Opensource ML embedded evaluation kit
Change-Id: I12e807f19f5cacad7cef82572b6dd48252fd61fd
diff --git a/source/application/hal/hal.c b/source/application/hal/hal.c
new file mode 100644
index 0000000..dbf94ba
--- /dev/null
+++ b/source/application/hal/hal.c
@@ -0,0 +1,264 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "hal.h" /* API */
+
+#include "hal_config.h" /* HAL configuration */
+#include "system_init.h"
+
+#include <stdio.h>
+#include <assert.h>
+
+#if defined(ARM_NPU)
+
+#include "ethosu_driver.h" /* Arm Ethos-U55 driver header */
+#include "timing_adapter.h" /* Arm Ethos-U55 timing adapter driver header */
+#include "timing_adapter_settings.h" /* Arm Ethos-U55 timing adapter settings */
+
+/**
+ * @brief Initialises the Arm Ethos-U55 NPU
+ * @return 0 if successful, error code otherwise
+ **/
+static int _arm_npu_init(void);
+
+#endif /* ARM_NPU */
+
+int hal_init(hal_platform* platform, data_acq_module* data_acq,
+ data_psn_module* data_psn, platform_timer* timer)
+{
+ assert(platform && data_acq && data_psn);
+
+ platform->data_acq = data_acq;
+ platform->data_psn = data_psn;
+ platform->timer = timer;
+ platform->platform_init = system_init;
+ platform->platform_release = system_release;
+ system_name(platform->plat_name, sizeof(platform->plat_name));
+
+ return 0;
+}
+
+/**
+ * @brief Local helper function to clean the slate for current platform.
+ **/
+static void _hal_platform_clear(hal_platform* platform)
+{
+ assert(platform);
+ platform->inited = 0;
+}
+
+int hal_platform_init(hal_platform* platform)
+{
+ int state;
+ assert(platform && platform->platform_init);
+ _hal_platform_clear(platform);
+
+ /* Initialise platform */
+ if (0 != (state = platform->platform_init())) {
+ printf_err("failed to initialise platform %s\n", platform->plat_name);
+ return state;
+ }
+
+ /* Initialise the data acquisition module */
+ if (0 != (state = data_acq_channel_init(platform->data_acq))) {
+ if (!platform->data_acq->inited) {
+ printf_err("failed to initialise data acq module: %s\n",
+ platform->data_acq->system_name);
+ }
+ hal_platform_release(platform);
+ return state;
+ }
+
+ /* Initialise the presentation module */
+ if (0 != (state = data_psn_system_init(platform->data_psn))) {
+ printf_err("failed to initialise data psn module: %s\n",
+ platform->data_psn->system_name);
+ data_acq_channel_release(platform->data_acq);
+ hal_platform_release(platform);
+ return state;
+ }
+
+#if defined(ARM_NPU)
+
+ /* If Arm Ethos-U55 NPU is to be used, we initialise it here */
+ if (0 != (state = _arm_npu_init())) {
+ return state;
+ }
+
+#endif /* ARM_NPU */
+
+ /* followed by the timer module */
+ init_timer(platform->timer);
+
+ info("%s platform initialised\n", platform->plat_name);
+ debug("using %s module for data acquisition\n",
+ platform->data_acq->system_name);
+ debug("using %s module for data presentation\n",
+ platform->data_psn->system_name);
+
+ platform->inited = !state;
+
+ return state;
+}
+
+void hal_platform_release(hal_platform *platform)
+{
+ assert(platform && platform->platform_release);
+ data_acq_channel_release(platform->data_acq);
+ data_psn_system_release(platform->data_psn);
+
+ _hal_platform_clear(platform);
+ info("releasing platform %s\n", platform->plat_name);
+ platform->platform_release();
+}
+
+#if defined(ARM_NPU)
+/**
+ * @brief Defines the Ethos-U interrupt handler: just a wrapper around the default
+ * implementation.
+ **/
+static void _arm_npu_irq_handler(void)
+{
+ /* Call the default interrupt handler from the NPU driver */
+ ethosu_irq_handler();
+}
+
+/**
+ * @brief Initialises the NPU IRQ
+ **/
+static void _arm_npu_irq_init(void)
+{
+ const IRQn_Type ethosu_irqnum = (IRQn_Type)EthosU_IRQn;
+
+ /* Register the EthosU IRQ handler in our vector table.
+ * Note, this handler comes from the EthosU driver */
+ NVIC_SetVector(ethosu_irqnum, (uint32_t)_arm_npu_irq_handler);
+
+ /* Enable the IRQ */
+ NVIC_EnableIRQ(ethosu_irqnum);
+
+ debug("EthosU IRQ#: %u, Handler: 0x%p\n",
+ ethosu_irqnum, _arm_npu_irq_handler);
+}
+
+static int _arm_npu_timing_adapter_init(void)
+{
+#if defined (TA0_BASE)
+ struct timing_adapter ta_0;
+ struct timing_adapter_settings ta_0_settings = {
+ .maxr = TA0_MAXR,
+ .maxw = TA0_MAXW,
+ .maxrw = TA0_MAXRW,
+ .rlatency = TA0_RLATENCY,
+ .wlatency = TA0_WLATENCY,
+ .pulse_on = TA0_PULSE_ON,
+ .pulse_off = TA0_PULSE_OFF,
+ .bwcap = TA0_BWCAP,
+ .perfctrl = TA0_PERFCTRL,
+ .perfcnt = TA0_PERFCNT,
+ .mode = TA0_MODE,
+ .maxpending = 0, /* This is a read-only parameter */
+ .histbin = TA0_HISTBIN,
+ .histcnt = TA0_HISTCNT
+ };
+
+ if (0 != ta_init(&ta_0, TA0_BASE)) {
+ printf_err("TA0 initialisation failed\n");
+ return 1;
+ }
+
+ ta_set_all(&ta_0, &ta_0_settings);
+#endif /* defined (TA0_BASE) */
+
+#if defined (TA1_BASE)
+ struct timing_adapter ta_1;
+ struct timing_adapter_settings ta_1_settings = {
+ .maxr = TA1_MAXR,
+ .maxw = TA1_MAXW,
+ .maxrw = TA1_MAXRW,
+ .rlatency = TA1_RLATENCY,
+ .wlatency = TA1_WLATENCY,
+ .pulse_on = TA1_PULSE_ON,
+ .pulse_off = TA1_PULSE_OFF,
+ .bwcap = TA1_BWCAP,
+ .perfctrl = TA1_PERFCTRL,
+ .perfcnt = TA1_PERFCNT,
+ .mode = TA1_MODE,
+ .maxpending = 0, /* This is a read-only parameter */
+ .histbin = TA1_HISTBIN,
+ .histcnt = TA1_HISTCNT
+ };
+
+ if (0 != ta_init(&ta_1, TA1_BASE)) {
+ printf_err("TA1 initialisation failed\n");
+ return 1;
+ }
+
+ ta_set_all(&ta_1, &ta_1_settings);
+#endif /* defined (TA1_BASE) */
+
+ return 0;
+}
+
+static int _arm_npu_init(void)
+{
+ int err = 0;
+
+ /* If the platform has timing adapter blocks along with Ethos-U55 core
+ * block, initialise them here. */
+ if (0 != (err = _arm_npu_timing_adapter_init())) {
+ return err;
+ }
+
+ /* Initialise the IRQ */
+ _arm_npu_irq_init();
+
+ /* Initialise Ethos-U55 device */
+ const void * ethosu_base_address = (void *)(SEC_ETHOS_U55_BASE);
+
+ if (0 != (err = ethosu_init_v3(
+ ethosu_base_address, /* Ethos-U55's base address. */
+ NULL, /* Pointer to fast mem area - NULL for U55. */
+ 0, /* Fast mem region size. */
+ 1, /* Security enable. */
+ 1))) { /* Privilege enable. */
+ printf_err("failed to initalise Ethos-U55 device\n");
+ return err;
+ }
+
+ info("Ethos-U55 device initialised\n");
+
+ /* Get Ethos-U55 version */
+ struct ethosu_version version;
+ if (0 != (err = ethosu_get_version(&version))) {
+ printf_err("failed to fetch Ethos-U55 version info\n");
+ return err;
+ }
+
+ info("Ethos-U55 version info:\n");
+ info("\tArch: v%u.%u.%u\n", version.id.arch_major_rev,
+ version.id.arch_minor_rev,
+ version.id.arch_patch_rev);
+ info("\tDriver: v%u.%u.%u\n", version.id.driver_major_rev,
+ version.id.driver_minor_rev,
+ version.id.driver_patch_rev);
+ info("\tMACs/cc: %u\n", (1 << version.cfg.macs_per_cc));
+ info("\tCmd stream: v%u\n", version.cfg.cmd_stream_version);
+ info("\tSHRAM size: %u\n", version.cfg.shram_size);
+
+ return 0;
+}
+#endif /* ARM_NPU */
diff --git a/source/application/hal/include/data_acq.h b/source/application/hal/include/data_acq.h
new file mode 100644
index 0000000..965fbe5
--- /dev/null
+++ b/source/application/hal/include/data_acq.h
@@ -0,0 +1,52 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef DATA_ACQ_H
+#define DATA_ACQ_H
+
+/**
+ * This file is the top level abstraction for the data acquisition module.
+ **/
+#include <stdint.h>
+
+/* Structure to encompass the data acquisition module and it's methods. */
+typedef struct data_acquisition_module {
+ int inited; /**< initialised or not. */
+ char system_name[8]; /**< name(s) of the channel in use. */
+ int (* system_init)(void); /**< channel initialisation function. */
+
+ /* Function to go and check if there are any events that require handling. */
+ int (* get_input)(char *user_input, int size);
+} data_acq_module;
+
+/**
+ * @brief Initialise the data acquisition channel: goes and
+ * sets the required channel up for usage.
+ * @param[in,out] module Pointer to a pre-allocated data
+ * acquisition structure object.
+ * @return 0 if successful, error code otherwise.
+ **/
+int data_acq_channel_init(data_acq_module *module);
+
+/**
+ * @brief Releases the data acquisition channel.
+ * @param[in,out] module Pointer to a pre-allocated data
+ * acquisition structure object.
+ * @return 0 if successful, error code otherwise.
+ **/
+int data_acq_channel_release(data_acq_module *module);
+
+#endif /* DATA_ACQ_H */
diff --git a/source/application/hal/include/data_psn.h b/source/application/hal/include/data_psn.h
new file mode 100644
index 0000000..8c14c77
--- /dev/null
+++ b/source/application/hal/include/data_psn.h
@@ -0,0 +1,72 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef DATA_PSN_H
+#define DATA_PSN_H
+
+/**
+ * This file is the top level abstraction for the data presentation module
+ **/
+#include <stdint.h>
+#include <stddef.h>
+#include <stdbool.h>
+
+/* Structure to encompass the data presentation module and it's methods */
+typedef struct data_presentation_module {
+ int inited; /**< initialised or not */
+ char system_name[8]; /**< name of the system in use */
+ int (* system_init)(void); /**< pointer to init function */
+
+ /** Pointer to the image presentation function */
+ int (* present_data_image)(uint8_t *data, const uint32_t width,
+ const uint32_t height, const uint32_t channels,
+ const uint32_t pos_x, const uint32_t pos_y,
+ const uint32_t downsample_factor);
+
+ /* Pointer to text presentation function */
+ int (* present_data_text)(const char *str, const size_t str_sz,
+ const uint32_t pos_x, const uint32_t pos_y,
+ const bool allow_multiple_lines);
+
+ /* Pointer to box presentation function */
+ int (* present_box)(const uint32_t pos_x, const uint32_t pos_y,
+ const uint32_t width, const uint32_t height, const uint16_t color);
+
+ /* Pointer to clear presentation function */
+ int (* clear)(const uint16_t color);
+
+ /* Pointer to set text color presentation function */
+ int (* set_text_color)(const uint16_t color);
+} data_psn_module;
+
+
+/**
+ * @brief Initialises the data presentation system.
+ * @param[in,out] module Pointer to a pre-allocated data
+ * presentation structure object.
+ * @return 0 if successful, error code otherwise.
+ **/
+int data_psn_system_init(data_psn_module *module);
+
+/**
+ * @brief Releases the data presentation system.
+ * @param[in,out] module Pointer to a pre-allocated data
+ * presentation structure object.
+ * @return 0 if successful, error code otherwise.
+ **/
+int data_psn_system_release(data_psn_module *module);
+
+#endif /* DATA_PSN_H */
diff --git a/source/application/hal/include/hal.h b/source/application/hal/include/hal.h
new file mode 100644
index 0000000..26ba1e3
--- /dev/null
+++ b/source/application/hal/include/hal.h
@@ -0,0 +1,81 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef PLATFORM_HAL_H
+#define PLATFORM_HAL_H
+
+/**
+ * This file should present a C API for the main application logic to use
+ * and be indifferent to the lower level platform. In addition to this it
+ * will also need to be aware of the API exposed by data acquisition and
+ * data presentation modules.
+ */
+#include "hal_config.h"
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+#include "data_acq.h" /* Data acquisition abstraction */
+#include "data_psn.h" /* Data presentation abstraction */
+#include "timer.h" /* Timer/profiler API */
+
+/* Structure to define a platform context to be used by the application */
+typedef struct hal_platform_context {
+ int inited; /**< initialised */
+ char plat_name[16]; /**< name of this platform */
+ data_acq_module * data_acq; /**< data acquisition module pointer */
+ data_psn_module * data_psn; /**< data presentation module pointer */
+ platform_timer * timer; /**< timer */
+ int (* platform_init)(); /**< pointer to platform initialisation function */
+ void (* platform_release)(); /**< pointer to platform release function */
+} hal_platform;
+
+/**
+ * @brief Initialise the HAL structure based on compile time config. This
+ * should be called before any other function in this API.
+ * @param[in,out] platform Pointer to a pre-allocated platform struct.
+ * @param[in,out] data_acq Pointer to a pre-allocated data acquisition module.
+ * @param[in,out] data_psn Pointer to a pre-allocated data presentation module.
+ * @param[in,out] timer Pointer to a pre-allocated timer module.
+ * @return 0 if successful, error code otherwise.
+ **/
+int hal_init(hal_platform *platform, data_acq_module *data_acq,
+ data_psn_module *data_psn, platform_timer *timer);
+
+
+/**
+ * @brief Initialise the HAL platform. This will go and initialise all the
+ * modules on the platform the application requires to run.
+ * @param[in] platform Pointer to a pre-allocated and initialised
+ * platform structure.
+ * @return 0 if successful, error code otherwise.
+ **/
+int hal_platform_init(hal_platform *platform);
+
+
+/**
+ * @brief Release the HAL platform. This should release resources acquired.
+ * @param[in] platform pointer to a pre-allocated and initialised
+ * platform structure.
+ **/
+void hal_platform_release(hal_platform *platform);
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif /* PLATFORM_HAL_H */
diff --git a/source/application/hal/include/hal_config.h b/source/application/hal/include/hal_config.h
new file mode 100644
index 0000000..55db973
--- /dev/null
+++ b/source/application/hal/include/hal_config.h
@@ -0,0 +1,43 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef HAL_CONFIG_H
+#define HAL_CONFIG_H
+
+/* This header provides some basic configuration for HAL */
+
+/* Platform definitions for the systems we expect to support */
+#define PLATFORM_CORTEX_M_BAREMETAL 1U
+#define PLATFORM_UNKNOWN_LINUX_OS 3U
+
+/* This should come from compile time definition */
+#ifndef PLATFORM_HAL
+ #define PLATFORM_HAL PLATFORM_UNKNOWN_LINUX_OS /* Default platform */
+#endif /* PLATFORM_HAL */
+
+#if ((PLATFORM_HAL) == PLATFORM_CORTEX_M_BAREMETAL)
+ #include "bsp.h"
+#elif ((PLATFORM_HAL) == PLATFORM_UNKNOWN_LINUX_OS)
+ #include "dummy_log.h"
+#else
+ #error "Invalid platform!"
+#endif /* PLATFORM_HAL==PLATFORM_CORTEX_M_BAREMETAL */
+
+#if !defined (DESIGN_NAME)
+ #define DESIGN_NAME ("N/A")
+#endif /* !defined (DESIGN_NAME) */
+
+#endif /* HAL_CONFIG_H */
diff --git a/source/application/hal/include/timer.h b/source/application/hal/include/timer.h
new file mode 100644
index 0000000..2955b7f
--- /dev/null
+++ b/source/application/hal/include/timer.h
@@ -0,0 +1,80 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef HAL_TIMER_H
+#define HAL_TIMER_H
+
+#include "hal_config.h"
+
+#if ((PLATFORM_HAL) == PLATFORM_CORTEX_M_BAREMETAL)
+#include "baremetal_timer.h"
+#elif ((PLATFORM_HAL) == PLATFORM_UNKNOWN_LINUX_OS)
+#include "native_timer.h"
+#else
+#error "Platform does not support a timer API"
+#endif /* PLATFORM_HAL */
+
+/** Struct for describing the capabilities available for
+ * the timer provided by HAL */
+typedef struct _platform_timer_capability {
+ uint32_t npu_cycles: 1;
+ uint32_t cpu_cycles: 1;
+ uint32_t duration_ms: 1;
+ uint32_t duration_us: 1;
+} timer_capability;
+
+/* Structure to hold a platform specific timer implementation */
+typedef struct _platform_timer {
+ int inited; /**< initialised or not */
+ timer_capability cap; /**< capability of this timer */
+
+ /* reset the timer */
+ void (* reset)(void);
+
+ /* Gets the current time counter. */
+ time_counter (* get_time_counter)(void);
+
+ /* Gets the duration in milliseconds. */
+ time_t (* get_duration_ms)(time_counter *start, time_counter *end);
+
+ /* Gets duration in microseconds. */
+ time_t (* get_duration_us)(time_counter *start, time_counter *end);
+
+ /* Gets difference in CPU cycle counts. */
+ uint32_t (* get_cpu_cycle_diff)(time_counter *start, time_counter *end);
+
+ /* Gets the difference in terms of total NPU cycle counts. */
+ uint64_t (* get_npu_total_cycle_diff)(time_counter *start, time_counter *end);
+
+ /* Gets the difference in terms of active NPU cycle counts. */
+ uint64_t (* get_npu_active_cycle_diff)(time_counter *start, time_counter *end);
+
+ /* Wraps get_time_counter function with additional profiling
+ * initialisation, if required. */
+ time_counter (* start_profiling)(void);
+
+ /* Wraps get_time_counter function along with additional instructions when
+ * profiling ends, if required. */
+ time_counter (* stop_profiling)(void);
+
+} platform_timer;
+
+/**
+ * @brief Initialise the timer available for the platform.
+ **/
+void init_timer(platform_timer *timer);
+
+#endif /* HAL_TIMER_H */
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-core/include/bsp_core_log.h b/source/application/hal/platforms/bare-metal/bsp/bsp-core/include/bsp_core_log.h
new file mode 100644
index 0000000..f049209
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-core/include/bsp_core_log.h
@@ -0,0 +1,66 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef BSP_CORE_LOG_H
+#define BSP_CORE_LOG_H
+
+#include "uart_stdout.h" /* UART for logging */
+
+#include <stdio.h>
+
+#define LOG_LEVEL_TRACE 0
+#define LOG_LEVEL_DEBUG 1
+#define LOG_LEVEL_INFO 2
+#define LOG_LEVEL_WARN 3
+#define LOG_LEVEL_ERROR 4
+
+#ifndef LOG_LEVEL
+#define LOG_LEVEL LOG_LEVEL_INFO
+#endif /*LOG_LEVEL*/
+
+#if (LOG_LEVEL == LOG_LEVEL_TRACE)
+ #define trace(...) printf("[TRACE] "); printf(__VA_ARGS__)
+#else
+ #define trace(...)
+#endif /* LOG_LEVEL == LOG_LEVEL_TRACE */
+
+#if (LOG_LEVEL <= LOG_LEVEL_DEBUG)
+ #define debug(...) printf("[DEBUG] "); printf(__VA_ARGS__)
+#else
+ #define debug(...)
+#endif /* LOG_LEVEL > LOG_LEVEL_TRACE */
+
+#if (LOG_LEVEL <= LOG_LEVEL_INFO)
+ #define info(...) printf("[INFO] "); printf(__VA_ARGS__)
+#else
+ #define info(...)
+#endif /* LOG_LEVEL > LOG_LEVEL_DEBUG */
+
+#if (LOG_LEVEL <= LOG_LEVEL_WARN)
+ #define warn(...) printf("[WARN] "); printf(__VA_ARGS__)
+#else
+ #define warn(...)
+#endif /* LOG_LEVEL > LOG_LEVEL_INFO */
+
+#if (LOG_LEVEL <= LOG_LEVEL_ERROR)
+ #define printf_err(...) printf("[ERROR] "); printf(__VA_ARGS__)
+#else
+ #define printf_err(...)
+#endif /* LOG_LEVEL > LOG_LEVEL_INFO */
+
+#define UNUSED(x) ((void)(x))
+
+#endif /* BSP_CORE_LOG_H */
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-core/include/uart_stdout.h b/source/application/hal/platforms/bare-metal/bsp/bsp-core/include/uart_stdout.h
new file mode 100644
index 0000000..9c5fbcf
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-core/include/uart_stdout.h
@@ -0,0 +1,57 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef UART_STDOUT_H
+#define UART_STDOUT_H
+
+#include <stdbool.h>
+
+/**
+ * @brief Initialised the UART block.
+ **/
+extern void UartStdOutInit(void);
+
+/**
+ * @brief Transmits a character over UART (blocking call).
+ * @param[in] my_ch Character to be transmitted.
+ * @return Character transmitted.
+ **/
+extern unsigned char UartPutc(unsigned char my_ch);
+
+/**
+ * @brief Receives a character from the UART block (blocking call).
+ * @return Character received.
+ **/
+extern unsigned char UartGetc(void);
+
+/**
+ * @brief Reads characters from the UART block until a line feed or
+ * carriage return terminates the function. NULL character
+ * also terminates the function, error is returned.
+ * @param[out] lp Characters read from the UART block.
+ * @param[in] len Character to be transmitted.
+ * @return true if successful, false otherwise.
+ **/
+extern bool GetLine(char *lp, unsigned int len);
+
+/**
+ * @brief Terminates UART simulation. This is useful when a Fixed
+ * Virtual Platform's session needs to be gracefully terminated.
+ * @param[in] code Terminating code displayed on the UART before the end of the simulation.
+ **/
+extern void UartEndSimulation(int code);
+
+#endif /* UART_STDOUT_H */
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-core/retarget.c b/source/application/hal/platforms/bare-metal/bsp/bsp-core/retarget.c
new file mode 100644
index 0000000..cf31a53
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-core/retarget.c
@@ -0,0 +1,235 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#if defined(__ARMCC_VERSION) && (__ARMCC_VERSION >= 6010050)
+
+#include "uart_stdout.h"
+#include "bsp_core_log.h"
+
+#if defined (MPS3_PLATFORM)
+#include "smm_mps3.h"
+#endif /* MPS3_PLATFORM */
+
+#include <stdio.h>
+#include <string.h>
+#include <time.h>
+#include <rt_misc.h>
+#include <rt_sys.h>
+
+
+/* Standard IO device handles. */
+#define STDIN 0x8001
+#define STDOUT 0x8002
+#define STDERR 0x8003
+
+/* Standard IO device name defines. */
+const char __stdin_name[] = "STDIN";
+const char __stdout_name[] = "STDOUT";
+const char __stderr_name[] = "STDERR";
+
+int fputc(int ch, FILE *f)
+{
+ UNUSED(f);
+ return (UartPutc(ch));
+}
+
+int fgetc(FILE *f)
+{
+ UNUSED(f);
+ return (UartPutc(UartGetc()));
+}
+
+int ferror(FILE *f)
+{
+ UNUSED(f);
+ /* Your implementation of ferror */
+ return EOF;
+}
+
+void _ttywrch(int ch)
+{
+ UartPutc(ch);
+}
+
+FILEHANDLE _sys_open(const char *name, int openmode)
+{
+ UNUSED(openmode);
+
+ /* Register standard Input Output devices. */
+ if (strcmp(name, "STDIN") == 0)
+ {
+ return (STDIN);
+ }
+ if (strcmp(name, "STDOUT") == 0)
+ {
+ return (STDOUT);
+ }
+ if (strcmp(name, "STDERR") == 0)
+ {
+ return (STDERR);
+ }
+ return (-1);
+}
+
+int _sys_close(FILEHANDLE fh)
+{
+ if (fh > 0x8000)
+ {
+ return (0);
+ }
+ return (-1);
+}
+
+int _sys_write(FILEHANDLE fh, const unsigned char *buf, unsigned int len, int mode)
+{
+ UNUSED(mode);
+ if (fh == STDOUT || fh == STDERR )
+ {
+ /* Standard Output device. */
+ for (; len; len--)
+ {
+ UartPutc(*buf++);
+ }
+ return (0);
+ }
+
+ if (fh > 0x8000)
+ {
+ return (-1);
+ }
+ return (-1);
+}
+
+int _sys_read(FILEHANDLE fh, unsigned char *buf, unsigned int len, int mode)
+{
+ UNUSED(mode);
+ if (fh == STDIN)
+ {
+ /* Standard Input device. */
+ for (; len; len--)
+ {
+ *buf++ = UartGetc();
+ }
+ return (0);
+ }
+
+ if (fh > 0x8000)
+ {
+ return (-1);
+ }
+ return (-1);
+}
+
+int _sys_istty(FILEHANDLE fh)
+{
+ if (fh > 0x8000)
+ {
+ return (1);
+ }
+ return (0);
+}
+
+int _sys_seek(FILEHANDLE fh, long pos)
+{
+ UNUSED(pos);
+ if (fh > 0x8000)
+ {
+ return (-1);
+ }
+ return (-1);
+}
+
+int _sys_ensure(FILEHANDLE fh)
+{
+ if (fh > 0x8000)
+ {
+ return (-1);
+ }
+ return (-1);
+}
+
+long _sys_flen(FILEHANDLE fh)
+{
+ if (fh > 0x8000)
+ {
+ return (0);
+ }
+ return (-1);
+}
+
+int _sys_tmpnam(char *name, int sig, unsigned maxlen)
+{
+ UNUSED(name);
+ UNUSED(sig);
+ UNUSED(maxlen);
+ return (1);
+}
+
+char *_sys_command_string(char *cmd, int len)
+{
+ UNUSED(len);
+ return (cmd);
+}
+
+void _sys_exit(int return_code)
+{
+ UartEndSimulation(return_code);
+}
+
+int system(const char *cmd)
+{
+ UNUSED(cmd);
+ return (0);
+}
+
+time_t time(time_t *timer)
+{
+ time_t current;
+
+#if defined (MPS3_PLATFORM)
+ current = MPS3_FPGAIO->COUNTER;
+#else /* MPS3_PLATFORM */
+ current = 0; /* No RTC implementation available. */
+#endif /* MPS3_PLATFORM */
+
+ if (timer != NULL) {
+ *timer = current;
+ }
+
+ return (current);
+}
+
+#else /* #if defined(__ARMCC_VERSION) && (__ARMCC_VERSION >= 6010050) */
+
+/******************************************************************************/
+/* Retarget functions for GNU Tools for ARM Embedded Processors */
+/******************************************************************************/
+#include <stdio.h>
+#include <sys/stat.h>
+
+extern unsigned char UartPutc(unsigned char my_ch);
+
+__attribute__((used)) int _write(int fd, char *ptr, int len)
+{
+ size_t i;
+ for (i = 0; i < len; i++)
+ {
+ UartPutc(ptr[i]); /* call character output function. */
+ }
+ return len;
+}
+
+#endif /* #if defined(__ARMCC_VERSION) && (__ARMCC_VERSION >= 6010050) */
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/device_mps3.c b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/device_mps3.c
new file mode 100644
index 0000000..f4f2e6b
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/device_mps3.c
@@ -0,0 +1,36 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "device_mps3.h"
+
+#include "bsp_core_log.h"
+#include "smm_mps3.h"
+
+uint32_t GetMPS3CoreClock(void)
+{
+ const uint32_t default_clock = 32000000;
+ static int warned_once = 0;
+ if (0 != MPS3_SCC->CFG_ACLK) {
+ return MPS3_SCC->CFG_ACLK;
+ }
+
+ if (!warned_once) {
+ warn("MPS3_SCC->CFG_ACLK reads 0. Assuming default clock of %u\n",
+ default_clock);
+ warned_once = 1;
+ }
+ return default_clock;
+}
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/glcd_mps3.c b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/glcd_mps3.c
new file mode 100644
index 0000000..530be4f
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/glcd_mps3.c
@@ -0,0 +1,460 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "glcd_mps3.h"
+
+#include "bsp_core_log.h"
+#include "font_9x15_h.h"
+#include "smm_mps3.h"
+
+/*-------------- CLCD Controller Internal Register addresses ----------------*/
+#define CHAR_COM ((volatile unsigned int *)(CLCD_CONFIG_BASE + 0x000))
+#define CHAR_DAT ((volatile unsigned int *)(CLCD_CONFIG_BASE + 0x004))
+#define CHAR_RD ((volatile unsigned int *)(CLCD_CONFIG_BASE + 0x008))
+#define CHAR_RAW ((volatile unsigned int *)(CLCD_CONFIG_BASE + 0x00C))
+#define CHAR_MASK ((volatile unsigned int *)(CLCD_CONFIG_BASE + 0x010))
+#define CHAR_STAT ((volatile unsigned int *)(CLCD_CONFIG_BASE + 0x014))
+#define CHAR_MISC ((volatile unsigned int *)(CLCD_CONFIG_BASE + 0x04C))
+
+/*--------------- Graphic LCD interface hardware definitions -----------------*/
+/* Pin CS setting to 0 or 1 */
+#define LCD_CS(x) ((x) ? (*CHAR_MISC |= CLCD_CS_Msk) : (*CHAR_MISC &= ~CLCD_CS_Msk))
+#define LCD_RST(x) ((x) ? (*CHAR_MISC |= CLCD_RESET_Msk) : (*CHAR_MISC &= ~CLCD_RESET_Msk))
+#define LCD_BL(x) ((x) ? (*CHAR_MISC |= CLCD_BL_Msk) : (*CHAR_MISC &= ~CLCD_BL_Msk))
+
+#define BG_COLOR 0 /* Background colour */
+#define TXT_COLOR 1 /* Text colour */
+
+/**
+* Text and background colour
+*/
+static volatile unsigned short Color[2] = {Black, White};
+
+/**
+ * @brief Delay in while loop cycles.
+ * @param[in] cnt Number of while cycles to delay.
+ **/
+static void delay (int cnt)
+{
+ cnt <<= DELAY_2N;
+ while (cnt != 0) {
+ --cnt;
+ }
+}
+
+/**
+ * @brief Write a command the LCD controller.
+ * @param[in] cmd Command to be written.
+ */
+static __inline void wr_cmd(unsigned char cmd)
+{
+ LCD_CS(0);
+ *CHAR_COM = cmd;
+ LCD_CS(1);
+}
+
+/**
+ * @brief Start of data writing to the LCD controller.
+ */
+static __inline void wr_dat_start (void)
+{
+ LCD_CS(0);
+}
+
+/**
+ * @brief Stop of data writing to the LCD controller.
+ */
+static __inline void wr_dat_stop (void)
+{
+ LCD_CS(1);
+}
+
+/**
+ * @brief Data writing to the LCD controller.
+ * @param[in] dat Data to be written.
+ */
+static __inline void wr_dat_only(unsigned short dat)
+{
+ *CHAR_DAT = (dat >> 8); /* Write D8..D15 */
+ *CHAR_DAT = (dat & 0xFF); /* Write D0..D7 */
+}
+
+/**
+ * @brief Write a value to the to LCD register.
+ * @param[in] reg Register to be written.
+ * @param[in] val Value to write to the register.
+ */
+static __inline void wr_reg(unsigned char reg, unsigned short val)
+{
+ LCD_CS(0);
+ *CHAR_COM = reg;
+ wr_dat_only(val);
+ LCD_CS(1);
+}
+
+/**
+ * @brief Converts a gray value to RGB565 representation.
+ * @param[in] src_uchar Pointer to the source pixel.
+ * @return 16 bit RGB565 value.
+ */
+static inline uint16_t _GLCD_Gray8_to_RGB565(uint8_t *src_uchar)
+{
+ uint16_t val_r = (*src_uchar >> 3);
+ uint16_t val_g = (*src_uchar >> 2);
+ return ((val_r << 11) | (val_g << 5) | val_r);
+}
+
+/**
+ * @brief Converts an RGB888 value to RGB565 representation.
+ * @param[in] src_uchar Pointer to the source pixel for R (assumed to
+ * be RGB format).
+ * @return 16 bit RGB565 value.
