_HISTBIN,
+        .histcnt = TA0_HISTCNT
+    };
+
+    if (0 != ta_init(&ta_0, TA0_BASE)) {
+        printf_err("TA0 initialisation failed\n");
+        return 1;
+    }
+
+    ta_set_all(&ta_0, &ta_0_settings);
+#endif /* defined (TA0_BASE) */
+
+#if defined (TA1_BASE)
+    struct timing_adapter ta_1;
+    struct timing_adapter_settings ta_1_settings = {
+        .maxr = TA1_MAXR,
+        .maxw = TA1_MAXW,
+        .maxrw = TA1_MAXRW,
+        .rlatency = TA1_RLATENCY,
+        .wlatency = TA1_WLATENCY,
+        .pulse_on = TA1_PULSE_ON,
+        .pulse_off = TA1_PULSE_OFF,
+        .bwcap = TA1_BWCAP,
+        .perfctrl = TA1_PERFCTRL,
+        .perfcnt = TA1_PERFCNT,
+        .mode = TA1_MODE,
+        .maxpending = 0, /* This is a read-only parameter */
+        .histbin = TA1_HISTBIN,
+        .histcnt = TA1_HISTCNT
+    };
+
+    if (0 != ta_init(&ta_1, TA1_BASE)) {
+        printf_err("TA1 initialisation failed\n");
+        return 1;
+    }
+
+    ta_set_all(&ta_1, &ta_1_settings);
+#endif /* defined (TA1_BASE) */
+
+    return 0;
+}
+
+static int _arm_npu_init(void)
+{
+    int err = 0;
+
+    /* If the platform has timing adapter blocks along with Ethos-U55 core
+     * block, initialise them here. */
+    if (0 != (err = _arm_npu_timing_adapter_init())) {
+        return err;
+    }
+
+    /* Initialise the IRQ */
+    _arm_npu_irq_init();
+
+    /* Initialise Ethos-U55 device */
+    const void * ethosu_base_address = (void *)(SEC_ETHOS_U55_BASE);
+
+    if (0 != (err = ethosu_init_v3(
+                        ethosu_base_address,    /* Ethos-U55's base address. */
+                        NULL,                   /* Pointer to fast mem area - NULL for U55. */
+                        0,                      /* Fast mem region size. */
+                        1,                      /* Security enable. */
+                        1))) {                  /* Privilege enable. */
+        printf_err("failed to initalise Ethos-U55 device\n");
+        return err;
+    }
+
+    info("Ethos-U55 device initialised\n");
+
+    /* Get Ethos-U55 version */
+    struct ethosu_version version;
+    if (0 != (err = ethosu_get_version(&version))) {
+        printf_err("failed to fetch Ethos-U55 version info\n");
+        return err;
+    }
+
+    info("Ethos-U55 version info:\n");
+    info("\tArch:       v%u.%u.%u\n", version.id.arch_major_rev,
+                                    version.id.arch_minor_rev,
+                                    version.id.arch_patch_rev);
+    info("\tDriver:     v%u.%u.%u\n", version.id.driver_major_rev,
+                                    version.id.driver_minor_rev,
+                                    version.id.driver_patch_rev);
+    info("\tMACs/cc:    %u\n", (1 << version.cfg.macs_per_cc));
+    info("\tCmd stream: v%u\n", version.cfg.cmd_stream_version);
+    info("\tSHRAM size: %u\n", version.cfg.shram_size);
+
+    return 0;
+}
+#endif /* ARM_NPU */
diff --git a/source/application/hal/include/data_acq.h b/source/application/hal/include/data_acq.h
new file mode 100644
index 0000000..965fbe5
--- /dev/null
+++ b/source/application/hal/include/data_acq.h
@@ -0,0 +1,52 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef DATA_ACQ_H
+#define DATA_ACQ_H
+
+/**
+ * This file is the top level abstraction for the data acquisition module.
+ **/
+#include <stdint.h>
+
+/* Structure to encompass the data acquisition module and it's methods. */
+typedef struct data_acquisition_module {
+    int inited;                 /**< initialised or not. */
+    char system_name[8];        /**< name(s) of the channel in use. */
+    int (* system_init)(void);  /**< channel initialisation function. */
+
+    /* Function to go and check if there are any events that require handling. */
+    int (* get_input)(char *user_input, int size);
+} data_acq_module;
+
+/**
+ * @brief           Initialise the data acquisition channel: goes and
+ *                  sets the required channel up for usage.
+ * @param[in,out]   module  Pointer to a pre-allocated data
+ *                          acquisition structure object.
+ * @return          0 if successful, error code otherwise.
+ **/
+int data_acq_channel_init(data_acq_module *module);
+
+/**
+ * @brief           Releases the data acquisition channel.
+ * @param[in,out]   module  Pointer to a pre-allocated data
+ *                          acquisition structure object.
+ * @return          0 if successful, error code otherwise.
+ **/
+int data_acq_channel_release(data_acq_module *module);
+
+#endif /* DATA_ACQ_H */
diff --git a/source/application/hal/include/data_psn.h b/source/application/hal/include/data_psn.h
new file mode 100644
index 0000000..8c14c77
--- /dev/null
+++ b/source/application/hal/include/data_psn.h
@@ -0,0 +1,72 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef DATA_PSN_H
+#define DATA_PSN_H
+
+/**
+ * This file is the top level abstraction for the data presentation module
+ **/
+#include <stdint.h>
+#include <stddef.h>
+#include <stdbool.h>
+
+/* Structure to encompass the data presentation module and it's methods */
+typedef struct data_presentation_module {
+    int inited;                 /**< initialised or not */
+    char system_name[8];        /**< name of the system in use */
+    int (* system_init)(void);  /**< pointer to init function */
+
+    /** Pointer to the image presentation function */
+    int (* present_data_image)(uint8_t *data, const uint32_t width,
+        const uint32_t height, const uint32_t channels,
+        const uint32_t pos_x, const uint32_t pos_y,
+        const uint32_t downsample_factor);
+
+    /* Pointer to text presentation function */
+    int (* present_data_text)(const char *str, const size_t str_sz,
+        const uint32_t pos_x, const uint32_t pos_y,
+        const bool allow_multiple_lines);
+
+    /* Pointer to box presentation function */
+    int (* present_box)(const uint32_t pos_x, const uint32_t pos_y,
+        const uint32_t width, const uint32_t height, const uint16_t color);
+
+    /* Pointer to clear presentation function */
+    int (* clear)(const uint16_t color);
+
+    /* Pointer to set text color presentation function */
+    int (* set_text_color)(const uint16_t color);
+} data_psn_module;
+
+
+/**
+ * @brief           Initialises the data presentation system.
+ * @param[in,out]   module  Pointer to a pre-allocated data
+ *                          presentation structure object.
+ * @return          0 if successful, error code otherwise.
+ **/
+int data_psn_system_init(data_psn_module *module);
+
+/**
+ * @brief           Releases the data presentation system.
+ * @param[in,out]   module  Pointer to a pre-allocated data
+ *                          presentation structure object.
+ * @return          0 if successful, error code otherwise.
+ **/
+int data_psn_system_release(data_psn_module *module);
+
+#endif /* DATA_PSN_H */
diff --git a/source/application/hal/include/hal.h b/source/application/hal/include/hal.h
new file mode 100644
index 0000000..26ba1e3
--- /dev/null
+++ b/source/application/hal/include/hal.h
@@ -0,0 +1,81 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef PLATFORM_HAL_H
+#define PLATFORM_HAL_H
+
+/**
+ * This file should present a C API for the main application logic to use
+ * and be indifferent to the lower level platform. In addition to this it
+ * will also need to be aware of the API exposed by data acquisition and
+ * data presentation modules.
+ */
+#include "hal_config.h"
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+#include "data_acq.h"                   /* Data acquisition abstraction */
+#include "data_psn.h"                   /* Data presentation abstraction */
+#include "timer.h"                      /* Timer/profiler API */
+
+/* Structure to define a platform context to be used by the application */
+typedef struct hal_platform_context {
+    int inited;                         /**< initialised */
+    char plat_name[16];                 /**< name of this platform */
+    data_acq_module * data_acq;         /**< data acquisition module pointer */
+    data_psn_module * data_psn;         /**< data presentation module pointer */
+    platform_timer *  timer;            /**< timer */
+    int (* platform_init)();            /**< pointer to platform initialisation function */
+    void (* platform_release)();        /**< pointer to platform release function */
+} hal_platform;
+
+/**
+ * @brief           Initialise the HAL structure based on compile time config. This
+ *                  should be called before any other function in this API.
+ * @param[in,out]   platform    Pointer to a pre-allocated platform struct.
+ * @param[in,out]   data_acq    Pointer to a pre-allocated data acquisition module.
+ * @param[in,out]   data_psn    Pointer to a pre-allocated data presentation module.
+ * @param[in,out]   timer       Pointer to a pre-allocated timer module.
+ * @return          0 if successful, error code otherwise.
+ **/
+int hal_init(hal_platform *platform, data_acq_module *data_acq,
+    data_psn_module *data_psn, platform_timer *timer);
+
+
+/**
+ * @brief       Initialise the HAL platform. This will go and initialise all the
+ *              modules on the platform the application requires to run.
+ * @param[in]   platform    Pointer to a pre-allocated and initialised
+ *                          platform structure.
+ * @return      0 if successful, error code otherwise.
+ **/
+int hal_platform_init(hal_platform *platform);
+
+
+/**
+ * @brief       Release the HAL platform. This should release resources acquired.
+ * @param[in]   platform    pointer to a pre-allocated and initialised
+ *                          platform structure.
+ **/
+void hal_platform_release(hal_platform *platform);
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif /* PLATFORM_HAL_H */
diff --git a/source/application/hal/include/hal_config.h b/source/application/hal/include/hal_config.h
new file mode 100644
index 0000000..55db973
--- /dev/null
+++ b/source/application/hal/include/hal_config.h
@@ -0,0 +1,43 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef HAL_CONFIG_H
+#define HAL_CONFIG_H
+
+/* This header provides some basic configuration for HAL */
+
+/* Platform definitions for the systems we expect to support */
+#define PLATFORM_CORTEX_M_BAREMETAL 1U
+#define PLATFORM_UNKNOWN_LINUX_OS   3U
+
+/* This should come from compile time definition */
+#ifndef PLATFORM_HAL
+    #define PLATFORM_HAL    PLATFORM_UNKNOWN_LINUX_OS    /* Default platform */
+#endif /* PLATFORM_HAL */
+
+#if ((PLATFORM_HAL) == PLATFORM_CORTEX_M_BAREMETAL)
+    #include "bsp.h"
+#elif ((PLATFORM_HAL) == PLATFORM_UNKNOWN_LINUX_OS)
+    #include "dummy_log.h"
+#else
+    #error "Invalid platform!"
+#endif /* PLATFORM_HAL==PLATFORM_CORTEX_M_BAREMETAL */
+
+#if !defined (DESIGN_NAME)
+    #define DESIGN_NAME   ("N/A")
+#endif /* !defined (DESIGN_NAME) */
+
+#endif /* HAL_CONFIG_H */
diff --git a/source/application/hal/include/timer.h b/source/application/hal/include/timer.h
new file mode 100644
index 0000000..2955b7f
--- /dev/null
+++ b/source/application/hal/include/timer.h
@@ -0,0 +1,80 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef HAL_TIMER_H
+#define HAL_TIMER_H
+
+#include "hal_config.h"
+
+#if ((PLATFORM_HAL) == PLATFORM_CORTEX_M_BAREMETAL)
+#include "baremetal_timer.h"
+#elif ((PLATFORM_HAL) == PLATFORM_UNKNOWN_LINUX_OS)
+#include "native_timer.h"
+#else
+#error "Platform does not support a timer API"
+#endif /* PLATFORM_HAL */
+
+/** Struct for describing the capabilities available for
+ * the timer provided by HAL */
+typedef struct _platform_timer_capability {
+    uint32_t npu_cycles:    1;
+    uint32_t cpu_cycles:    1;
+    uint32_t duration_ms:   1;
+    uint32_t duration_us:   1;
+} timer_capability;
+
+/* Structure to hold a platform specific timer implementation */
+typedef struct _platform_timer {
+    int inited;                 /**< initialised or not */
+    timer_capability cap;       /**< capability of this timer */
+
+    /* reset the timer */
+    void (* reset)(void);
+
+    /* Gets the current time counter. */
+    time_counter (* get_time_counter)(void);
+
+    /* Gets the duration in milliseconds. */
+    time_t (* get_duration_ms)(time_counter *start, time_counter *end);
+
+    /* Gets duration in microseconds. */
+    time_t (* get_duration_us)(time_counter *start, time_counter *end);
+
+    /* Gets difference in CPU cycle counts. */
+    uint32_t (* get_cpu_cycle_diff)(time_counter *start, time_counter *end);
+
+    /* Gets the difference in terms of total NPU cycle counts. */
+    uint64_t (* get_npu_total_cycle_diff)(time_counter *start, time_counter *end);
+
+    /* Gets the difference in terms of active NPU cycle counts. */
+    uint64_t (* get_npu_active_cycle_diff)(time_counter *start, time_counter *end);
+
+    /* Wraps get_time_counter function with additional profiling
+     * initialisation, if required. */
+    time_counter (* start_profiling)(void);
+
+    /* Wraps get_time_counter function along with additional instructions when
+     * profiling ends, if required. */
+    time_counter (* stop_profiling)(void);
+
+} platform_timer;
+
+/**
+ * @brief   Initialise the timer available for the platform.
+ **/
+void init_timer(platform_timer *timer);
+
+#endif /* HAL_TIMER_H */
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-core/include/bsp_core_log.h b/source/application/hal/platforms/bare-metal/bsp/bsp-core/include/bsp_core_log.h
new file mode 100644
index 0000000..f049209
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-core/include/bsp_core_log.h
@@ -0,0 +1,66 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef BSP_CORE_LOG_H
+#define BSP_CORE_LOG_H
+
+#include "uart_stdout.h"    /* UART for logging */
+
+#include <stdio.h>
+
+#define LOG_LEVEL_TRACE       0
+#define LOG_LEVEL_DEBUG       1
+#define LOG_LEVEL_INFO        2
+#define LOG_LEVEL_WARN        3
+#define LOG_LEVEL_ERROR       4
+
+#ifndef LOG_LEVEL
+#define LOG_LEVEL             LOG_LEVEL_INFO
+#endif /*LOG_LEVEL*/
+
+#if (LOG_LEVEL == LOG_LEVEL_TRACE)
+    #define trace(...)        printf("[TRACE] "); printf(__VA_ARGS__)
+#else
+    #define trace(...)
+#endif  /* LOG_LEVEL == LOG_LEVEL_TRACE */
+
+#if (LOG_LEVEL <= LOG_LEVEL_DEBUG)
+    #define debug(...)        printf("[DEBUG] "); printf(__VA_ARGS__)
+#else
+    #define debug(...)
+#endif  /* LOG_LEVEL > LOG_LEVEL_TRACE */
+
+#if (LOG_LEVEL <= LOG_LEVEL_INFO)
+    #define info(...)         printf("[INFO] "); printf(__VA_ARGS__)
+#else
+    #define info(...)
+#endif  /* LOG_LEVEL > LOG_LEVEL_DEBUG */
+
+#if (LOG_LEVEL <= LOG_LEVEL_WARN)
+    #define warn(...)         printf("[WARN] "); printf(__VA_ARGS__)
+#else
+    #define warn(...)
+#endif  /* LOG_LEVEL > LOG_LEVEL_INFO */
+
+#if (LOG_LEVEL <= LOG_LEVEL_ERROR)
+    #define printf_err(...)   printf("[ERROR] "); printf(__VA_ARGS__)
+#else
+    #define printf_err(...)
+#endif  /* LOG_LEVEL > LOG_LEVEL_INFO */
+
+#define UNUSED(x)       ((void)(x))
+
+#endif /* BSP_CORE_LOG_H */
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-core/include/uart_stdout.h b/source/application/hal/platforms/bare-metal/bsp/bsp-core/include/uart_stdout.h
new file mode 100644
index 0000000..9c5fbcf
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-core/include/uart_stdout.h
@@ -0,0 +1,57 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef UART_STDOUT_H
+#define UART_STDOUT_H
+
+#include <stdbool.h>
+
+/**
+ * @brief       Initialised the UART block.
+ **/
+extern void UartStdOutInit(void);
+
+/**
+ * @brief       Transmits a character over UART (blocking call).
+ * @param[in]   my_ch Character to be transmitted.
+ * @return      Character transmitted.
+ **/
+extern unsigned char UartPutc(unsigned char my_ch);
+
+/**
+ * @brief       Receives a character from the UART block (blocking call).
+ * @return      Character received.
+ **/
+extern unsigned char UartGetc(void);
+
+/**
+ * @brief       Reads characters from the UART block until a line feed or
+ *              carriage return terminates the function. NULL character
+ *              also terminates the function, error is returned.
+ * @param[out]  lp      Characters read from the UART block.
+ * @param[in]   len     Character to be transmitted.
+ * @return      true if successful, false otherwise.
+ **/
+extern bool GetLine(char *lp, unsigned int len);
+
+/**
+ * @brief       Terminates UART simulation. This is useful when a Fixed
+ *              Virtual Platform's session needs to be gracefully terminated.
+ * @param[in]   code Terminating code displayed on the UART before the end of the simulation.
+ **/
+extern void UartEndSimulation(int code);
+
+#endif /* UART_STDOUT_H */
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-core/retarget.c b/source/application/hal/platforms/bare-metal/bsp/bsp-core/retarget.c
new file mode 100644
index 0000000..cf31a53
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-core/retarget.c
@@ -0,0 +1,235 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#if defined(__ARMCC_VERSION) && (__ARMCC_VERSION >= 6010050)
+
+#include "uart_stdout.h"
+#include "bsp_core_log.h"
+
+#if defined (MPS3_PLATFORM)
+#include "smm_mps3.h"
+#endif  /* MPS3_PLATFORM */
+
+#include <stdio.h>
+#include <string.h>
+#include <time.h>
+#include <rt_misc.h>
+#include <rt_sys.h>
+
+
+/* Standard IO device handles. */
+#define STDIN   0x8001
+#define STDOUT  0x8002
+#define STDERR  0x8003
+
+/* Standard IO device name defines. */
+const char __stdin_name[]   = "STDIN";
+const char __stdout_name[]  = "STDOUT";
+const char __stderr_name[]  = "STDERR";
+
+int fputc(int ch, FILE *f)
+{
+    UNUSED(f);
+    return (UartPutc(ch));
+}
+
+int fgetc(FILE *f)
+{
+    UNUSED(f);
+    return (UartPutc(UartGetc()));
+}
+
+int ferror(FILE *f)
+{
+    UNUSED(f);
+    /* Your implementation of ferror */
+    return EOF;
+}
+
+void _ttywrch(int ch)
+{
+    UartPutc(ch);
+}
+
+FILEHANDLE _sys_open(const char *name, int openmode)
+{
+    UNUSED(openmode);
+
+    /* Register standard Input Output devices. */
+    if (strcmp(name, "STDIN") == 0)
+    {
+        return (STDIN);
+    }
+    if (strcmp(name, "STDOUT") == 0)
+    {
+        return (STDOUT);
+    }
+    if (strcmp(name, "STDERR") == 0)
+    {
+        return (STDERR);
+    }
+    return (-1);
+}
+
+int _sys_close(FILEHANDLE fh)
+{
+    if (fh > 0x8000)
+    {
+        return (0);
+    }
+    return (-1);
+}
+
+int _sys_write(FILEHANDLE fh, const unsigned char *buf, unsigned int len, int mode)
+{
+    UNUSED(mode);
+    if (fh == STDOUT || fh == STDERR )
+    {
+        /* Standard Output device. */
+        for (; len; len--)
+        {
+            UartPutc(*buf++);
+        }
+        return (0);
+    }
+
+    if (fh > 0x8000)
+    {
+        return (-1);
+    }
+    return (-1);
+}
+
+int _sys_read(FILEHANDLE fh, unsigned char *buf, unsigned int len, int mode)
+{
+    UNUSED(mode);
+    if (fh == STDIN)
+    {
+        /* Standard Input device. */
+        for (; len; len--)
+        {
+            *buf++ = UartGetc();
+        }
+        return (0);
+    }
+
+    if (fh > 0x8000)
+    {
+        return (-1);
+    }
+    return (-1);
+}
+
+int _sys_istty(FILEHANDLE fh)
+{
+    if (fh > 0x8000)
+    {
+        return (1);
+    }
+    return (0);
+}
+
+int _sys_seek(FILEHANDLE fh, long pos)
+{
+    UNUSED(pos);
+    if (fh > 0x8000)
+    {
+        return (-1);
+    }
+    return (-1);
+}
+
+int _sys_ensure(FILEHANDLE fh)
+{
+    if (fh > 0x8000)
+    {
+        return (-1);
+    }
+    return (-1);
+}
+
+long _sys_flen(FILEHANDLE fh)
+{
+    if (fh > 0x8000)
+    {
+        return (0);
+    }
+    return (-1);
+}
+
+int _sys_tmpnam(char *name, int sig, unsigned maxlen)
+{
+    UNUSED(name);
+    UNUSED(sig);
+    UNUSED(maxlen);
+    return (1);
+}
+
+char *_sys_command_string(char *cmd, int len)
+{
+    UNUSED(len);
+    return (cmd);
+}
+
+void _sys_exit(int return_code)
+{
+    UartEndSimulation(return_code);
+}
+
+int system(const char *cmd)
+{
+    UNUSED(cmd);
+    return (0);
+}
+
+time_t time(time_t *timer)
+{
+    time_t current;
+
+#if defined (MPS3_PLATFORM)
+    current = MPS3_FPGAIO->COUNTER;
+#else   /* MPS3_PLATFORM */
+    current  = 0;   /* No RTC implementation available. */
+#endif  /* MPS3_PLATFORM */
+
+    if (timer != NULL) {
+        *timer = current;
+    }
+
+    return (current);
+}
+
+#else   /* #if defined(__ARMCC_VERSION) && (__ARMCC_VERSION >= 6010050) */
+
+/******************************************************************************/
+/* Retarget functions for GNU Tools for ARM Embedded Processors               */
+/******************************************************************************/
+#include <stdio.h>
+#include <sys/stat.h>
+
+extern unsigned char UartPutc(unsigned char my_ch);
+
+__attribute__((used)) int _write(int fd, char *ptr, int len)
+{
+    size_t i;
+    for (i = 0; i < len; i++)
+    {
+        UartPutc(ptr[i]); /* call character output function. */
+    }
+    return len;
+}
+
+#endif /* #if defined(__ARMCC_VERSION) && (__ARMCC_VERSION >= 6010050) */
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/device_mps3.c b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/device_mps3.c
new file mode 100644
index 0000000..f4f2e6b
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/device_mps3.c
@@ -0,0 +1,36 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "device_mps3.h"
+
+#include "bsp_core_log.h"
+#include "smm_mps3.h"
+
+uint32_t GetMPS3CoreClock(void)
+{
+    const uint32_t default_clock = 32000000;
+    static int warned_once = 0;
+    if (0 != MPS3_SCC->CFG_ACLK) {
+        return MPS3_SCC->CFG_ACLK;
+    }
+
+    if (!warned_once) {
+        warn("MPS3_SCC->CFG_ACLK reads 0. Assuming default clock of %u\n",
+            default_clock);
+        warned_once = 1;
+    }
+    return default_clock;
+}
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/glcd_mps3.c b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/glcd_mps3.c
new file mode 100644
index 0000000..530be4f
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/glcd_mps3.c
@@ -0,0 +1,460 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "glcd_mps3.h"
+
+#include "bsp_core_log.h"
+#include "font_9x15_h.h"
+#include "smm_mps3.h"
+
+/*-------------- CLCD Controller Internal Register addresses ----------------*/
+#define CHAR_COM        ((volatile unsigned int *)(CLCD_CONFIG_BASE + 0x000))
+#define CHAR_DAT        ((volatile unsigned int *)(CLCD_CONFIG_BASE + 0x004))
+#define CHAR_RD         ((volatile unsigned int *)(CLCD_CONFIG_BASE + 0x008))
+#define CHAR_RAW        ((volatile unsigned int *)(CLCD_CONFIG_BASE + 0x00C))
+#define CHAR_MASK       ((volatile unsigned int *)(CLCD_CONFIG_BASE + 0x010))
+#define CHAR_STAT       ((volatile unsigned int *)(CLCD_CONFIG_BASE + 0x014))
+#define CHAR_MISC       ((volatile unsigned int *)(CLCD_CONFIG_BASE + 0x04C))
+
+/*--------------- Graphic LCD interface hardware definitions -----------------*/
+/* Pin CS setting to 0 or 1                                                   */
+#define LCD_CS(x)   ((x) ? (*CHAR_MISC |= CLCD_CS_Msk)    : (*CHAR_MISC &= ~CLCD_CS_Msk))
+#define LCD_RST(x)  ((x) ? (*CHAR_MISC |= CLCD_RESET_Msk) : (*CHAR_MISC &= ~CLCD_RESET_Msk))
+#define LCD_BL(x)   ((x) ? (*CHAR_MISC |= CLCD_BL_Msk)    : (*CHAR_MISC &= ~CLCD_BL_Msk))
+
+#define BG_COLOR  0                     /* Background colour                  */
+#define TXT_COLOR 1                     /* Text colour                        */
+
+/**
+* Text and background colour
+*/
+static volatile unsigned short Color[2] = {Black, White};
+
+/**
+ * @brief     Delay in while loop cycles.
+ * @param[in] cnt    Number of while cycles to delay.
+ **/
+static void delay (int cnt)
+{
+    cnt <<= DELAY_2N;
+    while (cnt != 0) {
+        --cnt;
+    }
+}
+
+/**
+ * @brief       Write a command the LCD controller.
+ * @param[in]   cmd    Command to be written.
+ */
+static __inline void wr_cmd(unsigned char cmd)
+{
+    LCD_CS(0);
+    *CHAR_COM = cmd;
+    LCD_CS(1);
+}
+
+/**
+ * @brief       Start of data writing to the LCD controller.
+ */
+static __inline void wr_dat_start (void)
+{
+    LCD_CS(0);
+}
+
+/**
+ * @brief       Stop of data writing to the LCD controller.
+ */
+static __inline void wr_dat_stop (void)
+{
+    LCD_CS(1);
+}
+
+/**
+ * @brief       Data writing to the LCD controller.
+ * @param[in]   dat    Data to be written.
+ */
+static __inline void wr_dat_only(unsigned short dat)
+{
+    *CHAR_DAT = (dat >>   8);   /* Write D8..D15    */
+    *CHAR_DAT = (dat & 0xFF);   /* Write D0..D7     */
+}
+
+/**
+ * @brief       Write a value to the to LCD register.
+ * @param[in]   reg    Register to be written.
+ * @param[in]   val    Value to write to the register.
+ */
+static __inline void wr_reg(unsigned char reg, unsigned short val)
+{
+    LCD_CS(0);
+    *CHAR_COM = reg;
+    wr_dat_only(val);
+    LCD_CS(1);
+}
+
+/**
+ * @brief       Converts a gray value to RGB565 representation.
+ * @param[in]   src_uchar   Pointer to the source pixel.
+ * @return      16 bit RGB565 value.
+ */
+static inline uint16_t _GLCD_Gray8_to_RGB565(uint8_t *src_uchar)
+{
+    uint16_t val_r = (*src_uchar >> 3);
+    uint16_t val_g = (*src_uchar >> 2);
+    return ((val_r << 11) | (val_g << 5) | val_r);
+}
+
+/**
+ * @brief       Converts an RGB888 value to RGB565 representation.
+ * @param[in]   src_uchar   Pointer to the source pixel for R (assumed to
+ *                          be RGB format).
+ * @return      16 bit RGB565 value.
+ */
+static inline uint16_t _GLCD_RGB888_to_RGB565(uint8_t *src_uchar)
+{
+    uint16_t val_r = (*src_uchar >> 3) & 0x1F;
+    uint16_t val_g = (*(src_uchar+1) >> 2) & 0x3F;
+    uint16_t val_b = (*(src_uchar+2) >> 3) & 0x1F;
+    return ((val_r << 11) | (val_g << 5) | val_b);
+}
+
+/* Helper typedef to encapsulate the colour conversion function
+ * signatures */
+typedef uint16_t (* std_clr_2_lcd_clr_fn)(uint8_t *src_uchar);
+
+void GLCD_SetWindow(unsigned int x, unsigned int y, unsigned int w, unsigned int h) {
+    unsigned int xe, ye;
+
+    xe = x+w-1;
+    ye = y+h-1;
+
+    wr_reg(0x02, x  >>    8);   /* Column address start MSB           */
+    wr_reg(0x03, x  &  0xFF);   /* Column address start LSB           */
+    wr_reg(0x04, xe >>    8);   /* Column address end MSB             */
+    wr_reg(0x05, xe &  0xFF);   /* Column address end LSB             */
+
+    wr_reg(0x06, y  >>    8);   /* Row address start MSB              */
+    wr_reg(0x07, y  &  0xFF);   /* Row address start LSB              */
+    wr_reg(0x08, ye >>    8);   /* Row address end MSB                */
+    wr_reg(0x09, ye &  0xFF);   /* Row address end LSB                */
+}
+
+void GLCD_WindowMax(void)
+{
+    GLCD_SetWindow (0, 0, GLCD_WIDTH, GLCD_HEIGHT);
+}
+
+void GLCD_SetTextColor(unsigned short color)
+{
+    Color[TXT_COLOR] = color;
+}
+
+void GLCD_SetBackColor(unsigned short color)
+{
+    Color[BG_COLOR] = color;
+}
+
+void GLCD_Clear(unsigned short color)
+{
+    unsigned int i;
+
+    GLCD_WindowMax();
+    wr_cmd(0x22);
+    wr_dat_start();
+
+    for(i = 0; i < (GLCD_WIDTH*GLCD_HEIGHT); ++i) {
+        wr_dat_only(color);
+    }
+    wr_dat_stop();
+}
+
+
+void GLCD_DrawChar(
+        unsigned int x, unsigned int y,
+        unsigned int cw, unsigned int ch,
+        unsigned char *c)
+{
+    unsigned int i, j, k, pixs;
+
+    /* Sanity check: out of bounds? */
+    if ((x + cw) > GLCD_WIDTH || (y + ch) > GLCD_HEIGHT) {
+        return;
+    }
+
+    GLCD_SetWindow(x, y, cw, ch);
+
+    wr_cmd(0x22);
+    wr_dat_start();
+
+    k  = (cw + 7)/8;
+
+    if (k == 1) {
+        for (j = 0; j < ch; ++j) {
+            pixs = *(unsigned char  *)c;
+            c += 1;
+
+            for (i = 0; i < cw; ++i) {
+                wr_dat_only (Color[(pixs >> i) & 1]);
+            }
+        }
+    }
+    else if (k == 2) {
+        for (j = 0; j < ch; ++j) {
+            pixs = *(unsigned short *)c;
+            c += 2;
+
+            for (i = 0; i < cw; ++i) {
+                wr_dat_only (Color[(pixs >> i) & 1]);
+            }
+        }
+    }
+    wr_dat_stop();
+}
+
+void GLCD_DisplayChar(
+        unsigned int ln, unsigned int col,
+        unsigned char fi, unsigned char c)
+{
+    c -= 32;
+    switch (fi) {
+        case 0: /* Font 9 x 15. */
+            GLCD_DrawChar(col * 9, ln * 15, 9, 15,
+                         (unsigned char *)&Font_9x15_h[c * 15]);
+            break;
+    }
+}
+
+void GLCD_DisplayString(
+        unsigned int ln, unsigned int col,
+        unsigned char fi, char *s)
+{
+  while (*s) {
+    GLCD_DisplayChar(ln, col++, fi, *s++);
+  }
+}
+
+
+
+void GLCD_ClearLn(unsigned int ln, unsigned char fi)
+{
+    unsigned char i;
+    char buf[60];
+
+    GLCD_WindowMax();
+    switch (fi) {
+        case 0:  /* Font 9x15*/
+            for (i = 0; i < (GLCD_WIDTH+8)/9; ++i) {
+                buf[i] = ' ';
+            }
+            buf[i+1] = 0;
+            break;
+    }
+    GLCD_DisplayString (ln, 0, fi, buf);
+}
+
+void GLCD_Bitmap(unsigned int x, unsigned int y,
+        unsigned int w, unsigned int h,
+        unsigned short *bitmap)
+{
+    unsigned int i;
+    unsigned short *bitmap_ptr = bitmap;
+
+    GLCD_SetWindow (x, y, w, h);
+
+    wr_cmd(0x22);
+    wr_dat_start();
+
+    for (i = 0; i < (w*h); ++i) {
+        wr_dat_only (bitmap_ptr[i]);
+    }
+    wr_dat_stop();
+}
+
+void GLCD_Image(void *data, const uint32_t width,
+    const uint32_t height, const uint32_t channels,
+    const uint32_t pos_x, const uint32_t pos_y,
+    const uint32_t downsample_factor)
+{
+    uint32_t i, j = 0; /* for loops */
+    const uint32_t x_incr = channels * downsample_factor; /* stride. */
+    const uint32_t y_incr = channels * width * (downsample_factor - 1); /* skip rows. */
+    uint8_t* src_unsigned = (uint8_t *)data; /* temporary pointer. */
+    std_clr_2_lcd_clr_fn cvt_clr_fn = 0; /* colour conversion function. */
+
+    /* Based on number of channels, we decide which of the above functions to use. */
+    switch (channels) {
+        case 1:
+            cvt_clr_fn = _GLCD_Gray8_to_RGB565;
+            break;
+
+        case 3:
+            cvt_clr_fn = _GLCD_RGB888_to_RGB565;
+            break;
+
+        default:
+            printf_err("number of channels not supported by display\n");
+            return;
+    }
+
+    /* Set the window position expected. Note: this is integer div. */
+    GLCD_SetWindow(pos_x, pos_y,
+        width/downsample_factor, height/downsample_factor);
+    wr_cmd(0x22);
+    wr_dat_start();
+
+    /* Loop over the image. */
+    for (j = height; j != 0; j -= downsample_factor) {
+        for (i = width; i != 0; i -= downsample_factor) {
+            wr_dat_only(cvt_clr_fn(src_unsigned));
+            src_unsigned += x_incr;
+        }
+
+        /* Skip rows if needed. */
+        src_unsigned += y_incr;
+    }
+
+    wr_dat_stop();
+}
+
+void GLCD_Box(
+        unsigned int x, unsigned int y,
+        unsigned int w, unsigned int h,
+        unsigned short color)
+{
+    unsigned int i;
+
+    GLCD_SetWindow (x, y, w, h);
+
+    wr_cmd(0x22);
+    wr_dat_start();
+    for(i = 0; i < (w*h); ++i){
+        wr_dat_only (color);
+    }
+    wr_dat_stop();
+}
+
+
+void GLCD_Initialize (void)
+{
+    /* CLCD screen setup (Default CLCD screen interface state) ------------- */
+    LCD_CS(1);              /* deassert nCS0. */
+    LCD_RST(1);             /* deassert Reset. */
+    LCD_BL(0);              /* switch off backlight. */
+
+    /* Reset CLCD screen --------------------------------------------------- */
+    LCD_RST(0);             /* assert Reset. */
+    delay(1);
+    LCD_RST(1);             /* deassert Reset. */
+    delay(10);
+
+    /* Driving ability settings ----------------------------------------------*/
+    wr_reg(0xEA, 0x00);     /* Power control internal used (1).    */
+    wr_reg(0xEB, 0x20);     /* Power control internal used (2).    */
+    wr_reg(0xEC, 0x0C);     /* Source control internal used (1).   */
+    wr_reg(0xED, 0xC7);     /* Source control internal used (2).   */
+    wr_reg(0xE8, 0x38);     /* Source output period Normal mode.   */
+    wr_reg(0xE9, 0x10);     /* Source output period Idle mode.     */
+    wr_reg(0xF1, 0x01);     /* RGB 18-bit interface ;0x0110.       */
+    wr_reg(0xF2, 0x10);
+
+    /* Adjust the Gamma Curve ------------------------------------------------*/
+    wr_reg(0x40, 0x01);
+    wr_reg(0x41, 0x00);
+    wr_reg(0x42, 0x00);
+    wr_reg(0x43, 0x10);
+    wr_reg(0x44, 0x0E);
+    wr_reg(0x45, 0x24);
+    wr_reg(0x46, 0x04);
+    wr_reg(0x47, 0x50);
+    wr_reg(0x48, 0x02);
+    wr_reg(0x49, 0x13);
+    wr_reg(0x4A, 0x19);
+    wr_reg(0x4B, 0x19);
+    wr_reg(0x4C, 0x16);
+
+    wr_reg(0x50, 0x1B);
+    wr_reg(0x51, 0x31);
+    wr_reg(0x52, 0x2F);
+    wr_reg(0x53, 0x3F);
+    wr_reg(0x54, 0x3F);
+    wr_reg(0x55, 0x3E);
+    wr_reg(0x56, 0x2F);
+    wr_reg(0x57, 0x7B);
+    wr_reg(0x58, 0x09);
+    wr_reg(0x59, 0x06);
+    wr_reg(0x5A, 0x06);
+    wr_reg(0x5B, 0x0C);
+    wr_reg(0x5C, 0x1D);
+    wr_reg(0x5D, 0xCC);
+
+    /* Power voltage setting -------------------------------------------------*/
+    wr_reg(0x1B, 0x1B);
+    wr_reg(0x1A, 0x01);
+    wr_reg(0x24, 0x2F);
+    wr_reg(0x25, 0x57);
+    wr_reg(0x23, 0x88);
+
+    /* Power on setting ------------------------------------------------------*/
+    wr_reg(0x18, 0x36);    /* Internal oscillator frequency adj.  */
+    wr_reg(0x19, 0x01);    /* Enable internal oscillator.         */
+    wr_reg(0x01, 0x00);    /* Normal mode, no scroll.             */
+    wr_reg(0x1F, 0x88);    /* Power control 6 - DDVDH Off.        */
+    delay(20);
+    wr_reg(0x1F, 0x82);    /* Power control 6 - Step-up: 3 x VCI. */
+    delay(5);
+    wr_reg(0x1F, 0x92);    /* Power control 6 - Step-up: On.      */
+    delay(5);
+    wr_reg(0x1F, 0xD2);    /* Power control 6 - VCOML active.     */
+    delay(5);
+
+    /* Color selection -------------------------------------------------------*/
+    wr_reg(0x17, 0x55);    /* RGB, System interface: 16 Bit/Pixel. */
+    wr_reg(0x00, 0x00);    /* Scrolling off, no standby.           */
+
+    /* Interface config ------------------------------------------------------*/
+    wr_reg(0x2F, 0x11);    /* LCD Drive: 1-line inversion.        */
+    wr_reg(0x31, 0x00);
+    wr_reg(0x32, 0x00);    /* DPL=0, HSPL=0, VSPL=0, EPL=0.       */
+
+    /* Display on setting ----------------------------------------------------*/
+    wr_reg(0x28, 0x38);    /* PT(0,0) active, VGL/VGL.            */
+    delay(20);
+    wr_reg(0x28, 0x3C);    /* Display active, VGL/VGL.            */
+
+#if (LANDSCAPE == 1)
+#if (ROTATE180 == 0)
+    wr_reg (0x16, 0xA8);
+#else /* (ROTATE180 == 0) */
+    wr_reg (0x16, 0x68);
+#endif /* (ROTATE180 == 0) */
+#else /* (LANDSCAPE == 1) */
+#if (ROTATE180 == 0)
+    wr_reg (0x16, 0x08);
+#else /* (ROTATE180 == 0) */
+     wr_reg (0x16, 0xC8);
+#endif /* (ROTATE180 == 0) */
+#endif /* (LANDSCAPE == 1) */
+
+    /* Display scrolling settings --------------------------------------------*/
+    wr_reg(0x0E, 0x00);         /* TFA MSB */
+    wr_reg(0x0F, 0x00);         /* TFA LSB */
+    wr_reg(0x10, 320 >> 8);     /* VSA MSB */
+    wr_reg(0x11, 320 &  0xFF);  /* VSA LSB */
+    wr_reg(0x12, 0x00);         /* BFA MSB */
+    wr_reg(0x13, 0x00);         /* BFA LSB */
+
+    LCD_BL(1);                  /* turn on backlight                  */
+}
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/include/device_mps3.h b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/include/device_mps3.h
new file mode 100644
index 0000000..f0bab79
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/include/device_mps3.h
@@ -0,0 +1,111 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef DEVICE_MPS3_H
+#define DEVICE_MPS3_H
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+#include "cmsis.h"      /* CMSIS device header. */
+#include "smm_mps3.h"   /* Memory map for MPS3. */
+
+#include <stdio.h>
+
+typedef struct _CMSDK_UART_TypeDef_
+{
+    __IO uint32_t  DATA;        /* Offset: 0x000 (R/W) Data Register.    */
+    __IO uint32_t  STATE;       /* Offset: 0x004 (R/W) Status Register.  */
+    __IO uint32_t  CTRL;        /* Offset: 0x008 (R/W) Control Register. */
+
+    union {
+    __I  uint32_t  INTSTATUS;   /* Offset: 0x00C (R/ ) Interrupt Status Register. */
+    __O  uint32_t  INTCLEAR;    /* Offset: 0x00C ( /W) Interrupt Clear Register. */
+    };
+    __IO uint32_t  BAUDDIV;     /* Offset: 0x010 (R/W) Baudrate Divider Register. */
+
+} CMSDK_UART_TypeDef;
+
+#define CMSDK_UART0             ((CMSDK_UART_TypeDef *)CMSDK_UART0_BASE)
+
+/* CMSDK_UART DATA Register Definitions. */
+#define CMSDK_UART_DATA_Pos               0                                             /* CMSDK_UART_DATA_Pos: DATA Position. */
+#define CMSDK_UART_DATA_Msk              (0xFFul << CMSDK_UART_DATA_Pos)                /* CMSDK_UART DATA: DATA Mask. */
+
+/* CMSDK_UART STATE Register Definitions. */
+#define CMSDK_UART_STATE_RXOR_Pos         3                                             /* CMSDK_UART STATE: RXOR Position. */
+#define CMSDK_UART_STATE_RXOR_Msk         (0x1ul << CMSDK_UART_STATE_RXOR_Pos)          /* CMSDK_UART STATE: RXOR Mask. */
+
+#define CMSDK_UART_STATE_TXOR_Pos         2                                             /* CMSDK_UART STATE: TXOR Position. */
+#define CMSDK_UART_STATE_TXOR_Msk         (0x1ul << CMSDK_UART_STATE_TXOR_Pos)          /* CMSDK_UART STATE: TXOR Mask. */
+
+#define CMSDK_UART_STATE_RXBF_Pos         1                                             /* CMSDK_UART STATE: RXBF Position. */
+#define CMSDK_UART_STATE_RXBF_Msk         (0x1ul << CMSDK_UART_STATE_RXBF_Pos)          /* CMSDK_UART STATE: RXBF Mask. */
+
+#define CMSDK_UART_STATE_TXBF_Pos         0                                             /* CMSDK_UART STATE: TXBF Position. */
+#define CMSDK_UART_STATE_TXBF_Msk         (0x1ul << CMSDK_UART_STATE_TXBF_Pos )         /* CMSDK_UART STATE: TXBF Mask. */
+
+/* CMSDK_UART CTRL Register Definitions. */
+#define CMSDK_UART_CTRL_HSTM_Pos          6                                             /* CMSDK_UART CTRL: HSTM Position. */
+#define CMSDK_UART_CTRL_HSTM_Msk          (0x01ul << CMSDK_UART_CTRL_HSTM_Pos)          /* CMSDK_UART CTRL: HSTM Mask. */
+
+#define CMSDK_UART_CTRL_RXORIRQEN_Pos     5                                             /* CMSDK_UART CTRL: RXORIRQEN Position. */
+#define CMSDK_UART_CTRL_RXORIRQEN_Msk     (0x01ul << CMSDK_UART_CTRL_RXORIRQEN_Pos)     /* CMSDK_UART CTRL: RXORIRQEN Mask. */
+
+#define CMSDK_UART_CTRL_TXORIRQEN_Pos     4                                             /* CMSDK_UART CTRL: TXORIRQEN Position. */
+#define CMSDK_UART_CTRL_TXORIRQEN_Msk     (0x01ul << CMSDK_UART_CTRL_TXORIRQEN_Pos)     /* CMSDK_UART CTRL: TXORIRQEN Mask. */
+
+#define CMSDK_UART_CTRL_RXIRQEN_Pos       3                                             /* CMSDK_UART CTRL: RXIRQEN Position. */
+#define CMSDK_UART_CTRL_RXIRQEN_Msk       (0x01ul << CMSDK_UART_CTRL_RXIRQEN_Pos)       /* CMSDK_UART CTRL: RXIRQEN Mask. */
+
+#define CMSDK_UART_CTRL_TXIRQEN_Pos       2                                             /* CMSDK_UART CTRL: TXIRQEN Position. */
+#define CMSDK_UART_CTRL_TXIRQEN_Msk       (0x01ul << CMSDK_UART_CTRL_TXIRQEN_Pos)       /* CMSDK_UART CTRL: TXIRQEN Mask. */
+
+#define CMSDK_UART_CTRL_RXEN_Pos          1                                             /* CMSDK_UART CTRL: RXEN Position. */
+#define CMSDK_UART_CTRL_RXEN_Msk          (0x01ul << CMSDK_UART_CTRL_RXEN_Pos)          /* CMSDK_UART CTRL: RXEN Mask. */
+
+#define CMSDK_UART_CTRL_TXEN_Pos          0                                             /* CMSDK_UART CTRL: TXEN Position. */
+#define CMSDK_UART_CTRL_TXEN_Msk          (0x01ul << CMSDK_UART_CTRL_TXEN_Pos)          /* CMSDK_UART CTRL: TXEN Mask. */
+
+/* CMSDK_UART INTSTATUS\INTCLEAR Register Definitions. */
+#define CMSDK_UART_INT_RXORIRQ_Pos        3                                             /* CMSDK_UART INT: RXORIRQ Position. */
+#define CMSDK_UART_INT_RXORIRQ_Msk        (0x01ul << CMSDK_UART_INT_RXORIRQ_Pos)        /* CMSDK_UART INT: RXORIRQ Mask. */
+
+#define CMSDK_UART_INT_TXORIRQ_Pos        2                                             /* CMSDK_UART INT: TXORIRQ Position. */
+#define CMSDK_UART_INT_TXORIRQ_Msk        (0x01ul << CMSDK_UART_INT_TXORIRQ_Pos)        /* CMSDK_UART INT: TXORIRQ Mask. */
+
+#define CMSDK_UART_INT_RXIRQ_Pos          1                                             /* CMSDK_UART INT: RXIRQ Position. */
+#define CMSDK_UART_INT_RXIRQ_Msk          (0x01ul << CMSDK_UART_INT_RXIRQ_Pos)          /* CMSDK_UART INT: RXIRQ Mask. */
+
+#define CMSDK_UART_INT_TXIRQ_Pos          0                                             /* CMSDK_UART INT: TXIRQ Position. */
+#define CMSDK_UART_INT_TXIRQ_Msk          (0x01ul << CMSDK_UART_INT_TXIRQ_Pos)          /* CMSDK_UART INT: TXIRQ Mask. */
+
+/* CMSDK_UART BAUDDIV Register Definitions. */
+#define CMSDK_UART_BAUDDIV_Pos            0                                             /* CMSDK_UART BAUDDIV: BAUDDIV Position. */
+#define CMSDK_UART_BAUDDIV_Msk           (0xFFFFFul << CMSDK_UART_BAUDDIV_Pos)
+
+/**
+ * @brief   Gets the core clock set for MPS3.