+ */
+static inline uint16_t _GLCD_RGB888_to_RGB565(uint8_t *src_uchar)
+{
+ uint16_t val_r = (*src_uchar >> 3) & 0x1F;
+ uint16_t val_g = (*(src_uchar+1) >> 2) & 0x3F;
+ uint16_t val_b = (*(src_uchar+2) >> 3) & 0x1F;
+ return ((val_r << 11) | (val_g << 5) | val_b);
+}
+
+/* Helper typedef to encapsulate the colour conversion function
+ * signatures */
+typedef uint16_t (* std_clr_2_lcd_clr_fn)(uint8_t *src_uchar);
+
+void GLCD_SetWindow(unsigned int x, unsigned int y, unsigned int w, unsigned int h) {
+ unsigned int xe, ye;
+
+ xe = x+w-1;
+ ye = y+h-1;
+
+ wr_reg(0x02, x >> 8); /* Column address start MSB */
+ wr_reg(0x03, x & 0xFF); /* Column address start LSB */
+ wr_reg(0x04, xe >> 8); /* Column address end MSB */
+ wr_reg(0x05, xe & 0xFF); /* Column address end LSB */
+
+ wr_reg(0x06, y >> 8); /* Row address start MSB */
+ wr_reg(0x07, y & 0xFF); /* Row address start LSB */
+ wr_reg(0x08, ye >> 8); /* Row address end MSB */
+ wr_reg(0x09, ye & 0xFF); /* Row address end LSB */
+}
+
+void GLCD_WindowMax(void)
+{
+ GLCD_SetWindow (0, 0, GLCD_WIDTH, GLCD_HEIGHT);
+}
+
+void GLCD_SetTextColor(unsigned short color)
+{
+ Color[TXT_COLOR] = color;
+}
+
+void GLCD_SetBackColor(unsigned short color)
+{
+ Color[BG_COLOR] = color;
+}
+
+void GLCD_Clear(unsigned short color)
+{
+ unsigned int i;
+
+ GLCD_WindowMax();
+ wr_cmd(0x22);
+ wr_dat_start();
+
+ for(i = 0; i < (GLCD_WIDTH*GLCD_HEIGHT); ++i) {
+ wr_dat_only(color);
+ }
+ wr_dat_stop();
+}
+
+
+void GLCD_DrawChar(
+ unsigned int x, unsigned int y,
+ unsigned int cw, unsigned int ch,
+ unsigned char *c)
+{
+ unsigned int i, j, k, pixs;
+
+ /* Sanity check: out of bounds? */
+ if ((x + cw) > GLCD_WIDTH || (y + ch) > GLCD_HEIGHT) {
+ return;
+ }
+
+ GLCD_SetWindow(x, y, cw, ch);
+
+ wr_cmd(0x22);
+ wr_dat_start();
+
+ k = (cw + 7)/8;
+
+ if (k == 1) {
+ for (j = 0; j < ch; ++j) {
+ pixs = *(unsigned char *)c;
+ c += 1;
+
+ for (i = 0; i < cw; ++i) {
+ wr_dat_only (Color[(pixs >> i) & 1]);
+ }
+ }
+ }
+ else if (k == 2) {
+ for (j = 0; j < ch; ++j) {
+ pixs = *(unsigned short *)c;
+ c += 2;
+
+ for (i = 0; i < cw; ++i) {
+ wr_dat_only (Color[(pixs >> i) & 1]);
+ }
+ }
+ }
+ wr_dat_stop();
+}
+
+void GLCD_DisplayChar(
+ unsigned int ln, unsigned int col,
+ unsigned char fi, unsigned char c)
+{
+ c -= 32;
+ switch (fi) {
+ case 0: /* Font 9 x 15. */
+ GLCD_DrawChar(col * 9, ln * 15, 9, 15,
+ (unsigned char *)&Font_9x15_h[c * 15]);
+ break;
+ }
+}
+
+void GLCD_DisplayString(
+ unsigned int ln, unsigned int col,
+ unsigned char fi, char *s)
+{
+ while (*s) {
+ GLCD_DisplayChar(ln, col++, fi, *s++);
+ }
+}
+
+
+
+void GLCD_ClearLn(unsigned int ln, unsigned char fi)
+{
+ unsigned char i;
+ char buf[60];
+
+ GLCD_WindowMax();
+ switch (fi) {
+ case 0: /* Font 9x15*/
+ for (i = 0; i < (GLCD_WIDTH+8)/9; ++i) {
+ buf[i] = ' ';
+ }
+ buf[i+1] = 0;
+ break;
+ }
+ GLCD_DisplayString (ln, 0, fi, buf);
+}
+
+void GLCD_Bitmap(unsigned int x, unsigned int y,
+ unsigned int w, unsigned int h,
+ unsigned short *bitmap)
+{
+ unsigned int i;
+ unsigned short *bitmap_ptr = bitmap;
+
+ GLCD_SetWindow (x, y, w, h);
+
+ wr_cmd(0x22);
+ wr_dat_start();
+
+ for (i = 0; i < (w*h); ++i) {
+ wr_dat_only (bitmap_ptr[i]);
+ }
+ wr_dat_stop();
+}
+
+void GLCD_Image(void *data, const uint32_t width,
+ const uint32_t height, const uint32_t channels,
+ const uint32_t pos_x, const uint32_t pos_y,
+ const uint32_t downsample_factor)
+{
+ uint32_t i, j = 0; /* for loops */
+ const uint32_t x_incr = channels * downsample_factor; /* stride. */
+ const uint32_t y_incr = channels * width * (downsample_factor - 1); /* skip rows. */
+ uint8_t* src_unsigned = (uint8_t *)data; /* temporary pointer. */
+ std_clr_2_lcd_clr_fn cvt_clr_fn = 0; /* colour conversion function. */
+
+ /* Based on number of channels, we decide which of the above functions to use. */
+ switch (channels) {
+ case 1:
+ cvt_clr_fn = _GLCD_Gray8_to_RGB565;
+ break;
+
+ case 3:
+ cvt_clr_fn = _GLCD_RGB888_to_RGB565;
+ break;
+
+ default:
+ printf_err("number of channels not supported by display\n");
+ return;
+ }
+
+ /* Set the window position expected. Note: this is integer div. */
+ GLCD_SetWindow(pos_x, pos_y,
+ width/downsample_factor, height/downsample_factor);
+ wr_cmd(0x22);
+ wr_dat_start();
+
+ /* Loop over the image. */
+ for (j = height; j != 0; j -= downsample_factor) {
+ for (i = width; i != 0; i -= downsample_factor) {
+ wr_dat_only(cvt_clr_fn(src_unsigned));
+ src_unsigned += x_incr;
+ }
+
+ /* Skip rows if needed. */
+ src_unsigned += y_incr;
+ }
+
+ wr_dat_stop();
+}
+
+void GLCD_Box(
+ unsigned int x, unsigned int y,
+ unsigned int w, unsigned int h,
+ unsigned short color)
+{
+ unsigned int i;
+
+ GLCD_SetWindow (x, y, w, h);
+
+ wr_cmd(0x22);
+ wr_dat_start();
+ for(i = 0; i < (w*h); ++i){
+ wr_dat_only (color);
+ }
+ wr_dat_stop();
+}
+
+
+void GLCD_Initialize (void)
+{
+ /* CLCD screen setup (Default CLCD screen interface state) ------------- */
+ LCD_CS(1); /* deassert nCS0. */
+ LCD_RST(1); /* deassert Reset. */
+ LCD_BL(0); /* switch off backlight. */
+
+ /* Reset CLCD screen --------------------------------------------------- */
+ LCD_RST(0); /* assert Reset. */
+ delay(1);
+ LCD_RST(1); /* deassert Reset. */
+ delay(10);
+
+ /* Driving ability settings ----------------------------------------------*/
+ wr_reg(0xEA, 0x00); /* Power control internal used (1). */
+ wr_reg(0xEB, 0x20); /* Power control internal used (2). */
+ wr_reg(0xEC, 0x0C); /* Source control internal used (1). */
+ wr_reg(0xED, 0xC7); /* Source control internal used (2). */
+ wr_reg(0xE8, 0x38); /* Source output period Normal mode. */
+ wr_reg(0xE9, 0x10); /* Source output period Idle mode. */
+ wr_reg(0xF1, 0x01); /* RGB 18-bit interface ;0x0110. */
+ wr_reg(0xF2, 0x10);
+
+ /* Adjust the Gamma Curve ------------------------------------------------*/
+ wr_reg(0x40, 0x01);
+ wr_reg(0x41, 0x00);
+ wr_reg(0x42, 0x00);
+ wr_reg(0x43, 0x10);
+ wr_reg(0x44, 0x0E);
+ wr_reg(0x45, 0x24);
+ wr_reg(0x46, 0x04);
+ wr_reg(0x47, 0x50);
+ wr_reg(0x48, 0x02);
+ wr_reg(0x49, 0x13);
+ wr_reg(0x4A, 0x19);
+ wr_reg(0x4B, 0x19);
+ wr_reg(0x4C, 0x16);
+
+ wr_reg(0x50, 0x1B);
+ wr_reg(0x51, 0x31);
+ wr_reg(0x52, 0x2F);
+ wr_reg(0x53, 0x3F);
+ wr_reg(0x54, 0x3F);
+ wr_reg(0x55, 0x3E);
+ wr_reg(0x56, 0x2F);
+ wr_reg(0x57, 0x7B);
+ wr_reg(0x58, 0x09);
+ wr_reg(0x59, 0x06);
+ wr_reg(0x5A, 0x06);
+ wr_reg(0x5B, 0x0C);
+ wr_reg(0x5C, 0x1D);
+ wr_reg(0x5D, 0xCC);
+
+ /* Power voltage setting -------------------------------------------------*/
+ wr_reg(0x1B, 0x1B);
+ wr_reg(0x1A, 0x01);
+ wr_reg(0x24, 0x2F);
+ wr_reg(0x25, 0x57);
+ wr_reg(0x23, 0x88);
+
+ /* Power on setting ------------------------------------------------------*/
+ wr_reg(0x18, 0x36); /* Internal oscillator frequency adj. */
+ wr_reg(0x19, 0x01); /* Enable internal oscillator. */
+ wr_reg(0x01, 0x00); /* Normal mode, no scroll. */
+ wr_reg(0x1F, 0x88); /* Power control 6 - DDVDH Off. */
+ delay(20);
+ wr_reg(0x1F, 0x82); /* Power control 6 - Step-up: 3 x VCI. */
+ delay(5);
+ wr_reg(0x1F, 0x92); /* Power control 6 - Step-up: On. */
+ delay(5);
+ wr_reg(0x1F, 0xD2); /* Power control 6 - VCOML active. */
+ delay(5);
+
+ /* Color selection -------------------------------------------------------*/
+ wr_reg(0x17, 0x55); /* RGB, System interface: 16 Bit/Pixel. */
+ wr_reg(0x00, 0x00); /* Scrolling off, no standby. */
+
+ /* Interface config ------------------------------------------------------*/
+ wr_reg(0x2F, 0x11); /* LCD Drive: 1-line inversion. */
+ wr_reg(0x31, 0x00);
+ wr_reg(0x32, 0x00); /* DPL=0, HSPL=0, VSPL=0, EPL=0. */
+
+ /* Display on setting ----------------------------------------------------*/
+ wr_reg(0x28, 0x38); /* PT(0,0) active, VGL/VGL. */
+ delay(20);
+ wr_reg(0x28, 0x3C); /* Display active, VGL/VGL. */
+
+#if (LANDSCAPE == 1)
+#if (ROTATE180 == 0)
+ wr_reg (0x16, 0xA8);
+#else /* (ROTATE180 == 0) */
+ wr_reg (0x16, 0x68);
+#endif /* (ROTATE180 == 0) */
+#else /* (LANDSCAPE == 1) */
+#if (ROTATE180 == 0)
+ wr_reg (0x16, 0x08);
+#else /* (ROTATE180 == 0) */
+ wr_reg (0x16, 0xC8);
+#endif /* (ROTATE180 == 0) */
+#endif /* (LANDSCAPE == 1) */
+
+ /* Display scrolling settings --------------------------------------------*/
+ wr_reg(0x0E, 0x00); /* TFA MSB */
+ wr_reg(0x0F, 0x00); /* TFA LSB */
+ wr_reg(0x10, 320 >> 8); /* VSA MSB */
+ wr_reg(0x11, 320 & 0xFF); /* VSA LSB */
+ wr_reg(0x12, 0x00); /* BFA MSB */
+ wr_reg(0x13, 0x00); /* BFA LSB */
+
+ LCD_BL(1); /* turn on backlight */
+}
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/include/device_mps3.h b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/include/device_mps3.h
new file mode 100644
index 0000000..f0bab79
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/include/device_mps3.h
@@ -0,0 +1,111 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef DEVICE_MPS3_H
+#define DEVICE_MPS3_H
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+#include "cmsis.h" /* CMSIS device header. */
+#include "smm_mps3.h" /* Memory map for MPS3. */
+
+#include <stdio.h>
+
+typedef struct _CMSDK_UART_TypeDef_
+{
+ __IO uint32_t DATA; /* Offset: 0x000 (R/W) Data Register. */
+ __IO uint32_t STATE; /* Offset: 0x004 (R/W) Status Register. */
+ __IO uint32_t CTRL; /* Offset: 0x008 (R/W) Control Register. */
+
+ union {
+ __I uint32_t INTSTATUS; /* Offset: 0x00C (R/ ) Interrupt Status Register. */
+ __O uint32_t INTCLEAR; /* Offset: 0x00C ( /W) Interrupt Clear Register. */
+ };
+ __IO uint32_t BAUDDIV; /* Offset: 0x010 (R/W) Baudrate Divider Register. */
+
+} CMSDK_UART_TypeDef;
+
+#define CMSDK_UART0 ((CMSDK_UART_TypeDef *)CMSDK_UART0_BASE)
+
+/* CMSDK_UART DATA Register Definitions. */
+#define CMSDK_UART_DATA_Pos 0 /* CMSDK_UART_DATA_Pos: DATA Position. */
+#define CMSDK_UART_DATA_Msk (0xFFul << CMSDK_UART_DATA_Pos) /* CMSDK_UART DATA: DATA Mask. */
+
+/* CMSDK_UART STATE Register Definitions. */
+#define CMSDK_UART_STATE_RXOR_Pos 3 /* CMSDK_UART STATE: RXOR Position. */
+#define CMSDK_UART_STATE_RXOR_Msk (0x1ul << CMSDK_UART_STATE_RXOR_Pos) /* CMSDK_UART STATE: RXOR Mask. */
+
+#define CMSDK_UART_STATE_TXOR_Pos 2 /* CMSDK_UART STATE: TXOR Position. */
+#define CMSDK_UART_STATE_TXOR_Msk (0x1ul << CMSDK_UART_STATE_TXOR_Pos) /* CMSDK_UART STATE: TXOR Mask. */
+
+#define CMSDK_UART_STATE_RXBF_Pos 1 /* CMSDK_UART STATE: RXBF Position. */
+#define CMSDK_UART_STATE_RXBF_Msk (0x1ul << CMSDK_UART_STATE_RXBF_Pos) /* CMSDK_UART STATE: RXBF Mask. */
+
+#define CMSDK_UART_STATE_TXBF_Pos 0 /* CMSDK_UART STATE: TXBF Position. */
+#define CMSDK_UART_STATE_TXBF_Msk (0x1ul << CMSDK_UART_STATE_TXBF_Pos ) /* CMSDK_UART STATE: TXBF Mask. */
+
+/* CMSDK_UART CTRL Register Definitions. */
+#define CMSDK_UART_CTRL_HSTM_Pos 6 /* CMSDK_UART CTRL: HSTM Position. */
+#define CMSDK_UART_CTRL_HSTM_Msk (0x01ul << CMSDK_UART_CTRL_HSTM_Pos) /* CMSDK_UART CTRL: HSTM Mask. */
+
+#define CMSDK_UART_CTRL_RXORIRQEN_Pos 5 /* CMSDK_UART CTRL: RXORIRQEN Position. */
+#define CMSDK_UART_CTRL_RXORIRQEN_Msk (0x01ul << CMSDK_UART_CTRL_RXORIRQEN_Pos) /* CMSDK_UART CTRL: RXORIRQEN Mask. */
+
+#define CMSDK_UART_CTRL_TXORIRQEN_Pos 4 /* CMSDK_UART CTRL: TXORIRQEN Position. */
+#define CMSDK_UART_CTRL_TXORIRQEN_Msk (0x01ul << CMSDK_UART_CTRL_TXORIRQEN_Pos) /* CMSDK_UART CTRL: TXORIRQEN Mask. */
+
+#define CMSDK_UART_CTRL_RXIRQEN_Pos 3 /* CMSDK_UART CTRL: RXIRQEN Position. */
+#define CMSDK_UART_CTRL_RXIRQEN_Msk (0x01ul << CMSDK_UART_CTRL_RXIRQEN_Pos) /* CMSDK_UART CTRL: RXIRQEN Mask. */
+
+#define CMSDK_UART_CTRL_TXIRQEN_Pos 2 /* CMSDK_UART CTRL: TXIRQEN Position. */
+#define CMSDK_UART_CTRL_TXIRQEN_Msk (0x01ul << CMSDK_UART_CTRL_TXIRQEN_Pos) /* CMSDK_UART CTRL: TXIRQEN Mask. */
+
+#define CMSDK_UART_CTRL_RXEN_Pos 1 /* CMSDK_UART CTRL: RXEN Position. */
+#define CMSDK_UART_CTRL_RXEN_Msk (0x01ul << CMSDK_UART_CTRL_RXEN_Pos) /* CMSDK_UART CTRL: RXEN Mask. */
+
+#define CMSDK_UART_CTRL_TXEN_Pos 0 /* CMSDK_UART CTRL: TXEN Position. */
+#define CMSDK_UART_CTRL_TXEN_Msk (0x01ul << CMSDK_UART_CTRL_TXEN_Pos) /* CMSDK_UART CTRL: TXEN Mask. */
+
+/* CMSDK_UART INTSTATUS\INTCLEAR Register Definitions. */
+#define CMSDK_UART_INT_RXORIRQ_Pos 3 /* CMSDK_UART INT: RXORIRQ Position. */
+#define CMSDK_UART_INT_RXORIRQ_Msk (0x01ul << CMSDK_UART_INT_RXORIRQ_Pos) /* CMSDK_UART INT: RXORIRQ Mask. */
+
+#define CMSDK_UART_INT_TXORIRQ_Pos 2 /* CMSDK_UART INT: TXORIRQ Position. */
+#define CMSDK_UART_INT_TXORIRQ_Msk (0x01ul << CMSDK_UART_INT_TXORIRQ_Pos) /* CMSDK_UART INT: TXORIRQ Mask. */
+
+#define CMSDK_UART_INT_RXIRQ_Pos 1 /* CMSDK_UART INT: RXIRQ Position. */
+#define CMSDK_UART_INT_RXIRQ_Msk (0x01ul << CMSDK_UART_INT_RXIRQ_Pos) /* CMSDK_UART INT: RXIRQ Mask. */
+
+#define CMSDK_UART_INT_TXIRQ_Pos 0 /* CMSDK_UART INT: TXIRQ Position. */
+#define CMSDK_UART_INT_TXIRQ_Msk (0x01ul << CMSDK_UART_INT_TXIRQ_Pos) /* CMSDK_UART INT: TXIRQ Mask. */
+
+/* CMSDK_UART BAUDDIV Register Definitions. */
+#define CMSDK_UART_BAUDDIV_Pos 0 /* CMSDK_UART BAUDDIV: BAUDDIV Position. */
+#define CMSDK_UART_BAUDDIV_Msk (0xFFFFFul << CMSDK_UART_BAUDDIV_Pos)
+
+/**
+ * @brief Gets the core clock set for MPS3.
+ * @return Clock value in Hz.
+ **/
+uint32_t GetMPS3CoreClock(void);
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif /* DEVICE_MPS3_H */
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/include/font_9x15_h.h b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/include/font_9x15_h.h
new file mode 100644
index 0000000..b8b6bdc
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/include/font_9x15_h.h
@@ -0,0 +1,128 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+//Font Generated by MikroElektronika GLCD Font Creator 1.2.0.0
+//MikroElektrnika 2011
+//http://www.mikroe.com
+
+//GLCD FontName : Lucida_Console9x15
+//GLCD FontSize : 9x15
+
+#ifndef FONT_9x15_H_H
+#define FONT_9x15_H_H
+
+const unsigned short Font_9x15_h[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, /* Code for char num 32. */
+ 0x00,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x00,0x10,0x10,0x00,0x00,0x00, /* Code for char num 33. */
+ 0x44,0x44,0x44,0x44,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, /* Code for char num 34. */
+ 0x00,0x12,0x12,0x24,0x7F,0x24,0x28,0x48,0xFE,0x48,0x90,0x90,0x00,0x00,0x00, /* Code for char num 35. */
+ 0x10,0x7C,0x16,0x12,0x12,0x1C,0x38,0x70,0x50,0x50,0x52,0x3E,0x10,0x00,0x00, /* Code for char num 36. */
+ 0x00,0x8C,0x92,0x52,0x52,0x2C,0x10,0x08,0x68,0x94,0x92,0x92,0x62,0x00,0x00, /* Code for char num 37. */
+ 0x00,0x18,0x24,0x24,0x34,0x18,0x0C,0x12,0xB2,0xE2,0xC2,0xBC,0x00,0x00,0x00, /* Code for char num 38. */
+ 0x08,0x08,0x08,0x08,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, /* Code for char num 39. */
+ 0xC0,0x60,0x10,0x10,0x08,0x08,0x08,0x08,0x08,0x08,0x10,0x10,0x60,0xC0,0x00, /* Code for char num 40. */
+ 0x0C,0x18,0x20,0x20,0x40,0x40,0x40,0x40,0x40,0x40,0x20,0x20,0x18,0x0C,0x00, /* Code for char num 41. */
+ 0x00,0x10,0x92,0xEE,0x18,0x28,0x28,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, /* Code for char num 42. */
+ 0x00,0x00,0x00,0x00,0x10,0x10,0x10,0x10,0xFE,0x10,0x10,0x10,0x00,0x00,0x00, /* Code for char num 43. */
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x18,0x18,0x10,0x08,0x00, /* Code for char num 44. */
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x7C,0x00,0x00,0x00,0x00,0x00,0x00,0x00, /* Code for char num 45. */
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x18,0x18,0x00,0x00,0x00, /* Code for char num 46. */
+ 0x80,0x40,0x40,0x60,0x20,0x20,0x10,0x10,0x08,0x08,0x0C,0x04,0x04,0x02,0x00, /* Code for char num 47. */
+ 0x00,0x38,0x44,0x82,0x82,0x82,0x82,0x82,0x82,0x82,0x44,0x38,0x00,0x00,0x00, /* Code for char num 48. */
+ 0x00,0x10,0x1E,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0xFE,0x00,0x00,0x00, /* Code for char num 49. */
+ 0x00,0x3E,0x42,0x40,0x40,0x40,0x20,0x10,0x08,0x04,0x02,0x7E,0x00,0x00,0x00, /* Code for char num 50. */
+ 0x00,0x3C,0x40,0x40,0x40,0x60,0x38,0x40,0x40,0x40,0x40,0x3C,0x00,0x00,0x00, /* Code for char num 51. */
+ 0x00,0x20,0x30,0x28,0x24,0x24,0x22,0x21,0x7F,0x20,0x20,0x20,0x00,0x00,0x00, /* Code for char num 52. */
+ 0x00,0x7C,0x04,0x04,0x04,0x1C,0x20,0x40,0x40,0x40,0x20,0x3C,0x00,0x00,0x00, /* Code for char num 53. */
+ 0x00,0x78,0x04,0x04,0x02,0x3A,0x46,0x82,0x82,0x82,0x44,0x38,0x00,0x00,0x00, /* Code for char num 54. */
+ 0x00,0xFE,0x80,0x40,0x20,0x20,0x10,0x10,0x08,0x08,0x04,0x04,0x00,0x00,0x00, /* Code for char num 55. */
+ 0x00,0x3C,0x42,0x42,0x42,0x24,0x1C,0x62,0x42,0x42,0x42,0x3C,0x00,0x00,0x00, /* Code for char num 56. */
+ 0x00,0x38,0x44,0x82,0x82,0x82,0xC4,0xB8,0x80,0x40,0x40,0x3C,0x00,0x00,0x00, /* Code for char num 57. */
+ 0x00,0x00,0x00,0x00,0x18,0x18,0x00,0x00,0x00,0x00,0x18,0x18,0x00,0x00,0x00, /* Code for char num 58. */
+ 0x00,0x00,0x00,0x00,0x18,0x18,0x00,0x00,0x00,0x00,0x18,0x18,0x10,0x08,0x00, /* Code for char num 59. */
+ 0x00,0x00,0x00,0x00,0x80,0x60,0x10,0x0C,0x0C,0x10,0x60,0x80,0x00,0x00,0x00, /* Code for char num 60. */
+ 0x00,0x00,0x00,0x00,0x00,0x00,0xFE,0x00,0x00,0xFE,0x00,0x00,0x00,0x00,0x00, /* Code for char num 61. */
+ 0x00,0x00,0x00,0x00,0x02,0x0C,0x10,0x60,0x60,0x10,0x0C,0x02,0x00,0x00,0x00, /* Code for char num 62. */
+ 0x00,0x3E,0x42,0x42,0x40,0x20,0x10,0x08,0x08,0x00,0x08,0x08,0x00,0x00,0x00, /* Code for char num 63. */
+ 0x00,0x78,0x84,0xE2,0x92,0x8A,0x8A,0xCA,0xCA,0xB2,0xA6,0x3C,0x00,0x00,0x00, /* Code for char num 64. */
+ 0x00,0x00,0x10,0x38,0x28,0x28,0x44,0x44,0xFE,0x82,0x82,0x82,0x00,0x00,0x00, /* Code for char num 65. */
+ 0x00,0x00,0x3E,0x42,0x42,0x22,0x1E,0x22,0x42,0x42,0x42,0x3E,0x00,0x00,0x00, /* Code for char num 66. */
+ 0x00,0x00,0xF8,0x06,0x02,0x01,0x01,0x01,0x01,0x02,0x06,0xF8,0x00,0x00,0x00, /* Code for char num 67. */
+ 0x00,0x00,0x3E,0x42,0x82,0x82,0x82,0x82,0x82,0x82,0x42,0x3E,0x00,0x00,0x00, /* Code for char num 68. */
+ 0x00,0x00,0xFE,0x02,0x02,0x02,0x02,0x7E,0x02,0x02,0x02,0xFE,0x00,0x00,0x00, /* Code for char num 69. */
+ 0x00,0x00,0xFE,0x02,0x02,0x02,0x02,0x7E,0x02,0x02,0x02,0x02,0x00,0x00,0x00, /* Code for char num 70. */
+ 0x00,0x00,0xF8,0x06,0x02,0x01,0x01,0xE1,0x81,0x82,0x86,0xF8,0x00,0x00,0x00, /* Code for char num 71. */
+ 0x00,0x00,0x42,0x42,0x42,0x42,0x42,0x7E,0x42,0x42,0x42,0x42,0x00,0x00,0x00, /* Code for char num 72. */
+ 0x00,0x00,0xFE,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0xFE,0x00,0x00,0x00, /* Code for char num 73. */
+ 0x00,0x00,0x3C,0x20,0x20,0x20,0x20,0x20,0x20,0x20,0x20,0x1E,0x00,0x00,0x00, /* Code for char num 74. */
+ 0x00,0x00,0x42,0x22,0x12,0x0A,0x06,0x0A,0x12,0x22,0x42,0x82,0x00,0x00,0x00, /* Code for char num 75. */
+ 0x00,0x00,0x02,0x02,0x02,0x02,0x02,0x02,0x02,0x02,0x02,0xFE,0x00,0x00,0x00, /* Code for char num 76. */
+ 0x00,0x00,0x63,0x63,0x63,0x55,0x55,0x55,0x4D,0x49,0x41,0x41,0x00,0x00,0x00, /* Code for char num 77. */
+ 0x00,0x00,0x82,0x86,0x8A,0x8A,0x92,0x92,0xA2,0xA2,0xC2,0x82,0x00,0x00,0x00, /* Code for char num 78. */
+ 0x00,0x00,0x3C,0x42,0x81,0x81,0x81,0x81,0x81,0x81,0x42,0x3C,0x00,0x00,0x00, /* Code for char num 79. */
+ 0x00,0x00,0x3E,0x42,0x42,0x42,0x62,0x1E,0x02,0x02,0x02,0x02,0x00,0x00,0x00, /* Code for char num 80. */
+ 0x00,0x00,0x3C,0x42,0x81,0x81,0x81,0x81,0x81,0x81,0x42,0x3C,0x60,0x80,0x00, /* Code for char num 81. */
+ 0x00,0x00,0x3E,0x42,0x42,0x42,0x22,0x1E,0x12,0x22,0x42,0x82,0x00,0x00,0x00, /* Code for char num 82. */
+ 0x00,0x00,0x7C,0x42,0x02,0x06,0x1C,0x20,0x40,0x40,0x42,0x3E,0x00,0x00,0x00, /* Code for char num 83. */
+ 0x00,0x00,0xFE,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x00,0x00,0x00, /* Code for char num 84. */
+ 0x00,0x00,0x82,0x82,0x82,0x82,0x82,0x82,0x82,0x82,0x44,0x3C,0x00,0x00,0x00, /* Code for char num 85. */
+ 0x00,0x00,0x82,0x82,0x82,0x82,0x44,0x44,0x28,0x28,0x38,0x10,0x00,0x00,0x00, /* Code for char num 86. */
+ 0x00,0x00,0x82,0x82,0x92,0x92,0xAA,0xAA,0xAA,0xAA,0x64,0x44,0x00,0x00,0x00, /* Code for char num 87. */
+ 0x00,0x00,0x82,0x82,0x44,0x28,0x10,0x10,0x28,0x44,0x82,0x82,0x00,0x00,0x00, /* Code for char num 88. */
+ 0x00,0x00,0x82,0x82,0x44,0x44,0x28,0x10,0x10,0x10,0x10,0x10,0x00,0x00,0x00, /* Code for char num 89. */
+ 0x00,0x00,0xFF,0x80,0x40,0x20,0x10,0x08,0x04,0x02,0x01,0xFF,0x00,0x00,0x00, /* Code for char num 90. */
+ 0xF8,0x08,0x08,0x08,0x08,0x08,0x08,0x08,0x08,0x08,0x08,0x08,0x08,0xF8,0x00, /* Code for char num 91. */
+ 0x02,0x04,0x04,0x04,0x08,0x08,0x10,0x10,0x20,0x20,0x20,0x40,0x40,0x80,0x00, /* Code for char num 92. */
+ 0x3E,0x20,0x20,0x20,0x20,0x20,0x20,0x20,0x20,0x20,0x20,0x20,0x20,0x3E,0x00, /* Code for char num 93. */
+ 0x00,0x10,0x10,0x10,0x28,0x28,0x44,0x44,0x44,0x82,0x00,0x00,0x00,0x00,0x00, /* Code for char num 94. */
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xFE,0x00,0x00, /* Code for char num 95. */
+ 0x10,0x20,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00, /* Code for char num 96. */
+ 0x00,0x00,0x00,0x00,0x3C,0x40,0x40,0x78,0x44,0x42,0x62,0xDC,0x00,0x00,0x00, /* Code for char num 97. */
+ 0x02,0x02,0x02,0x02,0x7A,0x46,0x82,0x82,0x82,0x82,0x46,0x3A,0x00,0x00,0x00, /* Code for char num 98. */
+ 0x00,0x00,0x00,0x00,0xF8,0x04,0x02,0x02,0x02,0x02,0x04,0xF8,0x00,0x00,0x00, /* Code for char num 99. */
+ 0x80,0x80,0x80,0x80,0xB8,0xC4,0x82,0x82,0x82,0x82,0xC4,0xBC,0x00,0x00,0x00, /* Code for char num 100. */
+ 0x00,0x00,0x00,0x00,0x38,0x44,0x42,0x7E,0x02,0x02,0x04,0x78,0x00,0x00,0x00, /* Code for char num 101. */
+ 0xF0,0x08,0x08,0x08,0xFE,0x08,0x08,0x08,0x08,0x08,0x08,0x08,0x00,0x00,0x00, /* Code for char num 102. */
+ 0x00,0x00,0x00,0x00,0xB8,0xC4,0x82,0x82,0x82,0x82,0xC4,0xBC,0x80,0x40,0x3C, /* Code for char num 103. */
+ 0x02,0x02,0x02,0x02,0x3A,0x46,0x42,0x42,0x42,0x42,0x42,0x42,0x00,0x00,0x00, /* Code for char num 104. */
+ 0x18,0x18,0x00,0x00,0x1E,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x00,0x00,0x00, /* Code for char num 105. */
+ 0x30,0x30,0x00,0x00,0x3C,0x20,0x20,0x20,0x20,0x20,0x20,0x20,0x20,0x20,0x1E, /* Code for char num 106. */
+ 0x02,0x02,0x02,0x02,0x42,0x22,0x12,0x0E,0x0A,0x12,0x22,0x42,0x00,0x00,0x00, /* Code for char num 107. */
+ 0x1E,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x00,0x00,0x00, /* Code for char num 108. */
+ 0x00,0x00,0x00,0x00,0xDA,0xB6,0x92,0x92,0x92,0x92,0x92,0x92,0x00,0x00,0x00, /* Code for char num 109. */
+ 0x00,0x00,0x00,0x00,0x3A,0x46,0x42,0x42,0x42,0x42,0x42,0x42,0x00,0x00,0x00, /* Code for char num 110. */
+ 0x00,0x00,0x00,0x00,0x38,0x44,0x82,0x82,0x82,0x82,0x44,0x38,0x00,0x00,0x00, /* Code for char num 111. */
+ 0x00,0x00,0x00,0x00,0x7A,0x46,0x82,0x82,0x82,0x82,0x46,0x3A,0x02,0x02,0x02, /* Code for char num 112. */
+ 0x00,0x00,0x00,0x00,0xB8,0xC4,0x82,0x82,0x82,0x82,0xC4,0xBC,0x80,0x80,0x80, /* Code for char num 113. */
+ 0x00,0x00,0x00,0x00,0xF4,0x8C,0x04,0x04,0x04,0x04,0x04,0x04,0x00,0x00,0x00, /* Code for char num 114. */
+ 0x00,0x00,0x00,0x00,0x7C,0x02,0x02,0x0C,0x30,0x40,0x42,0x3E,0x00,0x00,0x00, /* Code for char num 115. */
+ 0x00,0x00,0x08,0x08,0xFE,0x08,0x08,0x08,0x08,0x08,0x08,0xF0,0x00,0x00,0x00, /* Code for char num 116. */
+ 0x00,0x00,0x00,0x00,0x42,0x42,0x42,0x42,0x42,0x42,0x62,0x5C,0x00,0x00,0x00, /* Code for char num 117. */
+ 0x00,0x00,0x00,0x00,0x82,0x82,0x82,0x44,0x44,0x28,0x28,0x10,0x00,0x00,0x00, /* Code for char num 118. */
+ 0x00,0x00,0x00,0x00,0x82,0x92,0xAA,0xAA,0xAA,0xAA,0x44,0x44,0x00,0x00,0x00, /* Code for char num 119. */
+ 0x00,0x00,0x00,0x00,0x82,0x44,0x28,0x10,0x10,0x28,0x44,0x82,0x00,0x00,0x00, /* Code for char num 120. */
+ 0x00,0x00,0x00,0x00,0x82,0x82,0x82,0x44,0x44,0x28,0x28,0x10,0x10,0x0C,0x00, /* Code for char num 121. */
+ 0x00,0x00,0x00,0x00,0xFE,0x80,0x40,0x20,0x10,0x08,0x04,0xFE,0x00,0x00,0x00, /* Code for char num 122. */
+ 0xE0,0x10,0x10,0x10,0x10,0x10,0x10,0x0C,0x10,0x10,0x10,0x10,0x10,0xE0,0x00, /* Code for char num 123. */
+ 0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x10,0x00, /* Code for char num 124. */
+ 0x0E,0x10,0x10,0x10,0x10,0x10,0x10,0x60,0x10,0x10,0x10,0x10,0x10,0x0E,0x00, /* Code for char num 125. */
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x62,0x92,0x8C,0x00,0x00,0x00,0x00,0x00,0x00, /* Code for char num 126. */
+ 0x00,0x00,0x00,0x07,0x05,0x05,0x05,0x05,0x05,0x05,0x07,0x00,0x00,0x00,0x00 /* Code for char num 127. */
+};
+
+
+#endif /* FONT_9x15_H_H */
\ No newline at end of file
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/include/glcd_mps3.h b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/include/glcd_mps3.h
new file mode 100644
index 0000000..c2810c0
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/include/glcd_mps3.h
@@ -0,0 +1,202 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef GLCD_MPS3_H
+#define GLCD_MPS3_H
+
+#include <stdint.h>
+
+/******************************************************************************
+ Color coding
+ GLCD is coded: 15..11 red, 10..5 green, 4..0 blue (unsigned short)
+ GLCD_R5, GLCD_G6, GLCD_B5
+ original coding: 17..12 red, 11..6 green, 5..0 blue
+ ORG_R6, ORG_G6, ORG_B6
+
+ ORG_R1..5 = GLCD_R0..4, ORG_R0 = GLCD_R4
+ ORG_G0..5 = GLCD_G0..5,
+ ORG_B1..5 = GLCD_B0..4, ORG_B0 = GLCD_B4
+
+ GLCD RGB color definitions
+******************************************************************************/
+#define Black 0x0000 /* 0, 0, 0 */
+#define Navy 0x000F /* 0, 0, 128 */
+#define DarkGreen 0x03E0 /* 0, 128, 0 */
+#define DarkCyan 0x03EF /* 0, 128, 128 */
+#define Maroon 0x7800 /* 128, 0, 0 */
+#define Purple 0x780F /* 128, 0, 128 */
+#define Olive 0x7BE0 /* 128, 128, 0 */
+#define LightGrey 0xC618 /* 192, 192, 192 */
+#define DarkGrey 0x7BEF /* 128, 128, 128 */
+#define Blue 0x001F /* 0, 0, 255 */
+#define Green 0x07E0 /* 0, 255, 0 */
+#define Cyan 0x07FF /* 0, 255, 255 */
+#define Red 0xF800 /* 255, 0, 0 */
+#define Magenta 0xF81F /* 255, 0, 255 */
+#define Yellow 0xFFE0 /* 255, 255, 0 */
+#define White 0xFFFF /* 255, 255, 255 */
+
+/************************** Orientation configuration ************************/
+#ifndef LANDSCAPE
+#define LANDSCAPE 1 /* 1 for landscape, 0 for portrait. */
+#endif
+#ifndef ROTATE180
+#define ROTATE180 1 /* 1 to rotate the screen for 180 deg. */
+#endif
+
+/*------------------------- Speed dependant settings -------------------------*/
+
+/* If processor works on high frequency delay has to be increased, it can be
+ increased by factor 2^N by this constant. */
+#define DELAY_2N 8
+
+/*---------------------- Graphic LCD size definitions ------------------------*/
+#if (LANDSCAPE == 1)
+ #define GLCD_WIDTH 320 /* Screen Width (in pixels). */
+ #define GLCD_HEIGHT 240 /* Screen Hight (in pixels). */
+#else
+ #define GLCD_WIDTH 240 /* Screen Width (in pixels). */
+ #define GLCD_HEIGHT 320 /* Screen Hight (in pixels). */
+#endif
+
+#define BPP 16 /* Bits per pixel. */
+#define BYPP ((BPP+7)/8) /* Bytes per pixel. */
+
+
+/**
+ * @brief Initialize the Himax LCD with HX8347-D LCD Controller.
+ */
+void GLCD_Initialize(void);
+
+/**
+ * @brief Set draw window region to whole screen.
+ */
+void GLCD_WindowMax(void);
+
+/**
+ * @brief Set draw window region.
+ * @param[in] x Horizontal position.
+ * @param[in] y Vertical position.
+ * @param[in] w Window width in pixel.
+ * @param[in] h Window height in pixels.
+ */
+void GLCD_SetWindow(unsigned int x, unsigned int y,
+ unsigned int w, unsigned int h);
+
+/**
+ * @brief Set foreground color.
+ * @param[in] color Foreground color.
+ */
+void GLCD_SetTextColor(unsigned short color);
+
+/**
+ * @brief Set background color.
+ * @param[in] color Background color.
+ */
+void GLCD_SetBackColor(unsigned short color);
+
+/**
+ * @brief Clear display.
+ * @param[in] color Display clearing color.
+ *
+ */
+void GLCD_Clear(unsigned short color);
+
+/**
+ * @brief Draw character on given position.
+ * @param[in] x Horizontal position.
+ * @param[in] y Vertical position.
+ * @param[in] cw Character width in pixel.
+ * @param[in] ch Character height in pixels.
+ * @param[in] c Pointer to character bitmap.
+ *
+ */
+void GLCD_DrawChar(unsigned int x, unsigned int y,
+ unsigned int cw, unsigned int ch,
+ unsigned char *c);
+
+/**
+ * @brief Display character on given line.
+ * @param[in] ln Line number.
+ * @param[in] col Column number.
+ * @param[in] fi Font index (0 = 9x15).
+ * @param[in] c ASCII character.
+ */
+void GLCD_DisplayChar(unsigned int ln, unsigned int col,
+ unsigned char fi, unsigned char c);
+
+
+/**
+ * @brief Display string on given line.
+ * @param[in] ln Line number.
+ * @param[in] col Column number.
+ * @param[in] fi Font index (0 = 9x15).
+ * @param[in] s Pointer to string.
+ */
+void GLCD_DisplayString(unsigned int ln, unsigned int col,
+ unsigned char fi, char *s);
+
+/**
+ * @brief Clear given line.
+ * @param[in] ln: Line number.
+ * @param[in] fi Font index (0 = 9x15).
+ */
+void GLCD_ClearLn(unsigned int ln, unsigned char fi);
+
+/**
+ * @brief Display graphical bitmap image at position x horizontally and y
+ * vertically. This function is optimized for 16 bits per pixel
+ * format, it has to be adapted for any other format.
+ * @param[in] x Horizontal position.
+ * @param[in] y Vertical position.
+ * @param[in] w Width of bitmap.
+ * @param[in] h Height of bitmap.
+ * @param[in] bitmap Address at which the bitmap data resides.
+ */
+void GLCD_Bitmap(unsigned int x, unsigned int y,
+ unsigned int w, unsigned int h,
+ unsigned short *bitmap);
+
+/**
+ * @brief Displays an 8 bit image, conversion to the LCD's
+ * 16 bit codec is done on the fly.
+ * @param[in] data Pointer to the full sized image data.
+ * @param[in] width Image width.
+ * @param[in] height Image height.
+ * @param[in] channels Number of channels in the image.
+ * @param[in] pos_x Start x position for the LCD.
+ * @param[in] pos_y Start y position for the LCD.
+ * @param[in] downsample_factor Factor by which the image
+ * is downsampled by.
+ */
+void GLCD_Image(void *data, const uint32_t width,
+ const uint32_t height, const uint32_t channels,
+ const uint32_t pos_x, const uint32_t pos_y,
+ const uint32_t downsample_factor);
+
+/**
+ * @brief Draw box filled with color.
+ * @param[in] x Horizontal position.
+ * @param[in] y Vertical position.
+ * @param[in] w Window width in pixels.
+ * @param[in] h Window height in pixels.
+ * @param[in] color Box color.
+ */
+void GLCD_Box(unsigned int x, unsigned int y,
+ unsigned int w, unsigned int h,
+ unsigned short color);
+
+#endif /* GLCD_MPS3_H */
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/include/smm_mps3.h b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/include/smm_mps3.h
new file mode 100644
index 0000000..1c0e0f2
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/include/smm_mps3.h
@@ -0,0 +1,615 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef SMM_MPS3_H
+#define SMM_MPS3_H
+
+#include "cmsis.h" /* Device specific header file. */
+#include "peripheral_memmap.h" /* Peripheral memory map definitions. */
+
+#if defined ( __CC_ARM )
+#pragma anon_unions
+#endif
+
+/******************************************************************************/
+/* FPGA System Register declaration */
+/******************************************************************************/
+
+typedef struct
+{
+ __IO uint32_t LED; /* Offset: 0x000 (R/W) LED connections
+ * [31:2] : Reserved
+ * [1:0] : LEDs
+ */
+ uint32_t RESERVED1[1];
+ __IO uint32_t BUTTON; /* Offset: 0x008 (R/W) Buttons
+ * [31:2] : Reserved
+ * [1:0] : Buttons
+ */
+ uint32_t RESERVED2[1];
+ __IO uint32_t CLK1HZ; /* Offset: 0x010 (R/W) 1Hz up counter */
+ __IO uint32_t CLK100HZ; /* Offset: 0x014 (R/W) 100Hz up counter */
+ __IO uint32_t COUNTER; /* Offset: 0x018 (R/W) Cycle Up Counter
+ * Increments when 32-bit prescale counter reach zero
+ */
+ __IO uint32_t PRESCALE; /* Offset: 0x01C (R/W) Prescaler
+ * Bit[31:0] : reload value for prescale counter
+ */
+ __IO uint32_t PSCNTR; /* Offset: 0x020 (R/W) 32-bit Prescale counter
+ * current value of the pre-scaler counter
+ * The Cycle Up Counter increment when the prescale down counter reach 0
+ * The pre-scaler counter is reloaded with PRESCALE after reaching 0.
+ */
+ uint32_t RESERVED3[1];
+ __IO uint32_t SWITCHES; /* Offset: 0x028 (R/W) Switches
+ * [31:8] : Reserved
+ * [7:0] : Switches
+ */
+ uint32_t RESERVED4[8];
+ __IO uint32_t MISC; /* Offset: 0x04C (R/W) Misc control
+ * [31:10] : Reserved
+ * [9] :
+ * [8] :
+ * [7] : ADC_SPI_nCS
+ * [6] : CLCD_BL_CTRL
+ * [5] : CLCD_RD
+ * [4] : CLCD_RS
+ * [3] : CLCD_RESET
+ * [2] : SHIELD_1_SPI_nCS
+ * [1] : SHIELD_0_SPI_nCS
+ * [0] : CLCD_CS
+ */
+} MPS3_FPGAIO_TypeDef;
+
+/* MISC register bit definitions. */
+
+#define CLCD_CS_Pos 0
+#define CLCD_CS_Msk (1UL<<CLCD_CS_Pos)
+#define SHIELD_0_nCS_Pos 1
+#define SHIELD_0_nCS_Msk (1UL<<SHIELD_0_nCS_Pos)
+#define SHIELD_1_nCS_Pos 2
+#define SHIELD_1_nCS_Msk (1UL<<SHIELD_1_nCS_Pos)
+#define CLCD_RESET_Pos 3
+#define CLCD_RESET_Msk (1UL<<CLCD_RESET_Pos)
+#define CLCD_RS_Pos 4
+#define CLCD_RS_Msk (1UL<<CLCD_RS_Pos)
+#define CLCD_RD_Pos 5
+#define CLCD_RD_Msk (1UL<<CLCD_RD_Pos)
+#define CLCD_BL_Pos 6
+#define CLCD_BL_Msk (1UL<<CLCD_BL_Pos)
+#define ADC_nCS_Pos 7
+#define ADC_nCS_Msk (1UL<<ADC_nCS_Pos)
+
+/******************************************************************************/
+/* SCC Register declaration */
+/******************************************************************************/
+
+typedef struct
+{
+ __IO uint32_t CFG_REG0; /* Offset: 0x000 (R/W) Remaps block RAM to ZBT
+ * [31:1] : Reserved
+ * [0] 1 : REMAP BlockRam to ZBT
+ */
+ __IO uint32_t LEDS; /* Offset: 0x004 (R/W) Controls the MCC user LEDs
+ * [31:8] : Reserved
+ * [7:0] : MCC LEDs
+ */
+ uint32_t RESERVED0[1];
+ __I uint32_t SWITCHES; /* Offset: 0x00C (R/ ) Denotes the state of the MCC user switches
+ * [31:8] : Reserved
+ * [7:0] : These bits indicate state of the MCC switches
+ */
+ __I uint32_t CFG_REG4; /* Offset: 0x010 (R/ ) Denotes the board revision
+ * [31:4] : Reserved
+ * [3:0] : Used by the MCC to pass PCB revision. 0 = A 1 = B
+ */
+ __I uint32_t CFG_ACLK; /* Offset: 0x014 (R/ ) System Clock
+ */
+ uint32_t RESERVED1[34];
+ __IO uint32_t SYS_CFGDATA_RTN; /* Offset: 0x0A0 (R/W) User data register
+ * [31:0] : Data
+ */
+ __IO uint32_t SYS_CFGDATA_OUT; /* Offset: 0x0A4 (R/W) User data register
+ * [31:0] : Data
+ */
+ __IO uint32_t SYS_CFGCTRL; /* Offset: 0x0A8 (R/W) Control register
+ * [31] : Start (generates interrupt on write to this bit)
+ * [30] : R/W access
+ * [29:26] : Reserved
+ * [25:20] : Function value
+ * [19:12] : Reserved
+ * [11:0] : Device (value of 0/1/2 for supported clocks)
+ */
+ __IO uint32_t SYS_CFGSTAT; /* Offset: 0x0AC (R/W) Contains status information
+ * [31:2] : Reserved
+ * [1] : Error
+ * [0] : Complete
+ */
+ __IO uint32_t RESERVED2[20];
+ __IO uint32_t SCC_DLL; /* Offset: 0x100 (R/W) DLL Lock Register
+ * [31:24] : DLL LOCK MASK[7:0] - Indicate if the DLL locked is masked
+ * [23:16] : DLL LOCK MASK[7:0] - Indicate if the DLLs are locked or unlocked
+ * [15:1] : Reserved
+ * [0] : This bit indicates if all enabled DLLs are locked
+ */
+ uint32_t RESERVED3[957];
+ __I uint32_t SCC_AID; /* Offset: 0xFF8 (R/ ) SCC AID Register
+ * [31:24] : FPGA build number
+ * [23:20] : V2M-MPS3 target board revision (A = 0, B = 1)
+ * [19:11] : Reserved
+ * [10] : if “1” SCC_SW register has been implemented
+ * [9] : if “1” SCC_LED register has been implemented
+ * [8] : if “1” DLL lock register has been implemented
+ * [7:0] : number of SCC configuration register
+ */
+ __I uint32_t SCC_ID; /* Offset: 0xFFC (R/ ) Contains information about the FPGA image
+ * [31:24] : Implementer ID: 0x41 = ARM
+ * [23:20] : Application note IP variant number
+ * [19:16] : IP Architecture: 0x4 =AHB
+ * [15:4] : Primary part number: 386 = AN386
+ * [3:0] : Application note IP revision number
+ */
+} MPS3_SCC_TypeDef;
+
+
+/******************************************************************************/
+/* SSP Peripheral declaration */
+/******************************************************************************/
+
+typedef struct
+{
+ __IO uint32_t CR0; /* Offset: 0x000 (R/W) Control register 0
+ * [31:16] : Reserved
+ * [15:8] : Serial clock rate
+ * [7] : SSPCLKOUT phase, applicable to Motorola SPI frame format only
+ * [6] : SSPCLKOUT polarity, applicable to Motorola SPI frame format only
+ * [5:4] : Frame format
+ * [3:0] : Data Size Select
+ */
+ __IO uint32_t CR1; /* Offset: 0x004 (R/W) Control register 1
+ * [31:4] : Reserved
+ * [3] : Slave-mode output disable
+ * [2] : Master or slave mode select
+ * [1] : Synchronous serial port enable
+ * [0] : Loop back mode
+ */
+ __IO uint32_t DR; /* Offset: 0x008 (R/W) Data register
+ * [31:16] : Reserved
+ * [15:0] : Transmit/Receive FIFO
+ */
+ __I uint32_t SR; /* Offset: 0x00C (R/ ) Status register
+ * [31:5] : Reserved
+ * [4] : PrimeCell SSP busy flag
+ * [3] : Receive FIFO full
+ * [2] : Receive FIFO not empty
+ * [1] : Transmit FIFO not full
+ * [0] : Transmit FIFO empty
+ */
+ __IO uint32_t CPSR; /* Offset: 0x010 (R/W) Clock prescale register
+ * [31:8] : Reserved
+ * [8:0] : Clock prescale divisor
+ */
+ __IO uint32_t IMSC; /* Offset: 0x014 (R/W) Interrupt mask set or clear register
+ * [31:4] : Reserved
+ * [3] : Transmit FIFO interrupt mask
+ * [2] : Receive FIFO interrupt mask
+ * [1] : Receive timeout interrupt mask
+ * [0] : Receive overrun interrupt mask
+ */
+ __I uint32_t RIS; /* Offset: 0x018 (R/ ) Raw interrupt status register
+ * [31:4] : Reserved
+ * [3] : raw interrupt state, prior to masking, of the SSPTXINTR interrupt
+ * [2] : raw interrupt state, prior to masking, of the SSPRXINTR interrupt
+ * [1] : raw interrupt state, prior to masking, of the SSPRTINTR interrupt
+ * [0] : raw interrupt state, prior to masking, of the SSPRORINTR interrupt
+ */
+ __I uint32_t MIS; /* Offset: 0x01C (R/ ) Masked interrupt status register
+ * [31:4] : Reserved
+ * [3] : transmit FIFO masked interrupt state, after masking, of the SSPTXINTR interrupt
+ * [2] : receive FIFO masked interrupt state, after masking, of the SSPRXINTR interrupt
+ * [1] : receive timeout masked interrupt state, after masking, of the SSPRTINTR interrupt
+ * [0] : receive over run masked interrupt status, after masking, of the SSPRORINTR interrupt
+ */
+ __O uint32_t ICR; /* Offset: 0x020 ( /W) Interrupt clear register
+ * [31:2] : Reserved
+ * [1] : Clears the SSPRTINTR interrupt
+ * [0] : Clears the SSPRORINTR interrupt
+ */
+ __IO uint32_t DMACR; /* Offset: 0x024 (R/W) DMA control register
+ * [31:2] : Reserved
+ * [1] : Transmit DMA Enable
+ * [0] : Receive DMA Enable
+ */
+} MPS3_SSP_TypeDef;
+
+
+/* SSP_CR0 Control register 0. */
+#define SSP_CR0_DSS_Pos 0 /* Data Size Select. */
+#define SSP_CR0_DSS_Msk (0xF<<SSP_CR0_DSS_Pos)
+#define SSP_CR0_FRF_Pos 4 /* Frame Format Select. */
+#define SSP_CR0_FRF_Msk (3UL<<SSP_CR0_FRM_Pos)
+#define SSP_CR0_SPO_Pos 6 /* SSPCLKOUT polarity. */
+#define SSP_CR0_SPO_Msk (1UL<<SSP_CR0_SPO_Pos)
+#define SSP_CR0_SPH_Pos 7 /* SSPCLKOUT phase. */
+#define SSP_CR0_SPH_Msk (1UL<<SSP_CR0_SPH_Pos)
+#define SSP_CR0_SCR_Pos 8 /* Serial Clock Rate (divide). */
+#define SSP_CR0_SCR_Msk (0xFF<<SSP_CR0_SCR_Pos)
+
+#define SSP_CR0_SCR_DFLT 0x0300 /* Serial Clock Rate (divide), default set at 3. */
+#define SSP_CR0_FRF_MOT 0x0000 /* Frame format. */
+#define SSP_CR0_DSS_8 0x0007 /* Data packet size, 8bits. */
+#define SSP_CR0_DSS_16 0x000F /* Data packet size, 16bits. */
+
+/* SSP_CR1 Control register 1. */
+#define SSP_CR1_LBM_Pos 0 /* Loop Back Mode. */
+#define SSP_CR1_LBM_Msk (1UL<<SSP_CR1_LBM_Pos)
+#define SSP_CR1_SSE_Pos 1 /* Serial port enable. */
+#define SSP_CR1_SSE_Msk (1UL<<SSP_CR1_SSE_Pos)
+#define SSP_CR1_MS_Pos 2 /* Master or Slave mode. */
+#define SSP_CR1_MS_Msk (1UL<<SSP_CR1_MS_Pos)
+#define SSP_CR1_SOD_Pos 3 /* Slave Output mode Disable. */
+#define SSP_CR1_SOD_Msk (1UL<<SSP_CR1_SOD_Pos)
+
+/* SSP_SR Status register. */
+#define SSP_SR_TFE_Pos 0 /* Transmit FIFO empty. */
+#define SSP_SR_TFE_Msk (1UL<<SSP_SR_TFE_Pos)
+#define SSP_SR_TNF_Pos 1 /* Transmit FIFO not full. */
+#define SSP_SR_TNF_Msk (1UL<<SSP_SR_TNF_Pos)
+#define SSP_SR_RNE_Pos 2 /* Receive FIFO not empty. */
+#define SSP_SR_RNE_Msk (1UL<<SSP_SR_RNE_Pos)
+#define SSP_SR_RFF_Pos 3 /* Receive FIFO full. */
+#define SSP_SR_RFF_Msk (1UL<<SSP_SR_RFF_Pos)
+#define SSP_SR_BSY_Pos 4 /* Busy. */
+#define SSP_SR_BSY_Msk (1UL<<SSP_SR_BSY_Pos)
+
+/* SSP_CPSR Clock prescale register. */
+#define SSP_CPSR_CPD_Pos 0 /* Clock prescale divisor. */
+#define SSP_CPSR_CPD_Msk (0xFF<<SSP_CPSR_CDP_Pos)
+
+#define SSP_CPSR_DFLT 0x0008 /* Clock prescale (use with SCR), default set at 8. */
+
+/* SSPIMSC Interrupt mask set and clear register. */
+#define SSP_IMSC_RORIM_Pos 0 /* Receive overrun not Masked. */
+#define SSP_IMSC_RORIM_Msk (1UL<<SSP_IMSC_RORIM_Pos)
+#define SSP_IMSC_RTIM_Pos 1 /* Receive timeout not Masked. */
+#define SSP_IMSC_RTIM_Msk (1UL<<SSP_IMSC_RTIM_Pos)
+#define SSP_IMSC_RXIM_Pos 2 /* Receive FIFO not Masked. */
+#define SSP_IMSC_RXIM_Msk (1UL<<SSP_IMSC_RXIM_Pos)
+#define SSP_IMSC_TXIM_Pos 3 /* Transmit FIFO not Masked. */
+#define SSP_IMSC_TXIM_Msk (1UL<<SSP_IMSC_TXIM_Pos)
+
+/* SSPRIS Raw interrupt status register. */
+#define SSP_RIS_RORRIS_Pos 0 /* Raw Overrun interrupt flag. */
+#define SSP_RIS_RORRIS_Msk (1UL<<SSP_RIS_RORRIS_Pos)
+#define SSP_RIS_RTRIS_Pos 1 /* Raw Timemout interrupt flag. */
+#define SSP_RIS_RTRIS_Msk (1UL<<SSP_RIS_RTRIS_Pos)
+#define SSP_RIS_RXRIS_Pos 2 /* Raw Receive interrupt flag. */
+#define SSP_RIS_RXRIS_Msk (1UL<<SSP_RIS_RXRIS_Pos)
+#define SSP_RIS_TXRIS_Pos 3 /* Raw Transmit interrupt flag. */
+#define SSP_RIS_TXRIS_Msk (1UL<<SSP_RIS_TXRIS_Pos)
+
+/* SSPMIS Masked interrupt status register. */
+#define SSP_MIS_RORMIS_Pos 0 /* Masked Overrun interrupt flag. */
+#define SSP_MIS_RORMIS_Msk (1UL<<SSP_MIS_RORMIS_Pos)
+#define SSP_MIS_RTMIS_Pos 1 /* Masked Timemout interrupt flag. */
+#define SSP_MIS_RTMIS_Msk (1UL<<SSP_MIS_RTMIS_Pos)
+#define SSP_MIS_RXMIS_Pos 2 /* Masked Receive interrupt flag. */
+#define SSP_MIS_RXMIS_Msk (1UL<<SSP_MIS_RXMIS_Pos)
+#define SSP_MIS_TXMIS_Pos 3 /* Masked Transmit interrupt flag. */
+#define SSP_MIS_TXMIS_Msk (1UL<<SSP_MIS_TXMIS_Pos)
+
+/* SSPICR Interrupt clear register. */
+#define SSP_ICR_RORIC_Pos 0 /* Clears Overrun interrupt flag. */
+#define SSP_ICR_RORIC_Msk (1UL<<SSP_ICR_RORIC_Pos)
+#define SSP_ICR_RTIC_Pos 1 /* Clears Timemout interrupt flag. */
+#define SSP_ICR_RTIC_Msk (1UL<<SSP_ICR_RTIC_Pos)
+
+/* SSPDMACR DMA control register. */
+#define SSP_DMACR_RXDMAE_Pos 0 /* Enable Receive FIFO DMA. */
+#define SSP_DMACR_RXDMAE_Msk (1UL<<SSP_DMACR_RXDMAE_Pos)
+#define SSP_DMACR_TXDMAE_Pos 1 /* Enable Transmit FIFO DMA. */
+#define SSP_DMACR_TXDMAE_Msk (1UL<<SSP_DMACR_TXDMAE_Pos)
+
+/******************************************************************************/
+/* Audio and Touch Screen (I2C) Peripheral declaration */
+/******************************************************************************/
+
+typedef struct
+{
+ union {
+ __O uint32_t CONTROLS; /* Offset: 0x000 CONTROL Set Register ( /W). */
+ __I uint32_t CONTROL; /* Offset: 0x000 CONTROL Status Register (R/ ). */
+ };
+ __O uint32_t CONTROLC; /* Offset: 0x004 CONTROL Clear Register ( /W). */
+} MPS3_I2C_TypeDef;
+
+#define SDA 1 << 1
+#define SCL 1 << 0
+
+
+/******************************************************************************/
+/* Audio I2S Peripheral declaration */
+/******************************************************************************/
+
+typedef struct
+{
+ /*!< Offset: 0x000 CONTROL Register (R/W) */
+ __IO uint32_t CONTROL; /* <h> CONTROL </h>
+ * <o.0> TX Enable
+ * <0=> TX disabled
+ * <1=> TX enabled
+ * <o.1> TX IRQ Enable
+ * <0=> TX IRQ disabled
+ * <1=> TX IRQ enabled
+ * <o.2> RX Enable
+ * <0=> RX disabled
+ * <1=> RX enabled
+ * <o.3> RX IRQ Enable
+ * <0=> RX IRQ disabled
+ * <1=> RX IRQ enabled
+ * <o.10..8> TX Buffer Water Level
+ * <0=> / IRQ triggers when any space available
+ * <1=> / IRQ triggers when more than 1 space available
+ * <2=> / IRQ triggers when more than 2 space available
+ * <3=> / IRQ triggers when more than 3 space available
+ * <4=> Undefined!
+ * <5=> Undefined!
+ * <6=> Undefined!
+ * <7=> Undefined!
+ * <o.14..12> RX Buffer Water Level
+ * <0=> Undefined!
+ * <1=> / IRQ triggers when less than 1 space available
+ * <2=> / IRQ triggers when less than 2 space available
+ * <3=> / IRQ triggers when less than 3 space available
+ * <4=> / IRQ triggers when less than 4 space available
+ * <5=> Undefined!
+ * <6=> Undefined!
+ * <7=> Undefined!
+ * <o.16> FIFO reset
+ * <0=> Normal operation
+ * <1=> FIFO reset
+ * <o.17> Audio Codec reset
+ * <0=> Normal operation
+ * <1=> Assert audio Codec reset
+ */
+ /*!< Offset: 0x004 STATUS Register (R/ ) */
+ __I uint32_t STATUS; /* <h> STATUS </h>
+ * <o.0> TX Buffer alert
+ * <0=> TX buffer don't need service yet
+ * <1=> TX buffer need service
+ * <o.1> RX Buffer alert
+ * <0=> RX buffer don't need service yet
+ * <1=> RX buffer need service
+ * <o.2> TX Buffer Empty
+ * <0=> TX buffer have data
+ * <1=> TX buffer empty
+ * <o.3> TX Buffer Full
+ * <0=> TX buffer not full
+ * <1=> TX buffer full
+ * <o.4> RX Buffer Empty
+ * <0=> RX buffer have data
+ * <1=> RX buffer empty
+ * <o.5> RX Buffer Full
+ * <0=> RX buffer not full
+ * <1=> RX buffer full
+ */
+ union {
+ /*!< Offset: 0x008 Error Status Register (R/ ) */
+ __I uint32_t ERROR; /* <h> ERROR </h>
+ * <o.0> TX error
+ * <0=> Okay
+ * <1=> TX overrun/underrun
+ * <o.1> RX error
+ * <0=> Okay
+ * <1=> RX overrun/underrun
+ */
+ /*!< Offset: 0x008 Error Clear Register ( /W) */
+ __O uint32_t ERRORCLR; /* <h> ERRORCLR </h>
+ * <o.0> TX error
+ * <0=> Okay
+ * <1=> Clear TX error
+ * <o.1> RX error
+ * <0=> Okay
+ * <1=> Clear RX error
+ */
+ };
+ /*!< Offset: 0x00C Divide ratio Register (R/W) */
+ __IO uint32_t DIVIDE; /* <h> Divide ratio for Left/Right clock </h>
+ * <o.9..0> TX error (default 0x80)
+ */
+ /*!< Offset: 0x010 Transmit Buffer ( /W) */
+ __O uint32_t TXBUF; /* <h> Transmit buffer </h>
+ * <o.15..0> Right channel
+ * <o.31..16> Left channel
+ */
+
+ /*!< Offset: 0x014 Receive Buffer (R/ ) */
+ __I uint32_t RXBUF; /* <h> Receive buffer </h>
+ * <o.15..0> Right channel
+ * <o.31..16> Left channel
+ */
+ uint32_t RESERVED1[186];
+ __IO uint32_t ITCR; /* <h> Integration Test Control Register </h>
+ * <o.0> ITEN
+ * <0=> Normal operation
+ * <1=> Integration Test mode enable
+ */
+ __O uint32_t ITIP1; /* <h> Integration Test Input Register 1</h>
+ * <o.0> SDIN
+ */
+ __O uint32_t ITOP1; /* <h> Integration Test Output Register 1</h>
+ * <o.0> SDOUT
+ * <o.1> SCLK
+ * <o.2> LRCK
+ * <o.3> IRQOUT
+ */
+} MPS3_I2S_TypeDef;
+
+#define I2S_CONTROL_TXEN_Pos 0
+#define I2S_CONTROL_TXEN_Msk (1UL<<I2S_CONTROL_TXEN_Pos)
+
+#define I2S_CONTROL_TXIRQEN_Pos 1
+#define I2S_CONTROL_TXIRQEN_Msk (1UL<<I2S_CONTROL_TXIRQEN_Pos)
+
+#define I2S_CONTROL_RXEN_Pos 2
+#define I2S_CONTROL_RXEN_Msk (1UL<<I2S_CONTROL_RXEN_Pos)
+
+#define I2S_CONTROL_RXIRQEN_Pos 3
+#define I2S_CONTROL_RXIRQEN_Msk (1UL<<I2S_CONTROL_RXIRQEN_Pos)
+
+#define I2S_CONTROL_TXWLVL_Pos 8
+#define I2S_CONTROL_TXWLVL_Msk (7UL<<I2S_CONTROL_TXWLVL_Pos)
+
+#define I2S_CONTROL_RXWLVL_Pos 12
+#define I2S_CONTROL_RXWLVL_Msk (7UL<<I2S_CONTROL_RXWLVL_Pos)
+/* FIFO reset. */
+#define I2S_CONTROL_FIFORST_Pos 16
+#define I2S_CONTROL_FIFORST_Msk (1UL<<I2S_CONTROL_FIFORST_Pos)
+/* Codec reset. */
+#define I2S_CONTROL_CODECRST_Pos 17
+#define I2S_CONTROL_CODECRST_Msk (1UL<<I2S_CONTROL_CODECRST_Pos)
+
+#define I2S_STATUS_TXIRQ_Pos 0
+#define I2S_STATUS_TXIRQ_Msk (1UL<<I2S_STATUS_TXIRQ_Pos)
+
+#define I2S_STATUS_RXIRQ_Pos 1
+#define I2S_STATUS_RXIRQ_Msk (1UL<<I2S_STATUS_RXIRQ_Pos)
+
+#define I2S_STATUS_TXEmpty_Pos 2
+#define I2S_STATUS_TXEmpty_Msk (1UL<<I2S_STATUS_TXEmpty_Pos)
+
+#define I2S_STATUS_TXFull_Pos 3
+#define I2S_STATUS_TXFull_Msk (1UL<<I2S_STATUS_TXFull_Pos)
+
+#define I2S_STATUS_RXEmpty_Pos 4
+#define I2S_STATUS_RXEmpty_Msk (1UL<<I2S_STATUS_RXEmpty_Pos)
+
+#define I2S_STATUS_RXFull_Pos 5
+#define I2S_STATUS_RXFull_Msk (1UL<<I2S_STATUS_RXFull_Pos)
+
+#define I2S_ERROR_TXERR_Pos 0
+#define I2S_ERROR_TXERR_Msk (1UL<<I2S_ERROR_TXERR_Pos)
+
+#define I2S_ERROR_RXERR_Pos 1
+#define I2S_ERROR_RXERR_Msk (1UL<<I2S_ERROR_RXERR_Pos)
+
+/******************************************************************************/
+/* SMSC9220 Register Definitions */
+/******************************************************************************/
+
+typedef struct /* SMSC LAN9220 */
+{
+__I uint32_t RX_DATA_PORT; /* Receive FIFO Ports (offset 0x0). */
+ uint32_t RESERVED1[0x7];
+__O uint32_t TX_DATA_PORT; /* Transmit FIFO Ports (offset 0x20). */
+ uint32_t RESERVED2[0x7];
+
+__I uint32_t RX_STAT_PORT; /* Receive FIFO status port (offset 0x40). */
+__I uint32_t RX_STAT_PEEK; /* Receive FIFO status peek (offset 0x44). */
+__I uint32_t TX_STAT_PORT; /* Transmit FIFO status port (offset 0x48). */
+__I uint32_t TX_STAT_PEEK; /* Transmit FIFO status peek (offset 0x4C). */
+
+__I uint32_t ID_REV; /* Chip ID and Revision (offset 0x50). */
+__IO uint32_t IRQ_CFG; /* Main Interrupt Configuration (offset 0x54). */
+__IO uint32_t INT_STS; /* Interrupt Status (offset 0x58). */
+__IO uint32_t INT_EN; /* Interrupt Enable Register (offset 0x5C). */
+ uint32_t RESERVED3; /* Reserved for future use (offset 0x60). */
+__I uint32_t BYTE_TEST; /* Read-only byte order testing register 87654321h (offset 0x64). */
+__IO uint32_t FIFO_INT; /* FIFO Level Interrupts (offset 0x68). */
+__IO uint32_t RX_CFG; /* Receive Configuration (offset 0x6C). */
+__IO uint32_t TX_CFG; /* Transmit Configuration (offset 0x70). */
+__IO uint32_t HW_CFG; /* Hardware Configuration (offset 0x74). */
+__IO uint32_t RX_DP_CTL; /* RX Datapath Control (offset 0x78). */
+__I uint32_t RX_FIFO_INF; /* Receive FIFO Information (offset 0x7C). */
+__I uint32_t TX_FIFO_INF; /* Transmit FIFO Information (offset 0x80). */
+__IO uint32_t PMT_CTRL; /* Power Management Control (offset 0x84). */
+__IO uint32_t GPIO_CFG; /* General Purpose IO Configuration (offset 0x88). */
+__IO uint32_t GPT_CFG; /* General Purpose Timer Configuration (offset 0x8C). */
+__I uint32_t GPT_CNT; /* General Purpose Timer Count (offset 0x90). */
+ uint32_t RESERVED4; /* Reserved for future use (offset 0x94). */
+__IO uint32_t ENDIAN; /* WORD SWAP Register (offset 0x98). */
+__I uint32_t FREE_RUN; /* Free Run Counter (offset 0x9C). */
+__I uint32_t RX_DROP; /* RX Dropped Frames Counter (offset 0xA0). */
+__IO uint32_t MAC_CSR_CMD; /* MAC CSR Synchronizer Command (offset 0xA4). */
+__IO uint32_t MAC_CSR_DATA; /* MAC CSR Synchronizer Data (offset 0xA8). */
+__IO uint32_t AFC_CFG; /* Automatic Flow Control Configuration (offset 0xAC). */
+__IO uint32_t E2P_CMD; /* EEPROM Command (offset 0xB0). */
+__IO uint32_t E2P_DATA; /* EEPROM Data (offset 0xB4). */
+
+} SMSC9220_TypeDef;
+
+/* SMSC9220 MAC Registers Indices. */
+#define SMSC9220_MAC_CR 0x1
+#define SMSC9220_MAC_ADDRH 0x2
+#define SMSC9220_MAC_ADDRL 0x3
+#define SMSC9220_MAC_HASHH 0x4
+#define SMSC9220_MAC_HASHL 0x5
+#define SMSC9220_MAC_MII_ACC 0x6
+#define SMSC9220_MAC_MII_DATA 0x7
+#define SMSC9220_MAC_FLOW 0x8
+#define SMSC9220_MAC_VLAN1 0x9
+#define SMSC9220_MAC_VLAN2 0xA
+#define SMSC9220_MAC_WUFF 0xB
+#define SMSC9220_MAC_WUCSR 0xC
+
+/* SMSC9220 PHY Registers Indices. */
+#define SMSC9220_PHY_BCONTROL 0x0
+#define SMSC9220_PHY_BSTATUS 0x1
+#define SMSC9220_PHY_ID1 0x2
+#define SMSC9220_PHY_ID2 0x3
+#define SMSC9220_PHY_ANEG_ADV 0x4
+#define SMSC9220_PHY_ANEG_LPA 0x5
+#define SMSC9220_PHY_ANEG_EXP 0x6
+#define SMSC9220_PHY_MCONTROL 0x17
+#define SMSC9220_PHY_MSTATUS 0x18
+#define SMSC9220_PHY_CSINDICATE 0x27
+#define SMSC9220_PHY_INTSRC 0x29
+#define SMSC9220_PHY_INTMASK 0x30
+#define SMSC9220_PHY_CS 0x31
+
+/******************************************************************************/
+/* Peripheral declaration */
+/******************************************************************************/
+
+#define MPS3_TS_I2C ((MPS3_I2C_TypeDef *) MPS3_I2C0_BASE )
+#define MPS3_AAIC_I2C ((MPS3_I2C_TypeDef *) MPS3_I2C1_BASE )
+#define MPS3_CAM_I2C2 ((MPS3_I2C_TypeDef *) MPS3_I2C2_BASE )
+#define MPS3_CAM_I2C3 ((MPS3_I2C_TypeDef *) MPS3_I2C3_BASE )
+#define MPS3_AAIC_I2S ((MPS3_I2S_TypeDef *) MPS3_AAIC_I2S_BASE )
+#define MPS3_FPGAIO ((MPS3_FPGAIO_TypeDef *) MPS3_FPGAIO_BASE )
+#define MPS3_SCC ((MPS3_SCC_TypeDef *) MPS3_SCC_BASE )
+#define MPS3_SSP0 ((MPS3_SSP_TypeDef *) MPS3_SSP0_BASE )
+#define MPS3_SSP1 ((MPS3_SSP_TypeDef *) MPS3_SSP1_BASE )
+#define MPS3_SSP2 ((MPS3_SSP_TypeDef *) MPS3_SSP2_BASE )
+#define MPS3_SSP3 ((MPS3_SSP_TypeDef *) MPS3_SSP3_BASE )
+#define MPS3_SSP4 ((MPS3_SSP_TypeDef *) MPS3_SSP4_BASE )
+#define SMSC9220 ((SMSC9220_TypeDef *) SMSC9220_BASE)
+
+/******************************************************************************/
+/* Secure Peripheral declaration */
+/******************************************************************************/
+
+#define SEC_TS_I2C ((MPS3_I2C_TypeDef *) SEC_MPS3_I2C0_BASE )
+#define SEC_AAIC_I2C ((MPS3_I2C_TypeDef *) SEC_MPS3_I2C1_BASE )
+#define SEC_AAIC_I2S ((MPS3_I2S_TypeDef *) SEC_MPS3_AAIC_I2S_BASE )
+#define SEC_FPGAIO ((MPS3_FPGAIO_TypeDef *) SEC_MPS3_FPGAIO_BASE )
+#define SEC_SCC ((MPS3_SCC_TypeDef *) SEC_MPS3_SCC_BASE )
+#define SEC_SSP0 ((MPS3_SSP_TypeDef *) SEC_SSP0_BASE )
+#define SEC_SSP1 ((MPS3_SSP_TypeDef *) SEC_SSP1_BASE )
+#define SEC_SSP2 ((MPS3_SSP_TypeDef *) SEC_MPS3_SSP2_BASE )
+#define SEC_SMSC9220 ((SMSC9220_TypeDef *) SEC_SMSC9220_BASE)
+
+#endif /* SMM_MPS3_H */
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/include/timer_mps3.h b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/include/timer_mps3.h
new file mode 100644
index 0000000..14d64e5
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/include/timer_mps3.h
@@ -0,0 +1,86 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef TIMER_MPS3_H
+#define TIMER_MPS3_H
+
+#include <stdint.h>
+#include <time.h>
+
+/* Container for timestamp up-counters. */
+typedef struct _mps3_time_counter {
+ uint32_t counter_1Hz;
+ uint32_t counter_100Hz;
+
+ /* Running at FPGA clock rate. See GetMPS3CoreClock(). */
+ uint32_t counter_fpga;
+
+ /* Running at processor core's internal clock rate, triggered by SysTick. */
+ uint64_t counter_systick;
+} mps3_time_counter;
+
+/**
+ * @brief Resets the counters.
+ */
+void timer_reset(void);
+
+/**
+ * @brief Gets the current counter values.
+ * @returns Mps3 timer counter.
+ **/
+mps3_time_counter get_time_counter(void);
+
+/**
+ * @brief Gets the duration elapsed between two counters in milliseconds.
+ * @param[in] start Pointer to mps3_time_counter value at start time.
+ * @param[in] end Pointer to mps3_time_counter value at end.
+ * @returns Difference in milliseconds between the two give counters
+ * expressed as an unsigned integer.
+ **/
+uint32_t get_duration_milliseconds(mps3_time_counter *start,
+ mps3_time_counter *end);
+
+/**
+ * @brief Gets the duration elapsed between two counters in microseconds.
+ * @param[in] start Pointer to mps3_time_counter value at start time.
+ * @param[in] end Pointer to mps3_time_counter value at end.
+ * @returns Difference in microseconds between the two give counters
+ * expressed as an unsigned integer.
+ **/
+uint32_t get_duration_microseconds(mps3_time_counter *start,
+ mps3_time_counter *end);
+
+/**
+ * @brief Gets the cycle counts elapsed between start and end.
+ * @param[in] start Pointer to mps3_time_counter value at start time.
+ * @param[in] end Pointer to mps3_time_counter value at end.
+ * @return Difference in counter values as 32 bit unsigned integer.
+ **/
+uint64_t get_cycle_count_diff(mps3_time_counter *start,
+ mps3_time_counter *end);
+
+/**
+ * @brief Enables or triggers cycle counting mechanism, if required
+ * by the platform.
+ **/
+void start_cycle_counter(void);
+
+/**
+ * @brief Stops cycle counting mechanism, if required by the platform.