+ * @return  Clock value in Hz.
+ **/
+uint32_t GetMPS3CoreClock(void);
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif /* DEVICE_MPS3_H */
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/include/font_9x15_h.h b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/include/font_9x15_h.h
new file mode 100644
index 0000000..b8b6bdc
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/include/font_9x15_h.h
@@ -0,0 +1,128 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+//Font Generated by MikroElektronika GLCD Font Creator 1.2.0.0
+//MikroElektrnika 2011
+//http://www.mikroe.com
+
+//GLCD FontName : Lucida_Console9x15
+//GLCD FontSize : 9x15
+
+#ifndef FONT_9x15_H_H
+#define FONT_9x15_H_H
+
+const unsigned short Font_9x15_h[] = {
+    0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,      /* Code for char num 32. */
+    0x00,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x00,0x10,0x10,0x00,0x00,0x00,      /* Code for char num 33. */
+    0x44,0x44,0x44,0x44,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,      /* Code for char num 34. */
+    0x00,0x12,0x12,0x24,0x7F,0x24,0x28,0x48,0xFE,0x48,0x90,0x90,0x00,0x00,0x00,      /* Code for char num 35. */
+    0x10,0x7C,0x16,0x12,0x12,0x1C,0x38,0x70,0x50,0x50,0x52,0x3E,0x10,0x00,0x00,      /* Code for char num 36. */
+    0x00,0x8C,0x92,0x52,0x52,0x2C,0x10,0x08,0x68,0x94,0x92,0x92,0x62,0x00,0x00,      /* Code for char num 37. */
+    0x00,0x18,0x24,0x24,0x34,0x18,0x0C,0x12,0xB2,0xE2,0xC2,0xBC,0x00,0x00,0x00,      /* Code for char num 38. */
+    0x08,0x08,0x08,0x08,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,      /* Code for char num 39. */
+    0xC0,0x60,0x10,0x10,0x08,0x08,0x08,0x08,0x08,0x08,0x10,0x10,0x60,0xC0,0x00,      /* Code for char num 40. */
+    0x0C,0x18,0x20,0x20,0x40,0x40,0x40,0x40,0x40,0x40,0x20,0x20,0x18,0x0C,0x00,      /* Code for char num 41. */
+    0x00,0x10,0x92,0xEE,0x18,0x28,0x28,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,      /* Code for char num 42. */
+    0x00,0x00,0x00,0x00,0x10,0x10,0x10,0x10,0xFE,0x10,0x10,0x10,0x00,0x00,0x00,      /* Code for char num 43. */
+    0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x18,0x18,0x10,0x08,0x00,      /* Code for char num 44. */
+    0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x7C,0x00,0x00,0x00,0x00,0x00,0x00,0x00,      /* Code for char num 45. */
+    0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x18,0x18,0x00,0x00,0x00,      /* Code for char num 46. */
+    0x80,0x40,0x40,0x60,0x20,0x20,0x10,0x10,0x08,0x08,0x0C,0x04,0x04,0x02,0x00,      /* Code for char num 47. */
+    0x00,0x38,0x44,0x82,0x82,0x82,0x82,0x82,0x82,0x82,0x44,0x38,0x00,0x00,0x00,      /* Code for char num 48. */
+    0x00,0x10,0x1E,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0xFE,0x00,0x00,0x00,      /* Code for char num 49. */
+    0x00,0x3E,0x42,0x40,0x40,0x40,0x20,0x10,0x08,0x04,0x02,0x7E,0x00,0x00,0x00,      /* Code for char num 50. */
+    0x00,0x3C,0x40,0x40,0x40,0x60,0x38,0x40,0x40,0x40,0x40,0x3C,0x00,0x00,0x00,      /* Code for char num 51. */
+    0x00,0x20,0x30,0x28,0x24,0x24,0x22,0x21,0x7F,0x20,0x20,0x20,0x00,0x00,0x00,      /* Code for char num 52. */
+    0x00,0x7C,0x04,0x04,0x04,0x1C,0x20,0x40,0x40,0x40,0x20,0x3C,0x00,0x00,0x00,      /* Code for char num 53. */
+    0x00,0x78,0x04,0x04,0x02,0x3A,0x46,0x82,0x82,0x82,0x44,0x38,0x00,0x00,0x00,      /* Code for char num 54. */
+    0x00,0xFE,0x80,0x40,0x20,0x20,0x10,0x10,0x08,0x08,0x04,0x04,0x00,0x00,0x00,      /* Code for char num 55. */
+    0x00,0x3C,0x42,0x42,0x42,0x24,0x1C,0x62,0x42,0x42,0x42,0x3C,0x00,0x00,0x00,      /* Code for char num 56. */
+    0x00,0x38,0x44,0x82,0x82,0x82,0xC4,0xB8,0x80,0x40,0x40,0x3C,0x00,0x00,0x00,      /* Code for char num 57. */
+    0x00,0x00,0x00,0x00,0x18,0x18,0x00,0x00,0x00,0x00,0x18,0x18,0x00,0x00,0x00,      /* Code for char num 58. */
+    0x00,0x00,0x00,0x00,0x18,0x18,0x00,0x00,0x00,0x00,0x18,0x18,0x10,0x08,0x00,      /* Code for char num 59. */
+    0x00,0x00,0x00,0x00,0x80,0x60,0x10,0x0C,0x0C,0x10,0x60,0x80,0x00,0x00,0x00,      /* Code for char num 60. */
+    0x00,0x00,0x00,0x00,0x00,0x00,0xFE,0x00,0x00,0xFE,0x00,0x00,0x00,0x00,0x00,      /* Code for char num 61. */
+    0x00,0x00,0x00,0x00,0x02,0x0C,0x10,0x60,0x60,0x10,0x0C,0x02,0x00,0x00,0x00,      /* Code for char num 62. */
+    0x00,0x3E,0x42,0x42,0x40,0x20,0x10,0x08,0x08,0x00,0x08,0x08,0x00,0x00,0x00,      /* Code for char num 63. */
+    0x00,0x78,0x84,0xE2,0x92,0x8A,0x8A,0xCA,0xCA,0xB2,0xA6,0x3C,0x00,0x00,0x00,      /* Code for char num 64. */
+    0x00,0x00,0x10,0x38,0x28,0x28,0x44,0x44,0xFE,0x82,0x82,0x82,0x00,0x00,0x00,      /* Code for char num 65. */
+    0x00,0x00,0x3E,0x42,0x42,0x22,0x1E,0x22,0x42,0x42,0x42,0x3E,0x00,0x00,0x00,      /* Code for char num 66. */
+    0x00,0x00,0xF8,0x06,0x02,0x01,0x01,0x01,0x01,0x02,0x06,0xF8,0x00,0x00,0x00,      /* Code for char num 67. */
+    0x00,0x00,0x3E,0x42,0x82,0x82,0x82,0x82,0x82,0x82,0x42,0x3E,0x00,0x00,0x00,      /* Code for char num 68. */
+    0x00,0x00,0xFE,0x02,0x02,0x02,0x02,0x7E,0x02,0x02,0x02,0xFE,0x00,0x00,0x00,      /* Code for char num 69. */
+    0x00,0x00,0xFE,0x02,0x02,0x02,0x02,0x7E,0x02,0x02,0x02,0x02,0x00,0x00,0x00,      /* Code for char num 70. */
+    0x00,0x00,0xF8,0x06,0x02,0x01,0x01,0xE1,0x81,0x82,0x86,0xF8,0x00,0x00,0x00,      /* Code for char num 71. */
+    0x00,0x00,0x42,0x42,0x42,0x42,0x42,0x7E,0x42,0x42,0x42,0x42,0x00,0x00,0x00,      /* Code for char num 72. */
+    0x00,0x00,0xFE,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0xFE,0x00,0x00,0x00,      /* Code for char num 73. */
+    0x00,0x00,0x3C,0x20,0x20,0x20,0x20,0x20,0x20,0x20,0x20,0x1E,0x00,0x00,0x00,      /* Code for char num 74. */
+    0x00,0x00,0x42,0x22,0x12,0x0A,0x06,0x0A,0x12,0x22,0x42,0x82,0x00,0x00,0x00,      /* Code for char num 75. */
+    0x00,0x00,0x02,0x02,0x02,0x02,0x02,0x02,0x02,0x02,0x02,0xFE,0x00,0x00,0x00,      /* Code for char num 76. */
+    0x00,0x00,0x63,0x63,0x63,0x55,0x55,0x55,0x4D,0x49,0x41,0x41,0x00,0x00,0x00,      /* Code for char num 77. */
+    0x00,0x00,0x82,0x86,0x8A,0x8A,0x92,0x92,0xA2,0xA2,0xC2,0x82,0x00,0x00,0x00,      /* Code for char num 78. */
+    0x00,0x00,0x3C,0x42,0x81,0x81,0x81,0x81,0x81,0x81,0x42,0x3C,0x00,0x00,0x00,      /* Code for char num 79. */
+    0x00,0x00,0x3E,0x42,0x42,0x42,0x62,0x1E,0x02,0x02,0x02,0x02,0x00,0x00,0x00,      /* Code for char num 80. */
+    0x00,0x00,0x3C,0x42,0x81,0x81,0x81,0x81,0x81,0x81,0x42,0x3C,0x60,0x80,0x00,      /* Code for char num 81. */
+    0x00,0x00,0x3E,0x42,0x42,0x42,0x22,0x1E,0x12,0x22,0x42,0x82,0x00,0x00,0x00,      /* Code for char num 82. */
+    0x00,0x00,0x7C,0x42,0x02,0x06,0x1C,0x20,0x40,0x40,0x42,0x3E,0x00,0x00,0x00,      /* Code for char num 83. */
+    0x00,0x00,0xFE,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x00,0x00,0x00,      /* Code for char num 84. */
+    0x00,0x00,0x82,0x82,0x82,0x82,0x82,0x82,0x82,0x82,0x44,0x3C,0x00,0x00,0x00,      /* Code for char num 85. */
+    0x00,0x00,0x82,0x82,0x82,0x82,0x44,0x44,0x28,0x28,0x38,0x10,0x00,0x00,0x00,      /* Code for char num 86. */
+    0x00,0x00,0x82,0x82,0x92,0x92,0xAA,0xAA,0xAA,0xAA,0x64,0x44,0x00,0x00,0x00,      /* Code for char num 87. */
+    0x00,0x00,0x82,0x82,0x44,0x28,0x10,0x10,0x28,0x44,0x82,0x82,0x00,0x00,0x00,      /* Code for char num 88. */
+    0x00,0x00,0x82,0x82,0x44,0x44,0x28,0x10,0x10,0x10,0x10,0x10,0x00,0x00,0x00,      /* Code for char num 89. */
+    0x00,0x00,0xFF,0x80,0x40,0x20,0x10,0x08,0x04,0x02,0x01,0xFF,0x00,0x00,0x00,      /* Code for char num 90. */
+    0xF8,0x08,0x08,0x08,0x08,0x08,0x08,0x08,0x08,0x08,0x08,0x08,0x08,0xF8,0x00,      /* Code for char num 91. */
+    0x02,0x04,0x04,0x04,0x08,0x08,0x10,0x10,0x20,0x20,0x20,0x40,0x40,0x80,0x00,      /* Code for char num 92. */
+    0x3E,0x20,0x20,0x20,0x20,0x20,0x20,0x20,0x20,0x20,0x20,0x20,0x20,0x3E,0x00,      /* Code for char num 93. */
+    0x00,0x10,0x10,0x10,0x28,0x28,0x44,0x44,0x44,0x82,0x00,0x00,0x00,0x00,0x00,      /* Code for char num 94. */
+    0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xFE,0x00,0x00,      /* Code for char num 95. */
+    0x10,0x20,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,      /* Code for char num 96. */
+    0x00,0x00,0x00,0x00,0x3C,0x40,0x40,0x78,0x44,0x42,0x62,0xDC,0x00,0x00,0x00,      /* Code for char num 97. */
+    0x02,0x02,0x02,0x02,0x7A,0x46,0x82,0x82,0x82,0x82,0x46,0x3A,0x00,0x00,0x00,      /* Code for char num 98. */
+    0x00,0x00,0x00,0x00,0xF8,0x04,0x02,0x02,0x02,0x02,0x04,0xF8,0x00,0x00,0x00,      /* Code for char num 99. */
+    0x80,0x80,0x80,0x80,0xB8,0xC4,0x82,0x82,0x82,0x82,0xC4,0xBC,0x00,0x00,0x00,      /* Code for char num 100. */
+    0x00,0x00,0x00,0x00,0x38,0x44,0x42,0x7E,0x02,0x02,0x04,0x78,0x00,0x00,0x00,      /* Code for char num 101. */
+    0xF0,0x08,0x08,0x08,0xFE,0x08,0x08,0x08,0x08,0x08,0x08,0x08,0x00,0x00,0x00,      /* Code for char num 102. */
+    0x00,0x00,0x00,0x00,0xB8,0xC4,0x82,0x82,0x82,0x82,0xC4,0xBC,0x80,0x40,0x3C,      /* Code for char num 103. */
+    0x02,0x02,0x02,0x02,0x3A,0x46,0x42,0x42,0x42,0x42,0x42,0x42,0x00,0x00,0x00,      /* Code for char num 104. */
+    0x18,0x18,0x00,0x00,0x1E,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x00,0x00,0x00,      /* Code for char num 105. */
+    0x30,0x30,0x00,0x00,0x3C,0x20,0x20,0x20,0x20,0x20,0x20,0x20,0x20,0x20,0x1E,      /* Code for char num 106. */
+    0x02,0x02,0x02,0x02,0x42,0x22,0x12,0x0E,0x0A,0x12,0x22,0x42,0x00,0x00,0x00,      /* Code for char num 107. */
+    0x1E,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x00,0x00,0x00,      /* Code for char num 108. */
+    0x00,0x00,0x00,0x00,0xDA,0xB6,0x92,0x92,0x92,0x92,0x92,0x92,0x00,0x00,0x00,      /* Code for char num 109. */
+    0x00,0x00,0x00,0x00,0x3A,0x46,0x42,0x42,0x42,0x42,0x42,0x42,0x00,0x00,0x00,      /* Code for char num 110. */
+    0x00,0x00,0x00,0x00,0x38,0x44,0x82,0x82,0x82,0x82,0x44,0x38,0x00,0x00,0x00,      /* Code for char num 111. */
+    0x00,0x00,0x00,0x00,0x7A,0x46,0x82,0x82,0x82,0x82,0x46,0x3A,0x02,0x02,0x02,      /* Code for char num 112. */
+    0x00,0x00,0x00,0x00,0xB8,0xC4,0x82,0x82,0x82,0x82,0xC4,0xBC,0x80,0x80,0x80,      /* Code for char num 113. */
+    0x00,0x00,0x00,0x00,0xF4,0x8C,0x04,0x04,0x04,0x04,0x04,0x04,0x00,0x00,0x00,      /* Code for char num 114. */
+    0x00,0x00,0x00,0x00,0x7C,0x02,0x02,0x0C,0x30,0x40,0x42,0x3E,0x00,0x00,0x00,      /* Code for char num 115. */
+    0x00,0x00,0x08,0x08,0xFE,0x08,0x08,0x08,0x08,0x08,0x08,0xF0,0x00,0x00,0x00,      /* Code for char num 116. */
+    0x00,0x00,0x00,0x00,0x42,0x42,0x42,0x42,0x42,0x42,0x62,0x5C,0x00,0x00,0x00,      /* Code for char num 117. */
+    0x00,0x00,0x00,0x00,0x82,0x82,0x82,0x44,0x44,0x28,0x28,0x10,0x00,0x00,0x00,      /* Code for char num 118. */
+    0x00,0x00,0x00,0x00,0x82,0x92,0xAA,0xAA,0xAA,0xAA,0x44,0x44,0x00,0x00,0x00,      /* Code for char num 119. */
+    0x00,0x00,0x00,0x00,0x82,0x44,0x28,0x10,0x10,0x28,0x44,0x82,0x00,0x00,0x00,      /* Code for char num 120. */
+    0x00,0x00,0x00,0x00,0x82,0x82,0x82,0x44,0x44,0x28,0x28,0x10,0x10,0x0C,0x00,      /* Code for char num 121. */
+    0x00,0x00,0x00,0x00,0xFE,0x80,0x40,0x20,0x10,0x08,0x04,0xFE,0x00,0x00,0x00,      /* Code for char num 122. */
+    0xE0,0x10,0x10,0x10,0x10,0x10,0x10,0x0C,0x10,0x10,0x10,0x10,0x10,0xE0,0x00,      /* Code for char num 123. */
+    0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x00,      /* Code for char num 124. */
+    0x0E,0x10,0x10,0x10,0x10,0x10,0x10,0x60,0x10,0x10,0x10,0x10,0x10,0x0E,0x00,      /* Code for char num 125. */
+    0x00,0x00,0x00,0x00,0x00,0x00,0x62,0x92,0x8C,0x00,0x00,0x00,0x00,0x00,0x00,      /* Code for char num 126. */
+    0x00,0x00,0x00,0x07,0x05,0x05,0x05,0x05,0x05,0x05,0x07,0x00,0x00,0x00,0x00       /* Code for char num 127. */
+};
+
+
+#endif /* FONT_9x15_H_H */
\ No newline at end of file
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/include/glcd_mps3.h b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/include/glcd_mps3.h
new file mode 100644
index 0000000..c2810c0
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/include/glcd_mps3.h
@@ -0,0 +1,202 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef GLCD_MPS3_H
+#define GLCD_MPS3_H
+
+#include <stdint.h>
+
+/******************************************************************************
+  Color coding
+  GLCD is coded:   15..11 red, 10..5 green, 4..0 blue  (unsigned short)
+                   GLCD_R5, GLCD_G6, GLCD_B5
+  original coding: 17..12 red, 11..6 green, 5..0 blue
+                   ORG_R6,  ORG_G6,  ORG_B6
+
+  ORG_R1..5 = GLCD_R0..4,  ORG_R0 = GLCD_R4
+  ORG_G0..5 = GLCD_G0..5,
+  ORG_B1..5 = GLCD_B0..4,  ORG_B0 = GLCD_B4
+
+  GLCD RGB color definitions
+******************************************************************************/
+#define Black           0x0000      /*   0,   0,   0 */
+#define Navy            0x000F      /*   0,   0, 128 */
+#define DarkGreen       0x03E0      /*   0, 128,   0 */
+#define DarkCyan        0x03EF      /*   0, 128, 128 */
+#define Maroon          0x7800      /* 128,   0,   0 */
+#define Purple          0x780F      /* 128,   0, 128 */
+#define Olive           0x7BE0      /* 128, 128,   0 */
+#define LightGrey       0xC618      /* 192, 192, 192 */
+#define DarkGrey        0x7BEF      /* 128, 128, 128 */
+#define Blue            0x001F      /*   0,   0, 255 */
+#define Green           0x07E0      /*   0, 255,   0 */
+#define Cyan            0x07FF      /*   0, 255, 255 */
+#define Red             0xF800      /* 255,   0,   0 */
+#define Magenta         0xF81F      /* 255,   0, 255 */
+#define Yellow          0xFFE0      /* 255, 255, 0   */
+#define White           0xFFFF      /* 255, 255, 255 */
+
+/************************** Orientation  configuration ************************/
+#ifndef LANDSCAPE
+#define LANDSCAPE   1               /* 1 for landscape, 0 for portrait.    */
+#endif
+#ifndef ROTATE180
+#define ROTATE180   1               /* 1 to rotate the screen for 180 deg. */
+#endif
+
+/*------------------------- Speed dependant settings -------------------------*/
+
+/* If processor works on high frequency delay has to be increased, it can be
+   increased by factor 2^N by this constant. */
+#define DELAY_2N    8
+
+/*---------------------- Graphic LCD size definitions ------------------------*/
+#if (LANDSCAPE == 1)
+   #define GLCD_WIDTH       320                 /* Screen Width (in pixels). */
+   #define GLCD_HEIGHT      240                 /* Screen Hight (in pixels). */
+#else
+   #define GLCD_WIDTH       240                 /* Screen Width (in pixels). */
+   #define GLCD_HEIGHT      320                 /* Screen Hight (in pixels). */
+#endif
+
+#define BPP                 16                  /* Bits per pixel.           */
+#define BYPP                ((BPP+7)/8)         /* Bytes per pixel.          */
+
+
+/**
+ * @brief      Initialize the Himax LCD with HX8347-D LCD Controller.
+ */
+void GLCD_Initialize(void);
+
+/**
+ * @brief      Set draw window region to whole screen.
+ */
+void GLCD_WindowMax(void);
+
+/**
+ * @brief      Set draw window region.
+ * @param[in]  x  Horizontal position.
+ * @param[in]  y  Vertical position.
+ * @param[in]  w  Window width in pixel.
+ * @param[in]  h  Window height in pixels.
+ */
+void GLCD_SetWindow(unsigned int x, unsigned int y,
+                     unsigned int w, unsigned int h);
+
+/**
+ * @brief      Set foreground color.
+ * @param[in]  color    Foreground color.
+ */
+void GLCD_SetTextColor(unsigned short color);
+
+/**
+ * @brief      Set background color.
+ * @param[in]  color    Background color.
+ */
+void GLCD_SetBackColor(unsigned short color);
+
+/**
+ * @brief      Clear display.
+ * @param[in]  color Display clearing color.
+ *
+ */
+void GLCD_Clear(unsigned short color);
+
+/**
+ * @brief      Draw character on given position.
+ * @param[in]  x     Horizontal position.
+ * @param[in]  y     Vertical position.
+ * @param[in]  cw    Character width in pixel.
+ * @param[in]  ch    Character height in pixels.
+ * @param[in]  c     Pointer to character bitmap.
+ *
+ */
+void GLCD_DrawChar(unsigned int x,  unsigned int y,
+                  unsigned int cw, unsigned int ch,
+                  unsigned char *c);
+
+/**
+ * @brief      Display character on given line.
+ * @param[in]  ln    Line number.
+ * @param[in]  col   Column number.
+ * @param[in]  fi    Font index (0 = 9x15).
+ * @param[in]  c     ASCII character.
+ */
+void GLCD_DisplayChar(unsigned int ln, unsigned int col,
+                     unsigned char fi, unsigned char  c);
+
+
+/**
+ * @brief      Display string on given line.
+ * @param[in]  ln    Line number.
+ * @param[in]  col   Column number.
+ * @param[in]  fi    Font index (0 = 9x15).
+ * @param[in]  s     Pointer to string.
+ */
+void GLCD_DisplayString(unsigned int ln, unsigned int col,
+                        unsigned char fi, char *s);
+
+/**
+ * @brief      Clear given line.
+ * @param[in]  ln:   Line number.
+ * @param[in]  fi    Font index (0 = 9x15).
+ */
+void GLCD_ClearLn(unsigned int ln, unsigned char fi);
+
+/**
+ * @brief      Display graphical bitmap image at position x horizontally and y
+ *             vertically. This function is optimized for 16 bits per pixel
+ *             format, it has to be adapted for any other format.
+ * @param[in]  x        Horizontal position.
+ * @param[in]  y        Vertical position.
+ * @param[in]  w        Width of bitmap.
+ * @param[in]  h        Height of bitmap.
+ * @param[in]  bitmap   Address at which the bitmap data resides.
+ */
+void GLCD_Bitmap(unsigned int x,  unsigned int y,
+               unsigned int w, unsigned int h,
+               unsigned short *bitmap);
+
+/**
+ * @brief Displays an 8 bit image, conversion to the LCD's
+ *        16 bit codec is done on the fly.
+ * @param[in]  data                 Pointer to the full sized image data.
+ * @param[in]  width                Image width.
+ * @param[in]  height               Image height.
+ * @param[in]  channels             Number of channels in the image.
+ * @param[in]  pos_x                Start x position for the LCD.
+ * @param[in]  pos_y                Start y position for the LCD.
+ * @param[in]  downsample_factor    Factor by which the image
+ *                                  is downsampled by.
+ */
+void GLCD_Image(void *data, const uint32_t width,
+               const uint32_t height, const uint32_t channels,
+               const uint32_t pos_x, const uint32_t pos_y,
+               const uint32_t downsample_factor);
+
+/**
+ * @brief      Draw box filled with color.
+ * @param[in]  x        Horizontal position.
+ * @param[in]  y        Vertical position.
+ * @param[in]  w        Window width in pixels.
+ * @param[in]  h        Window height in pixels.
+ * @param[in]  color    Box color.
+ */
+void GLCD_Box(unsigned int x, unsigned int y,
+            unsigned int w, unsigned int h,
+            unsigned short color);
+
+#endif /* GLCD_MPS3_H */
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/include/smm_mps3.h b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/include/smm_mps3.h
new file mode 100644
index 0000000..1c0e0f2
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/include/smm_mps3.h
@@ -0,0 +1,615 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef SMM_MPS3_H
+#define SMM_MPS3_H
+
+#include "cmsis.h"                  /* Device specific header file. */
+#include "peripheral_memmap.h"      /* Peripheral memory map definitions. */
+
+#if defined ( __CC_ARM   )
+#pragma anon_unions
+#endif
+
+/******************************************************************************/
+/*                          FPGA System Register declaration                  */
+/******************************************************************************/
+
+typedef struct
+{
+  __IO uint32_t LED;             /* Offset: 0x000 (R/W)  LED connections
+                                  *                         [31:2] : Reserved
+                                  *                          [1:0] : LEDs
+                                  */
+       uint32_t RESERVED1[1];
+  __IO uint32_t BUTTON;          /* Offset: 0x008 (R/W)  Buttons
+                                  *                         [31:2] : Reserved
+                                  *                          [1:0] : Buttons
+                                  */
+       uint32_t RESERVED2[1];
+  __IO uint32_t CLK1HZ;          /* Offset: 0x010 (R/W)  1Hz up counter    */
+  __IO uint32_t CLK100HZ;        /* Offset: 0x014 (R/W)  100Hz up counter  */
+  __IO uint32_t COUNTER;         /* Offset: 0x018 (R/W)  Cycle Up Counter
+                                  *                         Increments when 32-bit prescale counter reach zero
+                                  */
+  __IO uint32_t PRESCALE;        /* Offset: 0x01C (R/W)  Prescaler
+                                  *                         Bit[31:0] : reload value for prescale counter
+                                  */
+  __IO uint32_t PSCNTR;          /* Offset: 0x020 (R/W)  32-bit Prescale counter
+                                  *                         current value of the pre-scaler counter
+                                  *                         The Cycle Up Counter increment when the prescale down counter reach 0
+                                  *                         The pre-scaler counter is reloaded with PRESCALE after reaching 0.