+ **/
+void stop_cycle_counter(void);
+
+#endif /* TIMER_MPS3_H */
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/timer_mps3.c b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/timer_mps3.c
new file mode 100644
index 0000000..0a3a8b1
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/timer_mps3.c
@@ -0,0 +1,112 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "timer_mps3.h"
+
+#include "bsp_core_log.h"
+#include "device_mps3.h"
+
+void timer_reset(void)
+{
+ MPS3_FPGAIO->CLK1HZ = 0;
+ MPS3_FPGAIO->CLK100HZ = 0;
+ MPS3_FPGAIO->COUNTER = 0;
+
+ if (0 != Init_SysTick()) {
+ printf_err("Failed to initialise system tick config\n");
+ }
+ debug("system tick config ready\n");
+}
+
+mps3_time_counter get_time_counter(void)
+{
+ mps3_time_counter t = {
+ .counter_1Hz = MPS3_FPGAIO->CLK1HZ,
+ .counter_100Hz = MPS3_FPGAIO->CLK100HZ,
+ .counter_fpga = MPS3_FPGAIO->COUNTER,
+ .counter_systick = Get_SysTick_Cycle_Count()
+ };
+ debug("Timestamp:\
+ \n\tCounter 1 Hz: %u\
+ \n\tCounter 100 Hz: %u\
+ \n\tCounter FPGA: %u\
+ \n\tCounter CPU: %llu\n",
+ t.counter_1Hz, t.counter_100Hz, t.counter_fpga, t.counter_systick);
+ return t;
+}
+
+/**
+ * Please note, that there are no checks for overflow in this function => if
+ * the time elapsed has been big (in days) this could happen and is currently
+ * not handled.
+ **/
+uint32_t get_duration_milliseconds(mps3_time_counter *start,
+ mps3_time_counter *end)
+{
+ uint32_t time_elapsed = 0;
+ if (end->counter_100Hz > start->counter_100Hz) {
+ time_elapsed = (end->counter_100Hz - start->counter_100Hz) * 10;
+ } else {
+ time_elapsed = (end->counter_1Hz - start->counter_1Hz) * 1000 +
+ ((0xFFFFFFFF - start->counter_100Hz) + end->counter_100Hz + 1) * 10;
+ }
+
+ /* If the time elapsed is less than 100ms, use microseconds count to be
+ * more precise */
+ if (time_elapsed < 100) {
+ debug("Using the microsecond function instead..\n");
+ return get_duration_microseconds(start, end)/1000;
+ }
+
+ return time_elapsed;
+}
+
+/**
+ * Like the microsecond counterpart, this function could return wrong results when
+ * the counter (MAINCLK) overflows. There are no overflow counters available.
+ **/
+uint32_t get_duration_microseconds(mps3_time_counter *start,
+ mps3_time_counter *end)
+{
+ const int divisor = GetMPS3CoreClock()/1000000;
+ uint32_t time_elapsed = 0;
+ if (end->counter_fpga > start->counter_fpga) {
+ time_elapsed = (end->counter_fpga - start->counter_fpga)/divisor;
+ } else {
+ time_elapsed = ((0xFFFFFFFF - end->counter_fpga)
+ + start->counter_fpga + 1)/divisor;
+ }
+ return time_elapsed;
+}
+
+uint64_t get_cycle_count_diff(mps3_time_counter *start,
+ mps3_time_counter *end)
+{
+ if (start->counter_systick > end->counter_systick) {
+ warn("start > end; counter might have overflown\n");
+ }
+ return end->counter_systick - start->counter_systick;
+}
+
+void start_cycle_counter(void)
+{
+ /* Nothing to do for FPGA */
+}
+
+void stop_cycle_counter(void)
+{
+ /* Nothing to do for FPGA */
+}
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/uart_stdout.c b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/uart_stdout.c
new file mode 100644
index 0000000..1bf8291
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/mps3/uart_stdout.c
@@ -0,0 +1,132 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "uart_stdout.h"
+
+#include "device_mps3.h"
+
+#include <stdio.h>
+
+#define CNTLQ 0x11
+#define CNTLS 0x13
+#define DEL 0x7F
+#define BACKSPACE 0x08
+#define CR 0x0D
+#define LF 0x0A
+#define ESC 0x1B
+
+void UartStdOutInit(void)
+{
+ /* NOTE: SystemCoreClock should have been set before initialising UART. */
+ CMSDK_UART0->BAUDDIV = SystemCoreClock / 115200; /* => (25 or 32 MHz) / (115200 bps). */
+ CMSDK_UART0->CTRL = ((1ul << 0) | /* TX enable. */
+ (1ul << 1) ); /* RX enable. */
+ return;
+}
+
+unsigned char UartPutc(unsigned char my_ch)
+{
+ while ((CMSDK_UART0->STATE & 1)); /* Wait if Transmit Holding register is full. */
+
+ if (my_ch == '\n') {
+ CMSDK_UART0->DATA = '\r';
+ while ((CMSDK_UART0->STATE & 1)); /* Wait if Transmit Holding register is full. */
+ }
+
+ CMSDK_UART0->DATA = my_ch; /* Write to transmit holding register. */
+ return (my_ch);
+}
+
+unsigned char UartGetc(void)
+{
+ unsigned char my_ch;
+ unsigned int cnt;
+
+ /* Wait if Receive Holding register is empty. */
+ while (0 == (CMSDK_UART0->STATE & 2)) {
+ cnt = MPS3_FPGAIO->CLK100HZ / 50;
+ if (cnt & 0x8) {
+ MPS3_FPGAIO->LED = 0x01 << (cnt & 0x7);
+ }
+ else {
+ MPS3_FPGAIO->LED = 0x80 >> (cnt & 0x7);
+ }
+ }
+
+ my_ch = CMSDK_UART0->DATA;
+
+ /* Convert CR to LF. */
+ if(my_ch == '\r') {
+ my_ch = '\n';
+ }
+
+ return (my_ch);
+}
+
+bool GetLine(char *lp, unsigned int len)
+{
+ unsigned int cnt = 0;
+ char c;
+
+ do {
+ c = UartGetc ();
+ switch (c) {
+ case CNTLQ: /* Ignore Control S/Q. */
+ case CNTLS:
+ break;
+
+ case BACKSPACE:
+ case DEL:
+ if (cnt == 0) {
+ break;
+ }
+ cnt--; /* Decrement count. */
+ lp--; /* Decrement line pointer. */
+ UartPutc (0x08); /* Echo backspace. */
+ UartPutc (' ');
+ UartPutc (0x08);
+ fflush (stdout);
+ break;
+
+ case ESC:
+ case 0:
+ *lp = 0; /* ESC - stop editing line. */
+ return false;
+
+ case CR: /* CR - done, stop editing line. */
+ *lp = c;
+ lp++; /* Increment line pointer */
+ cnt++; /* and count. */
+ c = LF;
+ default:
+ UartPutc (*lp = c); /* Echo and store character. */
+ fflush (stdout);
+ lp++; /* Increment line pointer */
+ cnt++; /* and count. */
+ break;
+ }
+ } while (cnt < len - 2 && c != LF); /* Check limit and CR. */
+ *lp = 0; /* Mark end of string. */
+
+ return true;
+}
+
+void UartEndSimulation(int code)
+{
+ UartPutc((char) 0x4); /* End of simulation */
+ UartPutc((char) code); /* End of simulation */
+ while(1);
+}
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-packs/simple_platform/include/stubs_fvp.h b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/simple_platform/include/stubs_fvp.h
new file mode 100644
index 0000000..a21f2d2
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/simple_platform/include/stubs_fvp.h
@@ -0,0 +1,124 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef BSP_PACK_FASTMODEL_H
+#define BSP_PACK_FASTMODEL_H
+
+#include "cmsis.h" /* device specific header file */
+#include "peripheral_memmap.h" /* peripheral memory map definitions */
+
+/****************************************************************************/
+/* Definitions and stub functions for modules currently */
+/* unavailable on the model */
+/****************************************************************************/
+#define GLCD_WIDTH 320
+#define GLCD_HEIGHT 240
+#define Black 0x0000 /* 0, 0, 0 */
+#define White 0xFFFF /* 255, 255, 255 */
+
+/*********************** Clock related functions *****************************/
+uint32_t GetCoreClock(void);
+
+/************************ GLCD related functions ****************************/
+/**
+ * @brief Initialize the Himax LCD with HX8347-D LCD Controller
+ * @return none
+ */
+void GLCD_Initialize(void);
+
+/**
+ * @brief Display graphical bitmap image at position x horizontally and y
+ * vertically. This function is optimized for 16 bits per pixel
+ * format, it has to be adapted for any other format.
+ * @param[in] x horizontal position.
+ * @param[in] y vertical position.
+ * @param[in] w width of bitmap.
+ * @param[in] h height of bitmap.
+ * @param[in] bitmap address at which the bitmap data resides.
+ * @return none
+ */
+void GLCD_Bitmap(unsigned int x, unsigned int y,
+ unsigned int w, unsigned int h,
+ unsigned short *bitmap);
+
+/**
+ * @brief Displays an 8 bit image, conversion to the LCD's
+ * 16 bit codec is done on the fly.
+ * @param[in] data pointer to the full sized image data.
+ * @param[in] width image width.
+ * @param[in] height image height.
+ * @param[in] channels number of channels in the image.
+ * @param[in] pos_x start x position for the LCD.
+ * @param[in] pos_y start y position for the LCD.
+ * @param[in] downsample_factor factor by which the image
+ * is downsampled by.
+ * @return none
+ */
+void GLCD_Image(void *data, const uint32_t width,
+ const uint32_t height, const uint32_t channels,
+ const uint32_t pos_x, const uint32_t pos_y,
+ const uint32_t downsample_factor);
+
+/**
+ * @brief Clear display
+ * @param[in] color display clearing color
+ * @return none
+ */
+void GLCD_Clear(unsigned short color);
+
+/**
+ * @brief Set foreground color
+ * @param[in] color foreground color
+ * @return none
+ */
+void GLCD_SetTextColor(unsigned short color);
+
+/**
+ * @brief Display character on given line
+ * @param[in] ln line number
+ * @param[in] col column number
+ * @param[in] fi font index (0 = 9x15)
+ * @param[in] c ASCII character
+ * @return none
+ */
+void GLCD_DisplayChar(unsigned int ln, unsigned int col,
+ unsigned char fi, unsigned char c);
+
+/**
+ * @brief Display string on given line
+ * @param[in] ln line number
+ * @param[in] col column number
+ * @param[in] fi font index (0 = 9x15)
+ * @param[in] s pointer to string
+ * @return none
+ */
+void GLCD_DisplayString(unsigned int ln, unsigned int col,
+ unsigned char fi, char *s);
+
+/**
+ * @brief Draw box filled with color
+ * @param[in] x horizontal position
+ * @param[in] y: vertical position
+ * @param[in] w: window width in pixels
+ * @param[in] h: window height in pixels
+ * @param[in] color box color
+ * @return none
+ */
+void GLCD_Box(unsigned int x, unsigned int y,
+ unsigned int w, unsigned int h,
+ unsigned short color);
+
+#endif /* BSP_PACK_FASTMODEL_H */
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-packs/simple_platform/include/timer_fvp.h b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/simple_platform/include/timer_fvp.h
new file mode 100644
index 0000000..c07a4eb
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/simple_platform/include/timer_fvp.h
@@ -0,0 +1,55 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef TIMER_FVP_H
+#define TIMER_FVP_H
+
+#include "stubs_fvp.h"
+
+/* Container for timestamp for fastmodel. */
+typedef struct _fvp_time_counter {
+ uint64_t counter_systick;
+} fvp_time_counter;
+
+/**
+ * @brief Resets the counters.
+ */
+void timer_reset(void);
+
+/**
+ * @brief Gets the current counter values.
+ * @returns counter struct.
+ **/
+fvp_time_counter get_time_counter(void);
+
+/**
+ * @brief Gets the cycle counts elapsed between start and end.
+ * @return difference in counter values as 32 bit unsigned integer.
+ */
+uint64_t get_cycle_count_diff(fvp_time_counter *start, fvp_time_counter *end);
+
+/**
+ * @brief Enables or triggers cycle counting mechanism, if required
+ * by the platform.
+ */
+void start_cycle_counter(void);
+
+/**
+ * @brief Stops cycle counting mechanism, if required by the platform.
+ */
+void stop_cycle_counter(void);
+
+#endif /* TIMER_FVP_H */
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-packs/simple_platform/stubs_fvp.c b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/simple_platform/stubs_fvp.c
new file mode 100644
index 0000000..e5b2969
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/simple_platform/stubs_fvp.c
@@ -0,0 +1,111 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "stubs_fvp.h"
+
+#include "bsp_core_log.h"
+
+uint32_t GetCoreClock(void)
+{
+ return 1;
+}
+
+void GLCD_Initialize(void) {}
+
+void GLCD_Bitmap(unsigned int x, unsigned int y,
+ unsigned int w, unsigned int h, unsigned short *bitmap)
+{
+ UNUSED(x);
+ UNUSED(y);
+ UNUSED(w);
+ UNUSED(h);
+ UNUSED(bitmap);
+}
+
+void GLCD_Image(void *data, const uint32_t width, const uint32_t height,
+ const uint32_t channels, const uint32_t pos_x,
+ const uint32_t pos_y, const uint32_t downsample_factor)
+{
+ UNUSED(data);
+ UNUSED(pos_x);
+ UNUSED(pos_y);
+ UNUSED(width);
+ UNUSED(height);
+ UNUSED(channels);
+ UNUSED(downsample_factor);
+ debug("image display: (x, y, w, h) = (%u, %u, %u, %u)\n",
+ pos_x, pos_y, width, height);
+ debug("image display: channels = %u, downsample factor = %u\n",
+ channels, downsample_factor);
+}
+
+void GLCD_Clear(unsigned short color)
+{
+ UNUSED(color);
+}
+
+void GLCD_SetTextColor(unsigned short color)
+{
+ UNUSED(color);
+}
+
+void GLCD_DisplayChar (unsigned int ln, unsigned int col, unsigned char fi,
+ unsigned char c)
+{
+ UNUSED(ln);
+ UNUSED(col);
+ UNUSED(fi);
+ UNUSED(c);
+}
+
+void GLCD_DisplayString(unsigned int ln, unsigned int col, unsigned char fi,
+ char *s)
+{
+ UNUSED(ln);
+ UNUSED(col);
+ UNUSED(fi);
+ UNUSED(s);
+ debug("text display: %s\n", s);
+}
+
+void GLCD_Box(unsigned int x, unsigned int y, unsigned int w, unsigned int h,
+ unsigned short color)
+{
+ UNUSED(x);
+ UNUSED(y);
+ UNUSED(w);
+ UNUSED(h);
+ UNUSED(color);
+}
+
+void LED_Initialize(uint32_t port)
+{
+ UNUSED(port);
+}
+
+void LED_On(uint32_t num, uint32_t port)
+{
+ UNUSED(num);
+ UNUSED(port);
+ debug("LED %u ON\n", num);
+}
+
+void LED_Off(uint32_t num, uint32_t port)
+{
+ UNUSED(num);
+ UNUSED(port);
+ debug("LED %u OFF\n", num);
+}
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-packs/simple_platform/timer_fvp.c b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/simple_platform/timer_fvp.c
new file mode 100644
index 0000000..b7a7232
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/simple_platform/timer_fvp.c
@@ -0,0 +1,56 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "timer_fvp.h"
+
+#include "irqs.h"
+#include "bsp_core_log.h"
+
+fvp_time_counter get_time_counter(void)
+{
+ fvp_time_counter t = {
+ .counter_systick = Get_SysTick_Cycle_Count()
+ };
+ debug("counter_systick: %llu\n", t.counter_systick);
+ return t;
+}
+
+void timer_reset(void)
+{
+ if (0 != Init_SysTick()) {
+ printf_err("Failed to initialise system tick config\n");
+ }
+ debug("system tick config ready\n");
+}
+
+uint64_t get_cycle_count_diff(fvp_time_counter *start,
+ fvp_time_counter *end)
+{
+ if (start->counter_systick > end->counter_systick) {
+ warn("start > end; counter might have overflown\n");
+ }
+ return end->counter_systick - start->counter_systick;
+}
+
+void start_cycle_counter(void)
+{
+ /* Add any custom requirement for this platform here */
+}
+
+void stop_cycle_counter(void)
+{
+ /* Add any custom requirement for this platform here */
+}
diff --git a/source/application/hal/platforms/bare-metal/bsp/bsp-packs/simple_platform/uart_pl011.c b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/simple_platform/uart_pl011.c
new file mode 100644
index 0000000..5c1ee06
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/bsp-packs/simple_platform/uart_pl011.c
@@ -0,0 +1,224 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "uart_stdout.h"
+#include "peripheral_memmap.h" /* peripheral memory map definitions */
+
+#include <stdio.h>
+#include <stdint.h>
+
+#define CNTLQ 0x11
+#define CNTLS 0x13
+#define DEL 0x7F
+#define BACKSPACE 0x08
+#define CR 0x0D
+#define LF 0x0A
+#define ESC 0x1B
+
+#define UARTBASE (PL011_UART0_BASE)
+
+/*****************************************************************************/
+/* UART Control Register Locations */
+/*****************************************************************************/
+#define UART0_DR *((volatile unsigned *) UARTBASE)
+#define UART0_RSR *((volatile unsigned *)(UARTBASE + 0x04))
+#define UART0_ECR *((volatile unsigned *)(UARTBASE + 0x04))
+#define UART0_LCRH *((volatile unsigned *)(UARTBASE + 0x2C))
+#define UART0_LCRM *((volatile unsigned *)(UARTBASE + 0x28))
+#define UART0_LCRL *((volatile unsigned *)(UARTBASE + 0x24))
+#define UART0_CR *((volatile unsigned *)(UARTBASE + 0x30))
+#define UART0_FR *((volatile unsigned *)(UARTBASE + 0x18))
+#define UART0_IIR *((volatile unsigned *)(UARTBASE + 0x1C))
+#define UART0_ICR *((volatile unsigned *)(UARTBASE + 0x44))
+
+/*****************************************************************************/
+/* Received Status Register - RSR */
+/*****************************************************************************/
+#define RSR_OVERRUN_ERROR 0x08
+#define RSR_BREAK_ERROR 0x04
+#define RSR_PARITY_ERROR 0x02
+#define RSR_FRAMING_ERROR 0x01
+
+/*****************************************************************************/
+/* Line Control High Byte Register - LCRH */
+/*****************************************************************************/
+#define LCRH_WORD_LENGTH_8 0x60
+#define LCRH_WORD_LENGTH_7 0x40
+#define LCRH_WORD_LENGTH_6 0x20
+#define LCRH_WORD_LENGTH_5 0x00
+#define LCRH_FIFO_ENABLED 0x10
+#define LCRH_2_STOP_BITS 0x08
+#define LCRH_EVEN_PARITY 0x04
+#define LCRH_PARITY_ENABLE 0x02
+#define LCRH_SEND_BREAK 0x01
+
+/*****************************************************************************/
+/* Line Control Medium Byte Register - LCRM */
+/* This register specifies the high byte of the Baud rate divisor */
+/*****************************************************************************/
+#define LCRM_BAUD_460800 0x00
+#define LCRM_BAUD_230400 0x00
+#define LCRM_BAUD_115200 0x00
+#define LCRM_BAUD_76800 0x00
+#define LCRM_BAUD_57600 0x00
+#define LCRM_BAUD_38400 0x00
+#define LCRM_BAUD_19200 0x00
+#define LCRM_BAUD_14400 0x00
+#define LCRM_BAUD_9600 0x00
+#define LCRM_BAUD_2400 0x01
+#define LCRM_BAUD_1200 0x02
+
+/*****************************************************************************/
+/* Line Control Low Byte Register - LCRL */
+/* This register specifies the low byte of the Baud rate divisor */
+/*****************************************************************************/
+#define LCRL_BAUD_460800 0x01
+#define LCRL_BAUD_230400 0x03
+#define LCRL_BAUD_115200 0x07
+#define LCRL_BAUD_76800 0x0B
+#define LCRL_BAUD_57600 0x0F
+#define LCRL_BAUD_38400 0xC
+#define LCRL_BAUD_19200 0x2F
+#define LCRL_BAUD_14400 0x3F
+#define LCRL_BAUD_9600 0x5F
+#define LCRL_BAUD_2400 0x7F
+#define LCRL_BAUD_1200 0xFF
+
+/*****************************************************************************/
+/* Control Register - CR */
+/*****************************************************************************/
+#define CR_LOOP_BACK_EN 0x80
+#define CR_TIMEOUT_INT_EN 0x40
+#define CR_TX_INT_ENABLE 0x100
+#define CR_RX_INT_ENABLE 0x200
+#define CR_MODSTAT_INT_EN 0x08
+#define CR_UART_ENABLE 0x01
+
+/*****************************************************************************/
+/* Flag Register - FR */
+/*****************************************************************************/
+#define FR_TX_FIFO_EMPTY 0x80
+#define FR_RX_FIFO_FULL 0x40
+#define FR_TX_FIFO_FULL 0x20
+#define FR_RX_FIFO_EMPTY 0x10
+#define FR_BUSY 0x08
+#define FR_CARRIER_DETECT 0x04
+#define FR_SET_READY 0x02
+#define FR_CLEAR_TO_SEND 0x01
+
+/*****************************************************************************/
+/* Interrupt Identification Register - IIR */
+/*****************************************************************************/
+#define IIR_RX_TIME_OUT 0x08
+#define IIR_TX 0x04
+#define IIR_RX 0x02
+#define IIR_MODEM 0x01
+
+void UartStdOutInit(void)
+{
+ /* Disable the serial port while setting the baud rate and word length. */
+ UART0_CR = 0;
+
+ /* Clear the receive status register. */
+ UART0_ECR = 0;
+
+ /* Set the correct baud rate and word length. */
+ UART0_LCRL = LCRL_BAUD_115200;
+ UART0_LCRM = LCRM_BAUD_115200;
+ UART0_LCRH = LCRH_WORD_LENGTH_8;
+
+ /* Explicitly disable FIFO's for char mode. */
+ UART0_LCRH &= ~LCRH_FIFO_ENABLED;
+
+ /* Enable UART0 (and RX/TX) without interrupts. */
+ UART0_CR = CR_UART_ENABLE | CR_TX_INT_ENABLE | CR_RX_INT_ENABLE;
+}
+
+unsigned char UartPutc(unsigned char ch)
+{
+ if (ch == '\n') {
+ (void) UartPutc('\r');
+ }
+ while (UART0_FR & FR_TX_FIFO_FULL)
+ ;
+ UART0_DR = ch;
+
+ return ch;
+}
+
+unsigned char UartGetc(void)
+{
+ unsigned char c;
+ while (UART0_FR & FR_RX_FIFO_EMPTY)
+ ;
+ c = UART0_DR;
+ if (c == '\r') {
+ c = '\n';
+ }
+
+ return c;
+}
+
+bool GetLine (char *lp, unsigned int len)
+{
+ unsigned int cnt = 0;
+ char c;
+
+ do {
+ c = UartGetc();
+ switch (c) {
+ case CNTLQ: /* ignore Control S/Q. */
+ case CNTLS:
+ break;
+ case BACKSPACE:
+ case DEL:
+ if (cnt == 0) {
+ break;
+ }
+ cnt--; /* decrement count. */
+ lp--; /* and line pointer. */
+ UartPutc (0x08); /* echo backspace. */
+ UartPutc (' ');
+ UartPutc (0x08);
+ fflush (stdout);
+ break;
+ case ESC:
+ case 0:
+ *lp = 0; /* ESC - stop editing line. */
+ return false;
+ case CR: /* CR - done, stop editing line. */
+ *lp = c;
+ lp++; /* increment line pointer. */
+ cnt++; /* and count. */
+ c = LF;
+ default:
+ UartPutc (*lp = c); /* echo and store character. */
+ fflush (stdout);
+ lp++; /* increment line pointer. */
+ cnt++; /* and count. */
+ break;
+ }
+ } while (cnt < len - 2 && c != LF); /* check limit and CR. */
+ *lp = 0; /* mark end of string. */
+ return true;
+}
+
+__attribute__((noreturn)) void UartEndSimulation(int code)
+{
+ UartPutc((char) 0x4); // End of simulation
+ UartPutc((char) code); // Exit code
+ while(1);
+}
diff --git a/source/application/hal/platforms/bare-metal/bsp/cmsis-device/cmsis.c b/source/application/hal/platforms/bare-metal/bsp/cmsis-device/cmsis.c
new file mode 100644
index 0000000..c9cf53d
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/cmsis-device/cmsis.c
@@ -0,0 +1,122 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "cmsis.h"
+
+extern void *__Vectors; /* see irqs.c */
+
+/*----------------------------------------------------------------------------*\
+ * Define clocks (uses OSC1 ACLK) *
+\*----------------------------------------------------------------------------*/
+#define __XTAL (25000000) /* Oscillator frequency */
+#define __SYSTEM_CLOCK (__XTAL)
+
+#define STR(x) #x
+#define RESET_REG(n) __ASM volatile("MOV " STR(r##n) ", #0" : : : STR(r##n))
+
+#if defined(CPU_CORTEX_M55)
+#define CCR_DL (1 << 19)
+#else
+#error "Invalid CPU; This file only services Cortex-M55 CPUs"
+#endif /* (CPU_CORTEX_M55) */
+
+/*----------------------------------------------------------------------------
+ System Core Clock Variable (Core Clock)
+ *----------------------------------------------------------------------------*/
+uint32_t SystemCoreClock = __SYSTEM_CLOCK;
+
+
+/*----------------------------------------------------------------------------
+ Clock functions
+ *----------------------------------------------------------------------------*/
+/**
+ * @brief Updates the SystemCoreClock variable with current core Clock
+ * retrieved from cpu registers.
+ */
+void SystemCoreClockUpdate(void)
+{
+ /* Update the SystemCoreClock variable */
+ SystemCoreClock = __SYSTEM_CLOCK;
+}
+
+uint32_t GetSystemCoreClock(void)
+{
+ return SystemCoreClock;
+}
+
+/**
+ * @brief Setup the microcontroller system.
+ * Initialize the System.
+ **/
+void SystemInit(void)
+{
+#if (defined (__FPU_USED) && (__FPU_USED == 1U)) || \
+ (defined (__MVE_USED) && (__MVE_USED == 1U))
+ SCB->CPACR |= ((3U << 10U*2U) | /* enable CP10 Full Access */
+ (3U << 11U*2U) );
+#endif
+
+ /* Initialise registers r0-r12 and LR(=r14)
+ * They must have a valid value before being potentially pushed to stack by
+ * C calling convention or by context saving in exception handling
+ */
+ RESET_REG(0);
+ RESET_REG(1);
+ RESET_REG(2);
+ RESET_REG(3);
+ RESET_REG(4);
+ RESET_REG(5);
+ RESET_REG(6);
+ RESET_REG(7);
+ RESET_REG(8);
+ RESET_REG(9);
+ RESET_REG(10);
+ RESET_REG(11);
+ RESET_REG(12);
+ RESET_REG(14);
+
+#if defined (__VTOR_PRESENT) && (__VTOR_PRESENT == 1U)
+ SCB->VTOR = (uint32_t) &__Vectors;
+#endif
+
+ /* Enable hard, bus, mem and usage fault detection in SHCSR, bits 16-18.
+ * Enable stkof, bf, div_0_trp, unalign_trp and usersetm bits in CCR.
+ */
+ SCB->SHCSR = (
+ _VAL2FLD(SCB_SHCSR_USGFAULTENA, 1) |
+ _VAL2FLD(SCB_SHCSR_BUSFAULTENA, 1) |
+ _VAL2FLD(SCB_SHCSR_MEMFAULTENA, 1));
+
+ SCB->CCR = (_VAL2FLD(SCB_CCR_USERSETMPEND, 1) |
+ _VAL2FLD(SCB_CCR_DIV_0_TRP, 1) |
+ _VAL2FLD(SCB_CCR_BFHFNMIGN, 1) |
+ _VAL2FLD(SCB_CCR_STKOFHFNMIGN, 1));
+#ifdef UNALIGNED_SUPPORT_DISABLE
+ SCB->CCR |= _VAL2FLD(SCB_CCR_UNALIGN_TRP, 1);
+#endif
+
+ SCB->CCR |= CCR_DL;
+
+ /* Reset pipeline. */
+ __DSB();
+ __ISB();
+
+#ifdef UNALIGNED_SUPPORT_DISABLE
+ SCB->CCR |= SCB_CCR_UNALIGN_TRP_Msk;
+#endif
+
+ SystemCoreClock = __SYSTEM_CLOCK;
+}
diff --git a/source/application/hal/platforms/bare-metal/bsp/cmsis-device/include/cmsis.h b/source/application/hal/platforms/bare-metal/bsp/cmsis-device/include/cmsis.h
new file mode 100644
index 0000000..969db15
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/cmsis-device/include/cmsis.h
@@ -0,0 +1,31 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef BAREMETAL_CMSIS_H
+#define BAREMETAL_CMSIS_H
+
+#include "ARMCM55.h" /* Cortex M system header file from CMSIS. */
+#include "irqs.h" /* Interrupt definitions file. */
+
+/* Addition to template functions should be mentioned here. */
+
+/**
+ * @brief Gets the internal processor clock.
+ * @return Clock frequency as unsigned 32 bit value.
+ **/
+uint32_t GetSystemCoreClock(void);
+
+#endif /* BAREMETAL_CMSIS_H */
diff --git a/source/application/hal/platforms/bare-metal/bsp/cmsis-device/include/irqs.h b/source/application/hal/platforms/bare-metal/bsp/cmsis-device/include/irqs.h
new file mode 100644
index 0000000..0d8dec6
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/cmsis-device/include/irqs.h
@@ -0,0 +1,54 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef IRQS_H
+#define IRQS_H
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+#include "peripheral_irqs.h"
+
+#include <stdint.h>
+
+/* Interrupt handler function type. */
+typedef void (*const irq_vec_type)(void);
+
+/**
+ * @brief Reset interrupt handler and also, the starting
+ * point of the application.
+ **/
+extern void Reset_Handler(void);
+
+/**
+ * @brief Gets the system tick triggered cycle counter for the CPU.
+ * @return 64-bit counter value.
+ **/
+extern uint64_t Get_SysTick_Cycle_Count(void);
+
+/**
+ * @brief Initialises the system tick registers.
+ * @return Error code return from sys tick configuration function
+ * (0 = no error).
+ **/
+extern int Init_SysTick(void);
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif /* IRQS_H */
diff --git a/source/application/hal/platforms/bare-metal/bsp/cmsis-device/irqs.c b/source/application/hal/platforms/bare-metal/bsp/cmsis-device/irqs.c
new file mode 100644
index 0000000..c6f54b1
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/cmsis-device/irqs.c
@@ -0,0 +1,261 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifdef __cplusplus
+extern "C"
+{
+#endif
+
+#include "irqs.h"
+#include "cmsis.h"
+
+#include <stdio.h>
+
+static uint64_t cpu_cycle_count = 0;
+
+/**
+ * @brief Dump core registers on stdout
+ */
+static void LogCoreCPURegisters(void)
+{
+ printf("CTRL : 0x%08x\n", __get_CONTROL());
+ printf("IPSR : 0x%08x\n", __get_IPSR());
+ printf("APSR : 0x%08x\n", __get_APSR());
+ printf("xPSR : 0x%08x\n", __get_xPSR());
+ printf("PSP : 0x%08x\n", __get_PSP());
+ printf("MSP : 0x%08x\n", __get_MSP());
+ printf("PRIMASK : 0x%08x\n", __get_PRIMASK());
+ printf("BASEPRI : 0x%08x\n", __get_BASEPRI());
+ printf("FAULTMSK: 0x%08x\n", __get_FAULTMASK());
+ printf("PC : 0x%08x\n", __current_pc());
+}
+
+/**
+ * @brief Default interrupt handler - an infinite loop.
+ **/
+__attribute__((noreturn)) static void DefaultHandler(void)
+{
+ LogCoreCPURegisters();
+ while (1) {
+ /* Without the following line, armclang may optimize away the
+ * infinite loop because it'd be without side effects and thus
+ * undefined behaviour. */
+ __ASM volatile("");
+ }
+}
+
+#define DEFAULT_HANDLER_CALL(type) \
+ do { \
+ printf("\n%s caught by function %s\n", \
+ type, __FUNCTION__); \
+ DefaultHandler(); \
+ } while (0)
+
+#define DEFAULT_ERROR_HANDLER_CALL() \
+ DEFAULT_HANDLER_CALL("Exception")
+
+#define DEFAULT_IRQ_HANDLER_CALL() \
+ DEFAULT_HANDLER_CALL("Interrupt")
+
+/**
+ * Dummy Exception Handlers for core interrupts.
+ *
+ * Weak definitions provided to be used if the user chooses not
+ * to override them.
+ **/
+
+/**
+ * @brief Non maskable interrupt handler.
+ **/
+ __attribute__((weak)) void NMI_Handler(void)
+{
+ DEFAULT_ERROR_HANDLER_CALL();
+}
+
+/**
+ * @brief Hardfault interrupt handler.
+ **/
+ __attribute__((weak)) void HardFault_Handler(void)
+{
+ DEFAULT_ERROR_HANDLER_CALL();
+}
+
+/**
+ * @brief Memory management interrupt handler.
+ **/
+__attribute__((weak)) void MemManage_Handler(void)
+{
+ DEFAULT_IRQ_HANDLER_CALL();
+}
+
+/**
+ * @brief Bus fault interrupt handler.
+ **/
+__attribute__((weak)) void BusFault_Handler(void)
+{
+ DEFAULT_ERROR_HANDLER_CALL();
+}
+
+/**
+ * @brief Usage fault interrupt handler.
+ **/
+__attribute__((weak)) void UsageFault_Handler(void)
+{
+ DEFAULT_ERROR_HANDLER_CALL();
+}
+
+/**
+ * @brief Secure access fault interrupt handler.
+ **/
+__attribute__((weak)) void SecureFault_Handler(void)
+{
+ DEFAULT_ERROR_HANDLER_CALL();
+}
+
+/**
+ * @brief Supervisor call interrupt handler.
+ **/
+__attribute__((weak)) void SVC_Handler(void)
+{
+ DEFAULT_IRQ_HANDLER_CALL();
+}
+
+/**
+ * @brief Debug monitor interrupt handler.
+ **/
+__attribute__((weak)) void DebugMon_Handler(void)
+{
+ DEFAULT_IRQ_HANDLER_CALL();
+}
+
+/**
+ * @brief Pending SV call interrupt handler.
+ */
+__attribute__((weak)) void PendSV_Handler(void)
+{
+ DEFAULT_IRQ_HANDLER_CALL();
+}
+
+/**
+ * @brief System tick interrupt handler.
+ **/
+void SysTick_Handler(void)
+{
+ /* Increment the cycle counter based on load value. */
+ cpu_cycle_count += SysTick->LOAD + 1;
+}
+
+uint64_t Get_SysTick_Cycle_Count(void)
+{
+ uint32_t systick_val;
+
+ NVIC_DisableIRQ(SysTick_IRQn);
+ systick_val = SysTick->VAL & SysTick_VAL_CURRENT_Msk;
+ NVIC_EnableIRQ(SysTick_IRQn);
+
+ return cpu_cycle_count + (SysTick->LOAD - systick_val);
+}
+
+
+/**
+ * These symbols are provided by the ARM lib - needs the stack and heap
+ * regions in the scatter file.
+ */
+extern void Image$$ARM_LIB_STACK$$ZI$$Base();
+extern void Image$$ARM_LIB_STACK$$ZI$$Limit();
+extern void Image$$ARM_LIB_HEAP$$ZI$$Base();
+extern void Image$$ARM_LIB_HEAP$$ZI$$Limit();
+extern __attribute__((noreturn)) void __main();
+
+__attribute__((naked, used)) void __user_setup_stackheap()
+{
+ __ASM volatile("LDR r0, =Image$$ARM_LIB_HEAP$$ZI$$Base");
+ __ASM volatile("LDR r1, =Image$$ARM_LIB_STACK$$ZI$$Limit");
+ __ASM volatile("LDR r2, =Image$$ARM_LIB_HEAP$$ZI$$Limit");
+ __ASM volatile("LDR r3, =Image$$ARM_LIB_STACK$$ZI$$Base");
+ __ASM volatile("bx lr");
+}
+
+/**
+ * Interrupt vector table.
+ */
+irq_vec_type __Vectors[] __attribute__((section("RESET"), used)) = {
+ &Image$$ARM_LIB_STACK$$ZI$$Limit, /* 0 Initial SP */
+ &Reset_Handler , /* 1 Initial PC, set to entry point */
+
+ &NMI_Handler , /* 2 (-14) NMI Handler */
+ &HardFault_Handler , /* 3 (-13) Hard Fault Handler */
+ &MemManage_Handler , /* 4 (-12) MPU Fault Handler */
+ &BusFault_Handler , /* 5 (-11) Bus Fault Handler */
+ &UsageFault_Handler , /* 6 (-10) Usage Fault Handler */
+ &SecureFault_Handler, /* 7 ( -9) Secure Fault Handler */
+ 0 , /* 8 ( -8) Reserved */
+ 0 , /* 9 ( -7) Reserved */
+ 0 , /* 10 ( -6) Reserved */
+ &SVC_Handler , /* 11 ( -5) SVCall Handler */
+ &DebugMon_Handler , /* 12 ( -4) Debug Monitor Handler */
+ 0 , /* 13 ( -3) Reserved */
+ &PendSV_Handler , /* 14 ( -2) PendSV Handler */
+ &SysTick_Handler , /* 15 ( -1) SysTick Handler */
+
+ /* External sources to be populated by user. */
+ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, /* 0 - 16 */
+ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, /* 16 - 32 */
+ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, /* 32 - 48 */
+ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, /* 48 - 64 */
+ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, /* 64 - 80 */
+ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, /* 80 - 96 */
+ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, /* 96 - 112 */
+ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, /* 112 - 128 */
+};
+
+int Init_SysTick(void)
+{
+ const uint32_t ticks_10ms = GetSystemCoreClock()/100 + 1;
+ int err = 0;
+
+ /* Reset CPU cycle count value. */
+ cpu_cycle_count = 0;
+
+ /* Changing configuration for sys tick => guard from being
+ * interrupted. */
+ NVIC_DisableIRQ(SysTick_IRQn);
+
+ /* SysTick init - this will enable interrupt too. */
+ err = SysTick_Config(ticks_10ms);
+
+ /* Enable interrupt again. */
+ NVIC_EnableIRQ(SysTick_IRQn);
+
+ return err;
+}
+
+/* Reset handler - starting point of our application. */
+__attribute__((used)) void Reset_Handler(void)
+{
+ /* Initialise system. */
+ SystemInit();
+
+ /* Configure the system tick. */
+ Init_SysTick();
+
+ /* libcxx supplied entry point. */
+ __main();
+}
+
+#ifdef __cplusplus
+}
+#endif
diff --git a/source/application/hal/platforms/bare-metal/bsp/include/bsp.h b/source/application/hal/platforms/bare-metal/bsp/include/bsp.h
new file mode 100644
index 0000000..fbe1ff6
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/include/bsp.h
@@ -0,0 +1,38 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef BSP_H
+#define BSP_H
+
+/* Core modules - these are common */
+#include "bsp_core_log.h" /* Logging related helpers. */
+#include "uart_stdout.h" /* stdout over UART. */
+
+#if defined(MPS3_PLATFORM) /* If running on MPS3 platform. */
+
+#include "smm_mps3.h" /* Mem map for MPS3 peripherals. */
+#include "glcd_mps3.h" /* LCD functions. */
+#include "timer_mps3.h" /* Timer functions. */
+#include "device_mps3.h" /* FPGA level definitions and functions. */
+
+#else /* MPS3_PLATFORM */
+
+#include "stubs_fvp.h" /* Stubs for FVP. */
+#include "timer_fvp.h" /* Timer API for FVP. */
+
+#endif /* MPS3_PLATFORM */
+
+#endif /* BSP_H */
diff --git a/source/application/hal/platforms/bare-metal/bsp/mem_layout/mps3-sse-200.sct b/source/application/hal/platforms/bare-metal/bsp/mem_layout/mps3-sse-200.sct
new file mode 100644
index 0000000..293193e
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/mem_layout/mps3-sse-200.sct
@@ -0,0 +1,102 @@
+; Copyright (c) 2021 Arm Limited. All rights reserved.
+; SPDX-License-Identifier: Apache-2.0
+;
+; Licensed under the Apache License, Version 2.0 (the "License");
+; you may not use this file except in compliance with the License.
+; You may obtain a copy of the License at
+;
+; http://www.apache.org/licenses/LICENSE-2.0
+;
+; Unless required by applicable law or agreed to in writing, software
+; distributed under the License is distributed on an "AS IS" BASIS,
+; WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+; See the License for the specific language governing permissions and
+; limitations under the License.
+
+; *************************************************************
+; *** Scatter-Loading Description File ***
+; *************************************************************
+;
+; Sections used:
+;---------------------------------------------------------
+; | Start | End | Size | Remarks |
+;-|-------------|-------------|-------------|------------|
+; | 0x0000_0000 | 0x0010_0000 | 0x0010_0000 | ITCM (RO) |
+; | 0x0010_0000 | 0x0030_0000 | 0x0020_0000 | BRAM (RW) |
+; | 0x2000_0000 | 0x2040_0000 | 0x0040_0000 | DTCM (RW) |
+; | 0x6000_0000 | 0x6200_0000 | 0x0200_0000 | DRAM (RW) |
+;-|-------------|-------------|-------------|------------|
+; ITCM is aliased at 0x1000_0000 (single bank)
+; BRAM is aliased at 0x1010_0000
+; DTCM is aliased at 0x3000_0000 (four banks of 1MiB each)
+; DRAM is aliased at 0x7000_0000 (section is 256MiB)
+;
+; Note: Ethos-U55 can only access DRAM and BRAM sections
+;---------------------------------------------------------
+; First load region
+;---------------------------------------------------------
+LOAD_REGION_0 0x00000000 0x00100000
+{
+ ;-----------------------------------------------------
+ ; First part of code mem - 1MiB
+ ;-----------------------------------------------------
+ itcm.bin 0x00000000 0x00100000
+ {
+ *.o (RESET, +First)
+ * (InRoot$$Sections)
+ .ANY (+RO)
+ }
+
+ ;-----------------------------------------------------
+ ; Code memory's 2MiB - reserved for activation buffers
+ ; Make sure this is uninitialised.
+ ;-----------------------------------------------------
+ bram.bin 0x00100000 UNINIT 0x00200000
+ {
+ ; activation buffers a.k.a tensor arena
+ *.o (.bss.NoInit.activation_buf)
+ }
+
+ ;-----------------------------------------------------
+ ; 1MiB bank is used for any other RW or ZI data
+ ; Note: this region is internal to the Cortex-M CPU
+ ;-----------------------------------------------------
+ dtcm.bin 0x20000000 0x00100000
+ {
+ .ANY(+RW +ZI)
+ }
+
+ ;-----------------------------------------------------
+ ; 128kiB of stack space within SRAM region
+ ;-----------------------------------------------------
+ ARM_LIB_STACK 0x20100000 EMPTY ALIGN 8 0x00020000
+ {}
+
+ ;-----------------------------------------------------
+ ; 2MiB of heap space within the SRAM region
+ ;-----------------------------------------------------
+ ARM_LIB_HEAP 0x20200000 EMPTY ALIGN 8 0x00200000
+ {}
+}
+
+;---------------------------------------------------------
+; Second load region
+;---------------------------------------------------------
+LOAD_REGION_1 0x60000000 0x02000000
+{
+ ;-----------------------------------------------------
+ ; 32 MiB of DRAM space for nn model and input vectors
+ ;-----------------------------------------------------
+ dram.bin 0x60000000 0x02000000
+ {
+ ; nn model's baked in input matrices
+ *.o (ifm)
+
+ ; nn model
+ *.o (nn_model)
+
+ ; if the activation buffer (tensor arena) doesn't
+ ; fit in the SRAM region, we accommodate it here
+ *.o (activation_buf)
+ }
+}
diff --git a/source/application/hal/platforms/bare-metal/bsp/mem_layout/mps3-sse-300.sct b/source/application/hal/platforms/bare-metal/bsp/mem_layout/mps3-sse-300.sct
new file mode 100644
index 0000000..327d511
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/mem_layout/mps3-sse-300.sct
@@ -0,0 +1,118 @@
+; Copyright (c) 2021 Arm Limited. All rights reserved.
+; SPDX-License-Identifier: Apache-2.0
+;
+; Licensed under the Apache License, Version 2.0 (the "License");
+; you may not use this file except in compliance with the License.
+; You may obtain a copy of the License at
+;
+; http://www.apache.org/licenses/LICENSE-2.0
+;
+; Unless required by applicable law or agreed to in writing, software
+; distributed under the License is distributed on an "AS IS" BASIS,
+; WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+; See the License for the specific language governing permissions and
+; limitations under the License.
+
+; *************************************************************
+; *** Scatter-Loading Description File ***
+; *************************************************************
+; Please see docs/sections/appendix.md for memory mapping information.
+;
+; Note: Ethos-U55 can access BRAM, internal SRAM and the DDR sections => activation buffers and
+; the model should only be placed in those regions.
+;
+;---------------------------------------------------------
+; First load region (ITCM)
+;---------------------------------------------------------
+LOAD_REGION_0 0x00000000 0x00080000
+{
+ ;-----------------------------------------------------
+ ; First part of code mem - 512kiB
+ ;-----------------------------------------------------
+ itcm.bin 0x00000000 0x00080000
+ {
+ *.o (RESET, +First)
+ * (InRoot$$Sections)
+
+ ; Essentially only RO-CODE, RO-DATA is in a
+ ; different region.
+ .ANY (+RO)
+ }
+
+ ;-----------------------------------------------------
+ ; 128kiB of 512kiB DTCM is used for any other RW or ZI
+ ; data. Note: this region is internal to the Cortex-M
+ ; CPU.
+ ;-----------------------------------------------------
+ dtcm.bin 0x20000000 0x00020000
+ {
+ ; Any R/W and/or zero initialised data
+ .ANY(+RW +ZI)
+ }
+
+ ;-----------------------------------------------------
+ ; 384kiB of stack space within the DTCM region. See
+ ; `dtcm.bin` for the first section. Note: by virtue of
+ ; being part of DTCM, this region is only accessible
+ ; from Cortex-M55.
+ ;-----------------------------------------------------
+ ARM_LIB_STACK 0x20020000 EMPTY ALIGN 8 0x00060000
+ {}
+
+ ;-----------------------------------------------------
+ ; SSE-300's internal SRAM of 4MiB - reserved for
+ ; activation buffers.
+ ; This region should have 3 cycle read latency from
+ ; both Cortex-M55 and Ethos-U55
+ ;-----------------------------------------------------
+ isram.bin 0x31000000 UNINIT ALIGN 16 0x00400000
+ {
+ ; activation buffers a.k.a tensor arena
+ *.o (.bss.NoInit.activation_buf)
+ }
+}
+
+;---------------------------------------------------------
+; Second load region (DDR)
+;---------------------------------------------------------
+LOAD_REGION_1 0x70000000 0x02000000
+{
+ ;-----------------------------------------------------
+ ; 32 MiB of DRAM space for neural network model,
+ ; input vectors and labels. If the activation buffer
+ ; size required by the network is bigger than the
+ ; SRAM size available, it is accommodated here.
+ ;-----------------------------------------------------
+ dram.bin 0x70000000 ALIGN 16 0x02000000
+ {
+ ; nn model's baked in input matrices
+ *.o (ifm)
+
+ ; nn model
+ *.o (nn_model)
+
+ ; labels
+ *.o (labels)
+
+ ; if the activation buffer (tensor arena) doesn't
+ ; fit in the SRAM region, we accommodate it here
+ *.o (activation_buf)
+ }
+
+ ;-----------------------------------------------------
+ ; First 256kiB of BRAM (FPGA SRAM) used for RO data.
+ ; Note: Total BRAM size available is 2MiB.
+ ;-----------------------------------------------------
+ bram.bin 0x11000000 ALIGN 8 0x00040000
+ {
+ ; RO data (incl. unwinding tables for debugging)
+ .ANY (+RO-DATA)
+ }
+
+ ;-----------------------------------------------------
+ ; Remaining part of the 2MiB BRAM used as heap space.
+ ; 0x00200000 - 0x00040000 = 0x001C0000 (1.75 MiB)
+ ;-----------------------------------------------------
+ ARM_LIB_HEAP 0x11040000 EMPTY ALIGN 8 0x001C0000
+ {}
+}
diff --git a/source/application/hal/platforms/bare-metal/bsp/mem_layout/simple_platform.sct b/source/application/hal/platforms/bare-metal/bsp/mem_layout/simple_platform.sct
new file mode 100644
index 0000000..a1ffb49
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/bsp/mem_layout/simple_platform.sct
@@ -0,0 +1,102 @@
+; Copyright (c) 2021 Arm Limited. All rights reserved.
+; SPDX-License-Identifier: Apache-2.0
+;
+; Licensed under the Apache License, Version 2.0 (the "License");
+; you may not use this file except in compliance with the License.
+; You may obtain a copy of the License at
+;
+; http://www.apache.org/licenses/LICENSE-2.0
+;
+; Unless required by applicable law or agreed to in writing, software
+; distributed under the License is distributed on an "AS IS" BASIS,
+; WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+; See the License for the specific language governing permissions and
+; limitations under the License.
+
+; *************************************************************
+; *** Scatter-Loading Description File ***
+; *************************************************************
+;
+;---------------------------------------------------------
+; First load region (ITCM)
+;---------------------------------------------------------
+LOAD_REGION_0 0x00000000 0x00080000
+{
+ ;-----------------------------------------------------
+ ; First part of code mem - 512kiB
+ ;-----------------------------------------------------
+ itcm.bin 0x00000000 0x00080000
+ {
+ *.o (RESET, +First)
+ * (InRoot$$Sections)
+
+ ; Essentially only RO-CODE, RO-DATA is in a
+ ; different region.
+ .ANY (+RO)
+ }
+
+ ;-----------------------------------------------------
+ ; BRAM or FPGA data SRAM region worth 2MiB
+ ;-----------------------------------------------------
+ bram.bin 0x11000000 UNINIT ALIGN 16 0x00200000
+ {
+ ; activation buffers a.k.a tensor arena
+ *.o (.bss.NoInit.activation_buf)
+ }
+
+ ;-----------------------------------------------------
+ ; 128kiB of 512kiB bank is used for any other RW or ZI
+ ; data. Note: this region is internal to the Cortex-M
+ ; CPU
+ ;-----------------------------------------------------
+ dtcm.bin 0x20000000 0x00020000
+ {
+ .ANY(+RW +ZI)
+ }
+
+ ;-----------------------------------------------------
+ ; 128kiB of stack space within the DTCM region
+ ;-----------------------------------------------------
+ ARM_LIB_STACK 0x20020000 EMPTY ALIGN 8 0x00020000
+ {}
+
+ ;-----------------------------------------------------
+ ; 256kiB of heap space within the DTCM region
+ ;-----------------------------------------------------
+ ARM_LIB_HEAP 0x20040000 EMPTY ALIGN 8 0x00040000
+ {}
+}
+
+;---------------------------------------------------------
+; Second load region (DDR)
+;---------------------------------------------------------
+LOAD_REGION_1 0x70000000 0x02000000
+{
+ ;-----------------------------------------------------
+ ; 32 MiB of DRAM space for nn model and input vectors
+ ;-----------------------------------------------------
+ dram.bin 0x70000000 ALIGN 16 0x02000000
+ {
+ ; nn model's baked in input matrices
+ *.o (ifm)
+
+ ; nn model
+ *.o (nn_model)
+
+ ; if the activation buffer (tensor arena) doesn't
+ ; fit in the SRAM region, we accommodate it here
+ *.o (activation_buf)
+ }
+
+ ;-----------------------------------------------------
+ ; SSE-300's internal SRAM of 2MiB - reserved for
+ ; activation buffers.
+ ; This region should have 3 cycle read latency from
+ ; both Cortex-M55 and Ethos-U55
+ ;-----------------------------------------------------
+ isram.bin 0x31000000 0x00080000
+ {
+ ; RO data (incl. unwinding tables for debugging)
+ .ANY (+RO-DATA)
+ }
+}
diff --git a/source/application/hal/platforms/bare-metal/data_acquisition/data_acq.c b/source/application/hal/platforms/bare-metal/data_acquisition/data_acq.c
new file mode 100644
index 0000000..1e40b02
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/data_acquisition/data_acq.c
@@ -0,0 +1,61 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "data_acq.h"
+
+#include "bsp.h"
+
+#include <assert.h>
+#include <stdlib.h>
+#include <string.h>
+
+/**
+ * @brief Get the user input from USART.
+ * @param[out] user_input String read from the UART block.
+ * @param[in] size String read length.
+ * @return 0 if successful, error code otherwise.
+ **/
+static int get_uart_user_input(char* user_input, int size)
+{
+ if (true != GetLine(user_input, size - 1)) {
+ printf_err("invalid input\n");
+ return 1;
+ }
+ return 0;
+}
+
+int data_acq_channel_init(data_acq_module* module)
+{
+ assert(module);
+
+ /* UART should have been initialised with low level initialisation
+ * routines. */
+ module->system_init = NULL;
+
+ strncpy(module->system_name, "UART", sizeof(module->system_name));
+ module->get_input = get_uart_user_input;
+ module->inited = 1;
+
+ return !(module->inited);
+}
+
+int data_acq_channel_release(data_acq_module* module)
+{
+ assert(module);
+ module->inited = 0;
+ module->get_input = NULL;
+ return 0;
+}
diff --git a/source/application/hal/platforms/bare-metal/data_presentation/data_psn.c b/source/application/hal/platforms/bare-metal/data_presentation/data_psn.c
new file mode 100644
index 0000000..474d552
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/data_presentation/data_psn.c
@@ -0,0 +1,46 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "data_psn.h"
+
+#include "bsp.h"
+#include "lcd_img.h"
+
+#include <assert.h>
+#include <string.h>
+
+int data_psn_system_init(data_psn_module* module)
+{
+ assert(module);
+
+ /* LCD output supported. */
+ module->system_init = lcd_init;
+ module->present_data_image = lcd_display_image;
+ module->present_data_text = lcd_display_text;
+ module->present_box = lcd_display_box;
+ module->set_text_color = lcd_set_text_color;
+ module->clear = lcd_clear;
+ strncpy(module->system_name, "lcd", sizeof(module->system_name));
+ module->inited = !module->system_init();
+ return !module->inited;
+}
+
+int data_psn_system_release(data_psn_module* module)
+{
+ assert(module);
+ module->inited = 0;
+ return 0;
+}
diff --git a/source/application/hal/platforms/bare-metal/data_presentation/lcd/include/lcd_img.h b/source/application/hal/platforms/bare-metal/data_presentation/lcd/include/lcd_img.h
new file mode 100644
index 0000000..e4ad791
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/data_presentation/lcd/include/lcd_img.h
@@ -0,0 +1,90 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef LCD_IMG_H
+#define LCD_IMG_H
+
+#include <stdint.h>
+#include <stddef.h>
+#include <stdbool.h>
+
+/**
+ * @brief Initialise the LCD
+ * @return 0 if successful, error code otherwise.
+ **/
+int lcd_init(void);
+
+/**
+ * @brief Display a given image on the LCD. This allows displaying 8 bit
+ * single or multi-channel images on the LCD.
+ * @param[in] data Pointer to start of the image.
+ * @param[in] width Width of this image.
+ * @param[in] height Image height.
+ * @param[in] channels Number of channels.
+ * @param[in] pos_x Screen position x co-ordinate.
+ * @param[in] pos_y Screen position y co-ordinate.
+ * @param[in] downsample_factor Factor by which the image needs to be
+ * downsampled.
+ * @return 0 if successful, non-zero otherwise.
+ **/
+int lcd_display_image(uint8_t* data, const uint32_t width,
+ const uint32_t height, const uint32_t channels,
+ const uint32_t pos_x, const uint32_t pos_y,
+ const uint32_t downsample_factor);
+
+/**
+ * @brief Display a given image on the LCD. This allows displaying 8 bit
+ * single or multi-channel images on the LCD.
+ * @param[in] str Pointer to a null terminated string.
+ * @param[in] str_sz Length of the string.
+ * @param[in] pos_x Screen position x co-ordinate.
+ * @param[in] pos_y Screen position y co-ordinate.
+ * @param[in] allow_multiple_lines The function will try and spread
+ * the string into multiple lines if
+ * they don't fit in one.
+ * @return 0 if successful, non-zero otherwise.
+ **/
+int lcd_display_text(const char* str, const size_t str_sz,
+ const uint32_t pos_x, const uint32_t pos_y,
+ const bool allow_multiple_lines);
+
+/**
+ * @brief Display a box with given color on LCD.
+ * @param[in] pos_x Screen position x co-ordinate.
+ * @param[in] pos_y Screen position y co-ordinate.
+ * @param[in] width Width.
+ * @param[in] height Height.
+ * @param[in] color Fill color.
+ * @return 0 if successful, non-zero otherwise.
+ **/
+int lcd_display_box(const uint32_t pos_x, const uint32_t pos_y,
+ const uint32_t width, const uint32_t height, const uint16_t color);
+
+/**
+ * @brief Clear LCD.
+ * @param[in] color Fill color.
+ * @return 0 if successful, non-zero otherwise.
+ **/
+int lcd_clear(const uint16_t color);
+
+/**
+ * @brief Set text color.
+ * @param[in] color Fill color.
+ * @return 0 if successful, non-zero otherwise.
+ **/
+int lcd_set_text_color(const uint16_t color);
+
+#endif /* LCD_IMG_H */
diff --git a/source/application/hal/platforms/bare-metal/data_presentation/lcd/lcd_img.c b/source/application/hal/platforms/bare-metal/data_presentation/lcd/lcd_img.c
new file mode 100644
index 0000000..75f58fd
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/data_presentation/lcd/lcd_img.c
@@ -0,0 +1,159 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "lcd_img.h"
+
+#include "bsp.h"
+
+#include <string.h>
+#include <assert.h>
+
+static int show_title(void)
+{
+ char title[128];
+ int status = 0;
+
+ /* LCD title string */
+#if defined(CPU_CORTEX_M55)
+ const char* cpu_name = "Arm Cortex-M55";
+#else /* defined(CPU_CORTEX_M55) */
+ const char* cpu_name = "Arm CPU";
+#endif /* defined(CPU_CORTEX_M55) */
+
+ lcd_set_text_color(White);
+
+ /* First line */
+ snprintf(title, sizeof(title), "Arm ML embedded code samples");
+
+ if (0 != (status = lcd_display_text(
+ title, strlen(title), 10, 0, false))) {
+ return status;
+ }
+
+ /* Second line */
+#if defined (ARM_NPU)
+ snprintf(title, sizeof(title), "%s + Arm Ethos-U55 NPU", cpu_name);
+#else /* defined (ARM_NPU) */
+ snprintf(title, sizeof(title), "%s", cpu_name);
+#endif /* defined (ARM_NPU) */
+
+ return lcd_display_text(title, strlen(title), 10, 20, false);
+}
+
+int lcd_init(void)
+{
+ GLCD_Initialize();
+ GLCD_Clear(Black);
+ return show_title();
+}
+
+int lcd_display_image(uint8_t* data, const uint32_t width,
+ const uint32_t height, const uint32_t channels,
+ const uint32_t pos_x, const uint32_t pos_y,
+ const uint32_t downsample_factor)
+{
+ /* Sanity checks */
+ assert(data);
+ if ((pos_x + width/downsample_factor > GLCD_WIDTH) ||
+ (pos_y + height/downsample_factor > GLCD_HEIGHT)) {
+ printf_err("Invalid image size for given location!\n");
+ return 1;
+ }
+
+ if (1 == channels || 3 == channels) {
+ GLCD_Image(data, width, height, channels, pos_x, pos_y,
+ downsample_factor);
+ } else {
+ printf_err("Only single and three channel images are supported!\n");
+ return 1;
+ }
+
+ return 0;
+}
+
+int lcd_display_text(const char* str, const size_t str_sz,
+ const uint32_t pos_x, const uint32_t pos_y,
+ const bool allow_multiple_lines)
+{
+ /* We use a font 0 which is 9x15. */
+ const uint32_t x_span = 9; /* Each character is this 9 pixels "wide". */
+ const uint32_t y_span = 15; /* Each character is this 15 pixels "high". */
+
+ if (str_sz == 0) {
+ return 1;
+ }
+
+ /* If not within the LCD bounds, return error. */
+ if (pos_x + x_span > GLCD_WIDTH || pos_y + y_span > GLCD_HEIGHT) {
+ return 1;
+ } else {
+ const unsigned char font_idx = 0; /* We are using the custom font = 0 */
+
+ const uint32_t col = pos_x/x_span;
+ const uint32_t max_cols = GLCD_WIDTH/x_span - 1;
+ const uint32_t max_lines = GLCD_HEIGHT/y_span - 1;
+
+ uint32_t i = 0;
+ uint32_t current_line = pos_y/y_span;
+ uint32_t current_col = col;
+
+ /* Display the string on the LCD. */
+ for (i = 0; i < str_sz; ++i) {
+
+ if (allow_multiple_lines) {
+
+ /* If the next character won't fit. */
+ if (current_col > max_cols) {
+ current_col = col;
+
+ /* If the next line won't fit. */
+ if (++current_line > max_lines) {
+ return 1;
+ }
+ }
+ }
+
+ GLCD_DisplayChar(current_line, current_col++, font_idx, str[i]);
+ }
+ }
+ return 0;
+}
+
+int lcd_display_box(const uint32_t pos_x, const uint32_t pos_y,
+ const uint32_t width, const uint32_t height, const uint16_t color)
+{
+ /* If not within the LCD bounds, return error. */
+ if (pos_x > GLCD_WIDTH || pos_y > GLCD_HEIGHT) {
+ return 1;
+ }
+ else {
+ GLCD_Box(pos_x, pos_y, width, height, color);
+ }
+ return 0;
+}
+
+int lcd_clear(const uint16_t color)
+{
+ GLCD_Clear(color);
+ GLCD_SetTextColor(White);
+ return show_title();
+}
+
+int lcd_set_text_color(const uint16_t color)
+{
+ GLCD_SetTextColor(color);
+ return 0;
+}
diff --git a/source/application/hal/platforms/bare-metal/timer/baremetal_timer.c b/source/application/hal/platforms/bare-metal/timer/baremetal_timer.c
new file mode 100644
index 0000000..7257c1d
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/timer/baremetal_timer.c
@@ -0,0 +1,243 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "bsp.h"
+#include "timer.h"
+
+#include <assert.h>
+#include <string.h>
+
+#if defined (ARM_NPU)
+
+#include "pmu_ethosu.h"
+
+/**
+ * @brief Initialises the PMU and enables the cycle counter.
+ **/
+static void _init_ethosu_cyclecounter(void);
+
+/**
+ * @brief Gets the difference of total NPU cycle counts.
+ * (includes active and idle)
+ * @param[in] st Pointer to time_counter value at start time.
+ * @param[in] end Pointer to time_counter value at end.
+ * @return Total NPU cycle counts difference between the arguments expressed
+ * as unsigned 64 bit integer.
+ **/
+static uint64_t bm_get_npu_total_cycle_diff(time_counter *st,
+ time_counter *end);
+
+/**
+ * @brief Gets the difference in active NPU cycle counts.
+ * @param[in] st Pointer to time_counter value at start time.
+ * @param[in] end Pointer to time_counter value at end.
+ * @return Active NPU cycle counts difference between the arguments expressed
+ * as unsigned 64 bit integer.
+ **/
+static uint64_t bm_get_npu_active_cycle_diff(time_counter *st,
+ time_counter *end);
+
+#endif /* defined (ARM_NPU) */
+
+#if defined(MPS3_PLATFORM)
+/**
+ * @brief Wrapper for getting milliseconds duration between time counters
+ * @param[in] st Pointer to time_counter value at start time.
+ * @param[in] end Pointer to time_counter value at end.
+ * @return Difference in milliseconds between given time counters.
+ **/
+static time_t bm_get_duration_ms(time_counter *st, time_counter *end);
+
+/**
+ * @brief Wrapper for getting microseconds duration between time counters
+ * @param[in] st Pointer to time_counter value at start time.
+ * @param[in] end Pointer to time_counter value at end.
+ * @return Difference in microseconds between given time counters.
+ **/
+static time_t bm_get_duration_us(time_counter *st, time_counter *end);
+#endif /* defined(MPS3_PLATFORM) */
+
+/**
+ * @brief Wrapper for resetting timer.
+ **/
+static void bm_timer_reset(void);
+
+/**
+ * @brief Wrapper for getting the current timer counter.
+ * @return Current time counter value.
+ **/
+static time_counter bm_get_time_counter(void);
+
+/**
+ * @brief Wrapper for profiler start.
+ * @return Current profiler start timer counter.
+ **/
+static time_counter bm_start_profiling(void);
+
+/**
+ * @brief Wrapper for profiler end.
+ * @return Current profiler end timer counter.
+ **/
+static time_counter bm_stop_profiling(void);
+
+/**
+ * @brief Wrapper for getting CPU cycle difference between time counters.
+ * @return CPU cycle difference between given time counters expressed
+ * as unsigned 32 bit integer.
+ **/
+static uint32_t bm_get_cpu_cycles_diff(time_counter *st, time_counter *end);
+
+/**
+ * @brief Initialiser for bare metal timer.
+ * @param[in] timer Platform timer to initialize.
+ **/
+void init_timer(platform_timer *timer)
+{
+ assert(timer);
+ memset(timer, 0, sizeof(*timer));
+
+ timer->reset = bm_timer_reset;
+ timer->get_time_counter = bm_get_time_counter;
+ timer->start_profiling = bm_start_profiling;
+ timer->stop_profiling = bm_stop_profiling;
+ timer->get_cpu_cycle_diff = bm_get_cpu_cycles_diff;
+ timer->cap.cpu_cycles = 1;
+
+#if defined (MPS3_PLATFORM)
+ timer->cap.duration_ms = 1;
+ timer->cap.duration_us = 1;
+ timer->get_duration_ms = bm_get_duration_ms;
+ timer->get_duration_us = bm_get_duration_us;
+#endif /* defined (MPS3_PLATFORM) */
+
+#if defined (ARM_NPU)
+ /* We are capable of reporting npu cycle counts. */
+ timer->cap.npu_cycles = 1;
+ timer->get_npu_total_cycle_diff = bm_get_npu_total_cycle_diff;
+ timer->get_npu_active_cycle_diff = bm_get_npu_active_cycle_diff;
+ _init_ethosu_cyclecounter();
+#endif /* defined (ARM_NPU) */
+
+ timer->reset();
+ timer->inited = 1;
+}
+
+#if defined (ARM_NPU)
+
+static void _reset_ethosu_counters(void)
+{
+ /* Reset all cycle and event counters. */
+ ETHOSU_PMU_CYCCNT_Reset();
+ ETHOSU_PMU_EVCNTR_ALL_Reset();
+}
+
+static void _init_ethosu_cyclecounter(void)
+{
+ /* Reset overflow status. */
+ ETHOSU_PMU_Set_CNTR_OVS(ETHOSU_PMU_CNT1_Msk | ETHOSU_PMU_CCNT_Msk);
+
+ /* Set the counter #0 to count idle cycles. */
+ ETHOSU_PMU_Set_EVTYPER(0, ETHOSU_PMU_NPU_IDLE);
+
+ /* Enable PMU. */
+ ETHOSU_PMU_Enable();
+
+ /* Enable counters for cycle and counter# 0. */
+ ETHOSU_PMU_CNTR_Enable(ETHOSU_PMU_CNT1_Msk | ETHOSU_PMU_CCNT_Msk);
+
+ _reset_ethosu_counters();
+}
+
+static uint64_t bm_get_npu_total_cycle_diff(time_counter *st, time_counter *end)
+{
+ return end->npu_total_ccnt - st->npu_total_ccnt;
+}
+
+static uint64_t bm_get_npu_active_cycle_diff(time_counter *st, time_counter *end)
+{
+ /* Check for overflow: The idle counter is 32 bit while the
+ total cycle count is 64 bit. */
+ const uint32_t overflow_status = ETHOSU_PMU_Get_CNTR_OVS();
+
+ if (ETHOSU_PMU_CNT1_Msk & overflow_status) {
+ printf_err("EthosU PMU idle counter overflow.\n");
+ return 0;
+ }
+
+ /* Active NPU time = total time - idle time */
+ return (bm_get_npu_total_cycle_diff(st, end) +
+ (uint64_t)(st->npu_idle_ccnt)) - (uint64_t)(end->npu_idle_ccnt);
+}
+
+#endif /* defined (ARM_NPU) */
+
+static void bm_timer_reset(void)
+{
+#if defined (ARM_NPU)
+ _init_ethosu_cyclecounter();
+#endif /* defined (ARM_NPU) */
+
+ timer_reset();
+}
+
+static time_counter bm_get_time_counter(void)
+{
+ time_counter t = {
+ .counter = get_time_counter(),
+
+#if defined (ARM_NPU)
+ .npu_idle_ccnt = ETHOSU_PMU_Get_EVCNTR(0),
+ .npu_total_ccnt = ETHOSU_PMU_Get_CCNTR()
+#endif /* defined (ARM_NPU) */
+
+ };
+
+#if defined (ARM_NPU)
+ debug("NPU total cc: %llu; NPU idle cc: %u\n",
+ t.npu_total_ccnt, t.npu_idle_ccnt);
+#endif /* defined (ARM_NPU) */
+
+ return t;
+}
+
+static time_counter bm_start_profiling(void)
+{
+ start_cycle_counter();
+ return bm_get_time_counter();
+}
+
+static time_counter bm_stop_profiling(void)
+{
+ stop_cycle_counter();
+ return bm_get_time_counter();
+}
+
+static uint32_t bm_get_cpu_cycles_diff(time_counter *st, time_counter *end)
+{
+ return get_cycle_count_diff(&(st->counter), &(end->counter));
+}
+
+#if defined(MPS3_PLATFORM)
+static time_t bm_get_duration_ms(time_counter *st, time_counter *end)
+{
+ return get_duration_milliseconds(&(st->counter), &(end->counter));
+}
+
+static time_t bm_get_duration_us(time_counter *st, time_counter *end)
+{
+ return get_duration_microseconds(&(st->counter), &(end->counter));
+}
+#endif /* defined(MPS3_PLATFORM) */
diff --git a/source/application/hal/platforms/bare-metal/timer/include/baremetal_timer.h b/source/application/hal/platforms/bare-metal/timer/include/baremetal_timer.h
new file mode 100644
index 0000000..c8fc32c
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/timer/include/baremetal_timer.h
@@ -0,0 +1,41 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef BAREMETAL_TIMER_H
+#define BAREMETAL_TIMER_H
+
+#include <stdint.h>
+#include <time.h>
+
+#if defined (MPS3_PLATFORM)
+ #include "timer_mps3.h"
+ typedef mps3_time_counter base_time_counter;
+#else /* defined (MPS3_PLATFORM) */
+ #include "timer_fvp.h"
+ typedef fvp_time_counter base_time_counter;
+#endif /* defined (MPS3_PLATFORM) */
+
+typedef struct bm_time_counter {
+ base_time_counter counter;
+
+#if defined (ARM_NPU)
+ uint64_t npu_total_ccnt;
+ uint32_t npu_idle_ccnt;
+#endif /* ARM_NPU */
+
+} time_counter;
+
+#endif /* BAREMETAL_TIMER_H */
diff --git a/source/application/hal/platforms/bare-metal/utils/include/system_init.h b/source/application/hal/platforms/bare-metal/utils/include/system_init.h
new file mode 100644
index 0000000..84e0305
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/utils/include/system_init.h
@@ -0,0 +1,43 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef BAREMETAL_SYSTEM_INIT_H
+#define BAREMETAL_SYSTEM_INIT_H
+
+#include "bsp.h"
+
+/**
+ * @brief Initialises the platform (MPS3 FPGA board or Fixed Virtual Platform)
+ * Updates the system core clock and initialises the UART. It also
+ * verifies that the Cortex-M CPU variant being used matches the expected
+ * value if running on MPS3.
+ * @return 0 if successful, error code otherwise.
+*/
+int system_init(void);
+
+/**
+ * @brief Releases the platform (MPS3 FPGA board or Fixed Virtual Platform).
+ **/
+void system_release(void);
+
+/**
+ * @brief Return the name the platform (MPS3 FPGA board or Fixed Virtual Platform).
+ * @param[out] name Platform name string.
+ * @param[in] size Name string length.
+ **/
+void system_name(char* name, size_t size);
+
+#endif /* BAREMETAL_SYSTEM_INIT_H */
diff --git a/source/application/hal/platforms/bare-metal/utils/system_init.c b/source/application/hal/platforms/bare-metal/utils/system_init.c
new file mode 100644
index 0000000..0a6a1b3
--- /dev/null
+++ b/source/application/hal/platforms/bare-metal/utils/system_init.c
@@ -0,0 +1,118 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "system_init.h"
+
+#include "uart_stdout.h"
+
+#include <string.h>
+
+#if defined(MPS3_PLATFORM)
+#define CREATE_MASK(msb, lsb) (((1U << ((msb) - (lsb) + 1)) - 1) << (lsb))
+#define MASK_BITS(arg, msb, lsb) ((arg) & CREATE_MASK(msb, lsb))
+#define EXTRACT_BITS(arg, msb, lsb) (MASK_BITS(arg, msb, lsb) >> (lsb))
+#endif /* MPS3_PLATFORM */
+
+int system_init(void)
+{
+#if defined(MPS3_PLATFORM)
+ uint32_t id = 0;
+ uint32_t fpgaid = 0;
+ uint32_t apnote = 0;
+ uint32_t rev = 0;
+ uint32_t aid = 0;
+ uint32_t fpga_clk = 0;
+
+ /* Initialise the LEDs as the switches are */
+ MPS3_FPGAIO->LED = MPS3_FPGAIO->SWITCHES & 0xFF;
+#endif
+
+ /* UART init - will enable valid use of printf (stdout
+ * re-directed at this UART (UART0) */
+ UartStdOutInit();
+ info("Processor internal clock: %u Hz\n", GetSystemCoreClock());
+
+#if defined(MPS3_PLATFORM)
+ /* Get revision information from various registers */
+ rev = MPS3_SCC->CFG_REG4;
+ fpgaid = MPS3_SCC->SCC_ID;
+ aid = MPS3_SCC->SCC_AID;
+ apnote = EXTRACT_BITS(fpgaid, 15, 4);
+ fpga_clk = GetMPS3CoreClock();
+
+ info("V2M-MPS3 revision %c\n\n", rev + 'A');
+ info("Application Note AN%x, Revision %c\n", apnote,
+ EXTRACT_BITS(aid, 23, 20) + 'A');
+ info("MPS3 build %d\n", EXTRACT_BITS(aid, 31, 24));
+ info("MPS3 core clock has been set to: %d Hz\n", fpga_clk);
+
+ /* Display CPU ID */
+ id = SCB->CPUID;
+ info("CPU ID: 0x%08x\n", id);
+
+ if(EXTRACT_BITS(id, 15, 8) == 0xD2) {
+ if (EXTRACT_BITS(id, 7, 4) == 2) {
+ info ("CPU: Cortex-M55 r%dp%d\n\n",
+ EXTRACT_BITS(id, 23, 20),EXTRACT_BITS(id, 3, 0));
+#if defined (CPU_CORTEX_M55)
+ /* CPU ID should be "0x_41_0f_d2_20" for Cortex-M55 */
+ return 0;
+#endif /* CPU_CORTEX_M55 */
+ } else if (EXTRACT_BITS(id, 7, 4) == 1) {
+ info ("CPU: Cortex-M33 r%dp%d\n\n",
+ EXTRACT_BITS(id, 23, 20),EXTRACT_BITS(id, 3, 0));
+#if defined (CPU_CORTEX_M33)
+ return 0;
+#endif /* CPU_CORTEX_M33 */
+ } else if (EXTRACT_BITS(id, 7, 4) == 0) {
+ info ("CPU: Cortex-M23 r%dp%d\n\n",
+ EXTRACT_BITS(id, 23, 20),EXTRACT_BITS(id, 3, 0));
+ } else {
+ info ("CPU: Cortex-M processor family");
+ }
+ } else if (EXTRACT_BITS(id, 15, 8) == 0xC6) {
+ info ("CPU: Cortex-M%d+ r%dp%d\n\n",
+ EXTRACT_BITS(id, 7, 4), EXTRACT_BITS(id, 23, 20),
+ EXTRACT_BITS(id, 3, 0));
+ } else {
+ info ("CPU: Cortex-M%d r%dp%d\n\n",
+ EXTRACT_BITS(id, 7, 4), EXTRACT_BITS(id, 23, 20),
+ EXTRACT_BITS(id, 3, 0));
+ }
+#else /* MPS3_PLATFORM */
+
+ info("ARM model environment ready..\n");
+ return 0;
+#endif /* MPS3_PLATFORM */
+
+ /* If the CPU is anything other than M33 or M55, we return 1 */
+ printf_err("CPU mismatch!\n");
+ return 1;
+}
+
+void system_release(void)
+{
+ __disable_irq();
+}
+
+void system_name(char* name, size_t size)
+{
+#if defined (MPS3_PLATFORM)
+ strncpy(name, "mps3-bare", size);
+#else /* MPS3_PLATFORM */
+ strncpy(name, "FVP", size);
+#endif /* MPS3_PLATFORM */
+}
\ No newline at end of file
diff --git a/source/application/hal/platforms/native/data_acquisition/data_acq.c b/source/application/hal/platforms/native/data_acquisition/data_acq.c
new file mode 100644
index 0000000..01f47fa
--- /dev/null
+++ b/source/application/hal/platforms/native/data_acquisition/data_acq.c
@@ -0,0 +1,61 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "data_acq.h"
+
+#include <assert.h>
+#include <stdio.h>
+#include <string.h>
+
+/**
+ * @brief Initialize the acuisition.