+                                  */
+       uint32_t RESERVED3[1];
+  __IO uint32_t SWITCHES;        /* Offset: 0x028 (R/W)  Switches
+                                  *                         [31:8] : Reserved
+                                  *                          [7:0] : Switches
+                                  */
+       uint32_t RESERVED4[8];
+  __IO uint32_t MISC;            /* Offset: 0x04C (R/W)  Misc control
+                                  *                         [31:10] : Reserved
+                                  *                            [9] :
+                                  *                            [8] :
+                                  *                            [7] : ADC_SPI_nCS
+                                  *                            [6] : CLCD_BL_CTRL
+                                  *                            [5] : CLCD_RD
+                                  *                            [4] : CLCD_RS
+                                  *                            [3] : CLCD_RESET
+                                  *                            [2] : SHIELD_1_SPI_nCS
+                                  *                            [1] : SHIELD_0_SPI_nCS
+                                  *                            [0] : CLCD_CS
+                                  */
+} MPS3_FPGAIO_TypeDef;
+
+/* MISC register bit definitions. */
+
+#define CLCD_CS_Pos        0
+#define CLCD_CS_Msk        (1UL<<CLCD_CS_Pos)
+#define SHIELD_0_nCS_Pos   1
+#define SHIELD_0_nCS_Msk   (1UL<<SHIELD_0_nCS_Pos)
+#define SHIELD_1_nCS_Pos   2
+#define SHIELD_1_nCS_Msk   (1UL<<SHIELD_1_nCS_Pos)
+#define CLCD_RESET_Pos     3
+#define CLCD_RESET_Msk     (1UL<<CLCD_RESET_Pos)
+#define CLCD_RS_Pos        4
+#define CLCD_RS_Msk        (1UL<<CLCD_RS_Pos)
+#define CLCD_RD_Pos        5
+#define CLCD_RD_Msk        (1UL<<CLCD_RD_Pos)
+#define CLCD_BL_Pos        6
+#define CLCD_BL_Msk        (1UL<<CLCD_BL_Pos)
+#define ADC_nCS_Pos        7
+#define ADC_nCS_Msk        (1UL<<ADC_nCS_Pos)
+
+/******************************************************************************/
+/*                        SCC Register declaration                            */
+/******************************************************************************/
+
+typedef struct
+{
+  __IO uint32_t CFG_REG0;        /* Offset: 0x000 (R/W)  Remaps block RAM to ZBT
+                                  *                         [31:1] : Reserved
+                                  *                            [0] 1 : REMAP BlockRam to ZBT
+                                  */
+  __IO uint32_t LEDS;            /* Offset: 0x004 (R/W)  Controls the MCC user LEDs
+                                  *                         [31:8] : Reserved
+                                  *                          [7:0] : MCC LEDs
+                                  */
+       uint32_t RESERVED0[1];
+  __I  uint32_t SWITCHES;        /* Offset: 0x00C (R/ )  Denotes the state of the MCC user switches
+                                  *                         [31:8] : Reserved
+                                  *                          [7:0] : These bits indicate state of the MCC switches
+                                  */
+  __I  uint32_t CFG_REG4;        /* Offset: 0x010 (R/ )  Denotes the board revision
+                                  *                         [31:4] : Reserved
+                                  *                          [3:0] : Used by the MCC to pass PCB revision. 0 = A 1 = B
+                                  */
+  __I  uint32_t CFG_ACLK;        /* Offset: 0x014 (R/ )  System Clock
+                                  */
+       uint32_t RESERVED1[34];
+  __IO uint32_t SYS_CFGDATA_RTN; /* Offset: 0x0A0 (R/W)  User data register
+                                  *                         [31:0] : Data
+                                  */
+  __IO uint32_t SYS_CFGDATA_OUT; /* Offset: 0x0A4 (R/W)  User data register
+                                  *                         [31:0] : Data
+                                  */
+  __IO uint32_t SYS_CFGCTRL;     /* Offset: 0x0A8 (R/W)  Control register
+                                  *                           [31] : Start (generates interrupt on write to this bit)
+                                  *                           [30] : R/W access
+                                  *                        [29:26] : Reserved
+                                  *                        [25:20] : Function value
+                                  *                        [19:12] : Reserved
+                                  *                         [11:0] : Device (value of 0/1/2 for supported clocks)
+                                  */
+  __IO uint32_t SYS_CFGSTAT;     /* Offset: 0x0AC (R/W)  Contains status information
+                                  *                         [31:2] : Reserved
+                                  *                            [1] : Error
+                                  *                            [0] : Complete
+                                  */
+  __IO uint32_t RESERVED2[20];
+  __IO uint32_t SCC_DLL;         /* Offset: 0x100 (R/W)  DLL Lock Register
+                                  *                        [31:24] : DLL LOCK MASK[7:0] - Indicate if the DLL locked is masked
+                                  *                        [23:16] : DLL LOCK MASK[7:0] - Indicate if the DLLs are locked or unlocked
+                                  *                         [15:1] : Reserved
+                                  *                            [0] : This bit indicates if all enabled DLLs are locked
+                                  */
+       uint32_t RESERVED3[957];
+  __I  uint32_t SCC_AID;         /* Offset: 0xFF8 (R/ )  SCC AID Register
+                                  *                        [31:24] : FPGA build number
+                                  *                        [23:20] : V2M-MPS3 target board revision (A = 0, B = 1)
+                                  *                        [19:11] : Reserved
+                                  *                           [10] : if “1” SCC_SW register has been implemented
+                                  *                            [9] : if “1” SCC_LED register has been implemented
+                                  *                            [8] : if “1” DLL lock register has been implemented
+                                  *                          [7:0] : number of SCC configuration register
+                                  */
+  __I  uint32_t SCC_ID;          /* Offset: 0xFFC (R/ )  Contains information about the FPGA image
+                                  *                        [31:24] : Implementer ID: 0x41 = ARM
+                                  *                        [23:20] : Application note IP variant number
+                                  *                        [19:16] : IP Architecture: 0x4 =AHB
+                                  *                         [15:4] : Primary part number: 386 = AN386
+                                  *                          [3:0] : Application note IP revision number
+                                  */
+} MPS3_SCC_TypeDef;
+
+
+/******************************************************************************/
+/*                        SSP Peripheral declaration                          */
+/******************************************************************************/
+
+typedef struct
+{
+  __IO uint32_t CR0;             /* Offset: 0x000 (R/W)  Control register 0
+                                  *                        [31:16] : Reserved
+                                  *                         [15:8] : Serial clock rate
+                                  *                            [7] : SSPCLKOUT phase,    applicable to Motorola SPI frame format only
+                                  *                            [6] : SSPCLKOUT polarity, applicable to Motorola SPI frame format only
+                                  *                          [5:4] : Frame format
+                                  *                          [3:0] : Data Size Select
+                                  */
+  __IO uint32_t CR1;             /* Offset: 0x004 (R/W)  Control register 1
+                                  *                         [31:4] : Reserved
+                                  *                            [3] : Slave-mode output disable
+                                  *                            [2] : Master or slave mode select
+                                  *                            [1] : Synchronous serial port enable
+                                  *                            [0] : Loop back mode
+                                  */
+  __IO uint32_t DR;              /* Offset: 0x008 (R/W)  Data register
+                                  *                        [31:16] : Reserved
+                                  *                         [15:0] : Transmit/Receive FIFO
+                                  */
+  __I  uint32_t SR;              /* Offset: 0x00C (R/ )  Status register
+                                  *                         [31:5] : Reserved
+                                  *                            [4] : PrimeCell SSP busy flag
+                                  *                            [3] : Receive FIFO full
+                                  *                            [2] : Receive FIFO not empty
+                                  *                            [1] : Transmit FIFO not full
+                                  *                            [0] : Transmit FIFO empty
+                                  */
+  __IO uint32_t CPSR;            /* Offset: 0x010 (R/W)  Clock prescale register
+                                  *                         [31:8] : Reserved
+                                  *                          [8:0] : Clock prescale divisor
+                                  */
+  __IO uint32_t IMSC;            /* Offset: 0x014 (R/W)  Interrupt mask set or clear register
+                                  *                         [31:4] : Reserved
+                                  *                            [3] : Transmit FIFO interrupt mask
+                                  *                            [2] : Receive FIFO interrupt mask
+                                  *                            [1] : Receive timeout interrupt mask
+                                  *                            [0] : Receive overrun interrupt mask
+                                  */
+  __I  uint32_t RIS;             /* Offset: 0x018 (R/ )  Raw interrupt status register
+                                  *                         [31:4] : Reserved
+                                  *                            [3] : raw interrupt state, prior to masking, of the SSPTXINTR interrupt
+                                  *                            [2] : raw interrupt state, prior to masking, of the SSPRXINTR interrupt
+                                  *                            [1] : raw interrupt state, prior to masking, of the SSPRTINTR interrupt
+                                  *                            [0] : raw interrupt state, prior to masking, of the SSPRORINTR interrupt
+                                  */
+  __I  uint32_t MIS;             /* Offset: 0x01C (R/ )  Masked interrupt status register
+                                  *                         [31:4] : Reserved
+                                  *                            [3] : transmit FIFO masked interrupt state, after masking, of the SSPTXINTR interrupt
+                                  *                            [2] : receive FIFO masked interrupt state, after masking, of the SSPRXINTR interrupt
+                                  *                            [1] : receive timeout masked interrupt state, after masking, of the SSPRTINTR interrupt
+                                  *                            [0] : receive over run masked interrupt status, after masking, of the SSPRORINTR interrupt
+                                  */
+  __O  uint32_t ICR;             /* Offset: 0x020 ( /W)  Interrupt clear register
+                                  *                         [31:2] : Reserved
+                                  *                            [1] : Clears the SSPRTINTR interrupt
+                                  *                            [0] : Clears the SSPRORINTR interrupt
+                                  */
+  __IO uint32_t DMACR;           /* Offset: 0x024 (R/W)  DMA control register
+                                  *                         [31:2] : Reserved
+                                  *                            [1] : Transmit DMA Enable
+                                  *                            [0] : Receive DMA Enable
+                                  */
+} MPS3_SSP_TypeDef;
+
+
+/* SSP_CR0 Control register 0. */
+#define SSP_CR0_DSS_Pos         0           /* Data Size Select.    */
+#define SSP_CR0_DSS_Msk         (0xF<<SSP_CR0_DSS_Pos)
+#define SSP_CR0_FRF_Pos         4           /* Frame Format Select. */
+#define SSP_CR0_FRF_Msk         (3UL<<SSP_CR0_FRM_Pos)
+#define SSP_CR0_SPO_Pos         6           /* SSPCLKOUT polarity.  */
+#define SSP_CR0_SPO_Msk         (1UL<<SSP_CR0_SPO_Pos)
+#define SSP_CR0_SPH_Pos         7           /* SSPCLKOUT phase.     */
+#define SSP_CR0_SPH_Msk         (1UL<<SSP_CR0_SPH_Pos)
+#define SSP_CR0_SCR_Pos         8           /* Serial Clock Rate (divide). */
+#define SSP_CR0_SCR_Msk         (0xFF<<SSP_CR0_SCR_Pos)
+
+#define SSP_CR0_SCR_DFLT        0x0300      /* Serial Clock Rate (divide), default set at 3. */
+#define SSP_CR0_FRF_MOT         0x0000      /* Frame format.                                 */
+#define SSP_CR0_DSS_8           0x0007      /* Data packet size, 8bits.                      */
+#define SSP_CR0_DSS_16          0x000F      /* Data packet size, 16bits.                     */
+
+/* SSP_CR1 Control register 1. */
+#define SSP_CR1_LBM_Pos         0           /* Loop Back Mode. */
+#define SSP_CR1_LBM_Msk         (1UL<<SSP_CR1_LBM_Pos)
+#define SSP_CR1_SSE_Pos         1           /* Serial port enable. */
+#define SSP_CR1_SSE_Msk         (1UL<<SSP_CR1_SSE_Pos)
+#define SSP_CR1_MS_Pos          2           /* Master or Slave mode. */
+#define SSP_CR1_MS_Msk          (1UL<<SSP_CR1_MS_Pos)
+#define SSP_CR1_SOD_Pos         3           /* Slave Output mode Disable. */
+#define SSP_CR1_SOD_Msk         (1UL<<SSP_CR1_SOD_Pos)
+
+/* SSP_SR Status register. */
+#define SSP_SR_TFE_Pos          0           /* Transmit FIFO empty. */
+#define SSP_SR_TFE_Msk          (1UL<<SSP_SR_TFE_Pos)
+#define SSP_SR_TNF_Pos          1           /* Transmit FIFO not full. */
+#define SSP_SR_TNF_Msk          (1UL<<SSP_SR_TNF_Pos)
+#define SSP_SR_RNE_Pos          2           /* Receive  FIFO not empty. */
+#define SSP_SR_RNE_Msk          (1UL<<SSP_SR_RNE_Pos)
+#define SSP_SR_RFF_Pos          3           /* Receive  FIFO full. */
+#define SSP_SR_RFF_Msk          (1UL<<SSP_SR_RFF_Pos)
+#define SSP_SR_BSY_Pos          4           /* Busy. */
+#define SSP_SR_BSY_Msk          (1UL<<SSP_SR_BSY_Pos)
+
+/* SSP_CPSR Clock prescale register. */
+#define SSP_CPSR_CPD_Pos        0           /* Clock prescale divisor. */
+#define SSP_CPSR_CPD_Msk        (0xFF<<SSP_CPSR_CDP_Pos)
+
+#define SSP_CPSR_DFLT        0x0008      /* Clock prescale (use with SCR), default set at 8. */
+
+/* SSPIMSC Interrupt mask set and clear register. */
+#define SSP_IMSC_RORIM_Pos         0           /* Receive overrun not Masked. */
+#define SSP_IMSC_RORIM_Msk         (1UL<<SSP_IMSC_RORIM_Pos)
+#define SSP_IMSC_RTIM_Pos          1           /* Receive timeout not Masked. */
+#define SSP_IMSC_RTIM_Msk          (1UL<<SSP_IMSC_RTIM_Pos)
+#define SSP_IMSC_RXIM_Pos          2           /* Receive  FIFO not Masked.   */
+#define SSP_IMSC_RXIM_Msk          (1UL<<SSP_IMSC_RXIM_Pos)
+#define SSP_IMSC_TXIM_Pos          3           /* Transmit FIFO not Masked.   */
+#define SSP_IMSC_TXIM_Msk          (1UL<<SSP_IMSC_TXIM_Pos)
+
+/* SSPRIS Raw interrupt status register. */
+#define SSP_RIS_RORRIS_Pos         0           /* Raw Overrun  interrupt flag. */
+#define SSP_RIS_RORRIS_Msk         (1UL<<SSP_RIS_RORRIS_Pos)
+#define SSP_RIS_RTRIS_Pos          1           /* Raw Timemout interrupt flag. */
+#define SSP_RIS_RTRIS_Msk          (1UL<<SSP_RIS_RTRIS_Pos)
+#define SSP_RIS_RXRIS_Pos          2           /* Raw Receive  interrupt flag. */
+#define SSP_RIS_RXRIS_Msk          (1UL<<SSP_RIS_RXRIS_Pos)
+#define SSP_RIS_TXRIS_Pos          3           /* Raw Transmit interrupt flag. */
+#define SSP_RIS_TXRIS_Msk          (1UL<<SSP_RIS_TXRIS_Pos)
+
+/* SSPMIS Masked interrupt status register. */
+#define SSP_MIS_RORMIS_Pos         0           /* Masked Overrun  interrupt flag. */
+#define SSP_MIS_RORMIS_Msk         (1UL<<SSP_MIS_RORMIS_Pos)
+#define SSP_MIS_RTMIS_Pos          1           /* Masked Timemout interrupt flag. */
+#define SSP_MIS_RTMIS_Msk          (1UL<<SSP_MIS_RTMIS_Pos)
+#define SSP_MIS_RXMIS_Pos          2           /* Masked Receive  interrupt flag. */
+#define SSP_MIS_RXMIS_Msk          (1UL<<SSP_MIS_RXMIS_Pos)
+#define SSP_MIS_TXMIS_Pos          3           /* Masked Transmit interrupt flag. */
+#define SSP_MIS_TXMIS_Msk          (1UL<<SSP_MIS_TXMIS_Pos)
+
+/* SSPICR Interrupt clear register. */
+#define SSP_ICR_RORIC_Pos           0           /* Clears Overrun  interrupt flag. */
+#define SSP_ICR_RORIC_Msk           (1UL<<SSP_ICR_RORIC_Pos)
+#define SSP_ICR_RTIC_Pos            1           /* Clears Timemout interrupt flag. */
+#define SSP_ICR_RTIC_Msk            (1UL<<SSP_ICR_RTIC_Pos)
+
+/* SSPDMACR DMA control register. */
+#define SSP_DMACR_RXDMAE_Pos        0           /* Enable Receive  FIFO DMA. */
+#define SSP_DMACR_RXDMAE_Msk        (1UL<<SSP_DMACR_RXDMAE_Pos)
+#define SSP_DMACR_TXDMAE_Pos        1           /* Enable Transmit FIFO DMA. */
+#define SSP_DMACR_TXDMAE_Msk        (1UL<<SSP_DMACR_TXDMAE_Pos)
+
+/******************************************************************************/
+/*               Audio and Touch Screen (I2C) Peripheral declaration          */
+/******************************************************************************/
+
+typedef struct
+{
+  union {
+  __O   uint32_t  CONTROLS;     /* Offset: 0x000 CONTROL Set Register     ( /W). */
+  __I   uint32_t  CONTROL;      /* Offset: 0x000 CONTROL Status Register  (R/ ). */
+  };
+  __O    uint32_t  CONTROLC;     /* Offset: 0x004 CONTROL Clear Register  ( /W). */
+} MPS3_I2C_TypeDef;
+
+#define SDA                1 << 1
+#define SCL                1 << 0
+
+
+/******************************************************************************/
+/*               Audio I2S Peripheral declaration                             */
+/******************************************************************************/
+
+typedef struct
+{
+  /*!< Offset: 0x000 CONTROL Register    (R/W) */
+  __IO   uint32_t  CONTROL;  /* <h> CONTROL </h>
+                              *   <o.0> TX Enable
+                              *     <0=> TX disabled
+                              *     <1=> TX enabled
+                              *   <o.1> TX IRQ Enable
+                              *     <0=> TX IRQ disabled
+                              *     <1=> TX IRQ enabled
+                              *   <o.2> RX Enable
+                              *     <0=> RX disabled
+                              *     <1=> RX enabled
+                              *   <o.3> RX IRQ Enable
+                              *     <0=> RX IRQ disabled
+                              *     <1=> RX IRQ enabled
+                              *   <o.10..8> TX Buffer Water Level
+                              *     <0=> / IRQ triggers when any space available
+                              *     <1=> / IRQ triggers when more than 1 space available
+                              *     <2=> / IRQ triggers when more than 2 space available
+                              *     <3=> / IRQ triggers when more than 3 space available
+                              *     <4=> Undefined!
+                              *     <5=> Undefined!
+                              *     <6=> Undefined!
+                              *     <7=> Undefined!
+                              *   <o.14..12> RX Buffer Water Level
+                              *     <0=> Undefined!
+                              *     <1=> / IRQ triggers when less than 1 space available
+                              *     <2=> / IRQ triggers when less than 2 space available
+                              *     <3=> / IRQ triggers when less than 3 space available
+                              *     <4=> / IRQ triggers when less than 4 space available
+                              *     <5=> Undefined!
+                              *     <6=> Undefined!
+                              *     <7=> Undefined!
+                              *   <o.16> FIFO reset
+                              *     <0=> Normal operation
+                              *     <1=> FIFO reset
+                              *   <o.17> Audio Codec reset
+                              *     <0=> Normal operation
+                              *     <1=> Assert audio Codec reset
+                              */
+  /*!< Offset: 0x004 STATUS Register     (R/ ) */
+  __I    uint32_t  STATUS;   /* <h> STATUS </h>
+                              *   <o.0> TX Buffer alert
+                              *     <0=> TX buffer don't need service yet
+                              *     <1=> TX buffer need service
+                              *   <o.1> RX Buffer alert
+                              *     <0=> RX buffer don't need service yet
+                              *     <1=> RX buffer need service
+                              *   <o.2> TX Buffer Empty
+                              *     <0=> TX buffer have data
+                              *     <1=> TX buffer empty
+                              *   <o.3> TX Buffer Full
+                              *     <0=> TX buffer not full
+                              *     <1=> TX buffer full
+                              *   <o.4> RX Buffer Empty
+                              *     <0=> RX buffer have data
+                              *     <1=> RX buffer empty
+                              *   <o.5> RX Buffer Full
+                              *     <0=> RX buffer not full
+                              *     <1=> RX buffer full
+                              */
+  union {
+   /*!< Offset: 0x008 Error Status Register (R/ ) */
+    __I    uint32_t  ERROR;  /* <h> ERROR </h>
+                              *   <o.0> TX error
+                              *     <0=> Okay
+                              *     <1=> TX overrun/underrun
+                              *   <o.1> RX error
+                              *     <0=> Okay
+                              *     <1=> RX overrun/underrun
+                              */
+   /*!< Offset: 0x008 Error Clear Register  ( /W) */
+    __O    uint32_t  ERRORCLR; /* <h> ERRORCLR </h>
+                                *   <o.0> TX error
+                                *     <0=> Okay
+                                *     <1=> Clear TX error
+                                *   <o.1> RX error
+                                *     <0=> Okay
+                                *     <1=> Clear RX error
+                                */
+    };
+   /*!< Offset: 0x00C Divide ratio Register (R/W) */
+  __IO   uint32_t  DIVIDE;  /* <h> Divide ratio for Left/Right clock </h>
+                             *   <o.9..0> TX error (default 0x80)
+                             */
+   /*!< Offset: 0x010 Transmit Buffer       ( /W) */
+  __O    uint32_t  TXBUF;  /* <h> Transmit buffer </h>
+                            *   <o.15..0> Right channel
+                            *   <o.31..16> Left channel
+                            */
+
+   /*!< Offset: 0x014 Receive Buffer        (R/ ) */
+  __I    uint32_t  RXBUF;  /* <h> Receive buffer </h>
+                            *   <o.15..0> Right channel
+                            *   <o.31..16> Left channel
+                            */
+         uint32_t  RESERVED1[186];
+  __IO uint32_t ITCR;        /* <h> Integration Test Control Register </h>
+                              *   <o.0> ITEN
+                              *     <0=> Normal operation
+                              *     <1=> Integration Test mode enable
+                              */
+  __O  uint32_t ITIP1;       /* <h> Integration Test Input Register 1</h>
+                              *   <o.0> SDIN
+                              */
+  __O  uint32_t ITOP1;       /* <h> Integration Test Output Register 1</h>
+                              *   <o.0> SDOUT
+                              *   <o.1> SCLK
+                              *   <o.2> LRCK
+                              *   <o.3> IRQOUT
+                              */
+} MPS3_I2S_TypeDef;
+
+#define I2S_CONTROL_TXEN_Pos        0
+#define I2S_CONTROL_TXEN_Msk        (1UL<<I2S_CONTROL_TXEN_Pos)
+
+#define I2S_CONTROL_TXIRQEN_Pos     1
+#define I2S_CONTROL_TXIRQEN_Msk     (1UL<<I2S_CONTROL_TXIRQEN_Pos)
+
+#define I2S_CONTROL_RXEN_Pos        2
+#define I2S_CONTROL_RXEN_Msk        (1UL<<I2S_CONTROL_RXEN_Pos)
+
+#define I2S_CONTROL_RXIRQEN_Pos     3
+#define I2S_CONTROL_RXIRQEN_Msk     (1UL<<I2S_CONTROL_RXIRQEN_Pos)
+
+#define I2S_CONTROL_TXWLVL_Pos      8
+#define I2S_CONTROL_TXWLVL_Msk      (7UL<<I2S_CONTROL_TXWLVL_Pos)
+
+#define I2S_CONTROL_RXWLVL_Pos      12
+#define I2S_CONTROL_RXWLVL_Msk      (7UL<<I2S_CONTROL_RXWLVL_Pos)
+/* FIFO reset. */
+#define I2S_CONTROL_FIFORST_Pos     16
+#define I2S_CONTROL_FIFORST_Msk     (1UL<<I2S_CONTROL_FIFORST_Pos)
+/* Codec reset. */
+#define I2S_CONTROL_CODECRST_Pos    17
+#define I2S_CONTROL_CODECRST_Msk    (1UL<<I2S_CONTROL_CODECRST_Pos)
+
+#define I2S_STATUS_TXIRQ_Pos        0
+#define I2S_STATUS_TXIRQ_Msk        (1UL<<I2S_STATUS_TXIRQ_Pos)
+
+#define I2S_STATUS_RXIRQ_Pos        1
+#define I2S_STATUS_RXIRQ_Msk        (1UL<<I2S_STATUS_RXIRQ_Pos)
+
+#define I2S_STATUS_TXEmpty_Pos      2
+#define I2S_STATUS_TXEmpty_Msk      (1UL<<I2S_STATUS_TXEmpty_Pos)
+
+#define I2S_STATUS_TXFull_Pos       3
+#define I2S_STATUS_TXFull_Msk       (1UL<<I2S_STATUS_TXFull_Pos)
+
+#define I2S_STATUS_RXEmpty_Pos      4
+#define I2S_STATUS_RXEmpty_Msk      (1UL<<I2S_STATUS_RXEmpty_Pos)
+
+#define I2S_STATUS_RXFull_Pos       5
+#define I2S_STATUS_RXFull_Msk       (1UL<<I2S_STATUS_RXFull_Pos)
+
+#define I2S_ERROR_TXERR_Pos         0
+#define I2S_ERROR_TXERR_Msk         (1UL<<I2S_ERROR_TXERR_Pos)
+
+#define I2S_ERROR_RXERR_Pos         1
+#define I2S_ERROR_RXERR_Msk         (1UL<<I2S_ERROR_RXERR_Pos)
+
+/******************************************************************************/
+/*                       SMSC9220 Register Definitions                        */
+/******************************************************************************/
+
+typedef struct                         /*   SMSC LAN9220                                  */
+{
+__I   uint32_t  RX_DATA_PORT;          /*   Receive FIFO Ports (offset 0x0).              */
+      uint32_t  RESERVED1[0x7];
+__O   uint32_t  TX_DATA_PORT;          /*   Transmit FIFO Ports (offset 0x20).            */
+      uint32_t  RESERVED2[0x7];
+
+__I   uint32_t  RX_STAT_PORT;          /*   Receive FIFO status port (offset 0x40).       */
+__I   uint32_t  RX_STAT_PEEK;          /*   Receive FIFO status peek (offset 0x44).       */
+__I   uint32_t  TX_STAT_PORT;          /*   Transmit FIFO status port (offset 0x48).      */
+__I   uint32_t  TX_STAT_PEEK;          /*   Transmit FIFO status peek (offset 0x4C).      */
+
+__I   uint32_t  ID_REV;                /*   Chip ID and Revision (offset 0x50).           */
+__IO  uint32_t  IRQ_CFG;               /*   Main Interrupt Configuration (offset 0x54).   */
+__IO  uint32_t  INT_STS;               /*   Interrupt Status (offset 0x58).               */
+__IO  uint32_t  INT_EN;                /*   Interrupt Enable Register (offset 0x5C).      */
+      uint32_t  RESERVED3;             /*   Reserved for future use (offset 0x60).        */
+__I   uint32_t  BYTE_TEST;             /*   Read-only byte order testing register 87654321h (offset 0x64). */
+__IO  uint32_t  FIFO_INT;              /*   FIFO Level Interrupts (offset 0x68).          */
+__IO  uint32_t  RX_CFG;                /*   Receive Configuration (offset 0x6C).          */
+__IO  uint32_t  TX_CFG;                /*   Transmit Configuration (offset 0x70).         */
+__IO  uint32_t  HW_CFG;                /*   Hardware Configuration (offset 0x74).         */
+__IO  uint32_t  RX_DP_CTL;             /*   RX Datapath Control (offset 0x78).            */
+__I   uint32_t  RX_FIFO_INF;           /*   Receive FIFO Information (offset 0x7C).       */
+__I   uint32_t  TX_FIFO_INF;           /*   Transmit FIFO Information (offset 0x80).      */
+__IO  uint32_t  PMT_CTRL;              /*   Power Management Control (offset 0x84).       */
+__IO  uint32_t  GPIO_CFG;              /*   General Purpose IO Configuration (offset 0x88). */
+__IO  uint32_t  GPT_CFG;               /*   General Purpose Timer Configuration (offset 0x8C). */
+__I   uint32_t  GPT_CNT;               /*   General Purpose Timer Count (offset 0x90).    */
+      uint32_t  RESERVED4;             /*   Reserved for future use (offset 0x94).        */
+__IO  uint32_t  ENDIAN;                /*   WORD SWAP Register (offset 0x98).             */
+__I   uint32_t  FREE_RUN;              /*   Free Run Counter (offset 0x9C).               */
+__I   uint32_t  RX_DROP;               /*   RX Dropped Frames Counter (offset 0xA0).      */
+__IO  uint32_t  MAC_CSR_CMD;           /*   MAC CSR Synchronizer Command (offset 0xA4).   */
+__IO  uint32_t  MAC_CSR_DATA;          /*   MAC CSR Synchronizer Data (offset 0xA8).      */
+__IO  uint32_t  AFC_CFG;               /*   Automatic Flow Control Configuration (offset 0xAC). */
+__IO  uint32_t  E2P_CMD;               /*   EEPROM Command (offset 0xB0).                 */
+__IO  uint32_t  E2P_DATA;              /*   EEPROM Data (offset 0xB4).                    */
+
+} SMSC9220_TypeDef;
+
+/* SMSC9220 MAC Registers       Indices. */
+#define SMSC9220_MAC_CR         0x1
+#define SMSC9220_MAC_ADDRH      0x2
+#define SMSC9220_MAC_ADDRL      0x3
+#define SMSC9220_MAC_HASHH      0x4
+#define SMSC9220_MAC_HASHL      0x5
+#define SMSC9220_MAC_MII_ACC    0x6
+#define SMSC9220_MAC_MII_DATA   0x7
+#define SMSC9220_MAC_FLOW       0x8
+#define SMSC9220_MAC_VLAN1      0x9
+#define SMSC9220_MAC_VLAN2      0xA
+#define SMSC9220_MAC_WUFF       0xB
+#define SMSC9220_MAC_WUCSR      0xC
+
+/* SMSC9220 PHY Registers       Indices. */
+#define SMSC9220_PHY_BCONTROL   0x0
+#define SMSC9220_PHY_BSTATUS    0x1
+#define SMSC9220_PHY_ID1        0x2
+#define SMSC9220_PHY_ID2        0x3
+#define SMSC9220_PHY_ANEG_ADV   0x4
+#define SMSC9220_PHY_ANEG_LPA   0x5
+#define SMSC9220_PHY_ANEG_EXP   0x6
+#define SMSC9220_PHY_MCONTROL   0x17
+#define SMSC9220_PHY_MSTATUS    0x18
+#define SMSC9220_PHY_CSINDICATE 0x27
+#define SMSC9220_PHY_INTSRC     0x29
+#define SMSC9220_PHY_INTMASK    0x30
+#define SMSC9220_PHY_CS         0x31
+
+/******************************************************************************/
+/*                         Peripheral declaration                             */
+/******************************************************************************/
+
+#define MPS3_TS_I2C             ((MPS3_I2C_TypeDef      *) MPS3_I2C0_BASE )
+#define MPS3_AAIC_I2C           ((MPS3_I2C_TypeDef      *) MPS3_I2C1_BASE )
+#define MPS3_CAM_I2C2           ((MPS3_I2C_TypeDef      *) MPS3_I2C2_BASE )
+#define MPS3_CAM_I2C3           ((MPS3_I2C_TypeDef      *) MPS3_I2C3_BASE )
+#define MPS3_AAIC_I2S           ((MPS3_I2S_TypeDef      *) MPS3_AAIC_I2S_BASE )
+#define MPS3_FPGAIO             ((MPS3_FPGAIO_TypeDef   *) MPS3_FPGAIO_BASE )
+#define MPS3_SCC                ((MPS3_SCC_TypeDef      *) MPS3_SCC_BASE )
+#define MPS3_SSP0               ((MPS3_SSP_TypeDef      *) MPS3_SSP0_BASE )
+#define MPS3_SSP1               ((MPS3_SSP_TypeDef      *) MPS3_SSP1_BASE )
+#define MPS3_SSP2               ((MPS3_SSP_TypeDef      *) MPS3_SSP2_BASE )
+#define MPS3_SSP3               ((MPS3_SSP_TypeDef      *) MPS3_SSP3_BASE )
+#define MPS3_SSP4               ((MPS3_SSP_TypeDef      *) MPS3_SSP4_BASE )
+#define SMSC9220                ((SMSC9220_TypeDef      *) SMSC9220_BASE)
+
+/******************************************************************************/
+/*                      Secure Peripheral declaration                         */
+/******************************************************************************/
+
+#define SEC_TS_I2C             ((MPS3_I2C_TypeDef      *) SEC_MPS3_I2C0_BASE )
+#define SEC_AAIC_I2C           ((MPS3_I2C_TypeDef      *) SEC_MPS3_I2C1_BASE )
+#define SEC_AAIC_I2S           ((MPS3_I2S_TypeDef      *) SEC_MPS3_AAIC_I2S_BASE )
+#define SEC_FPGAIO             ((MPS3_FPGAIO_TypeDef   *) SEC_MPS3_FPGAIO_BASE )
+#define SEC_SCC                ((MPS3_SCC_TypeDef      *) SEC_MPS3_SCC_BASE )
+#define SEC_SSP0               ((MPS3_SSP_TypeDef      *) SEC_SSP0_BASE )
+#define SEC_SSP1               ((MPS3_SSP_TypeDef      *) SEC_SSP1_BASE )
+#define SEC_SSP2               ((MPS3_SSP_TypeDef      *) SEC_MPS3_SSP2_BASE )
+#define SEC_SMSC9220           ((SMSC9220_TypeDef      *) SEC_SMSC9220_BASE)
+
+#endif /* SMM_MPS3_H */
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/include/timer_mps3.h b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/include/timer_mps3.h
new file mode 100644
index 0000000..14d64e5
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/include/timer_mps3.h
@@ -0,0 +1,86 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef TIMER_MPS3_H
+#define TIMER_MPS3_H
+
+#include <stdint.h>
+#include <time.h>
+
+/* Container for timestamp up-counters. */
+typedef struct _mps3_time_counter {
+    uint32_t    counter_1Hz;
+    uint32_t    counter_100Hz;
+
+    /* Running at FPGA clock rate. See GetMPS3CoreClock(). */
+    uint32_t    counter_fpga;
+
+    /* Running at processor core's internal clock rate, triggered by SysTick. */
+    uint64_t    counter_systick;
+} mps3_time_counter;
+
+/**
+ * @brief   Resets the counters.
+ */
+void timer_reset(void);
+
+/**
+ * @brief   Gets the current counter values.
+ * @returns Mps3 timer counter.
+ **/
+mps3_time_counter get_time_counter(void);
+
+/**
+ * @brief       Gets the duration elapsed between two counters in milliseconds.
+ * @param[in]   start   Pointer to mps3_time_counter value at start time.
+ * @param[in]   end     Pointer to mps3_time_counter value at end.
+ * @returns     Difference in milliseconds between the two give counters 
+ *              expressed as an unsigned integer.
+ **/
+uint32_t get_duration_milliseconds(mps3_time_counter *start,
+                                   mps3_time_counter *end);
+
+/**
+ * @brief       Gets the duration elapsed between two counters in microseconds.
+ * @param[in]   start   Pointer to mps3_time_counter value at start time.
+ * @param[in]   end     Pointer to mps3_time_counter value at end.
+ * @returns     Difference in microseconds between the two give counters 
+ *              expressed as an unsigned integer.
+ **/
+uint32_t get_duration_microseconds(mps3_time_counter *start,
+                                   mps3_time_counter *end);
+
+/**
+ * @brief       Gets the cycle counts elapsed between start and end.
+ * @param[in]   start   Pointer to mps3_time_counter value at start time.
+ * @param[in]   end     Pointer to mps3_time_counter value at end.
+ * @return      Difference in counter values as 32 bit unsigned integer.
+ **/
+uint64_t get_cycle_count_diff(mps3_time_counter *start,
+                              mps3_time_counter *end);
+
+/**
+ * @brief   Enables or triggers cycle counting mechanism, if required
+ *          by the platform.
+ **/
+void start_cycle_counter(void);
+
+/**
+ * @brief   Stops cycle counting mechanism, if required by the platform.
+ **/
+void stop_cycle_counter(void);
+
+#endif /* TIMER_MPS3_H */
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/timer_mps3.c b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/timer_mps3.c
new file mode 100644
index 0000000..0a3a8b1
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/timer_mps3.c
@@ -0,0 +1,112 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "timer_mps3.h"
+
+#include "bsp_core_log.h"
+#include "device_mps3.h"
+
+void timer_reset(void)
+{
+    MPS3_FPGAIO->CLK1HZ   = 0;
+    MPS3_FPGAIO->CLK100HZ = 0;
+    MPS3_FPGAIO->COUNTER  = 0;
+
+    if (0 != Init_SysTick()) {
+        printf_err("Failed to initialise system tick config\n");
+    }
+    debug("system tick config ready\n");
+}
+
+mps3_time_counter get_time_counter(void)
+{
+    mps3_time_counter t = {
+        .counter_1Hz        = MPS3_FPGAIO->CLK1HZ,
+        .counter_100Hz      = MPS3_FPGAIO->CLK100HZ,
+        .counter_fpga       = MPS3_FPGAIO->COUNTER,
+        .counter_systick    = Get_SysTick_Cycle_Count()
+    };
+    debug("Timestamp:\
+        \n\tCounter 1 Hz:   %u\
+        \n\tCounter 100 Hz: %u\
+        \n\tCounter FPGA:   %u\
+        \n\tCounter CPU:    %llu\n",
+        t.counter_1Hz, t.counter_100Hz, t.counter_fpga, t.counter_systick);
+    return t;
+}
+
+/**
+ * Please note, that there are no checks for overflow in this function => if
+ * the time elapsed has been big (in days) this could happen and is currently
+ * not handled.
+ **/
+uint32_t get_duration_milliseconds(mps3_time_counter *start,
+                                   mps3_time_counter *end)
+{
+    uint32_t time_elapsed = 0;
+    if (end->counter_100Hz > start->counter_100Hz) {
+        time_elapsed = (end->counter_100Hz - start->counter_100Hz) * 10;
+    } else {
+        time_elapsed = (end->counter_1Hz - start->counter_1Hz) * 1000 +
+            ((0xFFFFFFFF - start->counter_100Hz) + end->counter_100Hz + 1) * 10;
+    }
+
+    /* If the time elapsed is less than 100ms, use microseconds count to be
+     * more precise */
+    if (time_elapsed < 100) {
+        debug("Using the microsecond function instead..\n");
+        return get_duration_microseconds(start, end)/1000;
+    }
+
+    return time_elapsed;
+}
+
+/**
+ * Like the microsecond counterpart, this function could return wrong results when
+ * the counter (MAINCLK) overflows. There are no overflow counters available.