+ * @return 0 if successful, error code otherwise.
+ **/
+static int acquisition_init(void)
+{
+ return 0;
+}
+
+/**
+ * @brief Get the user input from stdin.
+ * @param[out] user_input String read from the stdin.
+ * @param[in,out] size String read length.
+ * @return 0 if successful, error code otherwise.
+ **/
+static int get_user_input(char* user_input, int size)
+{
+ fgets(user_input, size, stdin);
+ return 0;
+}
+
+int data_acq_channel_init(data_acq_module *module)
+{
+ assert(module);
+
+ module->system_init = acquisition_init;
+ module->get_input = get_user_input;
+ strncpy(module->system_name, "native",
+ sizeof(module->system_name));
+ module->inited = !module->system_init();
+ return !module->inited;
+}
+
+int data_acq_channel_release(data_acq_module *module)
+{
+ assert(module);
+ module->inited = 0;
+ return 0;
+}
diff --git a/source/application/hal/platforms/native/data_presentation/data_psn.c b/source/application/hal/platforms/native/data_presentation/data_psn.c
new file mode 100644
index 0000000..fe4bcfa
--- /dev/null
+++ b/source/application/hal/platforms/native/data_presentation/data_psn.c
@@ -0,0 +1,45 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "data_psn.h"
+
+#include "log.h"
+
+#include <assert.h>
+#include <string.h>
+
+int data_psn_system_init(data_psn_module *module)
+{
+ assert(module);
+
+ module->system_init = log_psn_init;
+ module->present_data_image = log_display_image;
+ module->present_data_text = log_display_text;
+ module->present_box = log_display_box_icon;
+ module->set_text_color = log_set_text_color;
+ module->clear = log_clear;
+ strncpy(module->system_name, "log_psn", sizeof(module->system_name));
+ module->inited = !module->system_init();
+ return !module->inited;
+}
+
+int data_psn_system_release(data_psn_module *module)
+{
+ /* Nothing to do here! */
+ assert(module);
+ module->inited = 0;
+ return 0;
+}
diff --git a/source/application/hal/platforms/native/data_presentation/log/include/log.h b/source/application/hal/platforms/native/data_presentation/log/include/log.h
new file mode 100644
index 0000000..10cf303
--- /dev/null
+++ b/source/application/hal/platforms/native/data_presentation/log/include/log.h
@@ -0,0 +1,86 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef NATIVE_LOG_H
+#define NATIVE_LOG_H
+
+#include <stdint.h>
+#include <stddef.h>
+#include <stdbool.h>
+
+/**
+ * @brief Data presentation initialiser
+ **/
+int log_psn_init(void);
+
+/**
+ * @brief Log parameters for the image to be displayed.
+ * @param[in] data Image pointer.
+ * @param[in] width Image width.
+ * @param[in] height Image height.
+ * @param[in] channels Number of channels.
+ * @param[in] pos_x Screen position x co-ordinate.
+ * @param[in] pos_y Screen position y co-ordinate.
+ * @param[in] downsample_factor Factor by which the image needs to be
+ * down-sampled.
+ * @return 0 if successful, non-zero otherwise.
+ **/
+
+int log_display_image(uint8_t* data, const uint32_t width,
+ const uint32_t height, const uint32_t channels,
+ const uint32_t pos_x, const uint32_t pos_y,
+ const uint32_t downsample_factor);
+
+/**
+ * @brief Log the parameters for text to be displayed.
+ * @param[in] str Pointer to a null terminated string.
+ * @param[in] str_sz Length of the string.
+ * @param[in] pos_x Screen position x co-ordinate.
+ * @param[in] pos_y Screen position y co-ordinate.
+ * @return 0 if successful, non-zero otherwise.
+ **/
+int log_display_text(const char* str, const size_t str_sz,
+ const uint32_t pos_x, const uint32_t pos_y,
+ const bool allow_multiple_lines);
+
+/**
+ * @brief Log parameters for the box to be displayed.
+ * @param[in] pos_x Screen position x co-ordinate.
+ * @param[in] pos_y Screen position y co-ordinate.
+ * @param[in] width Width.
+ * @param[in] height Height.
+ * @param[in] color Fill color.
+ * @return 0 if successful, non-zero otherwise.
+ **/
+int log_display_box_icon(const uint32_t pos_x, const uint32_t pos_y,
+ const uint32_t width, const uint32_t height, const uint16_t color);
+
+/**
+ * @brief Logs the colour with which the display
+ * needs to be cleared with.
+ * @param[in] color Fill color.
+ * @return 0 if successful, non-zero otherwise.
+ **/
+int log_clear(const uint16_t color);
+
+/**
+ * @brief Logs the text color to be set.
+ * @param[in] color Fill color.
+ * @return 0 if successful, non-zero otherwise.
+ **/
+int log_set_text_color (const uint16_t color);
+
+#endif /* NATIVE_LOG_H */
\ No newline at end of file
diff --git a/source/application/hal/platforms/native/data_presentation/log/log.c b/source/application/hal/platforms/native/data_presentation/log/log.c
new file mode 100644
index 0000000..48e8b95
--- /dev/null
+++ b/source/application/hal/platforms/native/data_presentation/log/log.c
@@ -0,0 +1,71 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "log.h"
+
+#include "dummy_log.h"
+
+#include <stdint.h>
+
+int log_psn_init(void)
+{
+ return 0;
+}
+
+int log_display_image(uint8_t* data, const uint32_t width,
+ const uint32_t height, const uint32_t channels,
+ const uint32_t pos_x, const uint32_t pos_y,
+ const uint32_t downsample_factor)
+{
+ info("Image details\n");
+ info("Data: %p\n", data);
+ info("WxHxC: %dx%dx%d\n", width, height, channels);
+ info("Pos (x,y): (%d,%d)\n", pos_x, pos_y);
+ info("Downsampling factor: %u\n", downsample_factor);
+ return 0;
+}
+
+int log_display_text(const char* str, const size_t str_sz,
+ const uint32_t pos_x, const uint32_t pos_y,
+ const bool allow_multiple_lines)
+{
+ UNUSED(allow_multiple_lines);
+ info("%s\n", str);
+ info("Text size: %lu, x: %d, y: %d\n", str_sz, pos_x, pos_y);
+ return 0;
+}
+
+
+int log_display_box_icon(const uint32_t pos_x, const uint32_t pos_y,
+ const uint32_t width, const uint32_t height,
+ const uint16_t color)
+{
+ info("Showing rectangular, width: %d, height: %d, color: %d, x: %d, y: %d\n",
+ width, height, color, pos_x, pos_y);
+ return 0;
+}
+
+int log_clear(const uint16_t color)
+{
+ info("Clearing with color: %d\n", color);
+ return 0;
+}
+
+int log_set_text_color (const uint16_t color)
+{
+ info("Setting text color: %d\n", color);
+ return 0;
+}
diff --git a/source/application/hal/platforms/native/timer/include/native_timer.h b/source/application/hal/platforms/native/timer/include/native_timer.h
new file mode 100644
index 0000000..df7b493
--- /dev/null
+++ b/source/application/hal/platforms/native/timer/include/native_timer.h
@@ -0,0 +1,31 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef TIMER_H
+#define TIMER_H
+
+#include <stdint.h>
+#include <time.h>
+
+/* Container for time struct */
+typedef struct _time_counter {
+ /* Current POSIX time in secs. */
+ time_t current_secs;
+ /* Nanoseconds expired in current second. */
+ time_t current_nsecs;
+} time_counter;
+
+#endif /* TIMER_H */
\ No newline at end of file
diff --git a/source/application/hal/platforms/native/timer/native_timer.cc b/source/application/hal/platforms/native/timer/native_timer.cc
new file mode 100644
index 0000000..c115f4d
--- /dev/null
+++ b/source/application/hal/platforms/native/timer/native_timer.cc
@@ -0,0 +1,110 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+#include "timer.h"
+
+#include <cassert>
+#include <ctime>
+#include <cstring>
+
+#define MILLISECONDS_IN_SECOND 1000
+#define MICROSECONDS_IN_SECOND 1000000
+#define NANOSECONDS_IN_MILLISECOND 1000000
+#define NANOSECONDS_IN_MICROSECOND 1000
+
+/**
+ * @brief Gets the current time counter value.
+ * @return Counter value expressed in terms of time_counter struct.
+ **/
+static time_counter get_time_counter(void)
+{
+ struct timespec current_time{};
+ clock_gettime(1, ¤t_time);
+ time_counter t = {
+ .current_secs = current_time.tv_sec,
+ .current_nsecs = current_time.tv_nsec
+ };
+
+ return t;
+}
+
+/**
+ * @brief Gets the time duration elapsed between start and end.
+ * @param[in] start Pointer to time_counter value at start time.
+ * @param[in] end Pointer to time_counter value at end.
+ * @return Difference in milliseconds between the arguments expressed
+ * as unsigned 32 bit integer.
+ **/
+static time_t get_duration_milliseconds(time_counter *start, time_counter *end)
+{
+ /* Convert both parts of time struct to ms then add for complete time. */
+ time_t seconds_part =
+ (end->current_secs - start->current_secs) * MILLISECONDS_IN_SECOND;
+ time_t nanoseconds_part =
+ (end->current_nsecs - start->current_nsecs) / NANOSECONDS_IN_MILLISECOND;
+
+ return seconds_part + nanoseconds_part;
+}
+
+/**
+ * @brief Gets the time duration elapsed between start and end.
+ * @param[in] start Pointer to time_counter value at start time.
+ * @param[in] end Pointer to time_counter value at end.
+ * @return Difference in microseconds between the arguments expressed
+ * as unsigned 32 bit integer.
+ **/
+static time_t get_duration_microseconds(time_counter *start, time_counter *end)
+{
+ /* Convert both parts of time struct to us then add for complete time. */
+ time_t seconds_part =
+ (end->current_secs - start->current_secs) * MICROSECONDS_IN_SECOND;
+ time_t nanoseconds_part =
+ (end->current_nsecs - start->current_nsecs) / NANOSECONDS_IN_MICROSECOND;
+
+ return seconds_part + nanoseconds_part;
+}
+
+/**
+ * @brief Stub for timer reset.
+ **/
+void reset_timer() {}
+
+/**
+ * @brief Initialise the timer for this platform.
+ **/
+void init_timer(platform_timer *timer)
+{
+ assert(timer);
+ memset(timer, 0, sizeof(*timer));
+
+ timer->get_time_counter = get_time_counter;
+ timer->start_profiling = get_time_counter;
+ timer->stop_profiling = get_time_counter;
+ timer->get_duration_ms = get_duration_milliseconds;
+ timer->cap.duration_ms = 1;
+ timer->get_duration_us = get_duration_microseconds;
+ timer->cap.duration_us = 1;
+ timer->reset = reset_timer;
+ timer->inited = 1;
+}
+
+#ifdef __cplusplus
+}
+#endif
diff --git a/source/application/hal/platforms/native/utils/include/dummy_log.h b/source/application/hal/platforms/native/utils/include/dummy_log.h
new file mode 100644
index 0000000..626436a
--- /dev/null
+++ b/source/application/hal/platforms/native/utils/include/dummy_log.h
@@ -0,0 +1,64 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef DUMMY_LOG_H
+#define DUMMY_LOG_H
+
+#include <stdio.h>
+
+#define LOG_LEVEL_TRACE 0
+#define LOG_LEVEL_DEBUG 1
+#define LOG_LEVEL_INFO 2
+#define LOG_LEVEL_WARN 3
+#define LOG_LEVEL_ERROR 4
+
+#ifndef LOG_LEVEL
+#define LOG_LEVEL LOG_LEVEL_INFO
+#endif /*LOG_LEVEL*/
+
+#define UNUSED(x) ((void)(x))
+
+#if (LOG_LEVEL == LOG_LEVEL_TRACE)
+ #define trace(...) printf("[TRACE] "); printf(__VA_ARGS__)
+#else
+ #define trace(...)
+#endif /* LOG_LEVEL == LOG_LEVEL_TRACE */
+
+#if (LOG_LEVEL <= LOG_LEVEL_DEBUG)
+ #define debug(...) printf("[DEBUG] "); printf(__VA_ARGS__)
+#else
+ #define debug(...)
+#endif /* LOG_LEVEL > LOG_LEVEL_TRACE */
+
+#if (LOG_LEVEL <= LOG_LEVEL_INFO)
+ #define info(...) printf("[INFO] "); printf(__VA_ARGS__)
+#else
+ #define info(...)
+#endif /* LOG_LEVEL > LOG_LEVEL_DEBUG */
+
+#if (LOG_LEVEL <= LOG_LEVEL_WARN)
+ #define warn(...) printf("[WARN] "); printf(__VA_ARGS__)
+#else
+ #define warn(...)
+#endif /* LOG_LEVEL > LOG_LEVEL_INFO */
+
+#if (LOG_LEVEL <= LOG_LEVEL_ERROR)
+ #define printf_err(...) printf("[ERROR] "); printf(__VA_ARGS__)
+#else
+ #define printf_err(...)
+#endif /* LOG_LEVEL > LOG_LEVEL_INFO */
+
+#endif /* DUMMY_LOG_H */
\ No newline at end of file
diff --git a/source/application/hal/platforms/native/utils/include/system_init.h b/source/application/hal/platforms/native/utils/include/system_init.h
new file mode 100644
index 0000000..80b1bb2
--- /dev/null
+++ b/source/application/hal/platforms/native/utils/include/system_init.h
@@ -0,0 +1,39 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef NATIVE_SYSTEM_INIT_H
+#define NATIVE_SYSTEM_INIT_H
+
+#include "dummy_log.h"
+
+/**
+ * @brief Platform initialisation for native platform.
+ **/
+int system_init(void);
+
+/**
+ * @brief Platform release for native platform.
+ **/
+void system_release(void);
+
+/**
+ * @brief Returns the name of the platform.
+ * @param[out] name Platform name string.
+ * @param[in] size Name string length.
+ */
+void system_name(char* name, size_t size);
+
+#endif /* NATIVE_SYSTEM_INIT_H */
diff --git a/source/application/hal/platforms/native/utils/system_init.c b/source/application/hal/platforms/native/utils/system_init.c
new file mode 100644
index 0000000..8e0b768
--- /dev/null
+++ b/source/application/hal/platforms/native/utils/system_init.c
@@ -0,0 +1,32 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "system_init.h"
+
+#include <string.h>
+
+int system_init(void)
+{
+ return 0;
+}
+
+void system_release(void)
+{}
+
+void system_name(char* name, size_t size)
+{
+ strncpy(name, "native", size);
+}
\ No newline at end of file
diff --git a/source/application/main/Classifier.cc b/source/application/main/Classifier.cc
new file mode 100644
index 0000000..bc2c378
--- /dev/null
+++ b/source/application/main/Classifier.cc
@@ -0,0 +1,191 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "Classifier.hpp"
+
+#include "hal.h"
+#include "TensorFlowLiteMicro.hpp"
+
+#include <vector>
+#include <string>
+#include <set>
+#include <cstdint>
+
+namespace arm {
+namespace app {
+
+ template<typename T>
+ bool Classifier::_GetTopNResults(TfLiteTensor* tensor,
+ std::vector<ClassificationResult>& vecResults,
+ uint32_t topNCount,
+ const std::vector <std::string>& labels)
+ {
+ std::set<std::pair<T, uint32_t>> sortedSet;
+
+ /* NOTE: inputVec's size verification against labels should be
+ * checked by the calling/public function. */
+ T* tensorData = tflite::GetTensorData<T>(tensor);
+
+ /* Set initial elements. */
+ for (uint32_t i = 0; i < topNCount; ++i) {
+ sortedSet.insert({tensorData[i], i});
+ }
+
+ /* Initialise iterator. */
+ auto setFwdIter = sortedSet.begin();
+
+ /* Scan through the rest of elements with compare operations. */
+ for (uint32_t i = topNCount; i < labels.size(); ++i) {
+ if (setFwdIter->first < tensorData[i]) {
+ sortedSet.erase(*setFwdIter);
+ sortedSet.insert({tensorData[i], i});
+ setFwdIter = sortedSet.begin();
+ }
+ }
+
+ /* Final results' container. */
+ vecResults = std::vector<ClassificationResult>(topNCount);
+
+ /* For getting the floating point values, we need quantization parameters. */
+ QuantParams quantParams = GetTensorQuantParams(tensor);
+
+ /* Reset the iterator to the largest element - use reverse iterator. */
+ auto setRevIter = sortedSet.rbegin();
+
+ /* Populate results
+ * Note: we could combine this loop with the loop above, but that
+ * would, involve more multiplications and other operations.
+ **/
+ for (size_t i = 0; i < vecResults.size(); ++i, ++setRevIter) {
+ double score = static_cast<int> (setRevIter->first);
+ vecResults[i].m_normalisedVal = quantParams.scale *
+ (score - quantParams.offset);
+ vecResults[i].m_label = labels[setRevIter->second];
+ vecResults[i].m_labelIdx = setRevIter->second;
+ }
+
+ return true;
+ }
+
+ template<>
+ bool Classifier::_GetTopNResults<float>(TfLiteTensor* tensor,
+ std::vector<ClassificationResult>& vecResults,
+ uint32_t topNCount,
+ const std::vector <std::string>& labels)
+ {
+ std::set<std::pair<float, uint32_t>> sortedSet;
+
+ /* NOTE: inputVec's size verification against labels should be
+ * checked by the calling/public function. */
+ float* tensorData = tflite::GetTensorData<float>(tensor);
+
+ /* Set initial elements. */
+ for (uint32_t i = 0; i < topNCount; ++i) {
+ sortedSet.insert({tensorData[i], i});
+ }
+
+ /* Initialise iterator. */
+ auto setFwdIter = sortedSet.begin();
+
+ /* Scan through the rest of elements with compare operations. */
+ for (uint32_t i = topNCount; i < labels.size(); ++i) {
+ if (setFwdIter->first < tensorData[i]) {
+ sortedSet.erase(*setFwdIter);
+ sortedSet.insert({tensorData[i], i});
+ setFwdIter = sortedSet.begin();
+ }
+ }
+
+ /* Final results' container. */
+ vecResults = std::vector<ClassificationResult>(topNCount);
+
+ /* Reset the iterator to the largest element - use reverse iterator. */
+ auto setRevIter = sortedSet.rbegin();
+
+ /* Populate results
+ * Note: we could combine this loop with the loop above, but that
+ * would, involve more multiplications and other operations.
+ **/
+ for (size_t i = 0; i < vecResults.size(); ++i, ++setRevIter) {
+ vecResults[i].m_normalisedVal = setRevIter->first;
+ vecResults[i].m_label = labels[setRevIter->second];
+ vecResults[i].m_labelIdx = setRevIter->second;
+ }
+
+ return true;
+ }
+
+ template bool Classifier::_GetTopNResults<uint8_t>(TfLiteTensor* tensor,
+ std::vector<ClassificationResult>& vecResults,
+ uint32_t topNCount, const std::vector <std::string>& labels);
+
+ template bool Classifier::_GetTopNResults<int8_t>(TfLiteTensor* tensor,
+ std::vector<ClassificationResult>& vecResults,
+ uint32_t topNCount, const std::vector <std::string>& labels);
+
+ bool Classifier::GetClassificationResults(
+ TfLiteTensor* outputTensor,
+ std::vector<ClassificationResult>& vecResults,
+ const std::vector <std::string>& labels, uint32_t topNCount)
+ {
+ if (outputTensor == nullptr) {
+ printf_err("Output vector is null pointer.\n");
+ return false;
+ }
+
+ uint32_t totalOutputSize = 1;
+ for (int inputDim = 0; inputDim < outputTensor->dims->size; inputDim++){
+ totalOutputSize *= outputTensor->dims->data[inputDim];
+ }
+
+ /* Sanity checks. */
+ if (totalOutputSize < topNCount) {
+ printf_err("Output vector is smaller than %u\n", topNCount);
+ return false;
+ } else if (totalOutputSize != labels.size()) {
+ printf_err("Output size doesn't match the labels' size\n");
+ return false;
+ }
+
+ bool resultState;
+ vecResults.clear();
+
+ /* Get the top N results. */
+ switch (outputTensor->type) {
+ case kTfLiteUInt8:
+ resultState = _GetTopNResults<uint8_t>(outputTensor, vecResults, topNCount, labels);
+ break;
+ case kTfLiteInt8:
+ resultState = _GetTopNResults<int8_t>(outputTensor, vecResults, topNCount, labels);
+ break;
+ case kTfLiteFloat32:
+ resultState = _GetTopNResults<float>(outputTensor, vecResults, topNCount, labels);
+ break;
+ default:
+ printf_err("Tensor type %s not supported by classifier\n", TfLiteTypeGetName(outputTensor->type));
+ return false;
+ }
+
+ if (!resultState) {
+ printf_err("Failed to get sorted set\n");
+ return false;
+ }
+
+ return true;
+ }
+
+} /* namespace app */
+} /* namespace arm */
\ No newline at end of file
diff --git a/source/application/main/Main.cc b/source/application/main/Main.cc
new file mode 100644
index 0000000..6e1c620
--- /dev/null
+++ b/source/application/main/Main.cc
@@ -0,0 +1,70 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/****************************************************************************\
+ * Main application file for ARM NPU on MPS3 board *
+\****************************************************************************/
+
+#include "hal.h" /* our hardware abstraction api */
+#include "TensorFlowLiteMicro.hpp" /* our inference logic api */
+
+#include <cstdio>
+
+extern void main_loop(hal_platform& platform);
+
+#if defined(__ARMCC_VERSION) && (__ARMCC_VERSION >= 6010050)
+__ASM(" .global __ARM_use_no_argv\n");
+#endif
+
+/* Print application information. */
+static void print_application_intro()
+{
+ info("%s\n", PRJ_DES_STR);
+ info("Target system design: %s\n", DESIGN_NAME);
+ info("Version %s Build date: " __DATE__ " @ " __TIME__ "\n", PRJ_VER_STR);
+ info("Copyright (C) ARM Ltd 2020. All rights reserved.\n\n");
+}
+
+int main ()
+{
+ hal_platform platform;
+ data_acq_module dataAcq;
+ data_psn_module dataPsn;
+ platform_timer timer;
+
+ /* Initialise the HAL and platform. */
+ hal_init(&platform, &dataAcq, &dataPsn, &timer);
+
+ if (0 == hal_platform_init(&platform)) {
+ /* Application information, UART should have been initialised. */
+ print_application_intro();
+
+ /* Check the version of TensorFlow Lite Micro. */
+ PrintTensorFlowVersion();
+
+ /* Run the application. */
+ main_loop(platform);
+ }
+
+ /* This is unreachable without errors. */
+ info("program terminating...\n");
+
+ /* Release platform. */
+ hal_platform_release(&platform);
+ return 0;
+}
+
diff --git a/source/application/main/Mfcc.cc b/source/application/main/Mfcc.cc
new file mode 100644
index 0000000..bf16159
--- /dev/null
+++ b/source/application/main/Mfcc.cc
@@ -0,0 +1,354 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "Mfcc.hpp"
+
+#include "PlatformMath.hpp"
+
+#include <cfloat>
+
+namespace arm {
+namespace app {
+namespace audio {
+
+ MfccParams::MfccParams(
+ const float samplingFreq,
+ const uint32_t numFbankBins,
+ const float melLoFreq,
+ const float melHiFreq,
+ const uint32_t numMfccFeats,
+ const uint32_t frameLen,
+ const bool useHtkMethod):
+ m_samplingFreq(samplingFreq),
+ m_numFbankBins(numFbankBins),
+ m_melLoFreq(melLoFreq),
+ m_melHiFreq(melHiFreq),
+ m_numMfccFeatures(numMfccFeats),
+ m_frameLen(frameLen),
+
+ /* Smallest power of 2 >= frame length. */
+ m_frameLenPadded(pow(2, ceil((log(frameLen)/log(2))))),
+ m_useHtkMethod(useHtkMethod)
+ {}
+
+ std::string MfccParams::Str()
+ {
+ char strC[1024];
+ snprintf(strC, sizeof(strC) - 1, "\n \
+ \n\t Sampling frequency: %f\
+ \n\t Number of filter banks: %u\
+ \n\t Mel frequency limit (low): %f\
+ \n\t Mel frequency limit (high): %f\
+ \n\t Number of MFCC features: %u\
+ \n\t Frame length: %u\
+ \n\t Padded frame length: %u\
+ \n\t Using HTK for Mel scale: %s\n",
+ this->m_samplingFreq, this->m_numFbankBins, this->m_melLoFreq,
+ this->m_melHiFreq, this->m_numMfccFeatures, this->m_frameLen,
+ this->m_frameLenPadded, this->m_useHtkMethod ? "yes" : "no");
+ return std::string{strC};
+ }
+
+ MFCC::MFCC(const MfccParams& params):
+ _m_params(params),
+ _m_filterBankInitialised(false)
+ {
+ this->_m_buffer = std::vector<float>(
+ this->_m_params.m_frameLenPadded, 0.0);
+ this->_m_frame = std::vector<float>(
+ this->_m_params.m_frameLenPadded, 0.0);
+ this->_m_melEnergies = std::vector<float>(
+ this->_m_params.m_numFbankBins, 0.0);
+
+ this->_m_windowFunc = std::vector<float>(this->_m_params.m_frameLen);
+ const float multiplier = 2 * M_PI / this->_m_params.m_frameLen;
+
+ /* Create window function. */
+ for (size_t i = 0; i < this->_m_params.m_frameLen; i++) {
+ this->_m_windowFunc[i] = (0.5 - (0.5 *
+ math::MathUtils::CosineF32(static_cast<float>(i) * multiplier)));
+ }
+
+ math::MathUtils::FftInitF32(this->_m_params.m_frameLenPadded, this->_m_fftInstance);
+ debug("Instantiated MFCC object: %s\n", this->_m_params.Str().c_str());
+ }
+
+ void MFCC::Init()
+ {
+ this->_InitMelFilterBank();
+ }
+
+ float MFCC::MelScale(const float freq, const bool useHTKMethod)
+ {
+ if (useHTKMethod) {
+ return 1127.0f * logf (1.0f + freq / 700.0f);
+ } else {
+ /* Slaney formula for mel scale. */
+
+ float mel = freq / ms_freqStep;
+
+ if (freq >= ms_minLogHz) {
+ mel = ms_minLogMel + logf(freq / ms_minLogHz) / ms_logStep;
+ }
+ return mel;
+ }
+ }
+
+ float MFCC::InverseMelScale(const float melFreq, const bool useHTKMethod)
+ {
+ if (useHTKMethod) {
+ return 700.0f * (expf (melFreq / 1127.0f) - 1.0f);
+ } else {
+ /* Slaney formula for mel scale. */
+ float freq = ms_freqStep * melFreq;
+
+ if (melFreq >= ms_minLogMel) {
+ freq = ms_minLogHz * expf(ms_logStep * (melFreq - ms_minLogMel));
+ }
+ return freq;
+ }
+ }
+
+
+ bool MFCC::ApplyMelFilterBank(
+ std::vector<float>& fftVec,
+ std::vector<std::vector<float>>& melFilterBank,
+ std::vector<int32_t>& filterBankFilterFirst,
+ std::vector<int32_t>& filterBankFilterLast,
+ std::vector<float>& melEnergies)
+ {
+ const size_t numBanks = melEnergies.size();
+
+ if (numBanks != filterBankFilterFirst.size() ||
+ numBanks != filterBankFilterLast.size()) {
+ printf_err("unexpected filter bank lengths\n");
+ return false;
+ }
+
+ for (size_t bin = 0; bin < numBanks; ++bin) {
+ auto filterBankIter = melFilterBank[bin].begin();
+ float melEnergy = FLT_MIN; /* Avoid log of zero at later stages */
+ int32_t firstIndex = filterBankFilterFirst[bin];
+ int32_t lastIndex = filterBankFilterLast[bin];
+
+ for (int i = firstIndex; i <= lastIndex; i++) {
+ float energyRep = math::MathUtils::SqrtF32(fftVec[i]);
+ melEnergy += (*filterBankIter++ * energyRep);
+ }
+
+ melEnergies[bin] = melEnergy;
+ }
+
+ return true;
+ }
+
+ void MFCC::ConvertToLogarithmicScale(std::vector<float>& melEnergies)
+ {
+ for (size_t bin = 0; bin < melEnergies.size(); ++bin) {
+ melEnergies[bin] = logf(melEnergies[bin]);
+ }
+ }
+
+ void MFCC::_ConvertToPowerSpectrum()
+ {
+ const uint32_t halfDim = this->_m_params.m_frameLenPadded / 2;
+
+ /* Handle this special case. */
+ float firstEnergy = this->_m_buffer[0] * this->_m_buffer[0];
+ float lastEnergy = this->_m_buffer[1] * this->_m_buffer[1];
+
+ math::MathUtils::ComplexMagnitudeSquaredF32(
+ this->_m_buffer.data(),
+ this->_m_buffer.size(),
+ this->_m_buffer.data(),
+ this->_m_buffer.size()/2);
+
+ this->_m_buffer[0] = firstEnergy;
+ this->_m_buffer[halfDim] = lastEnergy;
+ }
+
+ std::vector<float> MFCC::CreateDCTMatrix(
+ const int32_t inputLength,
+ const int32_t coefficientCount)
+ {
+ std::vector<float> dctMatix(inputLength * coefficientCount);
+
+ const float normalizer = math::MathUtils::SqrtF32(2.0f/inputLength);
+ const float angleIncr = M_PI/inputLength;
+ float angle = 0;
+
+ for (int32_t k = 0, m = 0; k < coefficientCount; k++, m += inputLength) {
+ for (int32_t n = 0; n < inputLength; n++) {
+ dctMatix[m+n] = normalizer *
+ math::MathUtils::CosineF32((n + 0.5) * angle);
+ }
+ angle += angleIncr;
+ }
+
+ return dctMatix;
+ }
+
+ float MFCC::GetMelFilterBankNormaliser(
+ const float& leftMel,
+ const float& rightMel,
+ const bool useHTKMethod)
+ {
+ UNUSED(leftMel);
+ UNUSED(rightMel);
+ UNUSED(useHTKMethod);
+
+ /* By default, no normalisation => return 1 */
+ return 1.f;
+ }
+
+ void MFCC::_InitMelFilterBank()
+ {
+ if (!this->_IsMelFilterBankInited()) {
+ this->_m_melFilterBank = this->_CreateMelFilterBank();
+ this->_m_dctMatrix = this->CreateDCTMatrix(
+ this->_m_params.m_numFbankBins,
+ this->_m_params.m_numMfccFeatures);
+ this->_m_filterBankInitialised = true;
+ }
+ }
+
+ bool MFCC::_IsMelFilterBankInited()
+ {
+ return this->_m_filterBankInitialised;
+ }
+
+ void MFCC::_MfccComputePreFeature(const std::vector<int16_t>& audioData)
+ {
+ this->_InitMelFilterBank();
+
+ /* TensorFlow way of normalizing .wav data to (-1, 1). */
+ constexpr float normaliser = 1.0/(1<<15);
+ for (size_t i = 0; i < this->_m_params.m_frameLen; i++) {
+ this->_m_frame[i] = static_cast<float>(audioData[i]) * normaliser;
+ }
+
+ /* Apply window function to input frame. */
+ for(size_t i = 0; i < this->_m_params.m_frameLen; i++) {
+ this->_m_frame[i] *= this->_m_windowFunc[i];
+ }
+
+ /* Set remaining frame values to 0. */
+ std::fill(this->_m_frame.begin() + this->_m_params.m_frameLen,this->_m_frame.end(), 0);
+
+ /* Compute FFT. */
+ math::MathUtils::FftF32(this->_m_frame, this->_m_buffer, this->_m_fftInstance);
+
+ /* Convert to power spectrum. */
+ this->_ConvertToPowerSpectrum();
+
+ /* Apply mel filterbanks. */
+ if (!this->ApplyMelFilterBank(this->_m_buffer,
+ this->_m_melFilterBank,
+ this->_m_filterBankFilterFirst,
+ this->_m_filterBankFilterLast,
+ this->_m_melEnergies)) {
+ printf_err("Failed to apply MEL filter banks\n");
+ }
+
+ /* Convert to logarithmic scale. */
+ this->ConvertToLogarithmicScale(this->_m_melEnergies);
+ }
+
+ std::vector<float> MFCC::MfccCompute(const std::vector<int16_t>& audioData)
+ {
+ this->_MfccComputePreFeature(audioData);
+
+ std::vector<float> mfccOut(this->_m_params.m_numMfccFeatures);
+
+ float * ptrMel = this->_m_melEnergies.data();
+ float * ptrDct = this->_m_dctMatrix.data();
+ float * ptrMfcc = mfccOut.data();
+
+ /* Take DCT. Uses matrix mul. */
+ for (size_t i = 0, j = 0; i < mfccOut.size();
+ ++i, j += this->_m_params.m_numFbankBins) {
+ *ptrMfcc++ = math::MathUtils::DotProductF32(
+ ptrDct + j,
+ ptrMel,
+ this->_m_params.m_numFbankBins);
+ }
+ return mfccOut;
+ }
+
+ std::vector<std::vector<float>> MFCC::_CreateMelFilterBank()
+ {
+ size_t numFftBins = this->_m_params.m_frameLenPadded / 2;
+ float fftBinWidth = static_cast<float>(this->_m_params.m_samplingFreq) / this->_m_params.m_frameLenPadded;
+
+ float melLowFreq = MFCC::MelScale(this->_m_params.m_melLoFreq,
+ this->_m_params.m_useHtkMethod);
+ float melHighFreq = MFCC::MelScale(this->_m_params.m_melHiFreq,
+ this->_m_params.m_useHtkMethod);
+ float melFreqDelta = (melHighFreq - melLowFreq) / (this->_m_params.m_numFbankBins + 1);
+
+ std::vector<float> thisBin = std::vector<float>(numFftBins);
+ std::vector<std::vector<float>> melFilterBank(
+ this->_m_params.m_numFbankBins);
+ this->_m_filterBankFilterFirst =
+ std::vector<int32_t>(this->_m_params.m_numFbankBins);
+ this->_m_filterBankFilterLast =
+ std::vector<int32_t>(this->_m_params.m_numFbankBins);
+
+ for (size_t bin = 0; bin < this->_m_params.m_numFbankBins; bin++) {
+ float leftMel = melLowFreq + bin * melFreqDelta;
+ float centerMel = melLowFreq + (bin + 1) * melFreqDelta;
+ float rightMel = melLowFreq + (bin + 2) * melFreqDelta;
+
+ int32_t firstIndex = -1;
+ int32_t lastIndex = -1;
+ const float normaliser = this->GetMelFilterBankNormaliser(leftMel, rightMel, this->_m_params.m_useHtkMethod);
+
+ for (size_t i = 0; i < numFftBins; i++) {
+ float freq = (fftBinWidth * i); /* Center freq of this fft bin. */
+ float mel = MFCC::MelScale(freq, this->_m_params.m_useHtkMethod);
+ thisBin[i] = 0.0;
+
+ if (mel > leftMel && mel < rightMel) {
+ float weight;
+ if (mel <= centerMel) {
+ weight = (mel - leftMel) / (centerMel - leftMel);
+ } else {
+ weight = (rightMel - mel) / (rightMel - centerMel);
+ }
+
+ thisBin[i] = weight * normaliser;
+ if (firstIndex == -1) {
+ firstIndex = i;
+ }
+ lastIndex = i;
+ }
+ }
+
+ this->_m_filterBankFilterFirst[bin] = firstIndex;
+ this->_m_filterBankFilterLast[bin] = lastIndex;
+
+ /* Copy the part we care about. */
+ for (int32_t i = firstIndex; i <= lastIndex; i++) {
+ melFilterBank[bin].push_back(thisBin[i]);
+ }
+ }
+
+ return melFilterBank;
+ }
+
+} /* namespace audio */
+} /* namespace app */
+} /* namespace arm */
diff --git a/source/application/main/PlatformMath.cc b/source/application/main/PlatformMath.cc
new file mode 100644
index 0000000..a9f5049
--- /dev/null
+++ b/source/application/main/PlatformMath.cc
@@ -0,0 +1,196 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "PlatformMath.hpp"
+
+#if 0 == ARM_DSP_AVAILABLE
+ #include <cmath>
+ #include <numeric>
+#endif /* 0 == ARM_DSP_AVAILABLE */
+
+namespace arm {
+namespace app {
+namespace math {
+
+ float MathUtils::CosineF32(float radians)
+ {
+#if ARM_DSP_AVAILABLE
+ return arm_cos_f32(radians);
+#else /* ARM_DSP_AVAILABLE */
+ return cos(radians);
+#endif /* ARM_DSP_AVAILABLE */
+ }
+
+ float MathUtils::SqrtF32(float input)
+ {
+#if ARM_DSP_AVAILABLE
+ float output = 0.f;
+ arm_sqrt_f32(input, &output);
+ return output;
+#else /* ARM_DSP_AVAILABLE */
+ return sqrtf(input);
+#endif /* ARM_DSP_AVAILABLE */
+ }
+
+ float MathUtils::MeanF32(float* ptrSrc, const uint32_t srcLen)
+ {
+ if (!srcLen) {
+ return 0.f;
+ }
+
+#if ARM_DSP_AVAILABLE
+ float result = 0.f;
+ arm_mean_f32(ptrSrc, srcLen, &result);
+ return result;
+#else /* ARM_DSP_AVAILABLE */
+ float acc = std::accumulate(ptrSrc, ptrSrc + srcLen, 0.0);
+ return acc/srcLen;
+#endif /* ARM_DSP_AVAILABLE */
+ }
+
+ float MathUtils::StdDevF32(float* ptrSrc, const uint32_t srcLen,
+ const float mean)
+ {
+ if (!srcLen) {
+ return 0.f;
+ }
+#if ARM_DSP_AVAILABLE
+ /**
+ * Note Standard deviation calculation can be off
+ * by > 0.01 but less than < 0.1, according to
+ * preliminary findings.