+ **/
+uint32_t get_duration_microseconds(mps3_time_counter *start,
+                                   mps3_time_counter *end)
+{
+    const int divisor = GetMPS3CoreClock()/1000000;
+    uint32_t time_elapsed = 0;
+    if (end->counter_fpga > start->counter_fpga) {
+        time_elapsed = (end->counter_fpga - start->counter_fpga)/divisor;
+    } else {
+        time_elapsed = ((0xFFFFFFFF - end->counter_fpga)
+            + start->counter_fpga + 1)/divisor;
+    }
+    return time_elapsed;
+}
+
+uint64_t get_cycle_count_diff(mps3_time_counter *start,
+                              mps3_time_counter *end)
+{
+    if (start->counter_systick > end->counter_systick) {
+        warn("start > end; counter might have overflown\n");
+    }
+    return end->counter_systick - start->counter_systick;
+}
+
+void start_cycle_counter(void)
+{
+    /* Nothing to do for FPGA */
+}
+
+void stop_cycle_counter(void)
+{
+    /* Nothing to do for FPGA */
+}
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/uart_stdout.c b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/uart_stdout.c
new file mode 100644
index 0000000..1bf8291
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/uart_stdout.c
@@ -0,0 +1,132 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "uart_stdout.h"
+
+#include "device_mps3.h"
+
+#include <stdio.h>
+
+#define CNTLQ       0x11
+#define CNTLS       0x13
+#define DEL         0x7F
+#define BACKSPACE   0x08
+#define CR          0x0D
+#define LF          0x0A
+#define ESC         0x1B
+
+void UartStdOutInit(void)
+{
+    /* NOTE: SystemCoreClock should have been set before initialising UART. */
+    CMSDK_UART0->BAUDDIV = SystemCoreClock / 115200;   /* => (25 or 32 MHz) / (115200 bps). */
+    CMSDK_UART0->CTRL    = ((1ul <<  0) |              /* TX enable. */
+                            (1ul <<  1) );             /* RX enable. */
+    return;
+}
+
+unsigned char UartPutc(unsigned char my_ch)
+{
+    while ((CMSDK_UART0->STATE & 1)); /* Wait if Transmit Holding register is full. */
+
+    if (my_ch == '\n') {
+        CMSDK_UART0->DATA  = '\r';
+        while ((CMSDK_UART0->STATE & 1)); /* Wait if Transmit Holding register is full. */
+    }
+
+    CMSDK_UART0->DATA = my_ch; /* Write to transmit holding register. */
+    return (my_ch);
+}
+
+unsigned char UartGetc(void)
+{
+    unsigned char my_ch;
+    unsigned int  cnt;
+
+    /* Wait if Receive Holding register is empty. */
+    while (0 == (CMSDK_UART0->STATE & 2)) {
+        cnt = MPS3_FPGAIO->CLK100HZ / 50;
+        if (cnt & 0x8) {
+            MPS3_FPGAIO->LED = 0x01 << (cnt & 0x7);
+        }
+        else {
+            MPS3_FPGAIO->LED = 0x80 >> (cnt & 0x7);
+        }
+    }
+
+    my_ch = CMSDK_UART0->DATA;
+
+    /* Convert CR to LF. */
+    if(my_ch == '\r') {
+        my_ch = '\n';
+    }
+
+    return (my_ch);
+}
+
+bool GetLine(char *lp, unsigned int len)
+{
+    unsigned int cnt = 0;
+    char c;
+
+    do {
+        c = UartGetc ();
+        switch (c) {
+            case CNTLQ:                       /* Ignore Control S/Q.            */
+            case CNTLS:
+                break;
+
+            case BACKSPACE:
+            case DEL:
+                if (cnt == 0) {
+                    break;
+                }
+                cnt--;                         /* Decrement count.               */
+                lp--;                          /* Decrement line pointer.        */
+                UartPutc (0x08);               /* Echo backspace.                */
+                UartPutc (' ');
+                UartPutc (0x08);
+                fflush (stdout);
+                break;
+
+            case ESC:
+            case 0:
+                *lp = 0;                        /* ESC - stop editing line.       */
+                return false;
+
+            case CR:                            /* CR - done, stop editing line.  */
+                *lp = c;
+                lp++;                           /* Increment line pointer         */
+                cnt++;                          /* and count.                     */
+                c = LF;
+            default:
+                UartPutc (*lp = c);             /* Echo and store character.      */
+                fflush (stdout);
+                lp++;                           /* Increment line pointer         */
+                    cnt++;                      /* and count.                     */
+                break;
+        }
+    } while (cnt < len - 2  &&  c != LF);       /* Check limit and CR.            */
+    *lp = 0;                                    /* Mark end of string.            */
+
+    return true;
+}
+
+void UartEndSimulation(int code)
+{
+    UartPutc((char) 0x4);   /* End of simulation */
+    UartPutc((char) code);  /* End of simulation */
+    while(1);
+}
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-packs/simple_platform/include/stubs_fvp.h b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/simple_platform/include/stubs_fvp.h
new file mode 100644
index 0000000..a21f2d2
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/simple_platform/include/stubs_fvp.h
@@ -0,0 +1,124 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef BSP_PACK_FASTMODEL_H
+#define BSP_PACK_FASTMODEL_H
+
+#include "cmsis.h"                  /* device specific header file    */
+#include "peripheral_memmap.h"      /* peripheral memory map definitions */
+
+/****************************************************************************/
+/*              Definitions and stub functions for modules currently        */
+/*              unavailable on the model                                    */
+/****************************************************************************/
+#define GLCD_WIDTH      320
+#define GLCD_HEIGHT     240
+#define Black           0x0000      /*   0,   0,   0 */
+#define White           0xFFFF      /* 255, 255, 255 */
+
+/*********************** Clock related functions *****************************/
+uint32_t GetCoreClock(void);
+
+/************************  GLCD related functions ****************************/
+/**
+ * @brief      Initialize the Himax LCD with HX8347-D LCD Controller
+ * @return     none
+ */
+void GLCD_Initialize(void);
+
+/**
+ * @brief      Display graphical bitmap image at position x horizontally and y
+ *             vertically. This function is optimized for 16 bits per pixel
+ *             format, it has to be adapted for any other format.
+ * @param[in]  x        horizontal position.
+ * @param[in]  y        vertical position.
+ * @param[in]  w        width of bitmap.
+ * @param[in]  h        height of bitmap.
+ * @param[in]  bitmap   address at which the bitmap data resides.
+ * @return     none
+ */
+void GLCD_Bitmap(unsigned int x,  unsigned int y,
+                unsigned int w, unsigned int h,
+                unsigned short *bitmap);
+
+/**
+ * @brief Displays an 8 bit image, conversion to the LCD's
+ *        16 bit codec is done on the fly.
+ * @param[in] data      pointer to the full sized image data.
+ * @param[in] width     image width.
+ * @param[in] height    image height.
+ * @param[in] channels  number of channels in the image.
+ * @param[in] pos_x     start x position for the LCD.
+ * @param[in] pos_y     start y position for the LCD.
+ * @param[in] downsample_factor   factor by which the image
+ *                                is downsampled by.
+ * @return none
+ */
+void GLCD_Image(void *data, const uint32_t width,
+                const uint32_t height, const uint32_t channels,
+                const uint32_t pos_x, const uint32_t pos_y,
+                const uint32_t downsample_factor);
+
+/**
+ * @brief      Clear display
+ * @param[in]  color    display clearing color
+ * @return     none
+ */
+void GLCD_Clear(unsigned short color);
+
+/**
+ * @brief      Set foreground color
+ * @param[in]  color    foreground color
+ * @return     none
+ */
+void GLCD_SetTextColor(unsigned short color);
+
+/**
+ * @brief      Display character on given line
+ * @param[in]  ln    line number
+ * @param[in]  col   column number
+ * @param[in]  fi    font index (0 = 9x15)
+ * @param[in]  c     ASCII character
+ * @return     none
+ */
+void GLCD_DisplayChar(unsigned int ln, unsigned int col,
+                    unsigned char fi, unsigned char  c);
+
+/**
+ * @brief      Display string on given line
+ * @param[in]  ln    line number
+ * @param[in]  col   column number
+ * @param[in]  fi    font index (0 = 9x15)
+ * @param[in]  s     pointer to string
+ * @return     none
+ */
+void GLCD_DisplayString(unsigned int ln, unsigned int col,
+                        unsigned char fi, char *s);
+
+/**
+ * @brief      Draw box filled with color
+ * @param[in]  x        horizontal position
+ * @param[in]  y:       vertical position
+ * @param[in]  w:       window width in pixels
+ * @param[in]  h:       window height in pixels
+ * @param[in]  color    box color
+ * @return     none
+ */
+void GLCD_Box(unsigned int x, unsigned int y,
+            unsigned int w, unsigned int h,
+            unsigned short color);
+
+#endif /* BSP_PACK_FASTMODEL_H */
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-packs/simple_platform/include/timer_fvp.h b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/simple_platform/include/timer_fvp.h
new file mode 100644
index 0000000..c07a4eb
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/simple_platform/include/timer_fvp.h
@@ -0,0 +1,55 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef TIMER_FVP_H
+#define TIMER_FVP_H
+
+#include "stubs_fvp.h"
+
+/* Container for timestamp for fastmodel. */
+typedef struct _fvp_time_counter {
+    uint64_t    counter_systick;
+} fvp_time_counter;
+
+/**
+ * @brief   Resets the counters.
+ */
+void timer_reset(void);
+
+/**
+ * @brief   Gets the current counter values.
+ * @returns counter struct.
+ **/
+fvp_time_counter get_time_counter(void);
+
+/**
+ * @brief   Gets the cycle counts elapsed between start and end.
+ * @return  difference in counter values as 32 bit unsigned integer.
+ */
+uint64_t get_cycle_count_diff(fvp_time_counter *start, fvp_time_counter *end);
+
+/**
+ * @brief   Enables or triggers cycle counting mechanism, if required
+ *          by the platform.
+ */
+void start_cycle_counter(void);
+
+/**
+ * @brief   Stops cycle counting mechanism, if required by the platform.
+ */
+void stop_cycle_counter(void);
+
+#endif /* TIMER_FVP_H */
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-packs/simple_platform/stubs_fvp.c b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/simple_platform/stubs_fvp.c
new file mode 100644
index 0000000..e5b2969
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/simple_platform/stubs_fvp.c
@@ -0,0 +1,111 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "stubs_fvp.h"
+
+#include "bsp_core_log.h"
+
+uint32_t GetCoreClock(void)
+{
+    return 1;
+}
+
+void GLCD_Initialize(void) {}
+
+void GLCD_Bitmap(unsigned int x,  unsigned int y,
+    unsigned int w, unsigned int h, unsigned short *bitmap)
+{
+    UNUSED(x);
+    UNUSED(y);
+    UNUSED(w);
+    UNUSED(h);
+    UNUSED(bitmap);
+}
+
+void GLCD_Image(void *data, const uint32_t width, const uint32_t height,
+    const uint32_t channels, const uint32_t pos_x,
+    const uint32_t pos_y, const uint32_t downsample_factor)
+{
+    UNUSED(data);
+    UNUSED(pos_x);
+    UNUSED(pos_y);
+    UNUSED(width);
+    UNUSED(height);
+    UNUSED(channels);
+    UNUSED(downsample_factor);
+    debug("image display: (x, y, w, h) = (%u, %u, %u, %u)\n",
+        pos_x, pos_y, width, height);
+    debug("image display: channels = %u, downsample factor = %u\n",
+        channels, downsample_factor);
+}
+
+void GLCD_Clear(unsigned short color)
+{
+    UNUSED(color);
+}
+
+void GLCD_SetTextColor(unsigned short color)
+{
+    UNUSED(color);
+}
+
+void GLCD_DisplayChar (unsigned int ln, unsigned int col, unsigned char fi,
+    unsigned char c)
+{
+    UNUSED(ln);
+    UNUSED(col);
+    UNUSED(fi);
+    UNUSED(c);
+}
+
+void GLCD_DisplayString(unsigned int ln, unsigned int col, unsigned char fi,
+    char *s)
+{
+    UNUSED(ln);
+    UNUSED(col);
+    UNUSED(fi);
+    UNUSED(s);
+    debug("text display: %s\n", s);
+}
+
+void GLCD_Box(unsigned int x, unsigned int y, unsigned int w, unsigned int h,
+    unsigned short color)
+{
+    UNUSED(x);
+    UNUSED(y);
+    UNUSED(w);
+    UNUSED(h);
+    UNUSED(color);
+}
+
+void LED_Initialize(uint32_t port)
+{
+    UNUSED(port);
+}
+
+void LED_On(uint32_t num, uint32_t port)
+{
+    UNUSED(num);
+    UNUSED(port);
+    debug("LED %u ON\n", num);
+}
+
+void LED_Off(uint32_t num, uint32_t port)
+{
+    UNUSED(num);
+    UNUSED(port);
+    debug("LED %u OFF\n", num);
+}
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-packs/simple_platform/timer_fvp.c b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/simple_platform/timer_fvp.c
new file mode 100644
index 0000000..b7a7232
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/simple_platform/timer_fvp.c
@@ -0,0 +1,56 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "timer_fvp.h"
+
+#include "irqs.h"
+#include "bsp_core_log.h"
+
+fvp_time_counter get_time_counter(void)
+{
+    fvp_time_counter t = {
+        .counter_systick = Get_SysTick_Cycle_Count()
+    };
+    debug("counter_systick: %llu\n", t.counter_systick);
+    return t;
+}
+
+void timer_reset(void)
+{
+    if (0 != Init_SysTick()) {
+        printf_err("Failed to initialise system tick config\n");
+    }
+    debug("system tick config ready\n");
+}
+
+uint64_t get_cycle_count_diff(fvp_time_counter *start,
+                              fvp_time_counter *end)
+{
+    if (start->counter_systick > end->counter_systick) {
+        warn("start > end; counter might have overflown\n");
+    }
+    return end->counter_systick - start->counter_systick;
+}
+
+void start_cycle_counter(void)
+{
+    /* Add any custom requirement for this platform here */
+}
+
+void stop_cycle_counter(void)
+{
+    /* Add any custom requirement for this platform here */
+}
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-packs/simple_platform/uart_pl011.c b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/simple_platform/uart_pl011.c
new file mode 100644
index 0000000..5c1ee06
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/simple_platform/uart_pl011.c
@@ -0,0 +1,224 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "uart_stdout.h"
+#include "peripheral_memmap.h"      /* peripheral memory map definitions */
+
+#include <stdio.h>
+#include <stdint.h>
+
+#define CNTLQ       0x11
+#define CNTLS       0x13
+#define DEL         0x7F
+#define BACKSPACE   0x08
+#define CR          0x0D
+#define LF          0x0A
+#define ESC         0x1B
+
+#define UARTBASE    (PL011_UART0_BASE)
+
+/*****************************************************************************/
+/*  UART Control Register Locations                                          */
+/*****************************************************************************/
+#define UART0_DR   *((volatile unsigned *) UARTBASE)
+#define UART0_RSR  *((volatile unsigned *)(UARTBASE + 0x04))
+#define UART0_ECR  *((volatile unsigned *)(UARTBASE + 0x04))
+#define UART0_LCRH *((volatile unsigned *)(UARTBASE + 0x2C))
+#define UART0_LCRM *((volatile unsigned *)(UARTBASE + 0x28))
+#define UART0_LCRL *((volatile unsigned *)(UARTBASE + 0x24))
+#define UART0_CR   *((volatile unsigned *)(UARTBASE + 0x30))
+#define UART0_FR   *((volatile unsigned *)(UARTBASE + 0x18))
+#define UART0_IIR  *((volatile unsigned *)(UARTBASE + 0x1C))
+#define UART0_ICR  *((volatile unsigned *)(UARTBASE + 0x44))
+
+/*****************************************************************************/
+/* Received Status Register - RSR                                            */
+/*****************************************************************************/
+#define RSR_OVERRUN_ERROR   0x08
+#define RSR_BREAK_ERROR     0x04
+#define RSR_PARITY_ERROR    0x02
+#define RSR_FRAMING_ERROR   0x01
+
+/*****************************************************************************/
+/* Line Control High Byte Register - LCRH                                    */
+/*****************************************************************************/
+#define LCRH_WORD_LENGTH_8  0x60
+#define LCRH_WORD_LENGTH_7  0x40
+#define LCRH_WORD_LENGTH_6  0x20
+#define LCRH_WORD_LENGTH_5  0x00
+#define LCRH_FIFO_ENABLED   0x10
+#define LCRH_2_STOP_BITS    0x08
+#define LCRH_EVEN_PARITY    0x04
+#define LCRH_PARITY_ENABLE  0x02
+#define LCRH_SEND_BREAK     0x01
+
+/*****************************************************************************/
+/* Line Control Medium Byte Register - LCRM                                  */
+/* This register specifies the high byte of the Baud rate divisor            */
+/*****************************************************************************/
+#define LCRM_BAUD_460800  0x00
+#define LCRM_BAUD_230400  0x00
+#define LCRM_BAUD_115200  0x00
+#define LCRM_BAUD_76800   0x00
+#define LCRM_BAUD_57600   0x00
+#define LCRM_BAUD_38400   0x00
+#define LCRM_BAUD_19200   0x00
+#define LCRM_BAUD_14400   0x00
+#define LCRM_BAUD_9600    0x00
+#define LCRM_BAUD_2400    0x01
+#define LCRM_BAUD_1200    0x02
+
+/*****************************************************************************/
+/* Line Control Low Byte Register - LCRL                                     */
+/* This register specifies the low byte of the Baud rate divisor             */
+/*****************************************************************************/
+#define LCRL_BAUD_460800  0x01
+#define LCRL_BAUD_230400  0x03
+#define LCRL_BAUD_115200  0x07
+#define LCRL_BAUD_76800   0x0B
+#define LCRL_BAUD_57600   0x0F
+#define LCRL_BAUD_38400   0xC
+#define LCRL_BAUD_19200   0x2F
+#define LCRL_BAUD_14400   0x3F
+#define LCRL_BAUD_9600    0x5F
+#define LCRL_BAUD_2400    0x7F
+#define LCRL_BAUD_1200    0xFF
+
+/*****************************************************************************/
+/* Control Register - CR                                                     */
+/*****************************************************************************/
+#define CR_LOOP_BACK_EN   0x80
+#define CR_TIMEOUT_INT_EN 0x40
+#define CR_TX_INT_ENABLE  0x100
+#define CR_RX_INT_ENABLE  0x200
+#define CR_MODSTAT_INT_EN 0x08
+#define CR_UART_ENABLE    0x01
+
+/*****************************************************************************/
+/* Flag Register - FR                                                        */
+/*****************************************************************************/
+#define FR_TX_FIFO_EMPTY  0x80
+#define FR_RX_FIFO_FULL   0x40
+#define FR_TX_FIFO_FULL   0x20
+#define FR_RX_FIFO_EMPTY  0x10
+#define FR_BUSY           0x08
+#define FR_CARRIER_DETECT 0x04
+#define FR_SET_READY      0x02
+#define FR_CLEAR_TO_SEND  0x01
+
+/*****************************************************************************/
+/* Interrupt Identification Register - IIR                                   */
+/*****************************************************************************/
+#define IIR_RX_TIME_OUT   0x08
+#define IIR_TX            0x04
+#define IIR_RX            0x02
+#define IIR_MODEM         0x01
+
+void UartStdOutInit(void)
+{
+    /* Disable the serial port while setting the baud rate and word length. */
+    UART0_CR = 0;
+
+    /* Clear the receive status register. */
+    UART0_ECR = 0;
+
+    /* Set the correct baud rate and word length. */
+    UART0_LCRL = LCRL_BAUD_115200;
+    UART0_LCRM = LCRM_BAUD_115200;
+    UART0_LCRH = LCRH_WORD_LENGTH_8;
+
+    /* Explicitly disable FIFO's for char mode. */
+    UART0_LCRH &= ~LCRH_FIFO_ENABLED;
+
+    /* Enable UART0 (and RX/TX) without interrupts. */
+    UART0_CR = CR_UART_ENABLE | CR_TX_INT_ENABLE | CR_RX_INT_ENABLE;
+}
+
+unsigned char UartPutc(unsigned char ch)
+{
+    if (ch == '\n') {
+        (void) UartPutc('\r');
+    }
+    while (UART0_FR & FR_TX_FIFO_FULL)
+        ;
+    UART0_DR = ch;
+
+    return ch;
+}
+
+unsigned char UartGetc(void)
+{
+    unsigned char c;
+    while (UART0_FR & FR_RX_FIFO_EMPTY)
+        ;
+    c = UART0_DR;
+    if (c == '\r') {
+        c = '\n';
+    }
+
+    return c;
+}
+
+bool GetLine (char *lp, unsigned int len)
+{
+    unsigned int cnt = 0;
+    char c;
+
+    do {
+        c = UartGetc();
+        switch (c) {
+            case CNTLQ:                       /* ignore Control S/Q.            */
+            case CNTLS:
+                break;
+            case BACKSPACE:
+            case DEL:
+                if (cnt == 0) {
+                    break;
+                }
+                cnt--;                         /* decrement count.               */
+                lp--;                          /* and line pointer.              */
+                UartPutc (0x08);               /* echo backspace.                */
+                UartPutc (' ');
+                UartPutc (0x08);
+                fflush (stdout);
+                break;
+            case ESC:
+            case 0:
+                *lp = 0;                       /* ESC - stop editing line.       */
+                return false;
+            case CR:                           /* CR - done, stop editing line.  */
+                *lp = c;
+                lp++;                          /* increment line pointer.        */
+                cnt++;                         /* and count.                     */
+                c = LF;
+            default:
+                UartPutc (*lp = c);            /* echo and store character.      */
+                fflush (stdout);
+                lp++;                          /* increment line pointer.        */
+                cnt++;                         /* and count.                     */
+                break;
+        }
+    } while (cnt < len - 2  &&  c != LF);      /* check limit and CR.            */
+    *lp = 0;                                   /* mark end of string.            */
+    return true;
+}
+
+__attribute__((noreturn)) void UartEndSimulation(int code)
+{
+    UartPutc((char) 0x4);  // End of simulation
+    UartPutc((char) code); // Exit code
+    while(1);
+}
diff --git a/source/application/hal/platforms/bare-metal/bsp/cmsis-device/cmsis.c b/source/application/hal/platforms/bare-metal/bsp/cmsis-device/cmsis.c
new file mode 100644
index 0000000..c9cf53d
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/cmsis-device/cmsis.c
@@ -0,0 +1,122 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "cmsis.h"
+
+extern void *__Vectors;                   /* see irqs.c */
+
+/*----------------------------------------------------------------------------*\
+ *                        Define clocks (uses OSC1 ACLK)                      *
+\*----------------------------------------------------------------------------*/
+#define __XTAL            (25000000)      /* Oscillator frequency             */
+#define __SYSTEM_CLOCK    (__XTAL)
+
+#define STR(x) #x
+#define RESET_REG(n) __ASM volatile("MOV " STR(r##n) ", #0" : : : STR(r##n))
+
+#if defined(CPU_CORTEX_M55)
+#define CCR_DL   (1 << 19)
+#else
+#error  "Invalid CPU; This file only services Cortex-M55 CPUs"
+#endif /* (CPU_CORTEX_M55) */
+
+/*----------------------------------------------------------------------------
+  System Core Clock Variable (Core Clock)
+ *----------------------------------------------------------------------------*/
+uint32_t SystemCoreClock = __SYSTEM_CLOCK;
+
+
+/*----------------------------------------------------------------------------
+  Clock functions
+ *----------------------------------------------------------------------------*/
+/**
+ * @brief  Updates the SystemCoreClock variable with current core Clock
+ *         retrieved from cpu registers.
+ */
+void SystemCoreClockUpdate(void)
+{
+    /* Update the SystemCoreClock variable */
+    SystemCoreClock = __SYSTEM_CLOCK;
+}
+
+uint32_t GetSystemCoreClock(void)
+{
+    return SystemCoreClock;
+}
+
+/**
+ * @brief  Setup the microcontroller system.
+ *         Initialize the System.
+ **/
+void SystemInit(void)
+{
+#if (defined (__FPU_USED) && (__FPU_USED == 1U)) || \
+    (defined (__MVE_USED) && (__MVE_USED == 1U))
+  SCB->CPACR |= ((3U << 10U*2U) |   /* enable CP10 Full Access */
+                 (3U << 11U*2U) );
+#endif
+
+    /* Initialise registers r0-r12 and LR(=r14)
+     * They must have a valid value before being potentially pushed to stack by
+     * C calling convention or by context saving in exception handling
+     */
+    RESET_REG(0);
+    RESET_REG(1);
+    RESET_REG(2);
+    RESET_REG(3);
+    RESET_REG(4);
+    RESET_REG(5);
+    RESET_REG(6);
+    RESET_REG(7);
+    RESET_REG(8);
+    RESET_REG(9);
+    RESET_REG(10);
+    RESET_REG(11);
+    RESET_REG(12);
+    RESET_REG(14);
+
+#if defined (__VTOR_PRESENT) && (__VTOR_PRESENT == 1U)
+  SCB->VTOR = (uint32_t) &__Vectors;
+#endif
+
+    /* Enable hard, bus, mem and usage fault detection in SHCSR, bits 16-18.
+     * Enable stkof, bf, div_0_trp, unalign_trp and usersetm bits in CCR.
+     */
+    SCB->SHCSR = (
+        _VAL2FLD(SCB_SHCSR_USGFAULTENA, 1) |
+        _VAL2FLD(SCB_SHCSR_BUSFAULTENA, 1) |
+        _VAL2FLD(SCB_SHCSR_MEMFAULTENA, 1));
+
+    SCB->CCR = (_VAL2FLD(SCB_CCR_USERSETMPEND, 1) |
+                _VAL2FLD(SCB_CCR_DIV_0_TRP, 1)    |
+                _VAL2FLD(SCB_CCR_BFHFNMIGN, 1)    |
+                _VAL2FLD(SCB_CCR_STKOFHFNMIGN, 1));
+#ifdef UNALIGNED_SUPPORT_DISABLE
+    SCB->CCR |= _VAL2FLD(SCB_CCR_UNALIGN_TRP, 1);
+#endif
+
+    SCB->CCR |= CCR_DL;
+
+  /* Reset pipeline. */
+  __DSB();
+  __ISB();
+
+#ifdef UNALIGNED_SUPPORT_DISABLE
+  SCB->CCR |= SCB_CCR_UNALIGN_TRP_Msk;
+#endif
+
+  SystemCoreClock = __SYSTEM_CLOCK;
+}
diff --git a/source/application/hal/platforms/bare-metal/bsp/cmsis-device/include/cmsis.h b/source/application/hal/platforms/bare-metal/bsp/cmsis-device/include/cmsis.h
new file mode 100644
index 0000000..969db15
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/cmsis-device/include/cmsis.h
@@ -0,0 +1,31 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef BAREMETAL_CMSIS_H
+#define BAREMETAL_CMSIS_H
+
+#include "ARMCM55.h"  /* Cortex M system header file from CMSIS. */
+#include "irqs.h"     /* Interrupt definitions file. */
+
+/* Addition to template functions should be mentioned here. */
+
+/**
+ * @brief   Gets the internal processor clock.
+ * @return  Clock frequency as unsigned 32 bit value.
+ **/
+uint32_t GetSystemCoreClock(void);
+
+#endif  /* BAREMETAL_CMSIS_H */
diff --git a/source/application/hal/platforms/bare-metal/bsp/cmsis-device/include/irqs.h b/source/application/hal/platforms/bare-metal/bsp/cmsis-device/include/irqs.h
new file mode 100644
index 0000000..0d8dec6
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/cmsis-device/include/irqs.h
@@ -0,0 +1,54 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef IRQS_H
+#define IRQS_H
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+#include "peripheral_irqs.h"
+
+#include <stdint.h>
+
+/* Interrupt handler function type. */
+typedef void (*const irq_vec_type)(void);
+
+/**
+ *  @brief  Reset interrupt handler and also, the starting
+ *          point of the application.
+ **/
+extern void Reset_Handler(void);
+
+/**
+ * @brief   Gets the system tick triggered cycle counter for the CPU.
+ * @return  64-bit counter value.
+ **/
+extern uint64_t Get_SysTick_Cycle_Count(void);
+
+/**
+ * @brief   Initialises the system tick registers.
+ * @return  Error code return from sys tick configuration function
+ *          (0 = no error).
+ **/
+extern int Init_SysTick(void);
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif /* IRQS_H */
diff --git a/source/application/hal/platforms/bare-metal/bsp/cmsis-device/irqs.c b/source/application/hal/platforms/bare-metal/bsp/cmsis-device/irqs.c
new file mode 100644
index 0000000..c6f54b1
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/cmsis-device/irqs.c
@@ -0,0 +1,261 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifdef __cplusplus
+extern "C"
+{
+#endif
+
+#include "irqs.h"
+#include "cmsis.h"
+
+#include <stdio.h>
+
+static uint64_t cpu_cycle_count = 0;
+
+/**
+ * @brief   Dump core registers on stdout
+ */
+static void LogCoreCPURegisters(void)
+{
+    printf("CTRL    : 0x%08x\n", __get_CONTROL());
+    printf("IPSR    : 0x%08x\n", __get_IPSR());
+    printf("APSR    : 0x%08x\n", __get_APSR());
+    printf("xPSR    : 0x%08x\n", __get_xPSR());
+    printf("PSP     : 0x%08x\n", __get_PSP());
+    printf("MSP     : 0x%08x\n", __get_MSP());
+    printf("PRIMASK : 0x%08x\n", __get_PRIMASK());
+    printf("BASEPRI : 0x%08x\n", __get_BASEPRI());
+    printf("FAULTMSK: 0x%08x\n", __get_FAULTMASK());
+    printf("PC      : 0x%08x\n", __current_pc());
+}
+
+/**
+ * @brief   Default interrupt handler - an infinite loop.
+ **/
+__attribute__((noreturn)) static void DefaultHandler(void)
+{
+    LogCoreCPURegisters();
+    while (1) {
+        /* Without the following line, armclang may optimize away the
+         * infinite loop because it'd be without side effects and thus
+         * undefined behaviour. */
+        __ASM volatile("");
+    }
+}
+
+#define DEFAULT_HANDLER_CALL(type)              \
+    do {                                        \
+        printf("\n%s caught by function %s\n",  \
+             type, __FUNCTION__);               \
+        DefaultHandler();                       \
+    } while (0)
+
+#define DEFAULT_ERROR_HANDLER_CALL()            \
+            DEFAULT_HANDLER_CALL("Exception")
+
+#define DEFAULT_IRQ_HANDLER_CALL()              \
+            DEFAULT_HANDLER_CALL("Interrupt")
+
+/**
+ * Dummy Exception Handlers for core interrupts.
+ *
+ * Weak definitions provided to be used if the user chooses not
+ * to override them.
+ **/
+
+/**
+ * @brief  Non maskable interrupt handler.
+ **/
+ __attribute__((weak)) void NMI_Handler(void)
+{
+    DEFAULT_ERROR_HANDLER_CALL();
+}
+
+/**
+ * @brief  Hardfault interrupt handler.
+ **/
+ __attribute__((weak)) void HardFault_Handler(void)
+{
+    DEFAULT_ERROR_HANDLER_CALL();
+}
+
+/**
+ * @brief  Memory management interrupt handler.
+ **/
+__attribute__((weak)) void MemManage_Handler(void)
+{
+    DEFAULT_IRQ_HANDLER_CALL();
+}
+
+/**
+ * @brief  Bus fault interrupt handler.
+ **/
+__attribute__((weak)) void BusFault_Handler(void)
+{
+    DEFAULT_ERROR_HANDLER_CALL();
+}
+
+/**
+ * @brief  Usage fault interrupt handler.
+ **/
+__attribute__((weak)) void UsageFault_Handler(void)
+{
+    DEFAULT_ERROR_HANDLER_CALL();
+}
+
+/**
+ * @brief  Secure access fault interrupt handler.
+ **/
+__attribute__((weak)) void SecureFault_Handler(void)
+{
+    DEFAULT_ERROR_HANDLER_CALL();
+}
+
+/**
+ * @brief  Supervisor call interrupt handler.
+ **/
+__attribute__((weak)) void SVC_Handler(void)
+{
+    DEFAULT_IRQ_HANDLER_CALL();
+}
+
+/**
+ * @brief  Debug monitor interrupt handler.
+ **/
+__attribute__((weak)) void DebugMon_Handler(void)
+{
+    DEFAULT_IRQ_HANDLER_CALL();
+}
+
+/**
+ * @brief  Pending SV call interrupt handler.
+ */
+__attribute__((weak)) void PendSV_Handler(void)
+{
+    DEFAULT_IRQ_HANDLER_CALL();
+}
+
+/**
+ * @brief   System tick interrupt handler.
+ **/
+void SysTick_Handler(void)
+{
+    /* Increment the cycle counter based on load value. */
+    cpu_cycle_count += SysTick->LOAD + 1;
+}
+
+uint64_t Get_SysTick_Cycle_Count(void)
+{
+    uint32_t systick_val;
+
+    NVIC_DisableIRQ(SysTick_IRQn);
+    systick_val = SysTick->VAL & SysTick_VAL_CURRENT_Msk;
+    NVIC_EnableIRQ(SysTick_IRQn);
+
+    return cpu_cycle_count + (SysTick->LOAD - systick_val);
+}
+
+
+/**
+ * These symbols are provided by the ARM lib - needs the stack and heap
+ * regions in the scatter file.
+ */
+extern void Image$$ARM_LIB_STACK$$ZI$$Base();
+extern void Image$$ARM_LIB_STACK$$ZI$$Limit();
+extern void Image$$ARM_LIB_HEAP$$ZI$$Base();
+extern void Image$$ARM_LIB_HEAP$$ZI$$Limit();
+extern __attribute__((noreturn)) void __main();
+
+__attribute__((naked, used)) void __user_setup_stackheap()
+{
+    __ASM volatile("LDR  r0, =Image$$ARM_LIB_HEAP$$ZI$$Base");
+    __ASM volatile("LDR  r1, =Image$$ARM_LIB_STACK$$ZI$$Limit");
+    __ASM volatile("LDR  r2, =Image$$ARM_LIB_HEAP$$ZI$$Limit");
+    __ASM volatile("LDR  r3, =Image$$ARM_LIB_STACK$$ZI$$Base");
+    __ASM volatile("bx   lr");
+}
+
+/**
+ * Interrupt vector table.
+ */
+irq_vec_type __Vectors[] __attribute__((section("RESET"), used)) = {
+    &Image$$ARM_LIB_STACK$$ZI$$Limit,  /* 0 Initial SP */
+    &Reset_Handler      , /* 1 Initial PC, set to entry point */
+
+    &NMI_Handler        , /* 2 (-14) NMI Handler            */
+    &HardFault_Handler  , /* 3 (-13) Hard Fault Handler     */
+    &MemManage_Handler  , /* 4 (-12) MPU Fault Handler      */
+    &BusFault_Handler   , /* 5 (-11) Bus Fault Handler      */
+    &UsageFault_Handler , /* 6 (-10) Usage Fault Handler    */
+    &SecureFault_Handler, /* 7 ( -9) Secure Fault Handler   */
+    0                   , /* 8 ( -8) Reserved               */
+    0                   , /* 9 ( -7) Reserved               */
+    0                   , /* 10 ( -6) Reserved              */
+    &SVC_Handler        , /* 11 ( -5) SVCall Handler        */
+    &DebugMon_Handler   , /* 12 ( -4) Debug Monitor Handler */
+    0                   , /* 13 ( -3) Reserved              */
+    &PendSV_Handler     , /* 14 ( -2) PendSV Handler        */
+    &SysTick_Handler    , /* 15 ( -1) SysTick Handler       */
+
+    /* External sources to be populated by user. */
+    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, /*   0 -  16 */
+    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, /*  16 -  32 */
+    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, /*  32 -  48 */
+    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, /*  48 -  64 */
+    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, /*  64 -  80 */
+    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, /*  80 -  96 */
+    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, /*  96 -  112 */
+    0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, /* 112 -  128 */
+};
+
+int Init_SysTick(void)
+{
+    const uint32_t ticks_10ms = GetSystemCoreClock()/100 + 1;
+    int err = 0;
+
+    /* Reset CPU cycle count value. */
+    cpu_cycle_count = 0;
+
+    /* Changing configuration for sys tick => guard from being
+     * interrupted. */
+    NVIC_DisableIRQ(SysTick_IRQn);
+
+    /* SysTick init - this will enable interrupt too. */
+    err = SysTick_Config(ticks_10ms);
+
+    /* Enable interrupt again. */
+    NVIC_EnableIRQ(SysTick_IRQn);
+
+    return err;
+}
+
+/* Reset handler - starting point of our application. */
+__attribute__((used)) void Reset_Handler(void)
+{
+    /* Initialise system. */
+    SystemInit();
+
+    /* Configure the system tick. */
+    Init_SysTick();
+
+    /* libcxx supplied entry point. */
+    __main();
+}
+
+#ifdef __cplusplus
+}
+#endif
diff --git a/source/application/hal/platforms/bare-metal/bsp/include/bsp.h b/source/application/hal/platforms/bare-metal/bsp/include/bsp.h
new file mode 100644
index 0000000..fbe1ff6
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/include/bsp.h
@@ -0,0 +1,38 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef BSP_H
+#define BSP_H
+
+/* Core modules - these are common */
+#include "bsp_core_log.h"   /* Logging related helpers. */
+#include "uart_stdout.h"    /* stdout over UART. */
+
+#if defined(MPS3_PLATFORM) /* If running on MPS3 platform. */
+
+#include "smm_mps3.h"       /* Mem map for MPS3 peripherals. */
+#include "glcd_mps3.h"      /* LCD functions. */
+#include "timer_mps3.h"     /* Timer functions. */
+#include "device_mps3.h"    /* FPGA level definitions and functions. */
+
+#else /* MPS3_PLATFORM */
+
+#include "stubs_fvp.h"      /* Stubs for FVP. */
+#include "timer_fvp.h"      /* Timer API for FVP. */
+
+#endif /* MPS3_PLATFORM */
+
+#endif /* BSP_H */
diff --git a/source/application/hal/platforms/bare-metal/bsp/mem_layout/mps3-sse-200.sct b/source/application/hal/platforms/bare-metal/bsp/mem_layout/mps3-sse-200.sct
new file mode 100644
index 0000000..293193e
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/mem_layout/mps3-sse-200.sct
@@ -0,0 +1,102 @@
+;  Copyright (c) 2021 Arm Limited. All rights reserved.