+ **/
+ UNUSED(mean);
+ float stdDev = 0;
+ arm_std_f32(ptrSrc, srcLen, &stdDev);
+ return stdDev;
+#else /* ARM_DSP_AVAILABLE */
+ auto VarianceFunction = [=](float acc, const float value) {
+ return acc + (((value - mean) * (value - mean))/ srcLen);
+ };
+
+ float acc = std::accumulate(ptrSrc, ptrSrc + srcLen, 0.0,
+ VarianceFunction);
+
+ return sqrtf(acc);
+#endif /* ARM_DSP_AVAILABLE */
+ }
+
+ bool MathUtils::FftInitF32(const uint16_t fftLen, arm::app::math::FftInstance& fftInstance)
+ {
+#if ARM_DSP_AVAILABLE
+ if (!fftInstance.initialised) {
+ arm_status status = arm_rfft_fast_init_f32(&fftInstance.instance, fftLen);
+
+ if (ARM_MATH_SUCCESS != status) {
+ return false;
+ }
+ fftInstance.initialised = true;
+ }
+#else
+ UNUSED(fftLen);
+ UNUSED(fftInstance);
+#endif /* ARM_DSP_AVAILABLE */
+ return true;
+ }
+
+ void MathUtils::FftF32(std::vector<float>& input,
+ std::vector<float>& fftOutput,
+ arm::app::math::FftInstance& fftInstance)
+ {
+#if ARM_DSP_AVAILABLE
+ arm_rfft_fast_f32(&fftInstance.instance, input.data(), fftOutput.data(), 0);
+#else
+ UNUSED(fftInstance);
+ const int inputLength = input.size();
+
+ for (int k = 0; k <= inputLength / 2; k++) {
+ float sumReal = 0, sumImag = 0;
+
+ for (int t = 0; t < inputLength; t++) {
+ float angle = 2 * M_PI * t * k / inputLength;
+ sumReal += input[t] * cosf(angle);
+ sumImag += -input[t] * sinf(angle);
+ }
+
+ /* Arrange output to [real0, realN/2, real1, im1, real2, im2, ...] */
+ if (k == 0) {
+ fftOutput[0] = sumReal;
+ } else if (k == inputLength / 2) {
+ fftOutput[1] = sumReal;
+ } else {
+ fftOutput[k*2] = sumReal;
+ fftOutput[k*2 + 1] = sumImag;
+ };
+ }
+#endif /* ARM_DSP_AVAILABLE */
+ }
+
+ void MathUtils::VecLogarithmF32(std::vector <float>& input,
+ std::vector <float>& output)
+ {
+#if ARM_DSP_AVAILABLE
+ arm_vlog_f32(input.data(), output.data(),
+ output.size());
+#else /* ARM_DSP_AVAILABLE */
+ for (auto in = input.begin(), out = output.begin();
+ in != input.end(); ++in, ++out) {
+ *out = logf(*in);
+ }
+#endif /* ARM_DSP_AVAILABLE */
+ }
+
+ float MathUtils::DotProductF32(float* srcPtrA, float* srcPtrB,
+ const uint32_t srcLen)
+ {
+ float output = 0.f;
+
+#if ARM_DSP_AVAILABLE
+ arm_dot_prod_f32(srcPtrA, srcPtrB, srcLen, &output);
+#else /* ARM_DSP_AVAILABLE */
+ for (uint32_t i = 0; i < srcLen; ++i) {
+ output += *srcPtrA++ * *srcPtrB++;
+ }
+#endif /* ARM_DSP_AVAILABLE */
+
+ return output;
+ }
+
+ bool MathUtils::ComplexMagnitudeSquaredF32(float* ptrSrc,
+ const uint32_t srcLen,
+ float* ptrDst,
+ const uint32_t dstLen)
+ {
+ if (dstLen < srcLen/2) {
+ printf_err("dstLen must be greater than srcLen/2");
+ return false;
+ }
+
+#if ARM_DSP_AVAILABLE
+ arm_cmplx_mag_squared_f32(ptrSrc, ptrDst, srcLen/2);
+#else /* ARM_DSP_AVAILABLE */
+ for (uint32_t j = 0; j < srcLen; ++j) {
+ const float real = *ptrSrc++;
+ const float im = *ptrSrc++;
+ *ptrDst++ = real*real + im*im;
+ }
+#endif /* ARM_DSP_AVAILABLE */
+ return true;
+ }
+
+} /* namespace math */
+} /* namespace app */
+} /* namespace arm */
\ No newline at end of file
diff --git a/source/application/main/Profiler.cc b/source/application/main/Profiler.cc
new file mode 100644
index 0000000..f364759
--- /dev/null
+++ b/source/application/main/Profiler.cc
@@ -0,0 +1,219 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "Profiler.hpp"
+
+#include <cstring>
+#include <string>
+#include <sstream>
+
+namespace arm {
+namespace app {
+
+ template<class T>
+ static void writeStatLine(std::ostringstream& s,
+ const char* desc,
+ T total,
+ uint32_t samples,
+ T min,
+ T max)
+ {
+ s << "\t" << desc << total << " / "
+ << ((double)total / samples) << " / "
+ << min << " / " << max << std::endl;
+ }
+
+ Profiler::Profiler(hal_platform* platform, const char* name = "Unknown")
+ : _m_name(name)
+ {
+ if (platform && platform->inited) {
+ this->_m_pPlatform = platform;
+ this->Reset();
+ } else {
+ printf_err("Profiler %s initialised with invalid platform\n",
+ this->_m_name.c_str());
+ }
+ }
+
+ bool Profiler::StartProfiling(const char* name)
+ {
+ if (name) {
+ this->SetName(name);
+ }
+ if (this->_m_pPlatform && !this->_m_started) {
+ this->_m_pPlatform->timer->reset();
+ this->_m_tstampSt = this->_m_pPlatform->timer->start_profiling();
+ this->_m_started = true;
+ return true;
+ }
+ printf_err("Failed to start profiler %s\n", this->_m_name.c_str());
+ return false;
+ }
+
+ bool Profiler::StopProfiling()
+ {
+ if (this->_m_pPlatform && this->_m_started) {
+ this->_m_tstampEnd = this->_m_pPlatform->timer->stop_profiling();
+ this->_m_started = false;
+
+ this->_AddProfilingUnit(this->_m_tstampSt, this->_m_tstampEnd, this->_m_name);
+
+ return true;
+ }
+ printf_err("Failed to stop profiler %s\n", this->_m_name.c_str());
+ return false;
+ }
+
+ bool Profiler::StopProfilingAndReset()
+ {
+ if (this->StopProfiling()) {
+ this->Reset();
+ return true;
+ }
+ printf_err("Failed to stop profiler %s\n", this->_m_name.c_str());
+ return false;
+ }
+
+ void Profiler::Reset()
+ {
+ this->_m_started = false;
+ memset(&this->_m_tstampSt, 0, sizeof(this->_m_tstampSt));
+ memset(&this->_m_tstampEnd, 0, sizeof(this->_m_tstampEnd));
+ }
+
+ std::string Profiler::GetResultsAndReset()
+ {
+ std::ostringstream strResults;
+
+ for (const auto& item: this->_m_series) {
+ auto name = item.first;
+ ProfilingSeries series = item.second;
+
+ uint32_t samplesNum = series.size();
+
+ uint64_t totalNpuCycles = 0; /* Total NPU cycles (idle + active). */
+ uint64_t totalActiveNpuCycles = 0; /* Active NPU cycles. */
+ uint64_t totalCpuCycles = 0; /* Total CPU cycles. */
+ time_t totalTimeMs = 0;
+
+ uint64_t minActiveNpuCycles = series[0].activeNpuCycles;
+ uint64_t minIdleNpuCycles = series[0].npuCycles - minActiveNpuCycles;
+ uint64_t minActiveCpuCycles = series[0].cpuCycles - minActiveNpuCycles;
+ time_t minTimeMs = series[0].time;
+
+ uint64_t maxIdleNpuCycles = 0;
+ uint64_t maxActiveNpuCycles = 0;
+ uint64_t maxActiveCpuCycles = 0;
+ time_t maxTimeMs = 0;
+
+ for(ProfilingUnit& unit: series){
+ totalNpuCycles += unit.npuCycles;
+ totalActiveNpuCycles += unit.activeNpuCycles;
+ totalCpuCycles += unit.cpuCycles;
+ totalTimeMs += unit.time;
+
+ maxActiveNpuCycles = std::max(maxActiveNpuCycles,
+ unit.activeNpuCycles);
+ maxIdleNpuCycles = std::max(maxIdleNpuCycles,
+ unit.npuCycles - maxActiveNpuCycles);
+ maxActiveCpuCycles = std::max(maxActiveCpuCycles,
+ unit.cpuCycles - maxActiveNpuCycles);
+ maxTimeMs = std::max(maxTimeMs, unit.time);
+
+ minActiveNpuCycles = std::min(minActiveNpuCycles,
+ unit.activeNpuCycles);
+ minIdleNpuCycles = std::min(minIdleNpuCycles,
+ unit.npuCycles - minActiveNpuCycles);
+ minActiveCpuCycles = std::min(minActiveCpuCycles,
+ unit.cpuCycles - minActiveNpuCycles);
+ minTimeMs = std::min(minTimeMs, unit.time);
+ }
+
+ strResults << "Profile for " << name << ": " << std::endl;
+
+ if (samplesNum > 1) {
+ strResults << "\tSamples: " << samplesNum << std::endl;
+ strResults << "\t Total / Avg./ Min / Max"
+ << std::endl;
+
+ writeStatLine<uint64_t>(strResults, "Active NPU cycles: ",
+ totalActiveNpuCycles, samplesNum,
+ minActiveNpuCycles, maxActiveNpuCycles);
+
+ writeStatLine<uint64_t>(strResults, "Idle NPU cycles: ",
+ (totalNpuCycles - totalActiveNpuCycles),
+ samplesNum, minIdleNpuCycles, maxIdleNpuCycles);
+
+#if defined(CPU_PROFILE_ENABLED)
+ writeStatLine<uint64_t>(strResults, "Active CPU cycles (approx): ",
+ (totalCpuCycles - totalActiveNpuCycles),
+ samplesNum, minActiveCpuCycles,
+ maxActiveCpuCycles);
+
+ writeStatLine<time_t>(strResults, "Time in ms: ",
+ totalTimeMs, samplesNum, minTimeMs, maxTimeMs);
+#endif
+ } else {
+ strResults << "\tActive NPU cycles: " << totalActiveNpuCycles
+ << std::endl;
+ strResults << "\tIdle NPU cycles: "
+ << (totalNpuCycles - totalActiveNpuCycles)
+ << std::endl;
+#if defined(CPU_PROFILE_ENABLED)
+ strResults << "\tActive CPU cycles: "
+ << (totalCpuCycles - totalActiveNpuCycles)
+ << " (approx)" << std::endl;
+
+ strResults << "\tTime in ms: " << totalTimeMs << std::endl;
+#endif
+ }
+ }
+ this->Reset();
+ return strResults.str();
+ }
+
+ void Profiler::SetName(const char* str)
+ {
+ this->_m_name = std::string(str);
+ }
+
+ void Profiler::_AddProfilingUnit(time_counter start, time_counter end,
+ const std::string& name)
+ {
+ platform_timer * timer = this->_m_pPlatform->timer;
+
+ struct ProfilingUnit unit;
+
+ if (timer->cap.npu_cycles && timer->get_npu_total_cycle_diff &&
+ timer->get_npu_active_cycle_diff)
+ {
+ unit.npuCycles = timer->get_npu_total_cycle_diff(&start, &end);
+ unit.activeNpuCycles = timer->get_npu_active_cycle_diff(&start, &end);
+ }
+
+ if (timer->cap.cpu_cycles && timer->get_cpu_cycle_diff) {
+ unit.cpuCycles = timer->get_cpu_cycle_diff(&start, &end);
+ }
+
+ if (timer->cap.duration_ms && timer->get_duration_ms) {
+ unit.time = timer->get_duration_ms(&start, &end);
+ }
+
+ this->_m_series[name].emplace_back(unit);
+ }
+
+} /* namespace app */
+} /* namespace arm */
\ No newline at end of file
diff --git a/source/application/main/UseCaseCommonUtils.cc b/source/application/main/UseCaseCommonUtils.cc
new file mode 100644
index 0000000..4ea5e4d
--- /dev/null
+++ b/source/application/main/UseCaseCommonUtils.cc
@@ -0,0 +1,119 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "UseCaseCommonUtils.hpp"
+
+#include "InputFiles.hpp"
+
+namespace arm {
+namespace app {
+
+ bool RunInference(hal_platform& platform, arm::app::Model& model)
+ {
+ Profiler profiler{&platform, "Inference"};
+ profiler.StartProfiling();
+
+ bool runInf = model.RunInference();
+
+ profiler.StopProfiling();
+ std::string profileResults = profiler.GetResultsAndReset();
+ info("%s\n", profileResults.c_str());
+
+ return runInf;
+ }
+
+ int ReadUserInputAsInt(hal_platform& platform)
+ {
+ char chInput[128];
+ memset(chInput, 0, sizeof(chInput));
+
+ platform.data_acq->get_input(chInput, sizeof(chInput));
+ return atoi(chInput);
+ }
+
+ void DumpTensor(TfLiteTensor* tensor, const size_t lineBreakForNumElements)
+ {
+ char strhex[8];
+ std::string strdump;
+
+ if (!tensor) {
+ printf_err("invalid tensor\n");
+ return;
+ }
+
+ const uint32_t tensorSz = tensor->bytes;
+ const uint8_t* tensorData = tflite::GetTensorData<uint8_t>(tensor);
+
+ for (size_t i = 0; i < tensorSz; ++i) {
+ if (0 == i % lineBreakForNumElements) {
+ printf("%s\n\t", strdump.c_str());
+ strdump.clear();
+ }
+ snprintf(strhex, sizeof(strhex) - 1,
+ "0x%02x, ", tensorData[i]);
+ strdump += std::string(strhex);
+ }
+
+ if (strdump.size()) {
+ printf("%s\n", strdump.c_str());
+ }
+ }
+
+ bool ListFilesHandler(ApplicationContext& ctx)
+ {
+ auto& model = ctx.Get<Model&>("model");
+ auto& platform = ctx.Get<hal_platform&>("platform");
+
+ constexpr uint32_t dataPsnTxtStartX = 20;
+ constexpr uint32_t dataPsnTxtStartY = 40;
+
+ if (!model.IsInited()) {
+ printf_err("Model is not initialised! Terminating processing.\n");
+ return false;
+ }
+
+ /* Clear the LCD */
+ platform.data_psn->clear(COLOR_BLACK);
+
+ /* Show the total number of embedded files. */
+ std::string strNumFiles = std::string{"Total Number of Files: "} +
+ std::to_string(NUMBER_OF_FILES);
+ platform.data_psn->present_data_text(strNumFiles.c_str(),
+ strNumFiles.size(),
+ dataPsnTxtStartX,
+ dataPsnTxtStartY,
+ 0);
+
+#if NUMBER_OF_FILES > 0
+ constexpr uint32_t dataPsnTxtYIncr = 16;
+ info("List of Files:\n");
+ uint32_t yVal = dataPsnTxtStartY + dataPsnTxtYIncr;
+ for (uint32_t i = 0; i < NUMBER_OF_FILES; ++i, yVal += dataPsnTxtYIncr) {
+
+ std::string currentFilename{get_filename(i)};
+ platform.data_psn->present_data_text(currentFilename.c_str(),
+ currentFilename.size(),
+ dataPsnTxtStartX, yVal, 0);
+
+ info("\t%u => %s\n", i, currentFilename.c_str());
+ }
+#endif /* NUMBER_OF_FILES > 0 */
+
+ return true;
+ }
+
+} /* namespace app */
+} /* namespace arm */
\ No newline at end of file
diff --git a/source/application/main/include/AppContext.hpp b/source/application/main/include/AppContext.hpp
new file mode 100644
index 0000000..588dfaa
--- /dev/null
+++ b/source/application/main/include/AppContext.hpp
@@ -0,0 +1,102 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef APP_CTX_HPP
+#define APP_CTX_HPP
+
+#include <string>
+#include <map>
+
+namespace arm {
+namespace app {
+
+ class IAttribute
+ {
+ public:
+ virtual ~IAttribute() = default;
+ };
+
+ template<typename T>
+ class Attribute : public IAttribute
+ {
+ public:
+ ~Attribute() override = default;
+
+ explicit Attribute(const T value): _m_value(value){}
+
+ T Get()
+ {
+ return _m_value;
+ }
+ private:
+ T _m_value;
+ };
+
+ /* Application context class */
+ class ApplicationContext {
+ public:
+
+ /**
+ * @brief Saves given value as a named attribute in the context.
+ * @tparam T value type.
+ * @param[in] name Context attribute name.
+ * @param[in] object Value to save in the context.
+ */
+ template<typename T>
+ void Set(const std::string &name, T object)
+ {
+ this->_m_attributes[name] = new Attribute<T>(object);
+ }
+
+ /**
+ * @brief Gets the saved attribute from the context by the given name.
+ * @tparam T value type.
+ * @param[in] name Context attribute name.
+ * @return Value saved in the context.
+ */
+ template<typename T>
+ T Get(const std::string &name)
+ {
+ auto a = (Attribute<T>*)_m_attributes[name];
+ return a->Get();
+ }
+
+ /**
+ * @brief Checks if an attribute for a given name exists in the context.
+ * @param[in] name Attribute name.
+ * @return true if attribute exists, false otherwise
+ */
+ bool Has(const std::string& name)
+ {
+ return _m_attributes.find(name) != _m_attributes.end();
+ }
+
+ ApplicationContext() = default;
+
+ ~ApplicationContext() {
+ for (auto& attribute : _m_attributes)
+ delete attribute.second;
+
+ this->_m_attributes.clear();
+ }
+ private:
+ std::map<std::string, IAttribute*> _m_attributes;
+ };
+
+} /* namespace app */
+} /* namespace arm */
+
+#endif /* APP_CTX_HPP */
diff --git a/source/application/main/include/AudioUtils.hpp b/source/application/main/include/AudioUtils.hpp
new file mode 100644
index 0000000..cba981d
--- /dev/null
+++ b/source/application/main/include/AudioUtils.hpp
@@ -0,0 +1,171 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef AUDIO_UTILS_HPP
+#define AUDIO_UTILS_HPP
+
+#include <cstddef>
+#include <cstdint>
+
+namespace arm {
+namespace app {
+namespace audio {
+
+ template<class T>
+ class SlidingWindow {
+ public:
+
+ /**
+ * @brief Creates the window slider through the given data.
+ *
+ * @param[in] data Pointer to the data to slide through.
+ * @param[in] dataSize Size in T type elements wise.
+ * @param[in] windowSize Sliding window size in T type wise elements.
+ * @param[in] stride Stride size in T type wise elements.
+ */
+ SlidingWindow(T *data, size_t dataSize,
+ size_t windowSize, size_t stride) {
+ m_start = data;
+ m_dataSize = dataSize;
+ m_size = windowSize;
+ m_stride = stride;
+ }
+
+ SlidingWindow() = default;
+
+ ~SlidingWindow() = default;
+
+ /**
+ * @brief Get the next data window.
+ * @return Pointer to the next window, if next window is not available nullptr is returned.
+ */
+ virtual T *Next() {
+ if (HasNext()) {
+ m_count++;
+ return m_start + Index() * m_stride;
+ } else {
+ return nullptr;
+ }
+ }
+
+ /**
+ * @brief Checks if the next data portion is available.
+ * @return true if next data portion is available.
+ */
+ virtual bool HasNext() {
+ return m_size + m_count * m_stride <= m_dataSize;
+ }
+
+ /**
+ * @brief Reset the slider to the initial position.
+ */
+ virtual void Reset() {
+ m_count = 0;
+ }
+
+ /**
+ * @brief Resets the slider to the start of the new data.
+ * New data size MUST be the same as the old one.
+ * @param[in] newStart Pointer to the new data to slide through.
+ */
+ virtual void Reset(T *newStart) {
+ m_start = newStart;
+ Reset();
+ }
+
+ /**
+ * @brief Gets current index of the sliding window.
+ * @return Current position of the sliding window in number of strides.
+ */
+ size_t Index() {
+ return m_count == 0? 0: m_count - 1;
+ }
+
+ /**
+ * @brief Gets the index from the start of the data where the next window will begin.
+ * While Index() returns the index of sliding window itself this function
+ * returns the index of the data element itself.
+ * @return Index from the start of the data where the next sliding window will begin.
+ */
+ virtual uint32_t NextWindowStartIndex() {
+ return m_count == 0? 0: ((m_count) * m_stride);
+ }
+
+ /**
+ * @brief Go to given sliding window index.
+ * @param[in] index New position of the sliding window. If index is invalid
+ * (greater than possible range of strides) then next call to Next() will return nullptr.
+ */
+ void FastForward(size_t index) {
+ m_count = index;
+ }
+
+ /**
+ * @brief Calculates whole number of times the window can stride through the given data.
+ * @return Maximum number of whole strides.
+ */
+ size_t TotalStrides() {
+ if (m_size > m_dataSize) {
+ return 0;
+ }
+ return ((m_dataSize - m_size)/m_stride);
+ }
+
+ /**
+ * @brief Calculates number of times the window can stride through the given data.
+ * May not be a whole number.
+ * @return Number of strides to cover all data.
+ */
+ float FractionalTotalStrides() {
+ if (this->m_dataSize < this->m_size) {
+ return 0;
+ } else {
+ return ((this->m_dataSize - this->m_size)/ static_cast<float>(this->m_stride));
+ }
+ }
+
+ protected:
+ T *m_start = nullptr;
+ size_t m_dataSize = 0;
+ size_t m_size = 0;
+ size_t m_stride = 0;
+ size_t m_count = 0;
+ };
+
+ /*
+ * Sliding window for ASR will cover the whole of the input, even if
+ * this means the last window is not a full window length.
+ */
+ template<class T>
+ class ASRSlidingWindow : public SlidingWindow<T> {
+ public:
+ using SlidingWindow<T>::SlidingWindow;
+
+ /**
+ * @brief Checks if the next data portion is available.
+ * @return true if next data portion is available.
+ */
+ bool HasNext() {
+ return this->m_count < 1 + this->FractionalTotalStrides() && (this->NextWindowStartIndex() < this->m_dataSize);
+ }
+ };
+
+
+} /* namespace audio */
+} /* namespace app */
+} /* namespace arm */
+
+#endif /* AUDIO_UTILS_HPP */
\ No newline at end of file
diff --git a/source/application/main/include/ClassificationResult.hpp b/source/application/main/include/ClassificationResult.hpp
new file mode 100644
index 0000000..eae28e4
--- /dev/null
+++ b/source/application/main/include/ClassificationResult.hpp
@@ -0,0 +1,41 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef CLASSIFICATION_RESULT_HPP
+#define CLASSIFICATION_RESULT_HPP
+
+#include <string>
+
+namespace arm {
+namespace app {
+
+ /**
+ * @brief Class representing a single classification result.
+ */
+ class ClassificationResult {
+ public:
+ double m_normalisedVal = 0.0;
+ std::string m_label;
+ uint32_t m_labelIdx = 0;
+
+ ClassificationResult() = default;
+ ~ClassificationResult() = default;
+ };
+
+} /* namespace app */
+} /* namespace arm */
+
+#endif /* CLASSIFICATION_RESULT_HPP */
\ No newline at end of file
diff --git a/source/application/main/include/Classifier.hpp b/source/application/main/include/Classifier.hpp
new file mode 100644
index 0000000..510e6f9
--- /dev/null
+++ b/source/application/main/include/Classifier.hpp
@@ -0,0 +1,74 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef CLASSIFIER_HPP
+#define CLASSIFIER_HPP
+
+#include "ClassificationResult.hpp"
+#include "TensorFlowLiteMicro.hpp"
+
+#include <vector>
+
+namespace arm {
+namespace app {
+
+ /**
+ * @brief Classifier - a helper class to get certain number of top
+ * results from the output vector from a classification NN.
+ **/
+ class Classifier{
+ public:
+ /** @brief Constructor. */
+ Classifier() = default;
+
+ /**
+ * @brief Gets the top N classification results from the
+ * output vector.
+ * @param[in] outputTensor Inference output tensor from an NN model.
+ * @param[out] vecResults A vector of classification results.
+ * populated by this function.
+ * @param[in] labels Labels vector to match classified classes.
+ * @param[in] topNCount Number of top classifications to pick. Default is 1.
+ * @return true if successful, false otherwise.
+ **/
+ virtual bool GetClassificationResults(
+ TfLiteTensor* outputTensor,
+ std::vector<ClassificationResult>& vecResults,
+ const std::vector <std::string>& labels, uint32_t topNCount);
+
+ private:
+ /**
+ * @brief Utility function that gets the top N classification results from the
+ * output vector.
+ * @tparam T value type
+ * @param[in] tensor Inference output tensor from an NN model.
+ * @param[out] vecResults A vector of classification results
+ * populated by this function.
+ * @param[in] topNCount Number of top classifications to pick.
+ * @param[in] labels Labels vector to match classified classes.
+ * @return true if successful, false otherwise.
+ **/
+ template<typename T>
+ bool _GetTopNResults(TfLiteTensor* tensor,
+ std::vector<ClassificationResult>& vecResults,
+ uint32_t topNCount,
+ const std::vector <std::string>& labels);
+ };
+
+} /* namespace app */
+} /* namespace arm */
+
+#endif /* CLASSIFIER_HPP */
diff --git a/source/application/main/include/DataStructures.hpp b/source/application/main/include/DataStructures.hpp
new file mode 100644
index 0000000..5cc8b5e
--- /dev/null
+++ b/source/application/main/include/DataStructures.hpp
@@ -0,0 +1,132 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef DATA_STRUCTURES_HPP
+#define DATA_STRUCTURES_HPP
+
+#include "hal.h"
+
+#include <iterator>
+
+namespace arm {
+namespace app {
+
+ /**
+ * Class Array2d is a data structure that represents a two dimensional array.
+ * The data is allocated in contiguous memory, arranged row-wise
+ * and individual elements can be accessed with the () operator.
+ * For example a two dimensional array D of size (M, N) can be accessed:
+ *
+ * _|<------------- col size = N -------->|
+ * | D(r=0, c=0) D(r=0, c=1)... D(r=0, c=N)
+ * | D(r=1, c=0) D(r=1, c=1)... D(r=1, c=N)
+ * | ...
+ * row size = M ...
+ * | ...
+ * _ D(r=M, c=0) D(r=M, c=1)... D(r=M, c=N)
+ *
+ */
+ template<typename T>
+ class Array2d {
+ public:
+ /**
+ * @brief Creates the array2d with the given sizes.
+ * @param[in] rows Number of rows.
+ * @param[in] cols Number of columns.
+ */
+ Array2d(unsigned rows, unsigned cols)
+ {
+ if (rows == 0 || cols == 0) {
+ printf_err("Array2d constructor has 0 size.\n");
+ _m_data = nullptr;
+ return;
+ }
+ _m_rows = rows;
+ _m_cols = cols;
+ _m_data = new T[rows * cols];
+ }
+
+ ~Array2d()
+ {
+ delete[] _m_data;
+ }
+
+ T& operator() (unsigned int row, unsigned int col)
+ {
+#if defined(DEBUG)
+ if (row >= _m_rows || col >= _m_cols || _m_data == nullptr) {
+ printf_err("Array2d subscript out of bounds.\n");
+ }
+#endif /* defined(DEBUG) */
+ return _m_data[_m_cols * row + col];
+ }
+
+ T operator() (unsigned int row, unsigned int col) const
+ {
+#if defined(DEBUG)
+ if (row >= _m_rows || col >= _m_cols || _m_data == nullptr) {
+ printf_err("const Array2d subscript out of bounds.\n");
+ }
+#endif /* defined(DEBUG) */
+ return _m_data[_m_cols * row + col];
+ }
+
+ /**
+ * @brief Gets rows number of the current array2d.
+ * @return Number of rows.
+ */
+ size_t size(size_t dim)
+ {
+ switch (dim)
+ {
+ case 0:
+ return _m_rows;
+ case 1:
+ return _m_cols;
+ default:
+ return 0;
+ }
+ }
+
+ /**
+ * @brief Gets the array2d total size.
+ */
+ size_t totalSize()
+ {
+ return _m_rows * _m_cols;
+ }
+
+ /**
+ * array2d iterator.
+ */
+ using iterator=T*;
+ using const_iterator=T const*;
+
+ iterator begin() { return _m_data; }
+ iterator end() { return _m_data + totalSize(); }
+ const_iterator begin() const { return _m_data; }
+ const_iterator end() const { return _m_data + totalSize(); };
+
+ private:
+ size_t _m_rows;
+ size_t _m_cols;
+ T* _m_data;
+ };
+
+} /* namespace app */
+} /* namespace arm */
+
+#endif /* DATA_STRUCTURES_HPP */
\ No newline at end of file
diff --git a/source/application/main/include/Mfcc.hpp b/source/application/main/include/Mfcc.hpp
new file mode 100644
index 0000000..6379fab
--- /dev/null
+++ b/source/application/main/include/Mfcc.hpp
@@ -0,0 +1,255 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef MFCC_HPP
+#define MFCC_HPP
+
+#include "PlatformMath.hpp"
+
+#include <vector>
+#include <cstdint>
+#include <cmath>
+#include <limits>
+#include <string>
+
+namespace arm {
+namespace app {
+namespace audio {
+
+ /* MFCC's consolidated parameters. */
+ class MfccParams {
+ public:
+ float m_samplingFreq;
+ uint32_t m_numFbankBins;
+ float m_melLoFreq;
+ float m_melHiFreq;
+ uint32_t m_numMfccFeatures;
+ uint32_t m_frameLen;
+ uint32_t m_frameLenPadded;
+ bool m_useHtkMethod;
+
+ /** @brief Constructor */
+ MfccParams(float samplingFreq, uint32_t numFbankBins,
+ float melLoFreq, float melHiFreq,
+ uint32_t numMfccFeats, uint32_t frameLen,
+ bool useHtkMethod);
+
+ MfccParams() = delete;
+
+ ~MfccParams() = default;
+
+ /** @brief String representation of parameters */
+ std::string Str();
+ };
+
+ /**
+ * @brief Class for MFCC feature extraction.
+ * Based on https://github.com/ARM-software/ML-KWS-for-MCU/blob/master/Deployment/Source/MFCC/mfcc.cpp
+ * This class is designed to be generic and self-sufficient but
+ * certain calculation routines can be overridden to accommodate
+ * use-case specific requirements.
+ */
+ class MFCC {
+ public:
+ /**
+ * @brief Constructor
+ * @param[in] params MFCC parameters
+ */
+ explicit MFCC(const MfccParams& params);
+
+ MFCC() = delete;
+
+ ~MFCC() = default;
+
+ /**
+ * @brief Extract MFCC features for one single small frame of
+ * audio data e.g. 640 samples.
+ * @param[in] audioData Vector of audio samples to calculate
+ * features for.
+ * @return Vector of extracted MFCC features.
+ **/
+ std::vector<float> MfccCompute(const std::vector<int16_t>& audioData);
+
+ /** @brief Initialise. */
+ void Init();
+
+ /**
+ * @brief Extract MFCC features and quantise for one single small
+ * frame of audio data e.g. 640 samples.
+ * @param[in] audioData Vector of audio samples to calculate
+ * features for.
+ * @param[in] quantScale Quantisation scale.
+ * @param[in] quantOffset Quantisation offset.
+ * @return Vector of extracted quantised MFCC features.
+ **/
+ template<typename T>
+ std::vector<T> MfccComputeQuant(const std::vector<int16_t>& audioData,
+ const float quantScale,
+ const int quantOffset)
+ {
+ this->_MfccComputePreFeature(audioData);
+ float minVal = std::numeric_limits<T>::min();
+ float maxVal = std::numeric_limits<T>::max();
+
+ std::vector<T> mfccOut(this->_m_params.m_numMfccFeatures);
+ const size_t numFbankBins = this->_m_params.m_numFbankBins;
+
+ /* Take DCT. Uses matrix mul. */
+ for (size_t i = 0, j = 0; i < mfccOut.size(); ++i, j += numFbankBins) {
+ float sum = 0;
+ for (size_t k = 0; k < numFbankBins; ++k) {
+ sum += this->_m_dctMatrix[j + k] * this->_m_melEnergies[k];
+ }
+ /* Quantize to T. */
+ sum = std::round((sum / quantScale) + quantOffset);
+ mfccOut[i] = static_cast<T>(std::min<float>(std::max<float>(sum, minVal), maxVal));
+ }
+
+ return mfccOut;
+ }
+
+ /* Constants */
+ static constexpr float ms_logStep = /*logf(6.4)*/ 1.8562979903656 / 27.0;
+ static constexpr float ms_freqStep = 200.0 / 3;
+ static constexpr float ms_minLogHz = 1000.0;
+ static constexpr float ms_minLogMel = ms_minLogHz / ms_freqStep;
+
+ protected:
+ /**
+ * @brief Project input frequency to Mel Scale.
+ * @param[in] freq Input frequency in floating point.
+ * @param[in] useHTKmethod bool to signal if HTK method is to be
+ * used for calculation.
+ * @return Mel transformed frequency in floating point.
+ **/
+ static float MelScale(float freq,
+ bool useHTKMethod = true);
+
+ /**
+ * @brief Inverse Mel transform - convert MEL warped frequency
+ * back to normal frequency.
+ * @param[in] freq Mel frequency in floating point.
+ * @param[in] useHTKmethod bool to signal if HTK method is to be
+ * used for calculation.
+ * @return Real world frequency in floating point.
+ **/
+ static float InverseMelScale(float melFreq,
+ bool useHTKMethod = true);
+
+ /**
+ * @brief Populates MEL energies after applying the MEL filter
+ * bank weights and adding them up to be placed into
+ * bins, according to the filter bank's first and last
+ * indices (pre-computed for each filter bank element
+ * by _CreateMelFilterBank function).
+ * @param[in] fftVec Vector populated with FFT magnitudes.
+ * @param[in] melFilterBank 2D Vector with filter bank weights.
+ * @param[in] filterBankFilterFirst Vector containing the first indices of filter bank
+ * to be used for each bin.
+ * @param[in] filterBankFilterLast Vector containing the last indices of filter bank
+ * to be used for each bin.
+ * @param[out] melEnergies Pre-allocated vector of MEL energies to be
+ * populated.
+ * @return true if successful, false otherwise.
+ */
+ virtual bool ApplyMelFilterBank(
+ std::vector<float>& fftVec,
+ std::vector<std::vector<float>>& melFilterBank,
+ std::vector<int32_t>& filterBankFilterFirst,
+ std::vector<int32_t>& filterBankFilterLast,
+ std::vector<float>& melEnergies);
+
+ /**
+ * @brief Converts the Mel energies for logarithmic scale.
+ * @param[in,out] melEnergies 1D vector of Mel energies.
+ **/
+ virtual void ConvertToLogarithmicScale(std::vector<float>& melEnergies);
+
+ /**
+ * @brief Create a matrix used to calculate Discrete Cosine
+ * Transform.
+ * @param[in] inputLength Input length of the buffer on which
+ * DCT will be performed.
+ * @param[in] coefficientCount Total coefficients per input length.
+ * @return 1D vector with inputLength x coefficientCount elements
+ * populated with DCT coefficients.
+ */
+ virtual std::vector<float> CreateDCTMatrix(
+ int32_t inputLength,
+ int32_t coefficientCount);
+
+ /**
+ * @brief Given the low and high Mel values, get the normaliser
+ * for weights to be applied when populating the filter
+ * bank.
+ * @param[in] leftMel Low Mel frequency value.
+ * @param[in] rightMel High Mel frequency value.
+ * @param[in] useHTKMethod bool to signal if HTK method is to be
+ * used for calculation.
+ * @return Value to use for normalizing.
+ */
+ virtual float GetMelFilterBankNormaliser(
+ const float& leftMel,
+ const float& rightMel,
+ bool useHTKMethod);
+
+ private:
+ MfccParams _m_params;
+ std::vector<float> _m_frame;
+ std::vector<float> _m_buffer;
+ std::vector<float> _m_melEnergies;
+ std::vector<float> _m_windowFunc;
+ std::vector<std::vector<float>> _m_melFilterBank;
+ std::vector<float> _m_dctMatrix;
+ std::vector<int32_t> _m_filterBankFilterFirst;
+ std::vector<int32_t> _m_filterBankFilterLast;
+ bool _m_filterBankInitialised;
+ arm::app::math::FftInstance _m_fftInstance;
+
+ /**
+ * @brief Initialises the filter banks and the DCT matrix. **/
+ void _InitMelFilterBank();
+
+ /**
+ * @brief Signals whether the instance of MFCC has had its
+ * required buffers initialised.
+ * @return true if initialised, false otherwise.
+ **/
+ bool _IsMelFilterBankInited();
+
+ /**
+ * @brief Create mel filter banks for MFCC calculation.
+ * @return 2D vector of floats.
+ **/
+ std::vector<std::vector<float>> _CreateMelFilterBank();
+
+ /**
+ * @brief Computes and populates internal memeber buffers used
+ * in MFCC feature calculation
+ * @param[in] audioData 1D vector of 16-bit audio data.
+ */
+ void _MfccComputePreFeature(const std::vector<int16_t>& audioData);
+
+ /** @brief Computes the magnitude from an interleaved complex array. */
+ void _ConvertToPowerSpectrum();
+
+ };
+
+} /* namespace audio */
+} /* namespace app */
+} /* namespace arm */
+
+#endif /* MFCC_HPP */
\ No newline at end of file
diff --git a/source/application/main/include/PlatformMath.hpp b/source/application/main/include/PlatformMath.hpp
new file mode 100644
index 0000000..45e6a9e
--- /dev/null
+++ b/source/application/main/include/PlatformMath.hpp
@@ -0,0 +1,151 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef PLATFORM_MATH_HPP
+#define PLATFORM_MATH_HPP
+
+#include "hal.h"
+
+/* See if ARM DSP functions can be used. */
+#if PLATFORM_HAL == PLATFORM_CORTEX_M_BAREMETAL
+ #if defined(__DSP_PRESENT) && (__DSP_PRESENT == 1U)
+
+ #define ARM_DSP_AVAILABLE (1U)
+ #include "arm_math.h"
+ #define M_PI (PI)
+
+ #endif /* defined(__DSP_PRESENT) && (__DSP_PRESENT == 1U) */
+#endif /* PLATFORM_HAL == PLATFORM_CORTEX_M_BAREMETAL */
+
+#include <vector>
+
+namespace arm {
+namespace app {
+namespace math {
+
+ struct FftInstance {
+#if ARM_DSP_AVAILABLE
+ arm_rfft_fast_instance_f32 instance;
+#endif
+ bool initialised = false;
+ };
+
+ /* Class to provide Math functions like FFT, mean, stddev etc.
+ * This will allow other classes, functions to be independent of
+ * #if definition checks and provide a cleaner API. Also, it will
+ * consolidate all arm math functions used in one place and make
+ * them easier to test. */
+ class MathUtils {
+
+ public:
+ /**
+ * @brief Get the cosine value of the argument in floating point.
+ * @param[in] radians Angle in radians.
+ * @return Cosine value (floating point).
+ */
+ static float CosineF32(float radians);
+
+ /**
+ * @brief Get the square root of the argument in floating point.
+ * @param[in] input Value to compute square root of.
+ * @return Square root (floating point) value.
+ */
+ static float SqrtF32(float input);
+
+ /**
+ * @brief Gets the mean of a floating point array of elements.
+ * @param[in] ptrSrc Pointer to the first element.
+ * @param[in] srcLen Number of elements in the array/vector.
+ * @return Average value.
+ */
+ static float MeanF32(float* ptrSrc, uint32_t srcLen);
+
+ /**
+ * @brief Gets the standard deviation of a floating point array
+ * of elements.
+ * @param[in] ptrSrc Pointer to the first element.
+ * @param[in] srcLen Number of elements in the array/vector.
+ * @param[in] mean Pre-computed mean value.
+ * @return Standard deviation value.
+ */
+ static float StdDevF32(float* ptrSrc, uint32_t srcLen,
+ float mean);
+
+ /**
+ * @brief Initialises the internal FFT structures (if available
+ * for the platform). This function should be called
+ * prior to Fft32 function call if built with ARM DSP functions.
+ * @param[in] fftLen Requested length of the FFT.
+ * @param[in] fftInstance FFT instance struct to use.
+ * @return true if successful, false otherwise.
+ */
+ static bool FftInitF32(const uint16_t fftLen, arm::app::math::FftInstance& fftInstance);
+
+ /**
+ * @brief Computes the FFT for the input vector.
+ * @param[in] input Floating point vector of input elements
+ * @param[out] fftOutput Output buffer to be populated by computed FFTs.
+ * @param[in] fftInstance FFT instance struct to use.
+ */
+ static void FftF32(std::vector<float>& input,
+ std::vector<float>& fftOutput,
+ arm::app::math::FftInstance& fftInstance);
+
+ /**
+ * @brief Computes the natural logarithms of input floating point
+ * vector
+ * @param[in] input Floating point input vector
+ * @param[out] output Pre-allocated buffer to be populated with
+ * natural log values of each input element.
+ */
+ static void VecLogarithmF32(std::vector <float>& input,
+ std::vector <float>& output);
+
+ /**
+ * @brief Computes the dot product of two 1D floating point
+ * vectors.
+ * result = sum(srcA[0]*srcB[0] + srcA[1]*srcB[1] + ..)
+ * @param[in] srcPtrA Pointer to the first element of first
+ * array.
+ * @param[in] srcPtrB Pointer to the first element of second
+ * array.
+ * @param[in] srcLen Number of elements in the array/vector.
+ * @return Dot product.
+ */
+ static float DotProductF32(float* srcPtrA, float* srcPtrB,
+ const uint32_t srcLen);
+
+ /**
+ * @brief Computes the squared magnitude of floating point
+ * complex number array.
+ * @param[in] ptrSrc Pointer to the first element of input
+ * array.
+ * @param[in] srcLen Number of elements in the array/vector.
+ * @param[out] ptrDst Output buffer to be populated.
+ * @param[in] dstLen Output buffer len (for sanity check only).
+ * @return true if successful, false otherwise.
+ */
+ static bool ComplexMagnitudeSquaredF32(float* ptrSrc,
+ const uint32_t srcLen,
+ float* ptrDst,
+ const uint32_t dstLen);
+
+ };
+} /* namespace math */
+} /* namespace app */
+} /* namespace arm */
+
+#endif /* PLATFORM_MATH_HPP */
\ No newline at end of file
diff --git a/source/application/main/include/Profiler.hpp b/source/application/main/include/Profiler.hpp
new file mode 100644
index 0000000..b16a63b
--- /dev/null
+++ b/source/application/main/include/Profiler.hpp
@@ -0,0 +1,110 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef APP_PROFILER_HPP
+#define APP_PROFILER_HPP
+
+#include "hal.h"
+
+#include <string>
+#include <map>
+#include <vector>
+
+namespace arm {
+namespace app {
+
+ /** A single profiling unit definition. */
+ struct ProfilingUnit {
+ uint64_t npuCycles = 0;
+ uint64_t activeNpuCycles = 0;
+ uint64_t cpuCycles = 0;
+ time_t time = 0;
+ };
+
+ /* A collection of profiling units. */
+ using ProfilingSeries = std::vector<arm::app::ProfilingUnit>;
+
+ /* A map for string identifiable profiling series. */
+ using ProfilingMap = std::map<std::string, ProfilingSeries>;
+
+ /**
+ * @brief A very simple profiler example using the platform timer
+ * implementation.
+ */
+ class Profiler {
+ public:
+ /**
+ * @brief Constructor for profiler.
+ * @param[in] platform Pointer to a valid, initialised hal platform.
+ * @param[in] name A friendly name for this profiler.
+ **/
+ Profiler(hal_platform* platform, const char* name);
+
+ /** Block the default constructor. */
+ Profiler() = delete;
+
+ /** Default destructor. */
+ ~Profiler() = default;
+
+ /** @brief Start profiling => get starting time-stamp. */
+ bool StartProfiling(const char* name = nullptr);
+
+ /** @brief Stop profiling => get the ending time-stamp. */
+ bool StopProfiling();
+
+ /** @brief Stops the profiling and internally resets the
+ * platform timers. */
+ bool StopProfilingAndReset();
+
+ /** @brief Reset the platform timers. */
+ void Reset();
+
+ /**
+ * @brief Gets the results as string and resets the profiler.
+ * @returns Result string.
+ **/
+ std::string GetResultsAndReset();
+
+ /** @brief Set the profiler name. */
+ void SetName(const char* str);
+
+ private:
+ ProfilingMap _m_series; /* Profiling series map. */
+ time_counter _m_tstampSt; /* Container for a current starting timestamp. */
+ time_counter _m_tstampEnd; /* Container for a current ending timestamp. */
+ hal_platform * _m_pPlatform = nullptr; /* Platform pointer - to get the timer. */
+
+ bool _m_started = false; /* Indicates profiler has been started. */
+
+ std::string _m_name; /* Name given to this profiler. */
+
+ /**
+ * @brief Appends the profiling unit computed by the "start" and
+ * "end" timestamps to the profiling series identified by
+ * the name provided.
+ * @param[in] start Starting time-stamp.
+ * @param[in] end Ending time-stamp.
+ * @param[in] name Name for the profiling unit series to be
+ * appended to.
+ **/
+ void _AddProfilingUnit(time_counter start, time_counter end,
+ const std::string& name);
+ };
+
+} /* namespace app */
+} /* namespace arm */
+
+#endif /* APP_PROFILER_HPP */
diff --git a/source/application/main/include/UseCaseCommonUtils.hpp b/source/application/main/include/UseCaseCommonUtils.hpp
new file mode 100644
index 0000000..02200e8
--- /dev/null
+++ b/source/application/main/include/UseCaseCommonUtils.hpp
@@ -0,0 +1,76 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef USECASE_COMMON_UTILS_HPP
+#define USECASE_COMMON_UTILS_HPP
+
+#include "hal.h"
+#include "Model.hpp"
+#include "AppContext.hpp"
+#include "Profiler.hpp"
+
+/* Helper macro to convert RGB888 to RGB565 format. */
+#define RGB888_TO_RGB565(R8,G8,B8) ((((R8>>3) & 0x1F) << 11) | \
+ (((G8>>2) & 0x3F) << 5) | \
+ ((B8>>3) & 0x1F))
+
+constexpr uint16_t COLOR_BLACK = 0;
+constexpr uint16_t COLOR_GREEN = RGB888_TO_RGB565( 0, 255, 0); // 2016;
+constexpr uint16_t COLOR_YELLOW = RGB888_TO_RGB565(255, 255, 0); // 65504;
+
+namespace arm {
+namespace app {
+
+ /**
+ * @brief Run inference using given model
+ * object. If profiling is enabled, it will log the
+ * statistics too.
+ * @param[in] platform Reference to the hal platform object.
+ * @param[in] model Reference to the initialised model.
+ * @return true if inference succeeds, false otherwise.
+ **/
+ bool RunInference(hal_platform& platform, arm::app::Model& model);
+
+ /**
+ * @brief Read input and return as an integer.
+ * @param[in] platform Reference to the hal platform object.
+ * @param[in] model Reference to the initialised model.
+ * @return Integer value corresponding to the user input.
+ **/
+ int ReadUserInputAsInt(hal_platform& platform);
+
+#if VERIFY_TEST_OUTPUT
+ /**
+ * @brief Helper function to dump a tensor to stdout
+ * @param[in] tensor tensor to be dumped
+ * @param[in] lineBreakForNumElements number of elements
+ * after which line break will be added.
+ **/
+ void DumpTensor(TfLiteTensor* tensor,
+ const size_t lineBreakForNumElements = 16);
+#endif /* VERIFY_TEST_OUTPUT */
+
+ /**
+ * @brief List the files baked in the application.
+ * @param[in] ctx Reference to the application context.
+ * @return true or false based on event being handled.
+ **/
+ bool ListFilesHandler(ApplicationContext& ctx);
+
+} /* namespace app */
+} /* namespace arm */
+
+#endif /* USECASE_COMMON_UTILS_HPP */
\ No newline at end of file
diff --git a/source/application/tensorflow-lite-micro/Model.cc b/source/application/tensorflow-lite-micro/Model.cc
new file mode 100644
index 0000000..0775467
--- /dev/null
+++ b/source/application/tensorflow-lite-micro/Model.cc
@@ -0,0 +1,332 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "Model.hpp"
+
+#include "hal.h"
+
+#include <cstdint>
+
+/* Initialise the model */
+arm::app::Model::~Model()
+{
+ if (this->_m_pInterpreter) {
+ delete this->_m_pInterpreter;
+ }
+
+ /**
+ * No clean-up function available for allocator in TensorFlow Lite Micro yet.
+ **/
+}
+
+arm::app::Model::Model() :
+ _m_inited (false),
+ _m_type(kTfLiteNoType)
+{
+ this->_m_pErrorReporter = &this->_m_uErrorReporter;
+}
+
+bool arm::app::Model::Init(tflite::MicroAllocator* allocator)
+{
+ /* Following tf lite micro example:
+ * Map the model into a usable data structure. This doesn't involve any
+ * copying or parsing, it's a very lightweight operation. */
+ const uint8_t* model_addr = ModelPointer();
+ debug("loading model from @ 0x%p\n", model_addr);
+ this->_m_pModel = ::tflite::GetModel(model_addr);
+
+ if (this->_m_pModel->version() != TFLITE_SCHEMA_VERSION) {
+ this->_m_pErrorReporter->Report(
+ "[ERROR] model's schema version %d is not equal "
+ "to supported version %d.",
+ this->_m_pModel->version(), TFLITE_SCHEMA_VERSION);
+ return false;
+ }
+
+ /* Pull in only the operation implementations we need.
+ * This relies on a complete list of all the ops needed by this graph.
+ * An easier approach is to just use the AllOpsResolver, but this will
+ * incur some penalty in code space for op implementations that are not
+ * needed by this graph.
+ * static ::tflite::ops::micro::AllOpsResolver resolver; */
+ /* NOLINTNEXTLINE(runtime-global-variables) */
+ debug("loading op resolver\n");
+
+ this->EnlistOperations();
+
+ /* Create allocator instance, if it doesn't exist */
+ this->_m_pAllocator = allocator;
+ if (!this->_m_pAllocator) {
+ /* Create an allocator instance */
+ info("Creating allocator using tensor arena in %s\n",
+ ACTIVATION_BUF_SECTION_NAME);
+
+ this->_m_pAllocator = tflite::MicroAllocator::Create(
+ this->GetTensorArena(),
+ this->GetActivationBufferSize(),
+ this->_m_pErrorReporter);
+
+ if (!this->_m_pAllocator) {
+ printf_err("Failed to create allocator\n");
+ return false;
+ }
+ debug("Created new allocator @ 0x%p\n", this->_m_pAllocator);
+ } else {
+ debug("Using existing allocator @ 0x%p\n", this->_m_pAllocator);
+ }
+
+ this->_m_pInterpreter = new ::tflite::MicroInterpreter(
+ this->_m_pModel, this->GetOpResolver(),
+ this->_m_pAllocator, this->_m_pErrorReporter);
+
+ if (!this->_m_pInterpreter) {
+ printf_err("Failed to allocate interpreter\n");
+ return false;
+ }
+
+ /* Allocate memory from the tensor_arena for the model's tensors. */
+ info("Allocating tensors\n");
+ TfLiteStatus allocate_status = this->_m_pInterpreter->AllocateTensors();
+
+ if (allocate_status != kTfLiteOk) {
+ this->_m_pErrorReporter->Report("[ERROR] allocateTensors() failed");
+ printf_err("tensor allocation failed!\n");
+ delete this->_m_pInterpreter;
+ return false;
+ }
+
+ /* Get information about the memory area to use for the model's input. */
+ this->_m_input.resize(this->GetNumInputs());
+ for (size_t inIndex = 0; inIndex < this->GetNumInputs(); inIndex++)
+ this->_m_input[inIndex] = this->_m_pInterpreter->input(inIndex);
+
+ this->_m_output.resize(this->GetNumOutputs());
+ for (size_t outIndex = 0; outIndex < this->GetNumOutputs(); outIndex++)
+ this->_m_output[outIndex] = this->_m_pInterpreter->output(outIndex);
+
+ if (this->_m_input.empty() || this->_m_output.empty()) {
+ printf_err("failed to get tensors\n");
+ return false;
+ } else {
+ this->_m_type = this->_m_input[0]->type; /* Input 0 should be the main input */
+
+ /* Clear the input & output tensors */
+ for (size_t inIndex = 0; inIndex < this->GetNumInputs(); inIndex++) {
+ std::memset(this->_m_input[inIndex]->data.data, 0, this->_m_input[inIndex]->bytes);
+ }
+ for (size_t outIndex = 0; outIndex < this->GetNumOutputs(); outIndex++) {
+ std::memset(this->_m_output[outIndex]->data.data, 0, this->_m_output[outIndex]->bytes);
+ }
+
+ this->LogInterpreterInfo();
+ }
+
+ this->_m_inited = true;
+ return true;
+}
+
+tflite::MicroAllocator* arm::app::Model::GetAllocator()
+{
+ if (this->IsInited()) {
+ return this->_m_pAllocator;
+ }
+ return nullptr;
+}
+
+void arm::app::Model::LogTensorInfo(TfLiteTensor* tensor)
+{
+ if (!tensor) {
+ printf_err("Invalid tensor\n");
+ assert(tensor);
+ return;
+ }
+
+ debug("\ttensor is assigned to 0x%p\n", tensor);
+ info("\ttensor type is %s\n", TfLiteTypeGetName(tensor->type));
+ info("\ttensor occupies %u bytes with dimensions\n",
+ (uint32_t)tensor->bytes);
+ for (int i = 0 ; i < tensor->dims->size; ++i) {
+ info ("\t\t%d: %3d\n", i, tensor->dims->data[i]);
+ }
+
+ TfLiteQuantization quant = tensor->quantization;
+ if (kTfLiteAffineQuantization == quant.type) {
+ auto* quantParams = (TfLiteAffineQuantization*)quant.params;
+ info("Quant dimension: %u\n", quantParams->quantized_dimension);
+ for (int i = 0; i < quantParams->scale->size; ++i) {
+ info("Scale[%d] = %f\n", i, quantParams->scale->data[i]);
+ }
+ for (int i = 0; i < quantParams->zero_point->size; ++i) {
+ info("ZeroPoint[%d] = %d\n", i, quantParams->zero_point->data[i]);
+ }
+ }
+}
+
+void arm::app::Model::LogInterpreterInfo()
+{
+ if (!this->_m_pInterpreter) {
+ printf_err("Invalid interpreter\n");
+ return;
+ }
+
+ info("Model INPUT tensors: \n");
+ for (auto input : this->_m_input) {
+ this->LogTensorInfo(input);
+ }
+
+ info("Model OUTPUT tensors: \n");
+ for (auto output : this->_m_output) {
+ this->LogTensorInfo(output);
+ }
+
+ info("Activation buffer (a.k.a tensor arena) size used: %zu\n",
+ this->_m_pInterpreter->arena_used_bytes());
+
+ const uint32_t nOperators = this->_m_pInterpreter->operators_size();
+ info("Number of operators: %u\n", nOperators);
+
+ /* For each operator, display registration information */
+ for (uint32_t i = 0 ; i < nOperators; ++i) {
+ const tflite::NodeAndRegistration nodeReg =
+ this->_m_pInterpreter->node_and_registration(i);
+ const TfLiteRegistration* reg = nodeReg.registration;
+ std::string opName{""};
+
+ if (reg) {
+ if (tflite::BuiltinOperator_CUSTOM == reg->builtin_code) {
+ opName = std::string(reg->custom_name);
+ } else {
+ opName = std::string(EnumNameBuiltinOperator(
+ tflite::BuiltinOperator(reg->builtin_code)));
+ }
+ }
+ info("\tOperator %u: %s\n", i, opName.c_str());
+ }
+}
+
+bool arm::app::Model::IsInited() const
+{
+ return this->_m_inited;
+}
+
+bool arm::app::Model::IsDataSigned() const
+{
+ return this->GetType() == kTfLiteInt8;
+}
+
+bool arm::app::Model::RunInference()
+{
+ bool inference_state = false;
+ if (this->_m_pModel && this->_m_pInterpreter) {
+ if (kTfLiteOk != this->_m_pInterpreter->Invoke()) {
+ printf_err("Invoke failed.\n");
+ } else {
+ inference_state = true;
+ }
+ } else {
+ printf_err("Error: No interpreter!\n");
+ }
+ return inference_state;
+}
+
+TfLiteTensor* arm::app::Model::GetInputTensor(size_t index) const
+{
+ if (index < this->GetNumInputs()) {
+ return this->_m_input.at(index);
+ }
+ return nullptr;
+}
+
+TfLiteTensor* arm::app::Model::GetOutputTensor(size_t index) const
+{
+ if (index < this->GetNumOutputs()) {
+ return this->_m_output.at(index);
+ }
+ return nullptr;
+}
+
+size_t arm::app::Model::GetNumInputs() const
+{
+ if (this->_m_pModel && this->_m_pInterpreter) {
+ return this->_m_pInterpreter->inputs_size();
+ }
+ return 0;
+}
+
+size_t arm::app::Model::GetNumOutputs() const
+{
+ if (this->_m_pModel && this->_m_pInterpreter) {
+ return this->_m_pInterpreter->outputs_size();
+ }
+ return 0;
+}
+
+
+TfLiteType arm::app::Model::GetType() const
+{
+ return this->_m_type;
+}
+
+TfLiteIntArray* arm::app::Model::GetInputShape(size_t index) const
+{
+ if (index < this->GetNumInputs()) {
+ return this->_m_input.at(index)->dims;
+ }
+ return nullptr;
+}
+
+TfLiteIntArray* arm::app::Model::GetOutputShape(size_t index) const
+{
+ if (index < this->GetNumOutputs()) {
+ return this->_m_output.at(index)->dims;
+ }
+ return nullptr;
+}
+
+bool arm::app::Model::ShowModelInfoHandler()
+{
+ if (!this->IsInited()) {
+ printf_err("Model is not initialised! Terminating processing.\n");
+ return false;
+ }
+
+ PrintTensorFlowVersion();
+ info("Model info:\n");
+ this->LogInterpreterInfo();
+
+#if defined(ARM_NPU)
+ info("Use of Arm uNPU is enabled\n");
+#else /* ARM_NPU */
+ info("Use of Arm uNPU is disabled\n");
+#endif /* ARM_NPU */
+
+ return true;
+}
+namespace arm {
+namespace app {
+ static uint8_t _tensor_arena[ACTIVATION_BUF_SZ] ACTIVATION_BUF_ATTRIBUTE;
+} /* namespace app */
+} /* namespace arm */
+
+size_t arm::app::Model::GetActivationBufferSize()
+{
+ return ACTIVATION_BUF_SZ;
+}
+
+uint8_t *arm::app::Model::GetTensorArena()
+{
+ return _tensor_arena;
+}
\ No newline at end of file
diff --git a/source/application/tensorflow-lite-micro/TensorFlowLiteMicro.cc b/source/application/tensorflow-lite-micro/TensorFlowLiteMicro.cc
new file mode 100644
index 0000000..ce36a8f
--- /dev/null
+++ b/source/application/tensorflow-lite-micro/TensorFlowLiteMicro.cc
@@ -0,0 +1,47 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#include "TensorFlowLiteMicro.hpp"
+
+#include "hal.h"
+
+void PrintTensorFlowVersion()
+{
+ info("uTFL version: %u.%u.%u\n", TF_MAJOR_VERSION, TF_MINOR_VERSION,
+ TF_PATCH_VERSION);
+}
+
+arm::app::QuantParams arm::app::GetTensorQuantParams(TfLiteTensor* tensor)
+{
+ arm::app::QuantParams params;
+ if (kTfLiteAffineQuantization == tensor->quantization.type) {
+ auto* quantParams = (TfLiteAffineQuantization*) (tensor->quantization.params);
+ if (quantParams && 0 == quantParams->quantized_dimension) {
+ if (quantParams->scale->size) {
+ params.scale = quantParams->scale->data[0];
+ }
+ if (quantParams->zero_point->size) {
+ params.offset = quantParams->zero_point->data[0];
+ }
+ } else if (tensor->params.scale != 0.0) {
+ /* Legacy tensorflow quantisation parameters */
+ params.scale = tensor->params.scale;
+ params.offset = tensor->params.zero_point;
+ }
+ }
+ return params;
+}
+
diff --git a/source/application/tensorflow-lite-micro/include/BufAttributes.hpp b/source/application/tensorflow-lite-micro/include/BufAttributes.hpp
new file mode 100644
index 0000000..126172b
--- /dev/null
+++ b/source/application/tensorflow-lite-micro/include/BufAttributes.hpp
@@ -0,0 +1,85 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef BUF_ATTRIBUTES_HPP
+#define BUF_ATTRIBUTES_HPP
+
+#ifdef __has_attribute
+#define HAVE_ATTRIBUTE(x) __has_attribute(x)
+#else /* __has_attribute */
+#define HAVE_ATTRIBUTE(x) 0
+#endif /* __has_attribute */
+
+#if HAVE_ATTRIBUTE(aligned) || (defined(__GNUC__) && !defined(__clang__))
+
+/* We want all buffers/sections to be aligned to 16 byte. */
+#define ALIGNMENT_REQ aligned(16)
+
+/* Model data section name. */
+#define MODEL_SECTION section("nn_model")
+
+/* Label section name */
+#define LABEL_SECTION section("labels")
+
+#ifndef ACTIVATION_BUF_SZ
+ #warning "ACTIVATION_BUF_SZ needs to be defined. Using default value"
+ #define ACTIVATION_BUF_SZ 0x00200000
+#endif /* ACTIVATION_BUF_SZ */
+
+#ifndef ACTIVATION_BUF_SRAM_SZ
+ #warning "ACTIVATION_BUF_SRAM_SZ needs to be defined. Using default value = 0"
+ #define ACTIVATION_BUF_SRAM_SZ 0x00000000
+#endif /* ACTIVATION_BUF_SRAM_SZ */
+
+/**
+ * Activation buffer aka tensor arena section name
+ * We have to place the tensor arena in different region based on its size.
+ * If it fits in SRAM, we place it there, and also mark it by giving it a
+ * different section name. The scatter file places the ZI data in DDR and
+ * the uninitialised region in the SRAM.
+ **/
+#define ACTIVATION_BUF_SECTION_SRAM section(".bss.NoInit.activation_buf")
+#define ACTIVATION_BUF_SECTION_DRAM section("activation_buf")
+
+#if ACTIVATION_BUF_SZ > ACTIVATION_BUF_SRAM_SZ /* Will buffer not fit in SRAM? */
+ #define ACTIVATION_BUF_SECTION ACTIVATION_BUF_SECTION_DRAM
+ #define ACTIVATION_BUF_SECTION_NAME ("DDR")
+#else /* ACTIVATION_BUF_SZ > 0x00200000 */
+ #define ACTIVATION_BUF_SECTION ACTIVATION_BUF_SECTION_SRAM
+ #define ACTIVATION_BUF_SECTION_NAME ("SRAM")
+#endif /* ACTIVATION_BUF_SZ > 0x00200000 */
+
+/* IFM section name. */
+#define IFM_BUF_SECTION section("ifm")
+
+/* Form the attributes, alignment is mandatory. */
+#define MAKE_ATTRIBUTE(x) __attribute__((ALIGNMENT_REQ, x))
+#define MODEL_TFLITE_ATTRIBUTE MAKE_ATTRIBUTE(MODEL_SECTION)
+#define ACTIVATION_BUF_ATTRIBUTE MAKE_ATTRIBUTE(ACTIVATION_BUF_SECTION)
+#define IFM_BUF_ATTRIBUTE MAKE_ATTRIBUTE(IFM_BUF_SECTION)
+#define LABELS_ATTRIBUTE MAKE_ATTRIBUTE(LABEL_SECTION)
+
+#else /* HAVE_ATTRIBUTE(aligned) || (defined(__GNUC__) && !defined(__clang__)) */
+
+#define MODEL_TFLITE_ATTRIBUTE
+#define ACTIVATION_BUF_ATTRIBUTE
+#define IFM_BUF_ATTRIBUTE
+#define LABELS_ATTRIBUTE
+
+#endif /* HAVE_ATTRIBUTE(aligned) || (defined(__GNUC__) && !defined(__clang__)) */
+
+#endif /* BUF_ATTRIBUTES_HPP */
\ No newline at end of file
diff --git a/source/application/tensorflow-lite-micro/include/Model.hpp b/source/application/tensorflow-lite-micro/include/Model.hpp
new file mode 100644
index 0000000..70cf9ca
--- /dev/null
+++ b/source/application/tensorflow-lite-micro/include/Model.hpp
@@ -0,0 +1,142 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef MODEL_HPP
+#define MODEL_HPP
+
+#include "TensorFlowLiteMicro.hpp"
+#include "BufAttributes.hpp"
+
+#include <cstdint>
+
+namespace arm {
+namespace app {
+
+ /**
+ * @brief NN model class wrapping the underlying TensorFlow-Lite-Micro API.
+ */
+ class Model {
+ public:
+ /** @brief Constructor. */
+ Model();
+
+ /** @brief Destructor. */
+ ~Model();
+
+ /** @brief Gets the pointer to the model's input tensor at given input index. */
+ TfLiteTensor* GetInputTensor(size_t index) const;
+
+ /** @brief Gets the pointer to the model's output tensor at given output index. */
+ TfLiteTensor* GetOutputTensor(size_t index) const;
+
+ /** @brief Gets the model's data type. */
+ TfLiteType GetType() const;
+
+ /** @brief Gets the pointer to the model's input shape. */
+ TfLiteIntArray* GetInputShape(size_t index) const;
+
+ /** @brief Gets the pointer to the model's output shape at given output index. */
+ TfLiteIntArray* GetOutputShape(size_t index) const;
+
+ /** @brief Gets the number of input tensors the model has. */
+ size_t GetNumInputs() const;
+
+ /** @brief Gets the number of output tensors the model has. */
+ size_t GetNumOutputs() const;
+
+ /** @brief Logs the tensor information to stdout. */
+ void LogTensorInfo(TfLiteTensor* tensor);
+
+ /** @brief Logs the interpreter information to stdout. */
+ void LogInterpreterInfo();
+
+ /** @brief Initialise the model class object.
+ * @param[in] allocator Optional: a pre-initialised micro allocator pointer,
+ * if available. If supplied, this allocator will be used
+ * to create the interpreter instance.
+ * @return true if initialisation succeeds, false otherwise.
+ **/
+ bool Init(tflite::MicroAllocator* allocator = nullptr);
+
+ /**
+ * @brief Gets the allocator pointer for this instance.
+ * @return Pointer to a tflite::MicroAllocator object, if
+ * available; nullptr otherwise.
+ **/
+ tflite::MicroAllocator* GetAllocator();
+
+ /** @brief Checks if this object has been initialised. */
+ bool IsInited() const;
+
+ /** @brief Checks if the model uses signed data. */
+ bool IsDataSigned() const;
+
+ /** @brief Runs the inference (invokes the interpreter). */
+ bool RunInference();
+
+ /** @brief Model information handler common to all models.
+ * @return true or false based on execution success.
+ **/
+ bool ShowModelInfoHandler();
+
+ /** @brief Gets a pointer to the tensor arena. */
+ uint8_t* GetTensorArena();
+
+ protected:
+ /** @brief Gets the pointer to the NN model data array.
+ * @return Pointer of uint8_t type.
+ **/
+ virtual const uint8_t* ModelPointer() = 0;
+
+ /** @brief Gets the model size.
+ * @return size_t, size in bytes.
+ **/
+ virtual size_t ModelSize() = 0;
+
+ /**
+ * @brief Gets the op resolver for the model instance.
+ * @return const reference to a tflite::MicroOpResolver object.
+ **/
+ virtual const tflite::MicroOpResolver& GetOpResolver() = 0;
+
+ /**
+ * @brief Add all the operators required for the given model.
+ * Implementation of this should come from the use case.
+ * @return true is ops are successfully added, false otherwise.
+ **/
+ virtual bool EnlistOperations() = 0;
+
+ /** @brief Gets the total size of tensor arena available for use. */
+ size_t GetActivationBufferSize();
+
+ private:
+ tflite::MicroErrorReporter _m_uErrorReporter; /* Error reporter object. */
+ tflite::ErrorReporter* _m_pErrorReporter = nullptr; /* Pointer to the error reporter. */
+ const tflite::Model* _m_pModel = nullptr; /* Tflite model pointer. */
+ tflite::MicroInterpreter* _m_pInterpreter = nullptr; /* Tflite interpreter. */
+ tflite::MicroAllocator* _m_pAllocator = nullptr; /* Tflite micro allocator. */
+ bool _m_inited = false; /* Indicates whether this object has been initialised. */
+
+ std::vector<TfLiteTensor*> _m_input = {}; /* Model's input tensor pointers. */
+ std::vector<TfLiteTensor*> _m_output = {}; /* Model's output tensor pointers. */
+ TfLiteType _m_type = kTfLiteNoType;/* Model's data type. */
+
+ };
+
+} /* namespace app */
+} /* namespace arm */
+
+#endif /* MODEL_HPP */
diff --git a/source/application/tensorflow-lite-micro/include/TensorFlowLiteMicro.hpp b/source/application/tensorflow-lite-micro/include/TensorFlowLiteMicro.hpp
new file mode 100644
index 0000000..677b4ba
--- /dev/null
+++ b/source/application/tensorflow-lite-micro/include/TensorFlowLiteMicro.hpp
@@ -0,0 +1,78 @@
+/*
+ * Copyright (c) 2021 Arm Limited. All rights reserved.
+ * SPDX-License-Identifier: Apache-2.0
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+#ifndef TENSORFLOW_LITE_MICRO_LOCAL_HPP
+#define TENSORFLOW_LITE_MICRO_LOCAL_HPP
+
+/* We include all our TensorFlow Lite Micro headers here */
+
+/**
+ * TensorFlow Lite Micro sources can generate a lot of warnings from the usage
+ * of a single macro (TF_LITE_REMOVE_VIRTUAL_DELETE). Suppress the known ones
+ * here to prevent them from masking warnings that might be generated by our
+ * application sources.
+ */
+#if defined(__ARMCC_VERSION) && (__ARMCC_VERSION >= 6010050)
+ #pragma clang diagnostic push
+ #pragma clang diagnostic ignored "-Wunused-parameter"
+ #include "tensorflow/lite/micro/micro_mutable_op_resolver.h"
+ #include "tensorflow/lite/micro/micro_interpreter.h"
+ #include "tensorflow/lite/micro/micro_error_reporter.h"
+ #include "tensorflow/lite/micro/all_ops_resolver.h"
+ #pragma clang diagnostic pop
+#elif defined(__GNUC__)
+ #pragma GCC diagnostic push
+ #pragma GCC diagnostic ignored "-Wunused-parameter"
+ #include "tensorflow/lite/micro/micro_mutable_op_resolver.h"
+ #include "tensorflow/lite/micro/micro_interpreter.h"
+ #include "tensorflow/lite/micro/micro_error_reporter.h"
+ #include "tensorflow/lite/micro/all_ops_resolver.h"
+ #pragma GCC diagnostic pop
+#else
+ #include "tensorflow/lite/micro/micro_mutable_op_resolver.h"
+ #include "tensorflow/lite/micro/micro_interpreter.h"
+ #include "tensorflow/lite/micro/micro_error_reporter.h"
+ #include "tensorflow/lite/micro/all_ops_resolver.h"
+#endif
+
+#include "tensorflow/lite/c/common.h"
+#include "tensorflow/lite/micro/kernels/micro_ops.h"
+#include "tensorflow/lite/schema/schema_generated.h"
+#include "tensorflow/lite/version.h"
+
+#if defined (TESTS)
+ #include "tensorflow/lite/micro/test_helpers.h"
+#endif /* defined (TESTS) */
+
+namespace arm {
+namespace app {
+
+ struct QuantParams {
+ float scale = 1.0;
+ int offset = 0;
+ };
+
+ QuantParams GetTensorQuantParams(TfLiteTensor* tensor);
+
+} /* namespace app */
+} /* namespace arm */
+
+/**
+ * @brief Prints the tensor flow version in use to stdout.
+ */
+void PrintTensorFlowVersion();
+
+#endif /* TENSORFLOW_LITE_MICRO_LOCAL_HPP */