+;  SPDX-License-Identifier: Apache-2.0
+;
+;  Licensed under the Apache License, Version 2.0 (the "License");
+;  you may not use this file except in compliance with the License.
+;  You may obtain a copy of the License at
+;
+;      http://www.apache.org/licenses/LICENSE-2.0
+;
+;  Unless required by applicable law or agreed to in writing, software
+;  distributed under the License is distributed on an "AS IS" BASIS,
+;  WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+;  See the License for the specific language governing permissions and
+;  limitations under the License.
+
+; *************************************************************
+; ***       Scatter-Loading Description File                ***
+; *************************************************************
+;
+; Sections used:
+;---------------------------------------------------------
+; |    Start    |      End    |    Size     |   Remarks  |
+;-|-------------|-------------|-------------|------------|
+; | 0x0000_0000 | 0x0010_0000 | 0x0010_0000 | ITCM (RO)  |
+; | 0x0010_0000 | 0x0030_0000 | 0x0020_0000 | BRAM (RW)  |
+; | 0x2000_0000 | 0x2040_0000 | 0x0040_0000 | DTCM (RW)  |
+; | 0x6000_0000 | 0x6200_0000 | 0x0200_0000 | DRAM (RW)  |
+;-|-------------|-------------|-------------|------------|
+; ITCM is aliased at 0x1000_0000 (single bank)
+; BRAM is aliased at 0x1010_0000
+; DTCM is aliased at 0x3000_0000 (four banks of 1MiB each)
+; DRAM is aliased at 0x7000_0000 (section is 256MiB)
+;
+; Note: Ethos-U55 can only access DRAM and BRAM sections
+;---------------------------------------------------------
+; First load region
+;---------------------------------------------------------
+LOAD_REGION_0       0x00000000                  0x00100000
+{
+    ;-----------------------------------------------------
+    ; First part of code mem - 1MiB
+    ;-----------------------------------------------------
+    itcm.bin        0x00000000                  0x00100000
+    {
+        *.o (RESET, +First)
+        * (InRoot$$Sections)
+        .ANY (+RO)
+    }
+
+    ;-----------------------------------------------------
+    ; Code memory's 2MiB - reserved for activation buffers
+    ; Make sure this is uninitialised.
+    ;-----------------------------------------------------
+    bram.bin        0x00100000  UNINIT          0x00200000
+    {
+        ; activation buffers a.k.a tensor arena
+        *.o (.bss.NoInit.activation_buf)
+    }
+
+    ;-----------------------------------------------------
+    ; 1MiB bank is used for any other RW or ZI data
+    ; Note: this region is internal to the Cortex-M CPU
+    ;-----------------------------------------------------
+    dtcm.bin        0x20000000                  0x00100000
+    {
+        .ANY(+RW +ZI)
+    }
+
+    ;-----------------------------------------------------
+    ; 128kiB of stack space within SRAM region
+    ;-----------------------------------------------------
+    ARM_LIB_STACK   0x20100000 EMPTY ALIGN 8    0x00020000
+    {}
+
+    ;-----------------------------------------------------
+    ; 2MiB of heap space within the SRAM region
+    ;-----------------------------------------------------
+    ARM_LIB_HEAP    0x20200000 EMPTY ALIGN 8    0x00200000
+    {}
+}
+
+;---------------------------------------------------------
+; Second load region
+;---------------------------------------------------------
+LOAD_REGION_1       0x60000000                  0x02000000
+{
+    ;-----------------------------------------------------
+    ; 32 MiB of DRAM space for nn model and input vectors
+    ;-----------------------------------------------------
+    dram.bin        0x60000000                  0x02000000
+    {
+        ; nn model's baked in input matrices
+        *.o (ifm)
+
+        ; nn model
+        *.o (nn_model)
+
+        ; if the activation buffer (tensor arena) doesn't
+        ; fit in the SRAM region, we accommodate it here
+        *.o (activation_buf)
+    }
+}
diff --git a/source/application/hal/platforms/bare-metal/bsp/mem_layout/mps3-sse-300.sct b/source/application/hal/platforms/bare-metal/bsp/mem_layout/mps3-sse-300.sct
new file mode 100644
index 0000000..327d511
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/mem_layout/mps3-sse-300.sct
@@ -0,0 +1,118 @@
+;  Copyright (c) 2021 Arm Limited. All rights reserved.
+;  SPDX-License-Identifier: Apache-2.0
+;
+;  Licensed under the Apache License, Version 2.0 (the "License");
+;  you may not use this file except in compliance with the License.
+;  You may obtain a copy of the License at
+;
+;      http://www.apache.org/licenses/LICENSE-2.0
+;
+;  Unless required by applicable law or agreed to in writing, software
+;  distributed under the License is distributed on an "AS IS" BASIS,
+;  WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+;  See the License for the specific language governing permissions and
+;  limitations under the License.
+
+; *************************************************************
+; ***       Scatter-Loading Description File                ***
+; *************************************************************
+; Please see docs/sections/appendix.md for memory mapping information.
+;
+; Note: Ethos-U55 can access BRAM, internal SRAM and the DDR sections => activation buffers and
+;       the model should only be placed in those regions.
+;
+;---------------------------------------------------------
+; First load region (ITCM)
+;---------------------------------------------------------
+LOAD_REGION_0       0x00000000                  0x00080000
+{
+    ;-----------------------------------------------------
+    ; First part of code mem - 512kiB
+    ;-----------------------------------------------------
+    itcm.bin        0x00000000                  0x00080000
+    {
+        *.o (RESET, +First)
+        * (InRoot$$Sections)
+
+        ; Essentially only RO-CODE, RO-DATA is in a
+        ; different region.
+        .ANY (+RO)
+    }
+
+    ;-----------------------------------------------------
+    ; 128kiB of 512kiB DTCM is used for any other RW or ZI
+    ; data. Note: this region is internal to the Cortex-M
+    ; CPU.
+    ;-----------------------------------------------------
+    dtcm.bin        0x20000000                  0x00020000
+    {
+        ; Any R/W and/or zero initialised data
+        .ANY(+RW +ZI)
+    }
+
+    ;-----------------------------------------------------
+    ; 384kiB of stack space within the DTCM region. See
+    ; `dtcm.bin` for the first section. Note: by virtue of
+    ; being part of DTCM, this region is only accessible
+    ; from Cortex-M55.
+    ;-----------------------------------------------------
+    ARM_LIB_STACK   0x20020000 EMPTY ALIGN 8    0x00060000
+    {}
+
+    ;-----------------------------------------------------
+    ; SSE-300's internal SRAM of 4MiB - reserved for
+    ; activation buffers.
+    ; This region should have 3 cycle read latency from
+    ; both Cortex-M55 and Ethos-U55
+    ;-----------------------------------------------------
+    isram.bin       0x31000000  UNINIT ALIGN 16 0x00400000
+    {
+        ; activation buffers a.k.a tensor arena
+        *.o (.bss.NoInit.activation_buf)
+    }
+}
+
+;---------------------------------------------------------
+; Second load region (DDR)
+;---------------------------------------------------------
+LOAD_REGION_1       0x70000000                  0x02000000
+{
+    ;-----------------------------------------------------
+    ; 32 MiB of DRAM space for neural network model,
+    ; input vectors and labels. If the activation buffer
+    ; size required by the network is bigger than the
+    ; SRAM size available, it is accommodated here.
+    ;-----------------------------------------------------
+    dram.bin        0x70000000 ALIGN 16         0x02000000
+    {
+        ; nn model's baked in input matrices
+        *.o (ifm)
+
+        ; nn model
+        *.o (nn_model)
+
+        ; labels
+        *.o (labels)
+
+        ; if the activation buffer (tensor arena) doesn't
+        ; fit in the SRAM region, we accommodate it here
+        *.o (activation_buf)
+    }
+
+    ;-----------------------------------------------------
+    ; First 256kiB of BRAM (FPGA SRAM) used for RO data.
+    ; Note: Total BRAM size available is 2MiB.
+    ;-----------------------------------------------------
+    bram.bin        0x11000000          ALIGN 8 0x00040000
+    {
+        ; RO data (incl. unwinding tables for debugging)
+        .ANY (+RO-DATA)
+    }
+
+    ;-----------------------------------------------------
+    ; Remaining part of the 2MiB BRAM used as heap space.
+    ; 0x00200000 - 0x00040000 = 0x001C0000 (1.75 MiB)
+    ;-----------------------------------------------------
+    ARM_LIB_HEAP    0x11040000 EMPTY ALIGN 8    0x001C0000
+    {}
+}
diff --git a/source/application/hal/platforms/bare-metal/bsp/mem_layout/simple_platform.sct b/source/application/hal/platforms/bare-metal/bsp/mem_layout/simple_platform.sct
new file mode 100644
index 0000000..a1ffb49
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/mem_layout/simple_platform.sct
@@ -0,0 +1,102 @@
+;  Copyright (c) 2021 Arm Limited. All rights reserved.
+;  SPDX-License-Identifier: Apache-2.0
+;
+;  Licensed under the Apache License, Version 2.0 (the "License");
+;  you may not use this file except in compliance with the License.
+;  You may obtain a copy of the License at
+;
+;      http://www.apache.org/licenses/LICENSE-2.0
+;
+;  Unless required by applicable law or agreed to in writing, software
+;  distributed under the License is distributed on an "AS IS" BASIS,
+;  WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+;  See the License for the specific language governing permissions and
+;  limitations under the License.
+
+; *************************************************************
+; ***       Scatter-Loading Description File                ***
+; *************************************************************
+;
+;---------------------------------------------------------
+; First load region (ITCM)
+;---------------------------------------------------------
+LOAD_REGION_0       0x00000000                  0x00080000
+{
+    ;-----------------------------------------------------
+    ; First part of code mem - 512kiB
+    ;-----------------------------------------------------
+    itcm.bin        0x00000000                  0x00080000
+    {
+        *.o (RESET, +First)
+        * (InRoot$$Sections)
+
+        ; Essentially only RO-CODE, RO-DATA is in a
+        ; different region.
+        .ANY (+RO)
+    }
+
+    ;-----------------------------------------------------
+    ; BRAM or FPGA data SRAM region worth 2MiB
+    ;-----------------------------------------------------
+    bram.bin        0x11000000  UNINIT ALIGN 16 0x00200000
+    {
+        ; activation buffers a.k.a tensor arena
+        *.o (.bss.NoInit.activation_buf)
+    }
+
+    ;-----------------------------------------------------
+    ; 128kiB of 512kiB bank is used for any other RW or ZI
+    ; data. Note: this region is internal to the Cortex-M
+    ; CPU
+    ;-----------------------------------------------------
+    dtcm.bin        0x20000000                  0x00020000
+    {
+        .ANY(+RW +ZI)
+    }
+
+    ;-----------------------------------------------------
+    ; 128kiB of stack space within the DTCM region
+    ;-----------------------------------------------------
+    ARM_LIB_STACK   0x20020000 EMPTY ALIGN 8    0x00020000
+    {}
+
+    ;-----------------------------------------------------
+    ; 256kiB of heap space within the DTCM region
+    ;-----------------------------------------------------
+    ARM_LIB_HEAP    0x20040000 EMPTY ALIGN 8    0x00040000
+    {}
+}
+
+;---------------------------------------------------------
+; Second load region (DDR)
+;---------------------------------------------------------
+LOAD_REGION_1       0x70000000                  0x02000000
+{
+    ;-----------------------------------------------------
+    ; 32 MiB of DRAM space for nn model and input vectors
+    ;-----------------------------------------------------
+    dram.bin        0x70000000 ALIGN 16         0x02000000
+    {
+        ; nn model's baked in input matrices
+        *.o (ifm)
+
+        ; nn model
+        *.o (nn_model)
+
+        ; if the activation buffer (tensor arena) doesn't
+        ; fit in the SRAM region, we accommodate it here
+        *.o (activation_buf)
+    }
+
+    ;-----------------------------------------------------
+    ; SSE-300's internal SRAM of 2MiB - reserved for
+    ; activation buffers.
+    ; This region should have 3 cycle read latency from
+    ; both Cortex-M55 and Ethos-U55
+    ;-----------------------------------------------------
+    isram.bin       0x31000000                  0x00080000
+    {
+        ; RO data (incl. unwinding tables for debugging)
+        .ANY (+RO-DATA)
+    }
+}
diff --git a/source/application/hal/platforms/bare-metal/data_acquisition/data_acq.c b/source/application/hal/platforms/bare-metal/data_acquisition/data_acq.c
new file mode 100644
index 0000000..1e40b02
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/data_acquisition/data_acq.c
@@ -0,0 +1,61 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "data_acq.h"
+
+#include "bsp.h"
+
+#include <assert.h>
+#include <stdlib.h>
+#include <string.h>
+
+/**
+ * @brief       Get the user input from USART.
+ * @param[out]  user_input  String read from the UART block.
+ * @param[in]   size        String read length.
+ * @return      0 if successful, error code otherwise.
+ **/
+static int get_uart_user_input(char* user_input, int size)
+{
+    if (true != GetLine(user_input, size - 1)) {
+        printf_err("invalid input\n");
+        return 1;
+    }
+    return 0;
+}
+
+int data_acq_channel_init(data_acq_module* module)
+{
+    assert(module);
+
+    /* UART should have been initialised with low level initialisation
+     * routines. */
+    module->system_init = NULL;
+
+    strncpy(module->system_name, "UART", sizeof(module->system_name));
+    module->get_input = get_uart_user_input;
+    module->inited = 1;
+
+    return !(module->inited);
+}
+
+int data_acq_channel_release(data_acq_module* module)
+{
+    assert(module);
+    module->inited = 0;
+    module->get_input = NULL;
+    return 0;
+}
diff --git a/source/application/hal/platforms/bare-metal/data_presentation/data_psn.c b/source/application/hal/platforms/bare-metal/data_presentation/data_psn.c
new file mode 100644
index 0000000..474d552
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/data_presentation/data_psn.c
@@ -0,0 +1,46 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "data_psn.h"
+
+#include "bsp.h"
+#include "lcd_img.h"
+
+#include <assert.h>
+#include <string.h>
+
+int data_psn_system_init(data_psn_module* module)
+{
+    assert(module);
+
+    /* LCD output supported. */
+    module->system_init = lcd_init;
+    module->present_data_image = lcd_display_image;
+    module->present_data_text = lcd_display_text;
+    module->present_box = lcd_display_box;
+    module->set_text_color = lcd_set_text_color;
+    module->clear = lcd_clear;
+    strncpy(module->system_name, "lcd", sizeof(module->system_name));
+    module->inited =  !module->system_init();
+    return !module->inited;
+}
+
+int data_psn_system_release(data_psn_module* module)
+{
+    assert(module);
+    module->inited = 0;
+    return 0;
+}
diff --git a/source/application/hal/platforms/bare-metal/data_presentation/lcd/include/lcd_img.h b/source/application/hal/platforms/bare-metal/data_presentation/lcd/include/lcd_img.h
new file mode 100644
index 0000000..e4ad791
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/data_presentation/lcd/include/lcd_img.h
@@ -0,0 +1,90 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef LCD_IMG_H
+#define LCD_IMG_H
+
+#include <stdint.h>
+#include <stddef.h>
+#include <stdbool.h>
+
+/**
+ * @brief   Initialise the LCD
+ * @return  0 if successful, error code otherwise.
+ **/
+int lcd_init(void);
+
+/**
+ * @brief       Display a given image on the LCD. This allows displaying 8 bit
+ *              single or multi-channel images on the LCD.
+ * @param[in]   data        Pointer to start of the image.
+ * @param[in]   width       Width of this image.
+ * @param[in]   height      Image height.
+ * @param[in]   channels    Number of channels.
+ * @param[in]   pos_x       Screen position x co-ordinate.
+ * @param[in]   pos_y       Screen position y co-ordinate.
+ * @param[in]   downsample_factor   Factor by which the image needs to be
+ *                                  downsampled.
+ * @return      0 if successful, non-zero otherwise.
+ **/
+int lcd_display_image(uint8_t* data, const uint32_t width,
+    const uint32_t height, const uint32_t channels,
+    const uint32_t pos_x, const uint32_t pos_y,
+    const uint32_t downsample_factor);
+
+/**
+ * @brief       Display a given image on the LCD. This allows displaying 8 bit
+ *              single or multi-channel images on the LCD.
+ * @param[in]   str         Pointer to a null terminated string.
+ * @param[in]   str_sz      Length of the string.
+ * @param[in]   pos_x       Screen position x co-ordinate.
+ * @param[in]   pos_y       Screen position y co-ordinate.
+ * @param[in]   allow_multiple_lines    The function will try and spread
+ *                                      the string into multiple lines if
+ *                                      they don't fit in one.
+ * @return      0 if successful, non-zero otherwise.
+ **/
+int lcd_display_text(const char* str, const size_t str_sz,
+     const uint32_t pos_x, const uint32_t pos_y,
+     const bool allow_multiple_lines);
+
+/**
+ * @brief       Display a box with given color on LCD.
+ * @param[in]   pos_x       Screen position x co-ordinate.
+ * @param[in]   pos_y       Screen position y co-ordinate.
+ * @param[in]   width       Width.
+ * @param[in]   height      Height.
+ * @param[in]   color       Fill color.
+ * @return      0 if successful, non-zero otherwise.
+ **/
+int lcd_display_box(const uint32_t pos_x, const uint32_t pos_y,
+    const uint32_t width, const uint32_t height, const uint16_t color);
+
+/**
+ * @brief       Clear LCD.
+ * @param[in]   color   Fill color.
+ * @return      0 if successful, non-zero otherwise.
+ **/
+int lcd_clear(const uint16_t color);
+
+/**
+ * @brief       Set text color.
+ * @param[in]   color   Fill color.
+ * @return      0 if successful, non-zero otherwise.
+ **/
+int lcd_set_text_color(const uint16_t color);
+
+#endif /* LCD_IMG_H */
diff --git a/source/application/hal/platforms/bare-metal/data_presentation/lcd/lcd_img.c b/source/application/hal/platforms/bare-metal/data_presentation/lcd/lcd_img.c
new file mode 100644
index 0000000..75f58fd
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/data_presentation/lcd/lcd_img.c
@@ -0,0 +1,159 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "lcd_img.h"
+
+#include "bsp.h"
+
+#include <string.h>
+#include <assert.h>
+
+static int show_title(void)
+{
+    char title[128];
+    int status = 0;
+
+    /* LCD title string */
+#if defined(CPU_CORTEX_M55)
+    const char* cpu_name = "Arm Cortex-M55";
+#else /* defined(CPU_CORTEX_M55) */
+    const char* cpu_name = "Arm CPU";
+#endif /* defined(CPU_CORTEX_M55) */
+
+    lcd_set_text_color(White);
+
+    /* First line */
+    snprintf(title, sizeof(title), "Arm ML embedded code samples");
+
+    if (0 != (status = lcd_display_text(
+            title, strlen(title), 10, 0, false))) {
+        return status;
+    }
+
+    /* Second line */
+#if defined (ARM_NPU)
+    snprintf(title, sizeof(title), "%s + Arm Ethos-U55 NPU", cpu_name);
+#else /* defined (ARM_NPU) */
+    snprintf(title, sizeof(title), "%s", cpu_name);
+#endif /* defined (ARM_NPU) */
+
+    return lcd_display_text(title, strlen(title), 10, 20, false);
+}
+
+int lcd_init(void)
+{
+    GLCD_Initialize();
+    GLCD_Clear(Black);
+    return show_title();
+}
+
+int lcd_display_image(uint8_t* data, const uint32_t width,
+    const uint32_t height, const uint32_t channels,
+    const uint32_t pos_x, const uint32_t pos_y,
+    const uint32_t downsample_factor)
+{
+    /* Sanity checks */
+    assert(data);
+    if ((pos_x + width/downsample_factor > GLCD_WIDTH) ||
+            (pos_y + height/downsample_factor > GLCD_HEIGHT)) {
+        printf_err("Invalid image size for given location!\n");
+        return 1;
+    }
+
+    if (1 == channels || 3 == channels) {
+        GLCD_Image(data, width, height, channels, pos_x, pos_y,
+            downsample_factor);
+    } else {
+        printf_err("Only single and three channel images are supported!\n");
+        return 1;
+    }
+
+    return 0;
+}
+
+int lcd_display_text(const char* str, const size_t str_sz,
+    const uint32_t pos_x, const uint32_t pos_y,
+    const bool allow_multiple_lines)
+{
+    /* We use a font 0 which is 9x15. */
+    const uint32_t x_span =  9; /* Each character is this  9 pixels "wide". */
+    const uint32_t y_span = 15; /* Each character is this 15 pixels "high". */
+
+    if (str_sz == 0) {
+        return 1;
+    }
+
+    /* If not within the LCD bounds, return error. */
+    if (pos_x + x_span > GLCD_WIDTH || pos_y + y_span > GLCD_HEIGHT) {
+        return 1;
+    } else {
+        const unsigned char font_idx = 0; /* We are using the custom font = 0 */
+
+        const uint32_t col = pos_x/x_span;
+        const uint32_t max_cols = GLCD_WIDTH/x_span - 1;
+        const uint32_t max_lines = GLCD_HEIGHT/y_span - 1;
+
+        uint32_t i = 0;
+        uint32_t current_line = pos_y/y_span;
+        uint32_t current_col = col;
+
+        /* Display the string on the LCD. */
+        for (i = 0; i < str_sz; ++i) {
+
+            if (allow_multiple_lines) {
+
+                /* If the next character won't fit. */
+                if (current_col > max_cols) {
+                    current_col = col;
+
+                    /* If the next line won't fit. */
+                    if (++current_line  > max_lines) {
+                        return 1;
+                    }
+                }
+            }
+
+            GLCD_DisplayChar(current_line, current_col++, font_idx, str[i]);
+        }
+    }
+    return 0;
+}
+
+int lcd_display_box(const uint32_t pos_x, const uint32_t pos_y,
+    const uint32_t width, const uint32_t height, const uint16_t color)
+{
+    /* If not within the LCD bounds, return error. */
+    if (pos_x > GLCD_WIDTH || pos_y > GLCD_HEIGHT) {
+        return 1;
+    }
+    else {
+        GLCD_Box(pos_x, pos_y, width, height, color);
+    }
+    return 0;
+}
+
+int lcd_clear(const uint16_t color)
+{
+    GLCD_Clear(color);
+    GLCD_SetTextColor(White);
+    return show_title();
+}
+
+int lcd_set_text_color(const uint16_t color)
+{
+    GLCD_SetTextColor(color);
+    return 0;
+}
diff --git a/source/application/hal/platforms/bare-metal/timer/baremetal_timer.c b/source/application/hal/platforms/bare-metal/timer/baremetal_timer.c
new file mode 100644
index 0000000..7257c1d
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/timer/baremetal_timer.c
@@ -0,0 +1,243 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "bsp.h"
+#include "timer.h"
+
+#include <assert.h>
+#include <string.h>
+
+#if defined (ARM_NPU)
+
+#include "pmu_ethosu.h"
+
+/**
+ * @brief Initialises the PMU and enables the cycle counter.
+ **/
+static void _init_ethosu_cyclecounter(void);
+
+/**
+ * @brief       Gets the difference of total NPU cycle counts.
+ *              (includes active and idle)
+ * @param[in]   st      Pointer to time_counter value at start time.
+ * @param[in]   end     Pointer to time_counter value at end.
+ * @return      Total NPU cycle counts difference between the arguments expressed
+ *              as unsigned 64 bit integer.
+ **/
+static uint64_t bm_get_npu_total_cycle_diff(time_counter *st,
+                                            time_counter *end);
+
+/** 
+ * @brief       Gets the difference in active NPU cycle counts.
+ * @param[in]   st      Pointer to time_counter value at start time.
+ * @param[in]   end     Pointer to time_counter value at end.
+ * @return      Active NPU cycle counts difference between the arguments expressed
+ *              as unsigned 64 bit integer.
+ **/
+static uint64_t bm_get_npu_active_cycle_diff(time_counter *st,
+                                             time_counter *end);
+
+#endif /* defined (ARM_NPU) */
+
+#if defined(MPS3_PLATFORM)
+/** 
+ * @brief       Wrapper for getting milliseconds duration between time counters
+ * @param[in]   st      Pointer to time_counter value at start time.
+ * @param[in]   end     Pointer to time_counter value at end.
+ * @return      Difference in milliseconds between given time counters.
+ **/
+static time_t bm_get_duration_ms(time_counter *st, time_counter *end);
+
+/**
+ * @brief       Wrapper for getting microseconds duration between time counters
+ * @param[in]   st      Pointer to time_counter value at start time.
+ * @param[in]   end     Pointer to time_counter value at end.
+ * @return      Difference in microseconds between given time counters.
+ **/
+static time_t bm_get_duration_us(time_counter *st, time_counter *end);
+#endif /* defined(MPS3_PLATFORM) */
+
+/**
+ * @brief Wrapper for resetting timer.
+ **/
+static void bm_timer_reset(void);
+
+/**
+ * @brief   Wrapper for getting the current timer counter.
+ * @return  Current time counter value.
+ **/
+static time_counter bm_get_time_counter(void);
+
+/**
+ * @brief   Wrapper for profiler start.
+ * @return  Current profiler start timer counter.
+ **/
+static time_counter bm_start_profiling(void);
+
+/**
+ * @brief   Wrapper for profiler end.
+ * @return  Current profiler end timer counter.
+ **/
+static time_counter bm_stop_profiling(void);
+
+/**
+ * @brief   Wrapper for getting CPU cycle difference between time counters.
+ * @return  CPU cycle difference between given time counters expressed
+ *          as unsigned 32 bit integer.
+ **/
+static uint32_t bm_get_cpu_cycles_diff(time_counter *st, time_counter *end);
+
+/**
+ * @brief       Initialiser for bare metal timer. 
+ * @param[in]   timer  Platform timer to initialize.
+ **/
+void init_timer(platform_timer *timer)
+{
+    assert(timer);
+    memset(timer, 0, sizeof(*timer));
+
+    timer->reset            = bm_timer_reset;
+    timer->get_time_counter = bm_get_time_counter;
+    timer->start_profiling  = bm_start_profiling;
+    timer->stop_profiling   = bm_stop_profiling;
+    timer->get_cpu_cycle_diff = bm_get_cpu_cycles_diff;
+    timer->cap.cpu_cycles = 1;
+
+#if defined (MPS3_PLATFORM)
+    timer->cap.duration_ms  = 1;
+    timer->cap.duration_us  = 1;
+    timer->get_duration_ms  = bm_get_duration_ms;
+    timer->get_duration_us  = bm_get_duration_us;
+#endif  /* defined (MPS3_PLATFORM) */
+
+#if defined (ARM_NPU)
+    /* We are capable of reporting npu cycle counts. */
+    timer->cap.npu_cycles   = 1;
+    timer->get_npu_total_cycle_diff = bm_get_npu_total_cycle_diff;
+    timer->get_npu_active_cycle_diff = bm_get_npu_active_cycle_diff;
+    _init_ethosu_cyclecounter();
+#endif /* defined (ARM_NPU) */
+
+    timer->reset();
+    timer->inited = 1;
+}
+
+#if defined (ARM_NPU)
+
+static void _reset_ethosu_counters(void)
+{
+    /* Reset all cycle and event counters. */
+    ETHOSU_PMU_CYCCNT_Reset();
+    ETHOSU_PMU_EVCNTR_ALL_Reset();
+}
+
+static void _init_ethosu_cyclecounter(void)
+{
+    /* Reset overflow status. */
+    ETHOSU_PMU_Set_CNTR_OVS(ETHOSU_PMU_CNT1_Msk | ETHOSU_PMU_CCNT_Msk);
+
+    /* Set the counter #0 to count idle cycles. */
+    ETHOSU_PMU_Set_EVTYPER(0, ETHOSU_PMU_NPU_IDLE);
+
+    /* Enable PMU. */
+    ETHOSU_PMU_Enable();
+
+    /* Enable counters for cycle and counter# 0. */
+    ETHOSU_PMU_CNTR_Enable(ETHOSU_PMU_CNT1_Msk | ETHOSU_PMU_CCNT_Msk);
+
+    _reset_ethosu_counters();
+}
+
+static uint64_t bm_get_npu_total_cycle_diff(time_counter *st, time_counter *end)
+{
+    return end->npu_total_ccnt - st->npu_total_ccnt;
+}
+
+static uint64_t bm_get_npu_active_cycle_diff(time_counter *st, time_counter *end)
+{
+    /* Check for overflow: The idle counter is 32 bit while the
+       total cycle count is 64 bit. */
+    const uint32_t overflow_status = ETHOSU_PMU_Get_CNTR_OVS();
+
+    if (ETHOSU_PMU_CNT1_Msk & overflow_status) {
+        printf_err("EthosU PMU idle counter overflow.\n");
+        return 0;
+    }
+
+    /* Active NPU time = total time - idle time */
+    return (bm_get_npu_total_cycle_diff(st, end) +
+           (uint64_t)(st->npu_idle_ccnt)) - (uint64_t)(end->npu_idle_ccnt);
+}
+
+#endif /* defined (ARM_NPU) */
+
+static void bm_timer_reset(void)
+{
+#if defined (ARM_NPU)
+    _init_ethosu_cyclecounter();
+#endif /* defined (ARM_NPU) */
+
+    timer_reset();
+}
+
+static time_counter bm_get_time_counter(void)
+{
+    time_counter t = {
+        .counter = get_time_counter(),
+
+#if defined (ARM_NPU)
+        .npu_idle_ccnt = ETHOSU_PMU_Get_EVCNTR(0),
+        .npu_total_ccnt = ETHOSU_PMU_Get_CCNTR()
+#endif /* defined (ARM_NPU) */
+
+    };
+
+#if defined (ARM_NPU)
+    debug("NPU total cc: %llu; NPU idle cc: %u\n",
+        t.npu_total_ccnt, t.npu_idle_ccnt);
+#endif /* defined (ARM_NPU) */
+
+    return t;
+}
+
+static time_counter bm_start_profiling(void)
+{
+    start_cycle_counter();
+    return bm_get_time_counter();
+}
+
+static time_counter bm_stop_profiling(void)
+{
+    stop_cycle_counter();
+    return bm_get_time_counter();
+}
+
+static uint32_t bm_get_cpu_cycles_diff(time_counter *st, time_counter *end)
+{
+    return get_cycle_count_diff(&(st->counter), &(end->counter));
+}
+
+#if defined(MPS3_PLATFORM)
+static time_t bm_get_duration_ms(time_counter *st, time_counter *end)
+{
+    return get_duration_milliseconds(&(st->counter), &(end->counter));
+}
+
+static time_t bm_get_duration_us(time_counter *st, time_counter *end)
+{
+    return get_duration_microseconds(&(st->counter), &(end->counter));
+}
+#endif /* defined(MPS3_PLATFORM) */
diff --git a/source/application/hal/platforms/bare-metal/timer/include/baremetal_timer.h b/source/application/hal/platforms/bare-metal/timer/include/baremetal_timer.h
new file mode 100644
index 0000000..c8fc32c
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/timer/include/baremetal_timer.h
@@ -0,0 +1,41 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef BAREMETAL_TIMER_H
+#define BAREMETAL_TIMER_H
+
+#include <stdint.h>
+#include <time.h>
+
+#if defined (MPS3_PLATFORM)
+    #include "timer_mps3.h"
+    typedef mps3_time_counter   base_time_counter;
+#else /* defined (MPS3_PLATFORM) */
+    #include "timer_fvp.h"
+    typedef fvp_time_counter    base_time_counter;
+#endif  /* defined (MPS3_PLATFORM) */
+
+typedef struct bm_time_counter {
+    base_time_counter       counter;
+
+#if defined (ARM_NPU)
+    uint64_t                npu_total_ccnt;
+    uint32_t                npu_idle_ccnt;
+#endif /* ARM_NPU */
+
+} time_counter;
+
+#endif /* BAREMETAL_TIMER_H */
diff --git a/source/application/hal/platforms/bare-metal/utils/include/system_init.h b/source/application/hal/platforms/bare-metal/utils/include/system_init.h
new file mode 100644
index 0000000..84e0305
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/utils/include/system_init.h
@@ -0,0 +1,43 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef BAREMETAL_SYSTEM_INIT_H
+#define BAREMETAL_SYSTEM_INIT_H
+
+#include "bsp.h"
+
+/**
+ * @brief   Initialises the platform (MPS3 FPGA board or Fixed Virtual Platform)
+ *          Updates the system core clock and initialises the UART. It also
+ *          verifies that the Cortex-M CPU variant being used matches the expected
+ *          value if running on MPS3.
+ * @return  0 if successful, error code otherwise.
+*/
+int system_init(void);
+
+/**
+ * @brief  Releases the platform (MPS3 FPGA board or Fixed Virtual Platform).
+ **/
+void system_release(void);
+
+/**
+ * @brief  Return the name the platform (MPS3 FPGA board or Fixed Virtual Platform).
+ * @param[out]   name Platform name string.
+ * @param[in]    size Name string length.
+ **/
+void system_name(char* name, size_t size);
+
+#endif /* BAREMETAL_SYSTEM_INIT_H */
diff --git a/source/application/hal/platforms/bare-metal/utils/system_init.c b/source/application/hal/platforms/bare-metal/utils/system_init.c
new file mode 100644
index 0000000..0a6a1b3
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/utils/system_init.c
@@ -0,0 +1,118 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "system_init.h"
+
+#include "uart_stdout.h"
+
+#include <string.h>
+
+#if defined(MPS3_PLATFORM)
+#define CREATE_MASK(msb, lsb)           (((1U << ((msb) - (lsb) + 1)) - 1) << (lsb))
+#define MASK_BITS(arg, msb, lsb)        ((arg) & CREATE_MASK(msb, lsb))
+#define EXTRACT_BITS(arg, msb, lsb)     (MASK_BITS(arg, msb, lsb) >> (lsb))
+#endif /* MPS3_PLATFORM */
+
+int system_init(void)
+{
+#if defined(MPS3_PLATFORM)
+    uint32_t id = 0;
+    uint32_t fpgaid = 0;
+    uint32_t apnote = 0;
+    uint32_t rev = 0;
+    uint32_t aid = 0;
+    uint32_t fpga_clk = 0;
+
+    /* Initialise the LEDs as the switches are */
+    MPS3_FPGAIO->LED = MPS3_FPGAIO->SWITCHES & 0xFF;
+#endif
+
+    /* UART init - will enable valid use of printf (stdout
+     * re-directed at this UART (UART0) */
+    UartStdOutInit();
+    info("Processor internal clock: %u Hz\n", GetSystemCoreClock());
+
+#if defined(MPS3_PLATFORM)
+    /* Get revision information from various registers */
+    rev = MPS3_SCC->CFG_REG4;
+    fpgaid = MPS3_SCC->SCC_ID;
+    aid = MPS3_SCC->SCC_AID;
+    apnote = EXTRACT_BITS(fpgaid, 15, 4);
+    fpga_clk = GetMPS3CoreClock();
+
+    info("V2M-MPS3 revision %c\n\n", rev + 'A');
+    info("Application Note AN%x, Revision %c\n", apnote,
+        EXTRACT_BITS(aid, 23, 20) + 'A');
+    info("MPS3 build %d\n", EXTRACT_BITS(aid, 31, 24));
+    info("MPS3 core clock has been set to: %d Hz\n", fpga_clk);
+
+    /* Display CPU ID */
+    id = SCB->CPUID;
+    info("CPU ID: 0x%08x\n", id);
+
+    if(EXTRACT_BITS(id, 15, 8) == 0xD2) {
+        if (EXTRACT_BITS(id, 7, 4) == 2) {
+            info ("CPU: Cortex-M55 r%dp%d\n\n",
+                EXTRACT_BITS(id, 23, 20),EXTRACT_BITS(id, 3, 0));
+#if defined (CPU_CORTEX_M55)
+            /* CPU ID should be "0x_41_0f_d2_20" for Cortex-M55 */
+            return 0;
+#endif /* CPU_CORTEX_M55 */
+        } else if (EXTRACT_BITS(id, 7, 4) == 1) {
+            info ("CPU: Cortex-M33 r%dp%d\n\n",
+                EXTRACT_BITS(id, 23, 20),EXTRACT_BITS(id, 3, 0));
+#if defined (CPU_CORTEX_M33)
+            return 0;
+#endif /* CPU_CORTEX_M33 */
+        } else if (EXTRACT_BITS(id, 7, 4) == 0) {
+            info ("CPU: Cortex-M23 r%dp%d\n\n",
+                EXTRACT_BITS(id, 23, 20),EXTRACT_BITS(id, 3, 0));
+        } else {
+            info ("CPU: Cortex-M processor family");
+        }
+    } else if (EXTRACT_BITS(id, 15, 8) == 0xC6) {
+        info ("CPU: Cortex-M%d+ r%dp%d\n\n",
+            EXTRACT_BITS(id, 7, 4), EXTRACT_BITS(id, 23, 20),
+            EXTRACT_BITS(id, 3, 0));
+    } else {
+        info ("CPU: Cortex-M%d r%dp%d\n\n",
+            EXTRACT_BITS(id, 7, 4), EXTRACT_BITS(id, 23, 20),
+            EXTRACT_BITS(id, 3, 0));
+    }
+#else /* MPS3_PLATFORM */
+
+    info("ARM model environment ready..\n");
+    return 0;
+#endif /* MPS3_PLATFORM */
+
+    /* If the CPU is anything other than M33 or M55, we return 1 */
+    printf_err("CPU mismatch!\n");
+    return 1;
+}
+
+void system_release(void)
+{
+    __disable_irq();
+}
+
+void system_name(char* name, size_t size)
+{
+#if defined (MPS3_PLATFORM)
+    strncpy(name, "mps3-bare", size);
+#else /* MPS3_PLATFORM */
+    strncpy(name, "FVP", size);
+#endif /* MPS3_PLATFORM */
+}
\ No newline at end of file
diff --git a/source/application/hal/platforms/native/data_acquisition/data_acq.c b/source/application/hal/platforms/native/data_acquisition/data_acq.c
new file mode 100644
index 0000000..01f47fa
--- /dev/null
+++ b/source/application/hal/platforms/native/data_acquisition/data_acq.c
@@ -0,0 +1,61 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "data_acq.h"
+
+#include <assert.h>
+#include <stdio.h>
+#include <string.h>
+
+/**
+ * @brief   Initialize the acuisition.
+ * @return  0 if successful, error code otherwise.
+ **/
+static int acquisition_init(void)
+{
+    return 0;
+}
+
+/**
+ * @brief           Get the user input from stdin.
+ * @param[out]      user_input  String read from the stdin.
+ * @param[in,out]   size        String read length.
+ * @return          0 if successful, error code otherwise.
+ **/
+static int get_user_input(char* user_input, int size)
+{
+    fgets(user_input, size, stdin);
+    return 0;
+}
+
+int data_acq_channel_init(data_acq_module *module)
+{
+    assert(module);
+
+    module->system_init = acquisition_init;
+    module->get_input = get_user_input;
+    strncpy(module->system_name, "native",
+            sizeof(module->system_name));
+    module->inited = !module->system_init();
+    return !module->inited;
+}
+
+int data_acq_channel_release(data_acq_module *module)
+{
+    assert(module);
+    module->inited = 0;
+    return 0;
+}
diff --git a/source/application/hal/platforms/native/data_presentation/data_psn.c b/source/application/hal/platforms/native/data_presentation/data_psn.c
new file mode 100644
index 0000000..fe4bcfa
--- /dev/null
+++ b/source/application/hal/platforms/native/data_presentation/data_psn.c
@@ -0,0 +1,45 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "data_psn.h"
+
+#include "log.h"
+
+#include <assert.h>
+#include <string.h>
+
+int data_psn_system_init(data_psn_module *module)
+{
+    assert(module);
+
+    module->system_init = log_psn_init;
+    module->present_data_image = log_display_image;
+    module->present_data_text = log_display_text;
+    module->present_box = log_display_box_icon;
+    module->set_text_color = log_set_text_color;
+    module->clear = log_clear;
+    strncpy(module->system_name, "log_psn", sizeof(module->system_name));
+    module->inited =  !module->system_init();
+    return !module->inited;
+}
+
+int data_psn_system_release(data_psn_module *module)
+{
+    /* Nothing to do here! */
+    assert(module);
+    module->inited = 0;
+    return 0;
+}
diff --git a/source/application/hal/platforms/native/data_presentation/log/include/log.h b/source/application/hal/platforms/native/data_presentation/log/include/log.h
new file mode 100644
index 0000000..10cf303
--- /dev/null
+++ b/source/application/hal/platforms/native/data_presentation/log/include/log.h
@@ -0,0 +1,86 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef NATIVE_LOG_H
+#define NATIVE_LOG_H
+
+#include <stdint.h>
+#include <stddef.h>
+#include <stdbool.h>
+
+/**
+ * @brief  Data presentation initialiser
+ **/
+int log_psn_init(void);
+
+/**
+ * @brief       Log parameters for the image to be displayed.
+ * @param[in]   data        Image pointer.
+ * @param[in]   width       Image width.
+ * @param[in]   height      Image height.
+ * @param[in]   channels    Number of channels.
+ * @param[in]   pos_x       Screen position x co-ordinate.
+ * @param[in]   pos_y       Screen position y co-ordinate.
+ * @param[in]   downsample_factor   Factor by which the image needs to be
+ *                                  down-sampled.
+ * @return      0 if successful, non-zero otherwise.
+ **/
+
+int log_display_image(uint8_t* data, const uint32_t width,
+                      const uint32_t height, const uint32_t channels,
+                      const uint32_t pos_x, const uint32_t pos_y,
+                      const uint32_t downsample_factor);
+
+/**
+ * @brief       Log the parameters for text to be displayed.
+ * @param[in]   str         Pointer to a null terminated string.
+ * @param[in]   str_sz      Length of the string.
+ * @param[in]   pos_x       Screen position x co-ordinate.
+ * @param[in]   pos_y       Screen position y co-ordinate.
+ * @return      0 if successful, non-zero otherwise.
+ **/
+int log_display_text(const char* str, const size_t str_sz,
+                     const uint32_t pos_x, const uint32_t pos_y,
+                     const bool allow_multiple_lines);
+
+/**
+ * @brief       Log parameters for the box to be displayed.
+ * @param[in]   pos_x       Screen position x co-ordinate.
+ * @param[in]   pos_y       Screen position y co-ordinate.
+ * @param[in]   width       Width.
+ * @param[in]   height      Height.
+ * @param[in]   color       Fill color.
+ * @return      0 if successful, non-zero otherwise.
+ **/
+int log_display_box_icon(const uint32_t pos_x, const uint32_t pos_y,
+                         const uint32_t width, const uint32_t height, const uint16_t color);
+
+/**
+ * @brief       Logs the colour with which the display
+ *              needs to be cleared with.
+ * @param[in]   color       Fill color.
+ * @return      0 if successful, non-zero otherwise.
+ **/
+int log_clear(const uint16_t color);
+
+/**
+ * @brief       Logs the text color to be set.
+ * @param[in]   color       Fill color.
+ * @return 0 if successful, non-zero otherwise.
+ **/
+int log_set_text_color (const uint16_t color);
+
+#endif /* NATIVE_LOG_H */
\ No newline at end of file
diff --git a/source/application/hal/platforms/native/data_presentation/log/log.c b/source/application/hal/platforms/native/data_presentation/log/log.c
new file mode 100644
index 0000000..48e8b95
--- /dev/null
+++ b/source/application/hal/platforms/native/data_presentation/log/log.c
@@ -0,0 +1,71 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "log.h"
+
+#include "dummy_log.h"
+
+#include <stdint.h>
+
+int log_psn_init(void)
+{
+    return 0;
+}
+
+int log_display_image(uint8_t* data, const uint32_t width,
+                      const uint32_t height, const uint32_t channels,
+                      const uint32_t pos_x, const uint32_t pos_y,
+                      const uint32_t downsample_factor)
+{
+    info("Image details\n");
+    info("Data:                 %p\n", data);
+    info("WxHxC:                %dx%dx%d\n", width, height, channels);
+    info("Pos (x,y):            (%d,%d)\n", pos_x, pos_y);
+    info("Downsampling factor:  %u\n", downsample_factor);
+    return 0;
+}
+
+int log_display_text(const char* str, const size_t str_sz,
+                     const uint32_t pos_x, const uint32_t pos_y,
+                     const bool allow_multiple_lines)
+{
+    UNUSED(allow_multiple_lines);
+    info("%s\n", str);
+    info("Text size: %lu, x: %d, y: %d\n", str_sz, pos_x, pos_y);
+    return 0;
+}
+
+
+int log_display_box_icon(const uint32_t pos_x, const uint32_t pos_y,
+                         const uint32_t width, const uint32_t height, 
+                         const uint16_t color)
+{
+    info("Showing rectangular, width: %d, height: %d, color: %d, x: %d, y: %d\n", 
+            width, height, color, pos_x, pos_y);
+    return 0;
+}
+
+int log_clear(const uint16_t color)
+{
+    info("Clearing with color: %d\n", color);
+    return 0;
+}
+
+int log_set_text_color (const uint16_t color)
+{
+    info("Setting text color: %d\n", color);
+    return 0;
+}
diff --git a/source/application/hal/platforms/native/timer/include/native_timer.h b/source/application/hal/platforms/native/timer/include/native_timer.h
new file mode 100644
index 0000000..df7b493
--- /dev/null
+++ b/source/application/hal/platforms/native/timer/include/native_timer.h
@@ -0,0 +1,31 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef TIMER_H
+#define TIMER_H
+
+#include <stdint.h>
+#include <time.h>
+
+/* Container for time struct */
+typedef struct _time_counter {
+    /* Current POSIX time in secs. */
+    time_t current_secs;
+    /* Nanoseconds expired in current second. */
+    time_t current_nsecs;
+} time_counter;
+
+#endif /* TIMER_H */
\ No newline at end of file
diff --git a/source/application/hal/platforms/native/timer/native_timer.cc b/source/application/hal/platforms/native/timer/native_timer.cc
new file mode 100644
index 0000000..c115f4d
--- /dev/null
+++ b/source/application/hal/platforms/native/timer/native_timer.cc
@@ -0,0 +1,110 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+#include "timer.h"
+
+#include <cassert>
+#include <ctime>
+#include <cstring>
+
+#define MILLISECONDS_IN_SECOND      1000
+#define MICROSECONDS_IN_SECOND      1000000
+#define NANOSECONDS_IN_MILLISECOND  1000000
+#define NANOSECONDS_IN_MICROSECOND  1000
+
+/**
+ * @brief   Gets the current time counter value.
+ * @return  Counter value expressed in terms of time_counter struct.
+ **/
+static time_counter get_time_counter(void)
+{
+    struct timespec current_time{};
+    clock_gettime(1, &current_time);
+    time_counter t = {
+        .current_secs = current_time.tv_sec,
+        .current_nsecs = current_time.tv_nsec
+    };
+
+    return t;
+}
+
+/**
+ * @brief       Gets the time duration elapsed between start and end.
+ * @param[in]   start   Pointer to time_counter value at start time.
+ * @param[in]   end     Pointer to time_counter value at end.
+ * @return      Difference in milliseconds between the arguments expressed
+ *              as unsigned 32 bit integer.
+ **/
+static time_t get_duration_milliseconds(time_counter *start, time_counter *end)
+{
+    /* Convert both parts of time struct to ms then add for complete time. */
+    time_t seconds_part =
+        (end->current_secs - start->current_secs) * MILLISECONDS_IN_SECOND;
+    time_t nanoseconds_part =
+        (end->current_nsecs - start->current_nsecs) / NANOSECONDS_IN_MILLISECOND;
+
+    return seconds_part + nanoseconds_part;
+}
+
+/**
+ * @brief       Gets the time duration elapsed between start and end.
+ * @param[in]   start   Pointer to time_counter value at start time.
+ * @param[in]   end     Pointer to time_counter value at end.
+ * @return      Difference in microseconds between the arguments expressed
+ *              as unsigned 32 bit integer.
+ **/
+static time_t get_duration_microseconds(time_counter *start, time_counter *end)
+{
+    /* Convert both parts of time struct to us then add for complete time. */
+    time_t seconds_part =
+        (end->current_secs - start->current_secs) * MICROSECONDS_IN_SECOND;
+    time_t nanoseconds_part =
+        (end->current_nsecs - start->current_nsecs) / NANOSECONDS_IN_MICROSECOND;
+
+    return seconds_part + nanoseconds_part;
+}
+
+/**
+ * @brief Stub for timer reset.
+ **/
+void reset_timer() {}
+
+/**
+ * @brief Initialise the timer for this platform.
+ **/
+void init_timer(platform_timer *timer)
+{
+    assert(timer);
+    memset(timer, 0, sizeof(*timer));
+
+    timer->get_time_counter = get_time_counter;
+    timer->start_profiling = get_time_counter;
+    timer->stop_profiling = get_time_counter;
+    timer->get_duration_ms = get_duration_milliseconds;
+    timer->cap.duration_ms = 1;
+    timer->get_duration_us = get_duration_microseconds;
+    timer->cap.duration_us = 1;
+    timer->reset = reset_timer;
+    timer->inited = 1;
+}
+
+#ifdef __cplusplus
+}
+#endif
diff --git a/source/application/hal/platforms/native/utils/include/dummy_log.h b/source/application/hal/platforms/native/utils/include/dummy_log.h
new file mode 100644
index 0000000..626436a
--- /dev/null
+++ b/source/application/hal/platforms/native/utils/include/dummy_log.h
@@ -0,0 +1,64 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef DUMMY_LOG_H
+#define DUMMY_LOG_H
+
+#include <stdio.h>
+
+#define LOG_LEVEL_TRACE       0
+#define LOG_LEVEL_DEBUG       1
+#define LOG_LEVEL_INFO        2
+#define LOG_LEVEL_WARN        3
+#define LOG_LEVEL_ERROR       4
+
+#ifndef LOG_LEVEL
+#define LOG_LEVEL             LOG_LEVEL_INFO
+#endif /*LOG_LEVEL*/
+
+#define UNUSED(x)       ((void)(x))
+
+#if (LOG_LEVEL == LOG_LEVEL_TRACE)
+    #define trace(...)        printf("[TRACE] "); printf(__VA_ARGS__)
+#else
+    #define trace(...)
+#endif  /* LOG_LEVEL == LOG_LEVEL_TRACE */
+
+#if (LOG_LEVEL <= LOG_LEVEL_DEBUG)
+    #define debug(...)        printf("[DEBUG] "); printf(__VA_ARGS__)
+#else
+    #define debug(...)
+#endif  /* LOG_LEVEL > LOG_LEVEL_TRACE */
+
+#if (LOG_LEVEL <= LOG_LEVEL_INFO)
+    #define info(...)         printf("[INFO] "); printf(__VA_ARGS__)
+#else
+    #define info(...)
+#endif  /* LOG_LEVEL > LOG_LEVEL_DEBUG */
+
+#if (LOG_LEVEL <= LOG_LEVEL_WARN)
+    #define warn(...)         printf("[WARN] "); printf(__VA_ARGS__)
+#else
+    #define warn(...)
+#endif  /* LOG_LEVEL > LOG_LEVEL_INFO */
+
+#if (LOG_LEVEL <= LOG_LEVEL_ERROR)
+    #define printf_err(...)   printf("[ERROR] "); printf(__VA_ARGS__)
+#else
+    #define printf_err(...)
+#endif  /* LOG_LEVEL > LOG_LEVEL_INFO */
+
+#endif /* DUMMY_LOG_H */
\ No newline at end of file
diff --git a/source/application/hal/platforms/native/utils/include/system_init.h b/source/application/hal/platforms/native/utils/include/system_init.h
new file mode 100644
index 0000000..80b1bb2
--- /dev/null
+++ b/source/application/hal/platforms/native/utils/include/system_init.h
@@ -0,0 +1,39 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef NATIVE_SYSTEM_INIT_H
+#define NATIVE_SYSTEM_INIT_H
+
+#include "dummy_log.h"
+
+/**
+ * @brief  Platform initialisation for native platform.
+ **/
+int system_init(void);
+
+/**
+ * @brief  Platform release for native platform.
+ **/
+void system_release(void);
+
+/**
+ * @brief       Returns the name of the platform.
+ * @param[out]  name Platform name string.
+ * @param[in]   size Name string length.
+ */
+void system_name(char* name, size_t size);
+
+#endif /* NATIVE_SYSTEM_INIT_H */
diff --git a/source/application/hal/platforms/native/utils/system_init.c b/source/application/hal/platforms/native/utils/system_init.c
new file mode 100644
index 0000000..8e0b768
--- /dev/null
+++ b/source/application/hal/platforms/native/utils/system_init.c
@@ -0,0 +1,32 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "system_init.h"
+
+#include <string.h>
+
+int system_init(void)
+{
+    return 0;
+}
+
+void system_release(void)
+{}
+
+void system_name(char* name, size_t size)
+{
+    strncpy(name, "native", size);
+}
\ No newline at end of file
diff --git a/source/application/main/Classifier.cc b/source/application/main/Classifier.cc
new file mode 100644
index 0000000..bc2c378
--- /dev/null
+++ b/source/application/main/Classifier.cc
@@ -0,0 +1,191 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "Classifier.hpp"
+
+#include "hal.h"
+#include "TensorFlowLiteMicro.hpp"
+
+#include <vector>
+#include <string>
+#include <set>
+#include <cstdint>
+
+namespace arm {
+namespace app {
+
+    template<typename T>
+    bool Classifier::_GetTopNResults(TfLiteTensor* tensor,
+                         std::vector<ClassificationResult>& vecResults,
+                         uint32_t topNCount,
+                         const std::vector <std::string>& labels)
+    {
+        std::set<std::pair<T, uint32_t>> sortedSet;
+
+        /* NOTE: inputVec's size verification against labels should be
+         *       checked by the calling/public function. */
+        T* tensorData = tflite::GetTensorData<T>(tensor);
+
+        /* Set initial elements. */
+        for (uint32_t i = 0; i < topNCount; ++i) {
+            sortedSet.insert({tensorData[i], i});
+        }
+
+        /* Initialise iterator. */
+        auto setFwdIter = sortedSet.begin();
+
+        /* Scan through the rest of elements with compare operations. */
+        for (uint32_t i = topNCount; i < labels.size(); ++i) {
+            if (setFwdIter->first < tensorData[i]) {
+                sortedSet.erase(*setFwdIter);
+                sortedSet.insert({tensorData[i], i});
+                setFwdIter = sortedSet.begin();
+            }
+        }
+
+        /* Final results' container. */
+        vecResults = std::vector<ClassificationResult>(topNCount);
+
+        /* For getting the floating point values, we need quantization parameters. */
+        QuantParams quantParams = GetTensorQuantParams(tensor);
+
+        /* Reset the iterator to the largest element - use reverse iterator. */
+        auto setRevIter = sortedSet.rbegin();
+
+        /* Populate results
+         * Note: we could combine this loop with the loop above, but that
+         *       would, involve more multiplications and other operations.
+         **/
+        for (size_t i = 0; i < vecResults.size(); ++i, ++setRevIter) {
+            double score = static_cast<int> (setRevIter->first);
+            vecResults[i].m_normalisedVal = quantParams.scale *
+                                         (score - quantParams.offset);
+            vecResults[i].m_label = labels[setRevIter->second];
+            vecResults[i].m_labelIdx = setRevIter->second;
+        }
+
+        return true;
+    }
+
+    template<>
+    bool Classifier::_GetTopNResults<float>(TfLiteTensor* tensor,
+                                     std::vector<ClassificationResult>& vecResults,
+                                     uint32_t topNCount,
+                                     const std::vector <std::string>& labels)
+    {
+        std::set<std::pair<float, uint32_t>> sortedSet;
+
+        /* NOTE: inputVec's size verification against labels should be
+         *       checked by the calling/public function. */
+        float* tensorData = tflite::GetTensorData<float>(tensor);
+
+        /* Set initial elements. */
+        for (uint32_t i = 0; i < topNCount; ++i) {
+            sortedSet.insert({tensorData[i], i});
+        }
+
+        /* Initialise iterator. */
+        auto setFwdIter = sortedSet.begin();
+
+        /* Scan through the rest of elements with compare operations. */
+        for (uint32_t i = topNCount; i < labels.size(); ++i) {
+            if (setFwdIter->first < tensorData[i]) {
+                sortedSet.erase(*setFwdIter);
+                sortedSet.insert({tensorData[i], i});
+                setFwdIter = sortedSet.begin();
+            }
+        }
+
+        /* Final results' container. */
+        vecResults = std::vector<ClassificationResult>(topNCount);
+
+        /* Reset the iterator to the largest element - use reverse iterator. */
+        auto setRevIter = sortedSet.rbegin();
+
+        /* Populate results
+         * Note: we could combine this loop with the loop above, but that
+         *       would, involve more multiplications and other operations.
+         **/
+        for (size_t i = 0; i < vecResults.size(); ++i, ++setRevIter) {
+            vecResults[i].m_normalisedVal = setRevIter->first;
+            vecResults[i].m_label = labels[setRevIter->second];
+            vecResults[i].m_labelIdx = setRevIter->second;
+        }
+
+        return true;
+    }
+
+    template bool  Classifier::_GetTopNResults<uint8_t>(TfLiteTensor* tensor,
+                                           std::vector<ClassificationResult>& vecResults,
+                                           uint32_t topNCount, const std::vector <std::string>& labels);
+
+    template bool  Classifier::_GetTopNResults<int8_t>(TfLiteTensor* tensor,
+                                          std::vector<ClassificationResult>& vecResults,
+                                          uint32_t topNCount, const std::vector <std::string>& labels);
+
+    bool  Classifier::GetClassificationResults(
+        TfLiteTensor* outputTensor,
+        std::vector<ClassificationResult>& vecResults,
+        const std::vector <std::string>& labels, uint32_t topNCount)
+    {
+        if (outputTensor == nullptr) {
+            printf_err("Output vector is null pointer.\n");
+            return false;
+        }
+
+        uint32_t totalOutputSize = 1;
+        for (int inputDim = 0; inputDim < outputTensor->dims->size; inputDim++){
+            totalOutputSize *= outputTensor->dims->data[inputDim];
+        }
+
+        /* Sanity checks. */
+        if (totalOutputSize < topNCount) {
+            printf_err("Output vector is smaller than %u\n", topNCount);
+            return false;
+        } else if (totalOutputSize != labels.size()) {
+            printf_err("Output size doesn't match the labels' size\n");
+            return false;
+        }
+
+        bool resultState;
+        vecResults.clear();
+
+        /* Get the top N results. */
+        switch (outputTensor->type) {
+            case kTfLiteUInt8:
+                resultState = _GetTopNResults<uint8_t>(outputTensor, vecResults, topNCount, labels);
+                break;
+            case kTfLiteInt8:
+                resultState = _GetTopNResults<int8_t>(outputTensor, vecResults, topNCount, labels);
+                break;
+            case kTfLiteFloat32:
+                resultState = _GetTopNResults<float>(outputTensor, vecResults, topNCount, labels);
+                break;
+            default:
+                printf_err("Tensor type %s not supported by classifier\n", TfLiteTypeGetName(outputTensor->type));
+                return false;
+        }
+
+        if (!resultState) {
+            printf_err("Failed to get sorted set\n");
+            return false;
+        }
+
+        return true;
+    }
+
+} /* namespace app */
+} /* namespace arm */
\ No newline at end of file
diff --git a/source/application/main/Main.cc b/source/application/main/Main.cc
new file mode 100644
index 0000000..6e1c620
--- /dev/null
+++ b/source/application/main/Main.cc
@@ -0,0 +1,70 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/****************************************************************************\
+ *               Main application file for ARM NPU on MPS3 board             *
+\****************************************************************************/
+
+#include "hal.h"                    /* our hardware abstraction api */
+#include "TensorFlowLiteMicro.hpp"  /* our inference logic api */
+
+#include <cstdio>
+
+extern void main_loop(hal_platform& platform);
+
+#if defined(__ARMCC_VERSION) && (__ARMCC_VERSION >= 6010050)
+__ASM(" .global __ARM_use_no_argv\n");
+#endif
+
+/* Print application information. */
+static void print_application_intro()
+{
+    info("%s\n", PRJ_DES_STR);
+    info("Target system design: %s\n", DESIGN_NAME);
+    info("Version %s Build date: " __DATE__ " @ " __TIME__ "\n", PRJ_VER_STR);
+    info("Copyright (C) ARM Ltd 2020. All rights reserved.\n\n");
+}
+
+int main ()
+{
+    hal_platform    platform;
+    data_acq_module dataAcq;
+    data_psn_module dataPsn;
+    platform_timer  timer;
+
+    /* Initialise the HAL and platform. */
+    hal_init(&platform, &dataAcq, &dataPsn, &timer);
+
+    if (0 == hal_platform_init(&platform)) {
+        /* Application information, UART should have been initialised. */
+        print_application_intro();
+
+        /* Check the version of TensorFlow Lite Micro. */
+        PrintTensorFlowVersion();
+
+        /* Run the application. */
+        main_loop(platform);
+    }
+
+    /* This is unreachable without errors. */
+    info("program terminating...\n");
+
+    /* Release platform. */
+    hal_platform_release(&platform);
+    return 0;
+}
+
diff --git a/source/application/main/Mfcc.cc b/source/application/main/Mfcc.cc
new file mode 100644
index 0000000..bf16159
--- /dev/null
+++ b/source/application/main/Mfcc.cc
@@ -0,0 +1,354 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "Mfcc.hpp"
+
+#include "PlatformMath.hpp"
+
+#include <cfloat>
+
+namespace arm {
+namespace app {
+namespace audio {
+
+    MfccParams::MfccParams(
+                    const float samplingFreq,
+                    const uint32_t numFbankBins,
+                    const float melLoFreq,
+                    const float melHiFreq,
+                    const uint32_t numMfccFeats,
+                    const uint32_t frameLen,
+                    const bool useHtkMethod):
+                        m_samplingFreq(samplingFreq),
+                        m_numFbankBins(numFbankBins),
+                        m_melLoFreq(melLoFreq),
+                        m_melHiFreq(melHiFreq),
+                        m_numMfccFeatures(numMfccFeats),
+                        m_frameLen(frameLen),
+
+                        /* Smallest power of 2 >= frame length. */
+                        m_frameLenPadded(pow(2, ceil((log(frameLen)/log(2))))),
+                        m_useHtkMethod(useHtkMethod)
+    {}
+
+    std::string MfccParams::Str()
+    {
+        char strC[1024];
+        snprintf(strC, sizeof(strC) - 1, "\n   \
+            \n\t Sampling frequency:         %f\
+            \n\t Number of filter banks:     %u\
+            \n\t Mel frequency limit (low):  %f\
+            \n\t Mel frequency limit (high): %f\
+            \n\t Number of MFCC features:    %u\
+            \n\t Frame length:               %u\
+            \n\t Padded frame length:        %u\
+            \n\t Using HTK for Mel scale:    %s\n",
+                this->m_samplingFreq, this->m_numFbankBins, this->m_melLoFreq,
+                this->m_melHiFreq, this->m_numMfccFeatures, this->m_frameLen,
+                this->m_frameLenPadded, this->m_useHtkMethod ? "yes" : "no");
+        return std::string{strC};
+    }
+
+    MFCC::MFCC(const MfccParams& params):
+        _m_params(params),
+        _m_filterBankInitialised(false)
+    {
+        this->_m_buffer = std::vector<float>(
+                            this->_m_params.m_frameLenPadded, 0.0);
+        this->_m_frame = std::vector<float>(
+                            this->_m_params.m_frameLenPadded, 0.0);
+        this->_m_melEnergies = std::vector<float>(
+                                this->_m_params.m_numFbankBins, 0.0);
+
+        this->_m_windowFunc = std::vector<float>(this->_m_params.m_frameLen);
+        const float multiplier = 2 * M_PI / this->_m_params.m_frameLen;
+
+        /* Create window function. */
+        for (size_t i = 0; i < this->_m_params.m_frameLen; i++) {
+            this->_m_windowFunc[i] = (0.5 - (0.5 *
+                math::MathUtils::CosineF32(static_cast<float>(i) * multiplier)));
+        }
+
+        math::MathUtils::FftInitF32(this->_m_params.m_frameLenPadded, this->_m_fftInstance);
+        debug("Instantiated MFCC object: %s\n", this->_m_params.Str().c_str());
+    }
+
+    void MFCC::Init()
+    {
+        this->_InitMelFilterBank();
+    }
+
+    float MFCC::MelScale(const float freq, const bool useHTKMethod)
+    {
+        if (useHTKMethod) {
+            return 1127.0f * logf (1.0f + freq / 700.0f);
+        } else {
+            /* Slaney formula for mel scale. */
+
+            float mel = freq / ms_freqStep;
+
+            if (freq >= ms_minLogHz) {
+                mel = ms_minLogMel + logf(freq / ms_minLogHz) / ms_logStep;
+            }
+            return mel;
+        }
+    }
+
+    float MFCC::InverseMelScale(const float melFreq, const bool useHTKMethod)
+    {
+        if (useHTKMethod) {
+            return 700.0f * (expf (melFreq / 1127.0f) - 1.0f);
+        } else {
+            /* Slaney formula for mel scale. */
+            float freq = ms_freqStep * melFreq;
+
+            if (melFreq >= ms_minLogMel) {
+                freq = ms_minLogHz * expf(ms_logStep * (melFreq - ms_minLogMel));
+            }
+            return freq;
+        }
+    }
+
+
+    bool MFCC::ApplyMelFilterBank(
+            std::vector<float>&                 fftVec,
+            std::vector<std::vector<float>>&    melFilterBank,
+            std::vector<int32_t>&               filterBankFilterFirst,
+            std::vector<int32_t>&               filterBankFilterLast,
+            std::vector<float>&                 melEnergies)
+    {
+        const size_t numBanks = melEnergies.size();
+
+        if (numBanks != filterBankFilterFirst.size() ||
+                numBanks != filterBankFilterLast.size()) {
+            printf_err("unexpected filter bank lengths\n");
+            return false;
+        }
+
+        for (size_t bin = 0; bin < numBanks; ++bin) {
+            auto filterBankIter = melFilterBank[bin].begin();
+            float melEnergy = FLT_MIN;  /* Avoid log of zero at later stages */
+            int32_t firstIndex = filterBankFilterFirst[bin];
+            int32_t lastIndex = filterBankFilterLast[bin];
+
+            for (int i = firstIndex; i <= lastIndex; i++) {
+                float energyRep = math::MathUtils::SqrtF32(fftVec[i]);
+                melEnergy += (*filterBankIter++ * energyRep);
+            }
+
+            melEnergies[bin] = melEnergy;
+        }
+
+        return true;
+    }
+
+    void MFCC::ConvertToLogarithmicScale(std::vector<float>& melEnergies)
+    {
+        for (size_t bin = 0; bin < melEnergies.size(); ++bin) {
+            melEnergies[bin] = logf(melEnergies[bin]);
+        }
+    }
+
+    void MFCC::_ConvertToPowerSpectrum()
+    {
+        const uint32_t halfDim = this->_m_params.m_frameLenPadded / 2;
+
+        /* Handle this special case. */
+        float firstEnergy = this->_m_buffer[0] * this->_m_buffer[0];
+        float lastEnergy = this->_m_buffer[1] * this->_m_buffer[1];
+
+        math::MathUtils::ComplexMagnitudeSquaredF32(
+                            this->_m_buffer.data(),
+                            this->_m_buffer.size(),
+                            this->_m_buffer.data(),
+                            this->_m_buffer.size()/2);
+
+        this->_m_buffer[0] = firstEnergy;
+        this->_m_buffer[halfDim] = lastEnergy;
+    }
+
+    std::vector<float> MFCC::CreateDCTMatrix(
+                                const int32_t inputLength,
+                                const int32_t coefficientCount)
+    {
+        std::vector<float> dctMatix(inputLength * coefficientCount);
+
+        const float normalizer = math::MathUtils::SqrtF32(2.0f/inputLength);
+        const float angleIncr = M_PI/inputLength;
+        float angle = 0;
+
+        for (int32_t k = 0, m = 0; k < coefficientCount; k++, m += inputLength) {
+            for (int32_t n = 0; n < inputLength; n++) {
+                dctMatix[m+n] = normalizer *
+                    math::MathUtils::CosineF32((n + 0.5) * angle);
+            }
+            angle += angleIncr;
+        }
+
+        return dctMatix;
+    }
+
+    float MFCC::GetMelFilterBankNormaliser(
+                    const float&    leftMel,
+                    const float&    rightMel,
+                    const bool      useHTKMethod)
+    {
+        UNUSED(leftMel);
+        UNUSED(rightMel);
+        UNUSED(useHTKMethod);
+
+        /* By default, no normalisation => return 1 */
+        return 1.f;
+    }
+
+    void MFCC::_InitMelFilterBank()
+    {
+        if (!this->_IsMelFilterBankInited()) {
+            this->_m_melFilterBank = this->_CreateMelFilterBank();
+            this->_m_dctMatrix = this->CreateDCTMatrix(
+                                    this->_m_params.m_numFbankBins,
+                                    this->_m_params.m_numMfccFeatures);
+            this->_m_filterBankInitialised = true;
+        }
+    }
+
+    bool MFCC::_IsMelFilterBankInited()
+    {
+        return this->_m_filterBankInitialised;
+    }
+
+    void MFCC::_MfccComputePreFeature(const std::vector<int16_t>& audioData)
+    {
+        this->_InitMelFilterBank();
+
+        /* TensorFlow way of normalizing .wav data to (-1, 1). */
+        constexpr float normaliser = 1.0/(1<<15);
+        for (size_t i = 0; i < this->_m_params.m_frameLen; i++) {
+            this->_m_frame[i] = static_cast<float>(audioData[i]) * normaliser;
+        }
+
+        /* Apply window function to input frame. */
+        for(size_t i = 0; i < this->_m_params.m_frameLen; i++) {
+            this->_m_frame[i] *= this->_m_windowFunc[i];
+        }
+
+        /* Set remaining frame values to 0. */
+        std::fill(this->_m_frame.begin() + this->_m_params.m_frameLen,this->_m_frame.end(), 0);
+
+        /* Compute FFT. */
+        math::MathUtils::FftF32(this->_m_frame, this->_m_buffer, this->_m_fftInstance);
+
+        /* Convert to power spectrum. */
+        this->_ConvertToPowerSpectrum();
+
+        /* Apply mel filterbanks. */
+        if (!this->ApplyMelFilterBank(this->_m_buffer,
+                                      this->_m_melFilterBank,
+                                      this->_m_filterBankFilterFirst,
+                                      this->_m_filterBankFilterLast,
+                                      this->_m_melEnergies)) {
+            printf_err("Failed to apply MEL filter banks\n");
+        }
+
+        /* Convert to logarithmic scale. */
+        this->ConvertToLogarithmicScale(this->_m_melEnergies);
+    }
+
+    std::vector<float> MFCC::MfccCompute(const std::vector<int16_t>& audioData)
+    {
+        this->_MfccComputePreFeature(audioData);
+
+        std::vector<float> mfccOut(this->_m_params.m_numMfccFeatures);
+
+        float * ptrMel = this->_m_melEnergies.data();
+        float * ptrDct = this->_m_dctMatrix.data();
+        float * ptrMfcc = mfccOut.data();
+
+        /* Take DCT. Uses matrix mul. */
+        for (size_t i = 0, j = 0; i < mfccOut.size();
+                    ++i, j += this->_m_params.m_numFbankBins) {
+            *ptrMfcc++ = math::MathUtils::DotProductF32(
+                                            ptrDct + j,
+                                            ptrMel,
+                                            this->_m_params.m_numFbankBins);
+        }
+        return mfccOut;
+    }
+
+    std::vector<std::vector<float>> MFCC::_CreateMelFilterBank()
+    {
+        size_t numFftBins = this->_m_params.m_frameLenPadded / 2;
+        float fftBinWidth = static_cast<float>(this->_m_params.m_samplingFreq) / this->_m_params.m_frameLenPadded;
+
+        float melLowFreq = MFCC::MelScale(this->_m_params.m_melLoFreq,
+                                          this->_m_params.m_useHtkMethod);
+        float melHighFreq = MFCC::MelScale(this->_m_params.m_melHiFreq,
+                                           this->_m_params.m_useHtkMethod);
+        float melFreqDelta = (melHighFreq - melLowFreq) / (this->_m_params.m_numFbankBins + 1);
+
+        std::vector<float> thisBin = std::vector<float>(numFftBins);
+        std::vector<std::vector<float>> melFilterBank(
+                                            this->_m_params.m_numFbankBins);
+        this->_m_filterBankFilterFirst =
+                        std::vector<int32_t>(this->_m_params.m_numFbankBins);
+        this->_m_filterBankFilterLast =
+                        std::vector<int32_t>(this->_m_params.m_numFbankBins);
+
+        for (size_t bin = 0; bin < this->_m_params.m_numFbankBins; bin++) {
+            float leftMel = melLowFreq + bin * melFreqDelta;
+            float centerMel = melLowFreq + (bin + 1) * melFreqDelta;
+            float rightMel = melLowFreq + (bin + 2) * melFreqDelta;
+
+            int32_t firstIndex = -1;
+            int32_t lastIndex = -1;
+            const float normaliser = this->GetMelFilterBankNormaliser(leftMel, rightMel, this->_m_params.m_useHtkMethod);
+
+            for (size_t i = 0; i < numFftBins; i++) {
+                float freq = (fftBinWidth * i);  /* Center freq of this fft bin. */
+                float mel = MFCC::MelScale(freq, this->_m_params.m_useHtkMethod);
+                thisBin[i] = 0.0;
+
+                if (mel > leftMel && mel < rightMel) {
+                    float weight;
+                    if (mel <= centerMel) {
+                        weight = (mel - leftMel) / (centerMel - leftMel);
+                    } else {
+                        weight = (rightMel - mel) / (rightMel - centerMel);
+                    }
+
+                    thisBin[i] = weight * normaliser;
+                    if (firstIndex == -1) {
+                        firstIndex = i;
+                    }
+                    lastIndex = i;
+                }
+            }
+
+            this->_m_filterBankFilterFirst[bin] = firstIndex;
+            this->_m_filterBankFilterLast[bin] = lastIndex;
+
+            /* Copy the part we care about. */
+            for (int32_t i = firstIndex; i <= lastIndex; i++) {
+                melFilterBank[bin].push_back(thisBin[i]);
+            }
+        }
+
+        return melFilterBank;
+    }
+
+} /* namespace audio */
+} /* namespace app */
+} /* namespace arm */
diff --git a/source/application/main/PlatformMath.cc b/source/application/main/PlatformMath.cc
new file mode 100644
index 0000000..a9f5049
--- /dev/null
+++ b/source/application/main/PlatformMath.cc
@@ -0,0 +1,196 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "PlatformMath.hpp"
+
+#if 0 == ARM_DSP_AVAILABLE
+    #include <cmath>
+    #include <numeric>
+#endif /* 0 == ARM_DSP_AVAILABLE */
+
+namespace arm {
+namespace app {
+namespace math {
+
+    float MathUtils::CosineF32(float radians)
+    {
+#if ARM_DSP_AVAILABLE
+        return arm_cos_f32(radians);
+#else /* ARM_DSP_AVAILABLE */
+        return cos(radians);
+#endif /* ARM_DSP_AVAILABLE */
+    }
+
+    float MathUtils::SqrtF32(float input)
+    {
+#if ARM_DSP_AVAILABLE
+        float output = 0.f;
+        arm_sqrt_f32(input, &output);
+        return output;
+#else /* ARM_DSP_AVAILABLE */
+        return sqrtf(input);
+#endif /* ARM_DSP_AVAILABLE */
+    }
+
+    float MathUtils::MeanF32(float* ptrSrc, const uint32_t srcLen)
+    {
+        if (!srcLen) {
+            return 0.f;
+        }
+
+#if ARM_DSP_AVAILABLE
+        float result = 0.f;
+        arm_mean_f32(ptrSrc, srcLen, &result);
+        return result;
+#else /* ARM_DSP_AVAILABLE */
+        float acc = std::accumulate(ptrSrc, ptrSrc + srcLen, 0.0);
+        return acc/srcLen;
+#endif /* ARM_DSP_AVAILABLE */
+    }
+
+    float MathUtils::StdDevF32(float* ptrSrc, const uint32_t srcLen,
+                               const float mean)
+    {
+        if (!srcLen) {
+            return 0.f;
+        }
+#if ARM_DSP_AVAILABLE
+        /**
+         * Note Standard deviation calculation can be off
+         * by > 0.01 but less than < 0.1, according to
+         * preliminary findings.
+         **/
+        UNUSED(mean);
+        float stdDev = 0;
+        arm_std_f32(ptrSrc, srcLen, &stdDev);
+        return stdDev;
+#else /* ARM_DSP_AVAILABLE */
+        auto VarianceFunction = [=](float acc, const float value) {
+            return acc + (((value - mean) * (value - mean))/ srcLen);
+        };
+
+        float acc = std::accumulate(ptrSrc, ptrSrc + srcLen, 0.0,
+                                    VarianceFunction);
+
+        return sqrtf(acc);
+#endif /* ARM_DSP_AVAILABLE */
+    }
+
+    bool MathUtils::FftInitF32(const uint16_t fftLen, arm::app::math::FftInstance& fftInstance)
+    {
+#if ARM_DSP_AVAILABLE
+        if (!fftInstance.initialised) {
+            arm_status status = arm_rfft_fast_init_f32(&fftInstance.instance, fftLen);
+
+            if (ARM_MATH_SUCCESS != status) {
+                return false;
+            }
+            fftInstance.initialised = true;
+        }
+#else
+        UNUSED(fftLen);
+        UNUSED(fftInstance);
+#endif /* ARM_DSP_AVAILABLE */
+        return true;
+    }
+
+    void MathUtils::FftF32(std::vector<float>& input,
+                           std::vector<float>& fftOutput,
+                           arm::app::math::FftInstance& fftInstance)
+    {
+#if ARM_DSP_AVAILABLE
+        arm_rfft_fast_f32(&fftInstance.instance, input.data(), fftOutput.data(), 0);
+#else
+        UNUSED(fftInstance);
+        const int inputLength = input.size();
+
+        for (int k = 0; k <= inputLength / 2; k++) {
+            float sumReal = 0, sumImag = 0;
+
+            for (int t = 0; t < inputLength; t++) {
+                float angle = 2 * M_PI * t * k / inputLength;
+                sumReal += input[t] * cosf(angle);
+                sumImag += -input[t] * sinf(angle);
+            }
+
+            /* Arrange output to [real0, realN/2, real1, im1, real2, im2, ...] */
+            if (k == 0) {
+                fftOutput[0] = sumReal;
+            } else if (k == inputLength / 2) {
+                fftOutput[1] = sumReal;
+            } else {
+                fftOutput[k*2] = sumReal;
+                fftOutput[k*2 + 1] = sumImag;
+            };
+        }
+#endif /* ARM_DSP_AVAILABLE */
+    }
+
+    void MathUtils::VecLogarithmF32(std::vector <float>& input,
+                                    std::vector <float>& output)
+    {
+#if ARM_DSP_AVAILABLE
+        arm_vlog_f32(input.data(), output.data(),
+                     output.size());
+#else /* ARM_DSP_AVAILABLE */
+        for (auto in = input.begin(), out = output.begin();
+                in != input.end(); ++in, ++out) {
+            *out = logf(*in);
+        }
+#endif /* ARM_DSP_AVAILABLE */
+    }
+
+    float MathUtils::DotProductF32(float* srcPtrA, float* srcPtrB,
+                                   const uint32_t srcLen)
+    {
+        float output = 0.f;
+
+#if ARM_DSP_AVAILABLE
+        arm_dot_prod_f32(srcPtrA, srcPtrB, srcLen, &output);
+#else /* ARM_DSP_AVAILABLE */
+        for (uint32_t i = 0; i < srcLen; ++i) {
+            output += *srcPtrA++ * *srcPtrB++;
+        }
+#endif /* ARM_DSP_AVAILABLE */
+
+        return output;
+    }
+
+    bool MathUtils::ComplexMagnitudeSquaredF32(float* ptrSrc,
+                                               const uint32_t srcLen,
+                                               float* ptrDst,
+                                               const uint32_t dstLen)
+    {
+        if (dstLen < srcLen/2) {
+            printf_err("dstLen must be greater than srcLen/2");
+            return false;
+        }
+
+#if ARM_DSP_AVAILABLE
+        arm_cmplx_mag_squared_f32(ptrSrc, ptrDst, srcLen/2);
+#else /* ARM_DSP_AVAILABLE */
+        for (uint32_t j = 0; j < srcLen; ++j) {
+            const float real = *ptrSrc++;
+            const float im = *ptrSrc++;
+            *ptrDst++ = real*real + im*im;
+        }
+#endif /* ARM_DSP_AVAILABLE */
+        return true;
+    }
+
+} /* namespace math */
+} /* namespace app */
+} /* namespace arm */
\ No newline at end of file
diff --git a/source/application/main/Profiler.cc b/source/application/main/Profiler.cc
new file mode 100644
index 0000000..f364759
--- /dev/null
+++ b/source/application/main/Profiler.cc
@@ -0,0 +1,219 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "Profiler.hpp"
+
+#include <cstring>
+#include <string>
+#include <sstream>
+
+namespace arm {
+namespace app {
+
+    template<class T>
+    static void writeStatLine(std::ostringstream& s,
+                              const char* desc,
+                              T total,
+                              uint32_t samples,
+                              T min,
+                              T max)
+    {
+        s << "\t" << desc << total << " / "
+          << ((double)total / samples) << " / "
+          << min << " / " << max << std::endl;
+    }
+
+    Profiler::Profiler(hal_platform* platform, const char* name = "Unknown")
+    : _m_name(name)
+    {
+        if (platform && platform->inited) {
+            this->_m_pPlatform = platform;
+            this->Reset();
+        } else {
+            printf_err("Profiler %s initialised with invalid platform\n",
+                this->_m_name.c_str());
+        }
+    }
+
+    bool Profiler::StartProfiling(const char* name)
+    {
+        if (name) {
+            this->SetName(name);
+        }
+        if (this->_m_pPlatform && !this->_m_started) {
+            this->_m_pPlatform->timer->reset();
+            this->_m_tstampSt = this->_m_pPlatform->timer->start_profiling();
+            this->_m_started = true;
+            return true;
+        }
+        printf_err("Failed to start profiler %s\n", this->_m_name.c_str());
+        return false;
+    }
+
+    bool Profiler::StopProfiling()
+    {
+        if (this->_m_pPlatform && this->_m_started) {
+            this->_m_tstampEnd = this->_m_pPlatform->timer->stop_profiling();
+            this->_m_started = false;
+
+            this->_AddProfilingUnit(this->_m_tstampSt, this->_m_tstampEnd, this->_m_name);
+
+            return true;
+        }
+        printf_err("Failed to stop profiler %s\n", this->_m_name.c_str());
+        return false;
+    }
+
+    bool Profiler::StopProfilingAndReset()
+    {
+        if (this->StopProfiling()) {
+            this->Reset();
+            return true;
+        }
+        printf_err("Failed to stop profiler %s\n", this->_m_name.c_str());
+        return false;
+    }
+
+    void Profiler::Reset()
+    {
+        this->_m_started = false;
+        memset(&this->_m_tstampSt, 0, sizeof(this->_m_tstampSt));
+        memset(&this->_m_tstampEnd, 0, sizeof(this->_m_tstampEnd));
+    }
+
+    std::string Profiler::GetResultsAndReset()
+    {
+        std::ostringstream strResults;
+
+        for (const auto& item: this->_m_series) {
+            auto name = item.first;
+            ProfilingSeries series = item.second;
+
+            uint32_t samplesNum = series.size();
+
+            uint64_t totalNpuCycles = 0;        /* Total NPU cycles (idle + active). */
+            uint64_t totalActiveNpuCycles = 0;  /* Active NPU cycles. */
+            uint64_t totalCpuCycles = 0;        /* Total CPU cycles. */
+            time_t totalTimeMs = 0;
+
+            uint64_t minActiveNpuCycles = series[0].activeNpuCycles;
+            uint64_t minIdleNpuCycles = series[0].npuCycles - minActiveNpuCycles;
+            uint64_t minActiveCpuCycles = series[0].cpuCycles - minActiveNpuCycles;
+            time_t minTimeMs = series[0].time;
+
+            uint64_t maxIdleNpuCycles = 0;
+            uint64_t maxActiveNpuCycles = 0;
+            uint64_t maxActiveCpuCycles = 0;
+            time_t maxTimeMs = 0;
+
+            for(ProfilingUnit& unit: series){
+                totalNpuCycles += unit.npuCycles;
+                totalActiveNpuCycles += unit.activeNpuCycles;
+                totalCpuCycles += unit.cpuCycles;
+                totalTimeMs += unit.time;
+
+                maxActiveNpuCycles = std::max(maxActiveNpuCycles,
+                                              unit.activeNpuCycles);
+                maxIdleNpuCycles = std::max(maxIdleNpuCycles,
+                                            unit.npuCycles - maxActiveNpuCycles);
+                maxActiveCpuCycles = std::max(maxActiveCpuCycles,
+                                              unit.cpuCycles - maxActiveNpuCycles);
+                maxTimeMs = std::max(maxTimeMs, unit.time);
+
+                minActiveNpuCycles = std::min(minActiveNpuCycles,
+                                              unit.activeNpuCycles);
+                minIdleNpuCycles = std::min(minIdleNpuCycles,
+                                            unit.npuCycles - minActiveNpuCycles);
+                minActiveCpuCycles = std::min(minActiveCpuCycles,
+                                              unit.cpuCycles - minActiveNpuCycles);
+                minTimeMs = std::min(minTimeMs, unit.time);
+            }
+
+            strResults << "Profile for " << name << ": " << std::endl;
+
+            if (samplesNum > 1) {
+                strResults << "\tSamples: " << samplesNum << std::endl;
+                strResults << "\t                            Total / Avg./ Min / Max"
+                           << std::endl;
+
+                writeStatLine<uint64_t>(strResults, "Active NPU cycles:          ",
+                                        totalActiveNpuCycles, samplesNum,
+                                        minActiveNpuCycles, maxActiveNpuCycles);
+
+                writeStatLine<uint64_t>(strResults, "Idle NPU cycles:            ",
+                                        (totalNpuCycles - totalActiveNpuCycles),
+                                        samplesNum, minIdleNpuCycles, maxIdleNpuCycles);
+
+#if defined(CPU_PROFILE_ENABLED)
+                writeStatLine<uint64_t>(strResults, "Active CPU cycles (approx): ",
+                                        (totalCpuCycles - totalActiveNpuCycles),
+                                        samplesNum, minActiveCpuCycles,
+                                        maxActiveCpuCycles);
+
+                writeStatLine<time_t>(strResults, "Time in ms:                 ",
+                                        totalTimeMs, samplesNum, minTimeMs, maxTimeMs);
+#endif
+            } else {
+                strResults << "\tActive NPU cycles: " << totalActiveNpuCycles
+                           << std::endl;
+                strResults << "\tIdle NPU cycles:   "
+                           << (totalNpuCycles - totalActiveNpuCycles)
+                           << std::endl;
+#if defined(CPU_PROFILE_ENABLED)
+                strResults << "\tActive CPU cycles: "
+                           << (totalCpuCycles - totalActiveNpuCycles)
+                           << " (approx)" << std::endl;
+
+                strResults << "\tTime in ms:        " << totalTimeMs << std::endl;
+#endif
+            }
+        }
+        this->Reset();
+        return strResults.str();
+    }
+
+    void Profiler::SetName(const char* str)
+    {
+        this->_m_name = std::string(str);
+    }
+
+    void Profiler::_AddProfilingUnit(time_counter start, time_counter end,
+                                     const std::string& name)
+    {
+        platform_timer * timer = this->_m_pPlatform->timer;
+
+        struct ProfilingUnit unit;
+
+        if (timer->cap.npu_cycles && timer->get_npu_total_cycle_diff &&
+            timer->get_npu_active_cycle_diff)
+        {
+            unit.npuCycles = timer->get_npu_total_cycle_diff(&start, &end);
+            unit.activeNpuCycles = timer->get_npu_active_cycle_diff(&start, &end);
+        }
+
+        if (timer->cap.cpu_cycles && timer->get_cpu_cycle_diff) {
+            unit.cpuCycles = timer->get_cpu_cycle_diff(&start, &end);
+        }
+
+        if (timer->cap.duration_ms && timer->get_duration_ms) {
+            unit.time = timer->get_duration_ms(&start, &end);
+        }
+
+        this->_m_series[name].emplace_back(unit);
+    }
+
+} /* namespace app */
+} /* namespace arm */
\ No newline at end of file
diff --git a/source/application/main/UseCaseCommonUtils.cc b/source/application/main/UseCaseCommonUtils.cc
new file mode 100644
index 0000000..4ea5e4d
--- /dev/null
+++ b/source/application/main/UseCaseCommonUtils.cc
@@ -0,0 +1,119 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "UseCaseCommonUtils.hpp"
+
+#include "InputFiles.hpp"
+
+namespace arm {
+namespace app {
+
+    bool RunInference(hal_platform& platform, arm::app::Model& model)
+    {
+        Profiler profiler{&platform, "Inference"};
+        profiler.StartProfiling();
+
+        bool runInf = model.RunInference();
+
+        profiler.StopProfiling();
+        std::string profileResults = profiler.GetResultsAndReset();
+        info("%s\n", profileResults.c_str());
+
+        return runInf;
+    }
+
+    int ReadUserInputAsInt(hal_platform& platform)
+    {
+        char chInput[128];
+        memset(chInput, 0, sizeof(chInput));
+
+        platform.data_acq->get_input(chInput, sizeof(chInput));
+        return atoi(chInput);
+    }
+
+    void DumpTensor(TfLiteTensor* tensor, const size_t lineBreakForNumElements)
+    {
+        char strhex[8];
+        std::string strdump;
+
+        if (!tensor) {
+            printf_err("invalid tensor\n");
+            return;
+        }
+
+        const uint32_t tensorSz = tensor->bytes;
+        const uint8_t* tensorData = tflite::GetTensorData<uint8_t>(tensor);
+
+        for (size_t i = 0; i < tensorSz; ++i) {
+            if (0 == i % lineBreakForNumElements) {
+                printf("%s\n\t", strdump.c_str());
+                strdump.clear();
+            }
+            snprintf(strhex, sizeof(strhex) - 1,
+                     "0x%02x, ", tensorData[i]);
+            strdump += std::string(strhex);
+        }
+
+        if (strdump.size()) {
+            printf("%s\n", strdump.c_str());
+        }
+    }
+
+    bool ListFilesHandler(ApplicationContext& ctx)
+    {
+        auto& model = ctx.Get<Model&>("model");
+        auto& platform = ctx.Get<hal_platform&>("platform");
+
+        constexpr uint32_t dataPsnTxtStartX = 20;
+        constexpr uint32_t dataPsnTxtStartY = 40;
+
+        if (!model.IsInited()) {
+            printf_err("Model is not initialised! Terminating processing.\n");
+            return false;
+        }
+
+        /* Clear the LCD */
+        platform.data_psn->clear(COLOR_BLACK);
+
+        /* Show the total number of embedded files. */
+        std::string strNumFiles = std::string{"Total Number of Files: "} +
+                                   std::to_string(NUMBER_OF_FILES);
+        platform.data_psn->present_data_text(strNumFiles.c_str(),
+                                             strNumFiles.size(),
+                                             dataPsnTxtStartX,
+                                             dataPsnTxtStartY,
+                                             0);
+
+#if NUMBER_OF_FILES > 0
+        constexpr uint32_t dataPsnTxtYIncr = 16;
+        info("List of Files:\n");
+        uint32_t yVal = dataPsnTxtStartY + dataPsnTxtYIncr;
+        for (uint32_t i = 0; i < NUMBER_OF_FILES; ++i, yVal += dataPsnTxtYIncr) {
+
+            std::string currentFilename{get_filename(i)};
+            platform.data_psn->present_data_text(currentFilename.c_str(),
+                                                 currentFilename.size(),
+                                                 dataPsnTxtStartX, yVal, 0);
+
+            info("\t%u => %s\n", i, currentFilename.c_str());
+        }
+#endif /* NUMBER_OF_FILES > 0 */
+
+        return true;
+    }
+
+} /* namespace app */
+} /* namespace arm */
\ No newline at end of file
diff --git a/source/application/main/include/AppContext.hpp b/source/application/main/include/AppContext.hpp
new file mode 100644
index 0000000..588dfaa
--- /dev/null
+++ b/source/application/main/include/AppContext.hpp
@@ -0,0 +1,102 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef APP_CTX_HPP
+#define APP_CTX_HPP
+
+#include <string>
+#include <map>
+
+namespace arm {
+namespace app {
+
+    class IAttribute
+    {
+    public:
+        virtual ~IAttribute() = default;
+    };
+
+    template<typename T>
+    class Attribute : public IAttribute
+    {
+    public:
+        ~Attribute() override = default;
+
+        explicit Attribute(const T value): _m_value(value){}
+
+        T Get()
+        {
+            return _m_value;
+        }
+    private:
+        T _m_value;
+    };
+
+    /* Application context class */
+    class ApplicationContext {
+    public:
+
+        /**
+         * @brief     Saves given value as a named attribute in the context.
+         * @tparam    T value type.
+         * @param[in] name     Context attribute name.
+         * @param[in] object   Value to save in the context.
+         */
+        template<typename T>
+        void Set(const std::string &name, T object)
+        {
+            this->_m_attributes[name] = new Attribute<T>(object);
+        }
+
+        /**
+         * @brief      Gets the saved attribute from the context by the given name.
+         * @tparam     T value type.
+         * @param[in]  name   Context attribute name.
+         * @return     Value saved in the context.
+         */
+        template<typename T>
+        T Get(const std::string &name)
+        {
+            auto a = (Attribute<T>*)_m_attributes[name];
+            return a->Get();
+        }
+
+        /**
+         * @brief      Checks if an attribute for a given name exists in the context.
+         * @param[in]  name   Attribute name.
+         * @return     true if attribute exists, false otherwise
+         */
+        bool Has(const std::string& name)
+        {
+            return _m_attributes.find(name) != _m_attributes.end();
+        }
+
+        ApplicationContext() = default;
+
+        ~ApplicationContext() {
+            for (auto& attribute : _m_attributes)
+                delete attribute.second;
+
+            this->_m_attributes.clear();
+        }
+    private:
+        std::map<std::string, IAttribute*> _m_attributes;
+    };
+
+} /* namespace app */
+} /* namespace arm */
+
+#endif /* APP_CTX_HPP */
diff --git a/source/application/main/include/AudioUtils.hpp b/source/application/main/include/AudioUtils.hpp
new file mode 100644
index 0000000..cba981d
--- /dev/null
+++ b/source/application/main/include/AudioUtils.hpp
@@ -0,0 +1,171 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef AUDIO_UTILS_HPP
+#define AUDIO_UTILS_HPP
+
+#include <cstddef>
+#include <cstdint>
+
+namespace arm {
+namespace app {
+namespace audio {
+
+    template<class T>
+    class SlidingWindow {
+    public:
+
+        /**
+         * @brief     Creates the window slider through the given data.
+         *
+         * @param[in] data         Pointer to the data to slide through.
+         * @param[in] dataSize     Size in T type elements wise.
+         * @param[in] windowSize   Sliding window size in T type wise elements.
+         * @param[in] stride       Stride size in T type wise elements.
+         */
+        SlidingWindow(T *data, size_t dataSize,
+                      size_t windowSize, size_t stride) {
+            m_start = data;
+            m_dataSize = dataSize;
+            m_size = windowSize;
+            m_stride = stride;
+        }
+
+        SlidingWindow() = default;
+
+        ~SlidingWindow() = default;
+
+        /**
+         * @brief  Get the next data window.
+         * @return Pointer to the next window, if next window is not available nullptr is returned.
+         */
+        virtual T *Next() {
+            if (HasNext()) {
+                m_count++;
+                return m_start + Index() * m_stride;
+            } else {
+                return nullptr;
+            }
+        }
+
+        /**
+         * @brief  Checks if the next data portion is available.
+         * @return true if next data portion is available.
+         */
+        virtual bool HasNext() {
+            return m_size + m_count * m_stride <= m_dataSize;
+        }
+
+        /**
+         * @brief Reset the slider to the initial position.
+         */
+        virtual void Reset() {
+            m_count = 0;
+        }
+
+        /**
+         * @brief     Resets the slider to the start of the new data.
+         *            New data size MUST be the same as the old one.
+         * @param[in] newStart   Pointer to the new data to slide through.
+         */
+        virtual void Reset(T *newStart) {
+            m_start = newStart;
+            Reset();
+        }
+
+        /**
+         * @brief  Gets current index of the sliding window.
+         * @return Current position of the sliding window in number of strides.
+         */
+        size_t Index() {
+            return m_count == 0? 0: m_count - 1;
+        }
+
+        /**
+         * @brief  Gets the index from the start of the data where the next window will begin.
+         *         While Index() returns the index of sliding window itself this function
+         *         returns the index of the data element itself.
+         * @return Index from the start of the data where the next sliding window will begin.
+         */
+        virtual uint32_t NextWindowStartIndex() {
+            return m_count == 0? 0: ((m_count) * m_stride);
+        }
+
+        /**
+         * @brief     Go to given sliding window index.
+         * @param[in] index   New position of the sliding window. If index is invalid
+         *                    (greater than possible range of strides) then next call to Next() will return nullptr.
+         */
+        void FastForward(size_t index) {
+            m_count = index;
+        }
+
+        /**
+         * @brief  Calculates whole number of times the window can stride through the given data.
+         * @return Maximum number of whole strides.
+         */
+         size_t TotalStrides() {
+            if (m_size > m_dataSize) {
+                return 0;
+            }
+            return ((m_dataSize - m_size)/m_stride);
+        }
+
+        /**
+         * @brief  Calculates number of times the window can stride through the given data.
+         *         May not be a whole number.
+         * @return Number of strides to cover all data.
+         */
+        float FractionalTotalStrides() {
+            if (this->m_dataSize < this->m_size) {
+                return 0;
+            } else {
+                return ((this->m_dataSize - this->m_size)/ static_cast<float>(this->m_stride));
+            }
+        }
+
+    protected:
+        T *m_start = nullptr;
+        size_t m_dataSize = 0;
+        size_t m_size = 0;
+        size_t m_stride = 0;
+        size_t m_count = 0;
+    };
+
+    /*
+     * Sliding window for ASR will cover the whole of the input, even if
+     * this means the last window is not a full window length.
+     */
+    template<class T>
+    class ASRSlidingWindow : public SlidingWindow<T> {
+    public:
+        using SlidingWindow<T>::SlidingWindow;
+
+        /**
+         * @brief  Checks if the next data portion is available.
+         * @return true if next data portion is available.
+         */
+        bool HasNext() {
+            return this->m_count < 1 + this->FractionalTotalStrides() && (this->NextWindowStartIndex() < this->m_dataSize);
+        }
+    };
+
+
+} /* namespace audio */
+} /* namespace app */
+} /* namespace arm */
+
+#endif /* AUDIO_UTILS_HPP */
\ No newline at end of file
diff --git a/source/application/main/include/ClassificationResult.hpp b/source/application/main/include/ClassificationResult.hpp
new file mode 100644
index 0000000..eae28e4
--- /dev/null
+++ b/source/application/main/include/ClassificationResult.hpp
@@ -0,0 +1,41 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef CLASSIFICATION_RESULT_HPP
+#define CLASSIFICATION_RESULT_HPP
+
+#include <string>
+
+namespace arm {
+namespace app {
+
+    /**
+     * @brief   Class representing a single classification result.
+     */
+    class ClassificationResult {
+    public:
+        double          m_normalisedVal = 0.0;
+        std::string     m_label;
+        uint32_t        m_labelIdx = 0;
+
+        ClassificationResult() = default;
+        ~ClassificationResult() = default;
+    };
+
+} /* namespace app */
+} /* namespace arm */
+
+#endif /* CLASSIFICATION_RESULT_HPP */
\ No newline at end of file
diff --git a/source/application/main/include/Classifier.hpp b/source/application/main/include/Classifier.hpp
new file mode 100644
index 0000000..510e6f9
--- /dev/null
+++ b/source/application/main/include/Classifier.hpp
@@ -0,0 +1,74 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef CLASSIFIER_HPP
+#define CLASSIFIER_HPP
+
+#include "ClassificationResult.hpp"
+#include "TensorFlowLiteMicro.hpp"
+
+#include <vector>
+
+namespace arm {
+namespace app {
+
+    /**
+     * @brief   Classifier - a helper class to get certain number of top
+     *          results from the output vector from a classification NN.
+     **/
+    class Classifier{
+    public:
+        /** @brief Constructor. */
+        Classifier() = default;
+
+        /**
+         * @brief       Gets the top N classification results from the
+         *              output vector.
+         * @param[in]   outputTensor   Inference output tensor from an NN model.
+         * @param[out]  vecResults     A vector of classification results.
+         *                             populated by this function.
+         * @param[in]   labels         Labels vector to match classified classes.
+         * @param[in]   topNCount      Number of top classifications to pick. Default is 1.
+         * @return      true if successful, false otherwise.
+         **/
+        virtual bool GetClassificationResults(
+            TfLiteTensor* outputTensor,
+            std::vector<ClassificationResult>& vecResults,
+            const std::vector <std::string>& labels, uint32_t topNCount);
+
+    private:
+        /**
+         * @brief       Utility function that gets the top N classification results from the
+         *              output vector.
+         * @tparam T value type
+         * @param[in]   tensor       Inference output tensor from an NN model.
+         * @param[out]  vecResults   A vector of classification results
+         *                           populated by this function.
+         * @param[in]   topNCount    Number of top classifications to pick.
+         * @param[in]   labels       Labels vector to match classified classes.
+         * @return      true if successful, false otherwise.
+         **/
+        template<typename T>
+        bool _GetTopNResults(TfLiteTensor* tensor,
+                            std::vector<ClassificationResult>& vecResults,
+                            uint32_t topNCount,
+                            const std::vector <std::string>& labels);
+    };
+
+} /* namespace app */
+} /* namespace arm */
+
+#endif /* CLASSIFIER_HPP */
diff --git a/source/application/main/include/DataStructures.hpp b/source/application/main/include/DataStructures.hpp
new file mode 100644
index 0000000..5cc8b5e
--- /dev/null
+++ b/source/application/main/include/DataStructures.hpp
@@ -0,0 +1,132 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef DATA_STRUCTURES_HPP
+#define DATA_STRUCTURES_HPP
+
+#include "hal.h"
+
+#include <iterator>
+
+namespace arm {
+namespace app {
+
+    /**
+     * Class Array2d is a data structure that represents a two dimensional array.
+     * The data is allocated in contiguous memory, arranged row-wise
+     * and individual elements can be accessed with the () operator.
+     * For example a two dimensional array D of size (M, N) can be accessed:
+     *
+     *               _|<------------- col size = N  -------->|
+     *               |  D(r=0, c=0) D(r=0, c=1)... D(r=0, c=N)
+     *               |  D(r=1, c=0) D(r=1, c=1)... D(r=1, c=N)
+     *               |  ...
+     *    row size = M  ...
+     *               |  ...
+     *               _  D(r=M, c=0) D(r=M, c=1)... D(r=M, c=N)
+     *
+     */
+    template<typename T>
+    class Array2d {
+    public:
+        /**
+         * @brief     Creates the array2d with the given sizes.
+         * @param[in] rows   Number of rows.
+         * @param[in] cols   Number of columns.
+         */
+        Array2d(unsigned rows, unsigned cols)
+        {
+            if (rows == 0 || cols == 0) {
+                printf_err("Array2d constructor has 0 size.\n");
+                _m_data = nullptr;
+                return;
+            }
+            _m_rows = rows;
+            _m_cols = cols;
+            _m_data = new T[rows * cols];
+        }
+
+        ~Array2d()
+        {
+            delete[] _m_data;
+        }
+
+        T& operator() (unsigned int row, unsigned int col)
+        {
+#if defined(DEBUG)
+            if (row >= _m_rows || col >= _m_cols ||  _m_data == nullptr) {
+                printf_err("Array2d subscript out of bounds.\n");
+            }
+#endif /* defined(DEBUG) */
+            return _m_data[_m_cols * row + col];
+        }
+
+        T operator() (unsigned int row, unsigned int col) const
+        {
+#if defined(DEBUG)
+            if (row >= _m_rows || col >= _m_cols ||  _m_data == nullptr) {
+                printf_err("const Array2d subscript out of bounds.\n");
+            }
+#endif /* defined(DEBUG) */
+            return _m_data[_m_cols * row + col];
+        }
+
+        /**
+         * @brief  Gets rows number of the current array2d.
+         * @return Number of rows.
+         */
+        size_t size(size_t dim)
+        {
+            switch (dim)
+            {
+                case 0:
+                    return _m_rows;
+                case 1:
+                    return _m_cols;
+                default:
+                    return 0;
+            }
+        }
+
+        /**
+         * @brief Gets the array2d total size.
+         */
+        size_t totalSize()
+        {
+            return _m_rows * _m_cols;
+        }
+
+        /**
+         * array2d iterator.
+         */
+        using iterator=T*;
+        using const_iterator=T const*;
+
+        iterator begin() { return _m_data; }
+        iterator end() { return _m_data + totalSize(); }
+        const_iterator begin() const { return _m_data; }
+        const_iterator end() const { return _m_data + totalSize(); };
+
+    private:
+        size_t _m_rows;
+        size_t _m_cols;
+        T* _m_data;
+    };
+
+} /* namespace app */
+} /* namespace arm */
+
+#endif /* DATA_STRUCTURES_HPP */
\ No newline at end of file
diff --git a/source/application/main/include/Mfcc.hpp b/source/application/main/include/Mfcc.hpp
new file mode 100644
index 0000000..6379fab
--- /dev/null
+++ b/source/application/main/include/Mfcc.hpp
@@ -0,0 +1,255 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef MFCC_HPP
+#define MFCC_HPP
+
+#include "PlatformMath.hpp"
+
+#include <vector>
+#include <cstdint>
+#include <cmath>
+#include <limits>
+#include <string>
+
+namespace arm {
+namespace app {
+namespace audio {
+
+    /* MFCC's consolidated parameters. */
+    class MfccParams {
+    public:
+        float       m_samplingFreq;
+        uint32_t    m_numFbankBins;
+        float       m_melLoFreq;
+        float       m_melHiFreq;
+        uint32_t    m_numMfccFeatures;
+        uint32_t    m_frameLen;
+        uint32_t    m_frameLenPadded;
+        bool        m_useHtkMethod;
+
+        /** @brief  Constructor */
+        MfccParams(float samplingFreq, uint32_t numFbankBins,
+                   float melLoFreq, float melHiFreq,
+                   uint32_t numMfccFeats, uint32_t frameLen,
+                   bool useHtkMethod);
+
+        MfccParams()  = delete;
+
+        ~MfccParams() = default;
+
+        /** @brief  String representation of parameters */
+        std::string Str();
+    };
+
+    /**
+     * @brief   Class for MFCC feature extraction.
+     *          Based on https://github.com/ARM-software/ML-KWS-for-MCU/blob/master/Deployment/Source/MFCC/mfcc.cpp
+     *          This class is designed to be generic and self-sufficient but
+     *          certain calculation routines can be overridden to accommodate
+     *          use-case specific requirements.
+     */
+    class MFCC {
+    public:
+        /**
+         * @brief       Constructor
+         * @param[in]   params   MFCC parameters
+        */
+        explicit MFCC(const MfccParams& params);
+
+        MFCC() = delete;
+
+        ~MFCC() = default;
+
+        /**
+        * @brief        Extract MFCC  features for one single small frame of
+        *               audio data e.g. 640 samples.
+        * @param[in]    audioData   Vector of audio samples to calculate
+        *                           features for.
+        * @return       Vector of extracted MFCC features.
+        **/
+        std::vector<float> MfccCompute(const std::vector<int16_t>& audioData);
+
+        /** @brief  Initialise. */
+        void Init();
+
+       /**
+        * @brief        Extract MFCC features and quantise for one single small
+        *               frame of audio data e.g. 640 samples.
+        * @param[in]    audioData     Vector of audio samples to calculate
+        *                             features for.
+        * @param[in]    quantScale    Quantisation scale.
+        * @param[in]    quantOffset   Quantisation offset.
+        * @return       Vector of extracted quantised MFCC features.
+        **/
+        template<typename T>
+        std::vector<T> MfccComputeQuant(const std::vector<int16_t>& audioData,
+                                        const float quantScale,
+                                        const int quantOffset)
+        {
+            this->_MfccComputePreFeature(audioData);
+            float minVal = std::numeric_limits<T>::min();
+            float maxVal = std::numeric_limits<T>::max();
+
+            std::vector<T> mfccOut(this->_m_params.m_numMfccFeatures);
+            const size_t numFbankBins = this->_m_params.m_numFbankBins;
+
+            /* Take DCT. Uses matrix mul. */
+            for (size_t i = 0, j = 0; i < mfccOut.size(); ++i, j += numFbankBins) {
+                float sum = 0;
+                for (size_t k = 0; k < numFbankBins; ++k) {
+                    sum += this->_m_dctMatrix[j + k] * this->_m_melEnergies[k];
+                }
+                /* Quantize to T. */
+                sum = std::round((sum / quantScale) + quantOffset);
+                mfccOut[i] = static_cast<T>(std::min<float>(std::max<float>(sum, minVal), maxVal));
+            }
+
+            return mfccOut;
+        }
+
+        /* Constants */
+        static constexpr float ms_logStep = /*logf(6.4)*/ 1.8562979903656 / 27.0;
+        static constexpr float ms_freqStep = 200.0 / 3;
+        static constexpr float ms_minLogHz = 1000.0;
+        static constexpr float ms_minLogMel = ms_minLogHz / ms_freqStep;
+
+    protected:
+        /**
+         * @brief       Project input frequency to Mel Scale.
+         * @param[in]   freq           Input frequency in floating point.
+         * @param[in]   useHTKmethod   bool to signal if HTK method is to be
+         *                             used for calculation.
+         * @return      Mel transformed frequency in floating point.
+         **/
+        static float MelScale(float freq,
+                              bool  useHTKMethod = true);
+
+        /**
+         * @brief       Inverse Mel transform - convert MEL warped frequency
+         *              back to normal frequency.
+         * @param[in]   freq           Mel frequency in floating point.
+         * @param[in]   useHTKmethod   bool to signal if HTK method is to be
+         *                             used for calculation.
+         * @return      Real world frequency in floating point.
+         **/
+        static float InverseMelScale(float melFreq,
+                                     bool  useHTKMethod = true);
+
+        /**
+         * @brief       Populates MEL energies after applying the MEL filter
+         *              bank weights and adding them up to be placed into
+         *              bins, according to the filter bank's first and last
+         *              indices (pre-computed for each filter bank element
+         *              by _CreateMelFilterBank function).
+         * @param[in]   fftVec                  Vector populated with FFT magnitudes.
+         * @param[in]   melFilterBank           2D Vector with filter bank weights.
+         * @param[in]   filterBankFilterFirst   Vector containing the first indices of filter bank
+         *                                      to be used for each bin.
+         * @param[in]   filterBankFilterLast    Vector containing the last indices of filter bank
+         *                                      to be used for each bin.
+         * @param[out]  melEnergies             Pre-allocated vector of MEL energies to be
+         *                                      populated.
+         * @return      true if successful, false otherwise.
+         */
+        virtual bool ApplyMelFilterBank(
+            std::vector<float>&                 fftVec,
+            std::vector<std::vector<float>>&    melFilterBank,
+            std::vector<int32_t>&               filterBankFilterFirst,
+            std::vector<int32_t>&               filterBankFilterLast,
+            std::vector<float>&                 melEnergies);
+
+        /**
+         * @brief           Converts the Mel energies for logarithmic scale.
+         * @param[in,out]   melEnergies   1D vector of Mel energies.
+         **/
+        virtual void ConvertToLogarithmicScale(std::vector<float>& melEnergies);
+
+        /**
+         * @brief       Create a matrix used to calculate Discrete Cosine
+         *              Transform.
+         * @param[in]   inputLength        Input length of the buffer on which
+         *                                 DCT will be performed.
+         * @param[in]   coefficientCount   Total coefficients per input length.
+         * @return      1D vector with inputLength x coefficientCount elements
+         *              populated with DCT coefficients.
+         */
+        virtual std::vector<float> CreateDCTMatrix(
+                                    int32_t inputLength,
+                                    int32_t coefficientCount);
+
+        /**
+         * @brief       Given the low and high Mel values, get the normaliser
+         *              for weights to be applied when populating the filter
+         *              bank.
+         * @param[in]   leftMel        Low Mel frequency value.
+         * @param[in]   rightMel       High Mel frequency value.
+         * @param[in]   useHTKMethod   bool to signal if HTK method is to be
+         *                             used for calculation.
+         * @return      Value to use for normalizing.
+         */
+        virtual float GetMelFilterBankNormaliser(
+                        const float&   leftMel,
+                        const float&   rightMel,
+                        bool     useHTKMethod);
+
+    private:
+        MfccParams                      _m_params;
+        std::vector<float>              _m_frame;
+        std::vector<float>              _m_buffer;
+        std::vector<float>              _m_melEnergies;
+        std::vector<float>              _m_windowFunc;
+        std::vector<std::vector<float>> _m_melFilterBank;
+        std::vector<float>              _m_dctMatrix;
+        std::vector<int32_t>            _m_filterBankFilterFirst;
+        std::vector<int32_t>            _m_filterBankFilterLast;
+        bool                            _m_filterBankInitialised;
+        arm::app::math::FftInstance     _m_fftInstance;
+
+        /**
+         * @brief       Initialises the filter banks and the DCT matrix. **/
+        void _InitMelFilterBank();
+
+        /**
+         * @brief       Signals whether the instance of MFCC has had its
+         *              required buffers initialised.
+         * @return      true if initialised, false otherwise.
+         **/
+        bool _IsMelFilterBankInited();
+
+        /**
+         * @brief       Create mel filter banks for MFCC calculation.
+         * @return      2D vector of floats.
+         **/
+        std::vector<std::vector<float>> _CreateMelFilterBank();
+
+        /**
+         * @brief       Computes and populates internal memeber buffers used
+         *              in MFCC feature calculation
+         * @param[in]   audioData   1D vector of 16-bit audio data.
+         */
+        void _MfccComputePreFeature(const std::vector<int16_t>& audioData);
+
+        /** @brief       Computes the magnitude from an interleaved complex array. */
+        void _ConvertToPowerSpectrum();
+
+    };
+
+} /* namespace audio */
+} /* namespace app */
+} /* namespace arm */
+
+#endif /* MFCC_HPP */
\ No newline at end of file
diff --git a/source/application/main/include/PlatformMath.hpp b/source/application/main/include/PlatformMath.hpp
new file mode 100644
index 0000000..45e6a9e
--- /dev/null
+++ b/source/application/main/include/PlatformMath.hpp
@@ -0,0 +1,151 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef PLATFORM_MATH_HPP
+#define PLATFORM_MATH_HPP
+
+#include "hal.h"
+
+/* See if ARM DSP functions can be used. */
+#if PLATFORM_HAL == PLATFORM_CORTEX_M_BAREMETAL
+    #if defined(__DSP_PRESENT) && (__DSP_PRESENT == 1U)
+
+        #define ARM_DSP_AVAILABLE   (1U)
+        #include "arm_math.h"
+        #define M_PI    (PI)
+
+    #endif /* defined(__DSP_PRESENT) && (__DSP_PRESENT == 1U) */
+#endif /* PLATFORM_HAL == PLATFORM_CORTEX_M_BAREMETAL */
+
+#include <vector>
+
+namespace arm {
+namespace app {
+namespace math {
+
+    struct FftInstance {
+#if ARM_DSP_AVAILABLE
+        arm_rfft_fast_instance_f32 instance;
+#endif
+        bool initialised = false;
+    };
+
+    /* Class to provide Math functions like FFT, mean, stddev etc.
+     * This will allow other classes, functions to be independent of
+     * #if definition checks and provide a cleaner API. Also, it will
+     * consolidate all arm math functions used in one place and make
+     * them easier to test. */
+    class MathUtils {
+
+    public:
+        /**
+         * @brief       Get the cosine value of the argument in floating point.
+         * @param[in]   radians   Angle in radians.
+         * @return      Cosine value (floating point).
+         */
+        static float CosineF32(float radians);
+
+        /**
+         * @brief       Get the square root of the argument in floating point.
+         * @param[in]   input   Value to compute square root of.
+         * @return      Square root (floating point) value.
+         */
+        static float SqrtF32(float input);
+
+        /**
+         * @brief       Gets the mean of a floating point array of elements.
+         * @param[in]   ptrSrc   Pointer to the first element.
+         * @param[in]   srcLen   Number of elements in the array/vector.
+         * @return      Average value.
+         */
+        static float MeanF32(float* ptrSrc, uint32_t srcLen);
+
+        /**
+         * @brief       Gets the standard deviation of a floating point array
+         *              of elements.
+         * @param[in]   ptrSrc   Pointer to the first element.
+         * @param[in]   srcLen   Number of elements in the array/vector.
+         * @param[in]   mean     Pre-computed mean value.
+         * @return      Standard deviation value.
+         */
+        static float StdDevF32(float* ptrSrc, uint32_t srcLen,
+                               float mean);
+
+        /**
+         * @brief       Initialises the internal FFT structures (if available
+         *              for the platform). This function should be called
+         *              prior to Fft32 function call if built with ARM DSP functions.
+         * @param[in]   fftLen        Requested length of the FFT.
+         * @param[in]   fftInstance   FFT instance struct to use.
+         * @return      true if successful, false otherwise.
+         */
+        static bool FftInitF32(const uint16_t fftLen, arm::app::math::FftInstance& fftInstance);
+
+        /**
+         * @brief       Computes the FFT for the input vector.
+         * @param[in]   input       Floating point vector of input elements
+         * @param[out]  fftOutput   Output buffer to be populated by computed FFTs.
+         * @param[in]   fftInstance FFT instance struct to use.
+         */
+        static void FftF32(std::vector<float>& input,
+                           std::vector<float>& fftOutput,
+                           arm::app::math::FftInstance& fftInstance);
+
+        /**
+         * @brief       Computes the natural logarithms of input floating point
+         *              vector
+         * @param[in]   input    Floating point input vector
+         * @param[out]  output   Pre-allocated buffer to be populated with
+         *                       natural log values of each input element.
+         */
+        static void VecLogarithmF32(std::vector <float>& input,
+                                    std::vector <float>& output);
+
+        /**
+         * @brief       Computes the dot product of two 1D floating point
+         *              vectors.
+         *              result = sum(srcA[0]*srcB[0] + srcA[1]*srcB[1] + ..)
+         * @param[in]   srcPtrA   Pointer to the first element of first
+         *                        array.
+         * @param[in]   srcPtrB   Pointer to the first element of second
+         *                        array.
+         * @param[in]   srcLen    Number of elements in the array/vector.
+         * @return      Dot product.
+         */
+        static float DotProductF32(float* srcPtrA, float* srcPtrB,
+                                   const uint32_t srcLen);
+
+        /**
+         * @brief       Computes the squared magnitude of floating point
+         *              complex number array.
+         * @param[in]   ptrSrc   Pointer to the first element of input
+         *                       array.
+         * @param[in]   srcLen   Number of elements in the array/vector.
+         * @param[out]  ptrDst   Output buffer to be populated.
+         * @param[in]   dstLen   Output buffer len (for sanity check only).
+         * @return      true if successful, false otherwise.
+         */
+        static bool ComplexMagnitudeSquaredF32(float* ptrSrc,
+                                               const uint32_t srcLen,
+                                               float* ptrDst,
+                                               const uint32_t dstLen);
+
+    };
+} /* namespace math */
+} /* namespace app */
+} /* namespace arm */
+
+#endif /* PLATFORM_MATH_HPP */
\ No newline at end of file
diff --git a/source/application/main/include/Profiler.hpp b/source/application/main/include/Profiler.hpp
new file mode 100644
index 0000000..b16a63b
--- /dev/null
+++ b/source/application/main/include/Profiler.hpp
@@ -0,0 +1,110 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef APP_PROFILER_HPP
+#define APP_PROFILER_HPP
+
+#include "hal.h"
+
+#include <string>
+#include <map>
+#include <vector>
+
+namespace arm {
+namespace app {
+
+    /** A single profiling unit definition. */
+    struct ProfilingUnit {
+        uint64_t npuCycles = 0;
+        uint64_t activeNpuCycles = 0;
+        uint64_t cpuCycles = 0;
+        time_t time = 0;
+    };
+
+    /* A collection of profiling units. */
+    using ProfilingSeries = std::vector<arm::app::ProfilingUnit>;
+
+    /* A map for string identifiable profiling series. */
+    using ProfilingMap = std::map<std::string, ProfilingSeries>;
+
+    /**
+     * @brief   A very simple profiler example using the platform timer
+     *          implementation.
+     */
+    class Profiler {
+    public:
+        /**
+         * @brief       Constructor for profiler.
+         * @param[in]   platform   Pointer to a valid, initialised hal platform.
+         * @param[in]   name       A friendly name for this profiler.
+         **/
+        Profiler(hal_platform* platform, const char* name);
+
+        /** Block the default constructor. */
+        Profiler() = delete;
+
+        /** Default destructor. */
+        ~Profiler() = default;
+
+        /** @brief  Start profiling => get starting time-stamp. */
+        bool StartProfiling(const char* name = nullptr);
+
+        /** @brief  Stop profiling => get the ending time-stamp. */
+        bool StopProfiling();
+
+        /** @brief  Stops the profiling and internally resets the
+         *          platform timers. */
+        bool StopProfilingAndReset();
+
+        /** @brief  Reset the platform timers. */
+        void Reset();
+
+        /**
+         * @brief   Gets the results as string and resets the profiler.
+         * @returns Result string.
+         **/
+        std::string GetResultsAndReset();
+
+        /** @brief Set the profiler name. */
+        void SetName(const char* str);
+
+    private:
+        ProfilingMap    _m_series;                /* Profiling series map. */
+        time_counter    _m_tstampSt;              /* Container for a current starting timestamp. */
+        time_counter    _m_tstampEnd;             /* Container for a current ending timestamp. */
+        hal_platform *  _m_pPlatform = nullptr;   /* Platform pointer - to get the timer. */
+
+        bool            _m_started = false;       /* Indicates profiler has been started. */
+
+        std::string     _m_name;                  /* Name given to this profiler. */
+
+        /**
+         * @brief       Appends the profiling unit computed by the "start" and
+         *              "end" timestamps to the profiling series identified by
+         *              the name provided.
+         * @param[in]   start   Starting time-stamp.
+         * @param[in]   end     Ending time-stamp.
+         * @param[in]   name    Name for the profiling unit series to be
+         *                      appended to.
+         **/
+        void _AddProfilingUnit(time_counter start, time_counter end,
+                               const std::string& name);
+    };
+
+} /* namespace app */
+} /* namespace arm */
+
+#endif /* APP_PROFILER_HPP */
diff --git a/source/application/main/include/UseCaseCommonUtils.hpp b/source/application/main/include/UseCaseCommonUtils.hpp
new file mode 100644
index 0000000..02200e8
--- /dev/null
+++ b/source/application/main/include/UseCaseCommonUtils.hpp
@@ -0,0 +1,76 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef USECASE_COMMON_UTILS_HPP
+#define USECASE_COMMON_UTILS_HPP
+
+#include "hal.h"
+#include "Model.hpp"
+#include "AppContext.hpp"
+#include "Profiler.hpp"
+
+/* Helper macro to convert RGB888 to RGB565 format. */
+#define RGB888_TO_RGB565(R8,G8,B8)  ((((R8>>3) & 0x1F) << 11) |     \
+                                     (((G8>>2) & 0x3F) << 5)  |     \
+                                     ((B8>>3) & 0x1F))
+
+constexpr uint16_t COLOR_BLACK  = 0;
+constexpr uint16_t COLOR_GREEN  = RGB888_TO_RGB565(  0, 255,  0); // 2016;
+constexpr uint16_t COLOR_YELLOW = RGB888_TO_RGB565(255, 255,  0); // 65504;
+
+namespace arm {
+namespace app {
+
+    /**
+     * @brief           Run inference using given model
+     *                  object. If profiling is enabled, it will log the
+     *                  statistics too.
+     * @param[in]       platform   Reference to the hal platform object.
+     * @param[in]       model      Reference to the initialised model.
+     * @return          true if inference succeeds, false otherwise.
+     **/
+    bool RunInference(hal_platform& platform, arm::app::Model& model);
+
+    /**
+     * @brief           Read input and return as an integer.
+     * @param[in]       platform   Reference to the hal platform object.
+     * @param[in]       model      Reference to the initialised model.
+     * @return          Integer value corresponding to the user input.
+     **/
+    int ReadUserInputAsInt(hal_platform& platform);
+
+#if VERIFY_TEST_OUTPUT
+    /**
+     * @brief       Helper function to dump a tensor to stdout
+     * @param[in]   tensor  tensor to be dumped
+     * @param[in]   lineBreakForNumElements     number of elements
+     *              after which line break will be added.
+     **/
+    void DumpTensor(TfLiteTensor* tensor,
+                    const size_t lineBreakForNumElements = 16);
+#endif /* VERIFY_TEST_OUTPUT */
+
+    /**
+     * @brief       List the files baked in the application.
+     * @param[in]   ctx   Reference to the application context.
+     * @return      true or false based on event being handled.
+     **/
+    bool ListFilesHandler(ApplicationContext& ctx);
+
+} /* namespace app */
+} /* namespace arm */
+
+#endif /* USECASE_COMMON_UTILS_HPP */
\ No newline at end of file
diff --git a/source/application/tensorflow-lite-micro/Model.cc b/source/application/tensorflow-lite-micro/Model.cc
new file mode 100644
index 0000000..0775467
--- /dev/null
+++ b/source/application/tensorflow-lite-micro/Model.cc
@@ -0,0 +1,332 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "Model.hpp"
+
+#include "hal.h"
+
+#include <cstdint>
+
+/* Initialise the model */
+arm::app::Model::~Model()
+{
+    if (this->_m_pInterpreter) {
+        delete this->_m_pInterpreter;
+    }
+
+    /**
+     * No clean-up function available for allocator in TensorFlow Lite Micro yet.
+     **/
+}
+
+arm::app::Model::Model() :
+    _m_inited (false),
+    _m_type(kTfLiteNoType)
+{
+    this->_m_pErrorReporter = &this->_m_uErrorReporter;
+}
+
+bool arm::app::Model::Init(tflite::MicroAllocator* allocator)
+{
+    /* Following tf lite micro example:
+     * Map the model into a usable data structure. This doesn't involve any
+     * copying or parsing, it's a very lightweight operation. */
+    const uint8_t* model_addr = ModelPointer();
+    debug("loading model from @ 0x%p\n", model_addr);
+    this->_m_pModel = ::tflite::GetModel(model_addr);
+
+    if (this->_m_pModel->version() != TFLITE_SCHEMA_VERSION) {
+        this->_m_pErrorReporter->Report(
+            "[ERROR] model's schema version %d is not equal "
+            "to supported version %d.",
+            this->_m_pModel->version(), TFLITE_SCHEMA_VERSION);
+        return false;
+    }
+
+    /* Pull in only the operation implementations we need.
+     * This relies on a complete list of all the ops needed by this graph.
+     * An easier approach is to just use the AllOpsResolver, but this will
+     * incur some penalty in code space for op implementations that are not
+     * needed by this graph.
+     * static ::tflite::ops::micro::AllOpsResolver resolver; */
+    /* NOLINTNEXTLINE(runtime-global-variables) */
+    debug("loading op resolver\n");
+
+    this->EnlistOperations();
+
+    /* Create allocator instance, if it doesn't exist */
+    this->_m_pAllocator = allocator;
+    if (!this->_m_pAllocator) {
+        /* Create an allocator instance */
+        info("Creating allocator using tensor arena in %s\n",
+            ACTIVATION_BUF_SECTION_NAME);
+
+        this->_m_pAllocator = tflite::MicroAllocator::Create(
+                                        this->GetTensorArena(),
+                                        this->GetActivationBufferSize(),
+                                        this->_m_pErrorReporter);
+
+        if (!this->_m_pAllocator) {
+            printf_err("Failed to create allocator\n");
+            return false;
+        }
+        debug("Created new allocator @ 0x%p\n", this->_m_pAllocator);
+    } else {
+        debug("Using existing allocator @ 0x%p\n", this->_m_pAllocator);
+    }
+
+    this->_m_pInterpreter = new ::tflite::MicroInterpreter(
+        this->_m_pModel, this->GetOpResolver(),
+        this->_m_pAllocator, this->_m_pErrorReporter);
+
+    if (!this->_m_pInterpreter) {
+        printf_err("Failed to allocate interpreter\n");
+        return false;
+    }
+
+    /* Allocate memory from the tensor_arena for the model's tensors. */
+    info("Allocating tensors\n");
+    TfLiteStatus allocate_status = this->_m_pInterpreter->AllocateTensors();
+
+    if (allocate_status != kTfLiteOk) {
+        this->_m_pErrorReporter->Report("[ERROR] allocateTensors() failed");
+        printf_err("tensor allocation failed!\n");
+        delete this->_m_pInterpreter;
+        return false;
+    }
+
+    /* Get information about the memory area to use for the model's input. */
+    this->_m_input.resize(this->GetNumInputs());
+    for (size_t inIndex = 0; inIndex < this->GetNumInputs(); inIndex++)
+        this->_m_input[inIndex] = this->_m_pInterpreter->input(inIndex);
+
+    this->_m_output.resize(this->GetNumOutputs());
+    for (size_t outIndex = 0; outIndex < this->GetNumOutputs(); outIndex++)
+        this->_m_output[outIndex] = this->_m_pInterpreter->output(outIndex);
+
+    if (this->_m_input.empty() || this->_m_output.empty()) {
+        printf_err("failed to get tensors\n");
+        return false;
+    } else {
+        this->_m_type = this->_m_input[0]->type;  /* Input 0 should be the main input */
+
+        /* Clear the input & output tensors */
+        for (size_t inIndex = 0; inIndex < this->GetNumInputs(); inIndex++) {
+            std::memset(this->_m_input[inIndex]->data.data, 0, this->_m_input[inIndex]->bytes);
+        }
+        for (size_t outIndex = 0; outIndex < this->GetNumOutputs(); outIndex++) {
+            std::memset(this->_m_output[outIndex]->data.data, 0, this->_m_output[outIndex]->bytes);
+        }
+
+        this->LogInterpreterInfo();
+    }
+
+    this->_m_inited = true;
+    return true;
+}
+
+tflite::MicroAllocator* arm::app::Model::GetAllocator()
+{
+    if (this->IsInited()) {
+        return this->_m_pAllocator;
+    }
+    return nullptr;
+}
+
+void arm::app::Model::LogTensorInfo(TfLiteTensor* tensor)
+{
+    if (!tensor) {
+        printf_err("Invalid tensor\n");
+        assert(tensor);
+        return;
+    }
+
+    debug("\ttensor is assigned to 0x%p\n", tensor);
+    info("\ttensor type is %s\n", TfLiteTypeGetName(tensor->type));
+    info("\ttensor occupies %u bytes with dimensions\n",
+         (uint32_t)tensor->bytes);
+    for (int i = 0 ; i < tensor->dims->size; ++i) {
+        info ("\t\t%d: %3d\n", i, tensor->dims->data[i]);
+    }
+
+    TfLiteQuantization quant = tensor->quantization;
+    if (kTfLiteAffineQuantization == quant.type) {
+        auto* quantParams = (TfLiteAffineQuantization*)quant.params;
+        info("Quant dimension: %u\n", quantParams->quantized_dimension);
+        for (int i = 0; i < quantParams->scale->size; ++i) {
+            info("Scale[%d] = %f\n", i, quantParams->scale->data[i]);
+        }
+        for (int i = 0; i < quantParams->zero_point->size; ++i) {
+            info("ZeroPoint[%d] = %d\n", i, quantParams->zero_point->data[i]);
+        }
+    }
+}
+
+void arm::app::Model::LogInterpreterInfo()
+{
+    if (!this->_m_pInterpreter) {
+        printf_err("Invalid interpreter\n");
+        return;
+    }
+
+    info("Model INPUT tensors: \n");
+    for (auto input : this->_m_input) {
+        this->LogTensorInfo(input);
+    }
+
+    info("Model OUTPUT tensors: \n");
+    for (auto output : this->_m_output) {
+        this->LogTensorInfo(output);
+    }
+
+    info("Activation buffer (a.k.a tensor arena) size used: %zu\n",
+        this->_m_pInterpreter->arena_used_bytes());
+
+    const uint32_t nOperators = this->_m_pInterpreter->operators_size();
+    info("Number of operators: %u\n", nOperators);
+
+    /* For each operator, display registration information */
+    for (uint32_t i = 0 ; i < nOperators; ++i) {
+        const tflite::NodeAndRegistration nodeReg =
+            this->_m_pInterpreter->node_and_registration(i);
+        const TfLiteRegistration* reg = nodeReg.registration;
+        std::string opName{""};
+
+        if (reg) {
+            if (tflite::BuiltinOperator_CUSTOM == reg->builtin_code) {
+                opName = std::string(reg->custom_name);
+            } else {
+                opName = std::string(EnumNameBuiltinOperator(
+                            tflite::BuiltinOperator(reg->builtin_code)));
+            }
+        }
+        info("\tOperator %u: %s\n", i, opName.c_str());
+    }
+}
+
+bool arm::app::Model::IsInited() const
+{
+    return this->_m_inited;
+}
+
+bool arm::app::Model::IsDataSigned() const
+{
+    return this->GetType() == kTfLiteInt8;
+}
+
+bool arm::app::Model::RunInference()
+{
+    bool inference_state = false;
+    if (this->_m_pModel && this->_m_pInterpreter) {
+        if (kTfLiteOk != this->_m_pInterpreter->Invoke()) {
+            printf_err("Invoke failed.\n");
+        } else {
+            inference_state = true;
+        }
+    } else {
+        printf_err("Error: No interpreter!\n");
+    }
+    return inference_state;
+}
+
+TfLiteTensor* arm::app::Model::GetInputTensor(size_t index) const
+{
+    if (index < this->GetNumInputs()) {
+        return this->_m_input.at(index);
+    }
+    return nullptr;
+}
+
+TfLiteTensor* arm::app::Model::GetOutputTensor(size_t index) const
+{
+    if (index < this->GetNumOutputs()) {
+        return this->_m_output.at(index);
+    }
+    return nullptr;
+}
+
+size_t arm::app::Model::GetNumInputs() const
+{
+    if (this->_m_pModel && this->_m_pInterpreter) {
+        return this->_m_pInterpreter->inputs_size();
+    }
+    return 0;
+}
+
+size_t arm::app::Model::GetNumOutputs() const
+{
+    if (this->_m_pModel && this->_m_pInterpreter) {
+        return this->_m_pInterpreter->outputs_size();
+    }
+    return 0;
+}
+
+
+TfLiteType arm::app::Model::GetType() const
+{
+    return this->_m_type;
+}
+
+TfLiteIntArray* arm::app::Model::GetInputShape(size_t index) const
+{
+    if (index < this->GetNumInputs()) {
+        return this->_m_input.at(index)->dims;
+    }
+    return nullptr;
+}
+
+TfLiteIntArray* arm::app::Model::GetOutputShape(size_t index) const
+{
+    if (index < this->GetNumOutputs()) {
+        return this->_m_output.at(index)->dims;
+    }
+    return nullptr;
+}
+
+bool arm::app::Model::ShowModelInfoHandler()
+{
+    if (!this->IsInited()) {
+        printf_err("Model is not initialised! Terminating processing.\n");
+        return false;
+    }
+
+    PrintTensorFlowVersion();
+    info("Model info:\n");
+    this->LogInterpreterInfo();
+
+#if defined(ARM_NPU)
+    info("Use of Arm uNPU is enabled\n");
+#else   /* ARM_NPU */
+    info("Use of Arm uNPU is disabled\n");
+#endif  /* ARM_NPU */
+
+    return true;
+}
+namespace arm {
+namespace app {
+    static uint8_t  _tensor_arena[ACTIVATION_BUF_SZ] ACTIVATION_BUF_ATTRIBUTE;
+} /* namespace app */
+} /* namespace arm */
+
+size_t arm::app::Model::GetActivationBufferSize()
+{
+    return ACTIVATION_BUF_SZ;
+}
+
+uint8_t *arm::app::Model::GetTensorArena()
+{
+    return _tensor_arena;
+}
\ No newline at end of file
diff --git a/source/application/tensorflow-lite-micro/TensorFlowLiteMicro.cc b/source/application/tensorflow-lite-micro/TensorFlowLiteMicro.cc
new file mode 100644
index 0000000..ce36a8f
--- /dev/null
+++ b/source/application/tensorflow-lite-micro/TensorFlowLiteMicro.cc
@@ -0,0 +1,47 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "TensorFlowLiteMicro.hpp"
+
+#include "hal.h"
+
+void PrintTensorFlowVersion()
+{
+    info("uTFL version: %u.%u.%u\n", TF_MAJOR_VERSION, TF_MINOR_VERSION,
+        TF_PATCH_VERSION);
+}
+
+arm::app::QuantParams arm::app::GetTensorQuantParams(TfLiteTensor* tensor)
+{
+    arm::app::QuantParams params;
+    if (kTfLiteAffineQuantization == tensor->quantization.type) {
+        auto* quantParams = (TfLiteAffineQuantization*) (tensor->quantization.params);
+        if (quantParams && 0 == quantParams->quantized_dimension) {
+            if (quantParams->scale->size) {
+                params.scale = quantParams->scale->data[0];
+            }
+            if (quantParams->zero_point->size) {
+                params.offset = quantParams->zero_point->data[0];
+            }
+        } else if (tensor->params.scale != 0.0) {
+            /* Legacy tensorflow quantisation parameters */
+            params.scale = tensor->params.scale;
+            params.offset = tensor->params.zero_point;
+        }
+    }
+    return params;
+}
+
diff --git a/source/application/tensorflow-lite-micro/include/BufAttributes.hpp b/source/application/tensorflow-lite-micro/include/BufAttributes.hpp
new file mode 100644
index 0000000..126172b
--- /dev/null
+++ b/source/application/tensorflow-lite-micro/include/BufAttributes.hpp
@@ -0,0 +1,85 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef BUF_ATTRIBUTES_HPP
+#define BUF_ATTRIBUTES_HPP
+
+#ifdef __has_attribute
+#define HAVE_ATTRIBUTE(x) __has_attribute(x)
+#else   /* __has_attribute */
+#define HAVE_ATTRIBUTE(x) 0
+#endif  /* __has_attribute */
+
+#if HAVE_ATTRIBUTE(aligned) || (defined(__GNUC__) && !defined(__clang__))
+
+/* We want all buffers/sections to be aligned to 16 byte.  */
+#define ALIGNMENT_REQ               aligned(16)
+
+/* Model data section name. */
+#define MODEL_SECTION               section("nn_model")
+
+/* Label section name */
+#define LABEL_SECTION               section("labels")
+
+#ifndef ACTIVATION_BUF_SZ
+    #warning  "ACTIVATION_BUF_SZ needs to be defined. Using default value"
+    #define ACTIVATION_BUF_SZ       0x00200000
+#endif  /* ACTIVATION_BUF_SZ */
+
+#ifndef ACTIVATION_BUF_SRAM_SZ
+    #warning  "ACTIVATION_BUF_SRAM_SZ needs to be defined. Using default value = 0"
+    #define ACTIVATION_BUF_SRAM_SZ  0x00000000
+#endif /* ACTIVATION_BUF_SRAM_SZ */
+
+/**
+ * Activation buffer aka tensor arena section name
+ * We have to place the tensor arena in different region based on its size.
+ * If it fits in SRAM, we place it there, and also mark it by giving it a
+ * different section name. The scatter file places the ZI data in DDR and
+ * the uninitialised region in the SRAM.
+ **/
+#define ACTIVATION_BUF_SECTION_SRAM section(".bss.NoInit.activation_buf")
+#define ACTIVATION_BUF_SECTION_DRAM section("activation_buf")
+
+#if     ACTIVATION_BUF_SZ > ACTIVATION_BUF_SRAM_SZ /* Will buffer not fit in SRAM? */
+    #define ACTIVATION_BUF_SECTION      ACTIVATION_BUF_SECTION_DRAM
+    #define ACTIVATION_BUF_SECTION_NAME ("DDR")
+#else   /* ACTIVATION_BUF_SZ > 0x00200000 */
+    #define ACTIVATION_BUF_SECTION  ACTIVATION_BUF_SECTION_SRAM
+    #define ACTIVATION_BUF_SECTION_NAME ("SRAM")
+#endif  /* ACTIVATION_BUF_SZ > 0x00200000 */
+
+/* IFM section name. */
+#define IFM_BUF_SECTION             section("ifm")
+
+/* Form the attributes, alignment is mandatory. */
+#define MAKE_ATTRIBUTE(x)           __attribute__((ALIGNMENT_REQ, x))
+#define MODEL_TFLITE_ATTRIBUTE      MAKE_ATTRIBUTE(MODEL_SECTION)
+#define ACTIVATION_BUF_ATTRIBUTE    MAKE_ATTRIBUTE(ACTIVATION_BUF_SECTION)
+#define IFM_BUF_ATTRIBUTE           MAKE_ATTRIBUTE(IFM_BUF_SECTION)
+#define LABELS_ATTRIBUTE            MAKE_ATTRIBUTE(LABEL_SECTION)
+
+#else /* HAVE_ATTRIBUTE(aligned) || (defined(__GNUC__) && !defined(__clang__)) */
+
+#define MODEL_TFLITE_ATTRIBUTE
+#define ACTIVATION_BUF_ATTRIBUTE
+#define IFM_BUF_ATTRIBUTE
+#define LABELS_ATTRIBUTE
+
+#endif /* HAVE_ATTRIBUTE(aligned) || (defined(__GNUC__) && !defined(__clang__)) */
+
+#endif /* BUF_ATTRIBUTES_HPP */
\ No newline at end of file
diff --git a/source/application/tensorflow-lite-micro/include/Model.hpp b/source/application/tensorflow-lite-micro/include/Model.hpp
new file mode 100644
index 0000000..70cf9ca
--- /dev/null
+++ b/source/application/tensorflow-lite-micro/include/Model.hpp
@@ -0,0 +1,142 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef MODEL_HPP
+#define MODEL_HPP
+
+#include "TensorFlowLiteMicro.hpp"
+#include "BufAttributes.hpp"
+
+#include <cstdint>
+
+namespace arm {
+namespace app {
+
+    /**
+     * @brief   NN model class wrapping the underlying TensorFlow-Lite-Micro API.
+     */
+    class Model {
+    public:
+        /** @brief Constructor. */
+        Model();
+
+        /** @brief Destructor. */
+        ~Model();
+
+        /** @brief  Gets the pointer to the model's input tensor at given input index. */
+        TfLiteTensor* GetInputTensor(size_t index) const;
+
+        /** @brief  Gets the pointer to the model's output tensor at given output index. */
+        TfLiteTensor* GetOutputTensor(size_t index) const;
+
+        /** @brief  Gets the model's data type. */
+        TfLiteType GetType() const;
+
+        /** @brief  Gets the pointer to the model's input shape. */
+        TfLiteIntArray* GetInputShape(size_t index) const;
+
+        /** @brief  Gets the pointer to the model's output shape at given output index. */
+        TfLiteIntArray* GetOutputShape(size_t index) const;
+
+        /** @brief  Gets the number of input tensors the model has. */
+        size_t GetNumInputs() const;
+
+        /** @brief  Gets the number of output tensors the model has. */
+        size_t GetNumOutputs() const;
+
+        /** @brief  Logs the tensor information to stdout. */
+        void LogTensorInfo(TfLiteTensor* tensor);
+
+        /** @brief  Logs the interpreter information to stdout. */
+        void LogInterpreterInfo();
+
+        /** @brief      Initialise the model class object.
+         *  @param[in]  allocator   Optional: a pre-initialised micro allocator pointer,
+         *                          if available. If supplied, this allocator will be used
+         *                          to create the interpreter instance.
+         *  @return     true if initialisation succeeds, false otherwise.
+        **/
+        bool Init(tflite::MicroAllocator* allocator = nullptr);
+
+        /**
+         * @brief       Gets the allocator pointer for this instance.
+         * @return      Pointer to a tflite::MicroAllocator object, if
+         *              available; nullptr otherwise.
+         **/
+        tflite::MicroAllocator* GetAllocator();
+
+        /** @brief  Checks if this object has been initialised. */
+        bool IsInited() const;
+
+        /** @brief  Checks if the model uses signed data. */
+        bool IsDataSigned() const;
+
+        /** @brief  Runs the inference (invokes the interpreter). */
+        bool RunInference();
+
+        /** @brief   Model information handler common to all models.
+         *  @return  true or false based on execution success.
+         **/
+        bool ShowModelInfoHandler();
+
+        /** @brief   Gets a pointer to the tensor arena. */
+        uint8_t* GetTensorArena();
+
+    protected:
+        /** @brief      Gets the pointer to the NN model data array.
+         *  @return     Pointer of uint8_t type.
+         **/
+        virtual const uint8_t* ModelPointer() = 0;
+
+        /** @brief      Gets the model size.
+         *  @return     size_t, size in bytes.
+         **/
+        virtual size_t ModelSize() = 0;
+
+        /**
+         * @brief       Gets the op resolver for the model instance.
+         * @return      const reference to a tflite::MicroOpResolver object.
+         **/
+        virtual const tflite::MicroOpResolver& GetOpResolver() = 0;
+
+        /**
+         * @brief       Add all the operators required for the given model.
+         *              Implementation of this should come from the use case.
+         * @return      true is ops are successfully added, false otherwise.
+         **/
+        virtual bool EnlistOperations() = 0;
+
+        /** @brief   Gets the total size of tensor arena available for use. */
+        size_t GetActivationBufferSize();
+
+    private:
+        tflite::MicroErrorReporter      _m_uErrorReporter;                     /* Error reporter object. */
+        tflite::ErrorReporter*          _m_pErrorReporter      = nullptr;      /* Pointer to the error reporter. */
+        const tflite::Model*            _m_pModel              = nullptr;      /* Tflite model pointer. */
+        tflite::MicroInterpreter*       _m_pInterpreter        = nullptr;      /* Tflite interpreter. */
+        tflite::MicroAllocator*         _m_pAllocator          = nullptr;      /* Tflite micro allocator. */
+        bool                            _m_inited              = false;        /* Indicates whether this object has been initialised. */
+
+        std::vector<TfLiteTensor*>      _m_input              = {};           /* Model's input tensor pointers. */
+        std::vector<TfLiteTensor*>      _m_output             = {};           /* Model's output tensor pointers. */
+        TfLiteType                      _m_type               = kTfLiteNoType;/* Model's data type. */
+
+    };
+
+} /* namespace app */
+} /* namespace arm */
+
+#endif /* MODEL_HPP */
diff --git a/source/application/tensorflow-lite-micro/include/TensorFlowLiteMicro.hpp b/source/application/tensorflow-lite-micro/include/TensorFlowLiteMicro.hpp
new file mode 100644
index 0000000..677b4ba
--- /dev/null
+++ b/source/application/tensorflow-lite-micro/include/TensorFlowLiteMicro.hpp
@@ -0,0 +1,78 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef TENSORFLOW_LITE_MICRO_LOCAL_HPP
+#define TENSORFLOW_LITE_MICRO_LOCAL_HPP
+
+/* We include all our TensorFlow Lite Micro headers here */
+
+/**
+ * TensorFlow Lite Micro sources can generate a lot of warnings from the usage
+ * of a single macro (TF_LITE_REMOVE_VIRTUAL_DELETE). Suppress the known ones
+ * here to prevent them from masking warnings that might be generated by our
+ * application sources.
+ */
+#if defined(__ARMCC_VERSION) && (__ARMCC_VERSION >= 6010050)
+    #pragma clang diagnostic push
+    #pragma clang diagnostic ignored "-Wunused-parameter"
+    #include "tensorflow/lite/micro/micro_mutable_op_resolver.h"
+    #include "tensorflow/lite/micro/micro_interpreter.h"
+    #include "tensorflow/lite/micro/micro_error_reporter.h"
+    #include "tensorflow/lite/micro/all_ops_resolver.h"
+    #pragma clang diagnostic pop
+#elif defined(__GNUC__)
+    #pragma GCC diagnostic push
+    #pragma GCC diagnostic ignored "-Wunused-parameter"
+    #include "tensorflow/lite/micro/micro_mutable_op_resolver.h"
+    #include "tensorflow/lite/micro/micro_interpreter.h"
+    #include "tensorflow/lite/micro/micro_error_reporter.h"
+    #include "tensorflow/lite/micro/all_ops_resolver.h"
+    #pragma GCC diagnostic pop
+#else
+    #include "tensorflow/lite/micro/micro_mutable_op_resolver.h"
+    #include "tensorflow/lite/micro/micro_interpreter.h"
+    #include "tensorflow/lite/micro/micro_error_reporter.h"
+    #include "tensorflow/lite/micro/all_ops_resolver.h"
+#endif
+
+#include "tensorflow/lite/c/common.h"
+#include "tensorflow/lite/micro/kernels/micro_ops.h"
+#include "tensorflow/lite/schema/schema_generated.h"
+#include "tensorflow/lite/version.h"
+
+#if defined (TESTS)
+    #include "tensorflow/lite/micro/test_helpers.h"
+#endif /* defined (TESTS) */
+
+namespace arm {
+namespace app {
+
+    struct QuantParams {
+        float   scale   = 1.0;
+        int     offset  = 0;
+    };
+
+    QuantParams GetTensorQuantParams(TfLiteTensor* tensor);
+
+} /* namespace app */
+} /* namespace arm */
+
+/**
+ * @brief Prints the tensor flow version in use to stdout.
+ */
+void PrintTensorFlowVersion();
+
+#endif /* TENSORFLOW_LITE_MICRO_LOCAL_HPP */